Name | Data | CAS No | EC No | DNEL Inhalation [mg/m³] | Limit values | Remarks | ZVG | |||
---|---|---|---|---|---|---|---|---|---|---|
Set | local | systemic | TRGS 900 | MAK | EU |
Name | Data | CAS No | EG No | DNEL Inhalation [mg/m³] | Limit values | Remarks | ZVG | |||
---|---|---|---|---|---|---|---|---|---|---|
set | local | systematic | TRGS900 | MAK | EU | |||||
AAA reaction product | 1 | - | 452-110-7 | 1,2 | ||||||
Acetaldoxime | 1 | 107-29-9 | 203-479-6 | 0,49 | 32430 | |||||
Acetalization product between glucose and C14 alcohol | 1 | - | 923-418-3 | 7,84 | ||||||
Acetalization product between Glucose and C16-18(even numbered)-alcohol | 1 | - | 927-870-2 | 33,6 | ||||||
Acetalization product between glucose and C20-22(even numbered)-alcohol | 1 | - | 923-835-0 | 33,6 | ||||||
Acetalization product beween glucose and 12-hydroxystearyl alcohol | 1 | - | 700-891-2 | 7,84 | ||||||
Acetalization products between glucose and C12/18(even numbered)alcohol | 1 | - | 923-908-7 | 33,6 | ||||||
3-Acetamido-5-amino-4-hydroxybenzenesufonic acid | 1 | 40306-75-0 | 254-879-2 | 13,157 | 141921 | |||||
4-Acetamidobenzenesulfonyl chloride | 1 | 121-60-8 | 204-485-1 | 16,4 | 17790 | |||||
4-Acetamidophenol | 1 | 103-90-2 | 203-157-5 | 12,006 | 24840 | |||||
Acetic acid | 1 | 64-19-7 | 200-580-7 | 25 | TRGS900 | MAK | EU | 11400 | ||
Acetic acid, chloro-, sodium salt, reaction products with 4,5-dihydro-2-undecyl-1H-imidazole-1-ethanol and sodium hydroxide | 1 | 68608-66-2 | 271-794-6 | 5,88 | ||||||
Acetic acid, oxo-, potassium salt, reaction products with ethylenediamine and para-hydroxybenzenesulfonic acid potassium salt, iron potassium salts | 1 | - | 462-490-6 | 11,8 | ||||||
Acetic acid, oxo-, sodium salt, reaction products with Ethylenediamine and Phenol, Iron sodium salts | 1 | 84539-55-9 | 283-044-5 | 1,8 | ||||||
Acetic acid, oxo-, sodium salt, reaction products with cresol and ethylenediamine, iron sodium salts | 1 | 84539-53-7 | 283-041-9 | 8,8 | ||||||
Acetic acid, oxo-, sodium salt, reaction products with ethylenediamine and hydroxybenzenesulfonic acid monosodium salt, iron sodium salts | 1 | 84539-54-8 | 283-042-4 | 23,5 | ||||||
Acetic acid, 2-sulfo-, mono-C12-14(even numbered)-alkyl esters, sodium salt | 1 | - | 939-512-2 | 26,45 | ||||||
Acetic acid, 2,2',2''-(octylstannylidyne)tris(thio) tris-, triisooctyl ester | 1 | 27107-89-7 | 248-227-6 | 5,78 | TRGS900 | MAK | 490672 | |||
Acetic anhydride | 1 | 108-24-7 | 203-564-8 | 4,2 | 4,2 | TRGS900 | MAK | 12580 | ||
Acetoacetamide | 1 | 5977-14-0 | 227-774-4 | 0,292 | 18460 | |||||
2-Acetoacetoxyethyl methacrylate | 1 | 21282-97-3 | 244-311-1 | 35 | 35 | 132928 | ||||
2'-Acetonaphthone | 1 | 93-08-3 | 202-216-2 | 1,63 | 492531 | |||||
1'-Acetonaphthone | 1 | 941-98-0 | 213-384-1 | 0,822 | 493827 | |||||
Acetone | 1 | 67-64-1 | 200-662-2 | 1210 | TRGS900 | MAK | EU | 11230 | ||
2-Acetone, condensation product with Phenol | 1 | - | 931-252-8 | 2 | 2 | |||||
2-Acetone reaction product with Phenol | 1 | 35238-34-7 | 500-086-4 | 3,7 | ||||||
Acetone oxime | 1 | 127-06-0 | 204-820-1 | 0,35 | 32420 | |||||
Acetone oxime | 2 | 127-06-0 | 204-820-1 | 0,336 | 32420 | |||||
Acetonitrile | 1 | 75-05-8 | 200-835-2 | 68 | 68 | TRGS900 | MAK | EU | 13660 | |
Acetonitrile; Trifluoroborane | 1 | 420-16-6 | 690-796-1 | 0,74 | 0,74 | |||||
Acetophenone | 1 | 98-86-2 | 202-708-7 | 22 | 22380 | |||||
2-(Acetylamino)-N-benzyl-3-methoxypropanamide | 1 | 175481-26-2 | 700-539-8 | 8,88 | ||||||
N2-Acetyl-N-benzyl-O-methyl-L-serinamide | 1 | 175481-37-5 | 806-591-9 | 8,88 | ||||||
1-Acetyl-4-(3-dodecyl-2,5-dioxo-1-pyrrolidinyl)-2,2,6,6-tetramethylpiperidine | 1 | 106917-31-1 | 411-930-5 | 29,4 | 530722 | |||||
N-Acetylhexanelactam | 1 | 1888-91-1 | 217-565-6 | 1,47 | ||||||
1-Acetyl-4-(4-hydroxyphenyl)piperazine | 1 | 67914-60-7 | 267-744-8 | 7,053 | ||||||
4-Acetylmorpholine | 1 | 1696-20-4 | 216-913-4 | 24,5 | 110673 | |||||
1-(4-(Acetyloxy)-3-((acetyloxy)methyl)phenyl)ethanone | 1 | - | 921-042-4 | 4,9 | ||||||
2-((2-(Acetyloxy)-3-(1,1-dimethylethyl)-5-methylphenyl)methyl)-6-(1,1-dimethylethyl)-4-methylphenol | 1 | 41620-33-1 | 412-210-3 | 15 | 901267 | |||||
(3-Acetyloxy-2,2-dimethylpropyl) acetate | 1 | 13431-57-7 | 826-122-1 | 8,2 | ||||||
Acetylsalicylic acid | 1 | 50-78-2 | 200-064-1 | 19,5 | 491133 | |||||
Nα-Acetyl-DL-tryptophan | 1 | 87-32-1 | 201-739-3 | 411,4 | ||||||
Acid catalysed reaction products of 3,7-Dimethyl-2,6-octadienal in the presence of ethanol | 1 | - | 947-660-4 | 44,08 | 17,63 | |||||
Acrolein | 1 | 107-02-8 | 203-453-4 | 0,2 | 0,2 | TRGS900 | EU | 13480 | ||
2-Acrylamido-2-methylpropanesulfonic acid | 1 | 15214-89-8 | 239-268-0 | 1 | 495097 | |||||
Acrylic acid | 1 | 79-10-7 | 201-177-9 | 30 | 30 | TRGS900 | MAK | EU | 14360 | |
Acrylonitrile | 1 | 107-13-1 | 203-466-5 | 1,8 | Carcinogenic | 11410 | ||||
cis-2-(Acryloyloxy)ethyl hydrogen cyhexane-1,2-dicarboxylate | 1 | - | 478-080-5 | 0,32 | ||||||
Activated Carbon - High Density Skeleton | 1 | - | 931-328-0 | 1,84 | ||||||
Activated Carbon - Low Density Skeleton | 1 | - | 931-334-3 | 1,84 | ||||||
Addition product of Maleic anhydride, tall oil fatty acids, linseed oil and methanol | 1 | - | 926-195-0 | 164,5 | ||||||
Adipic acid | 1 | 124-04-9 | 204-673-3 | 5 | 264 | TRGS900 | MAK | 12050 | ||
Adipic acid, compd. with 1,6-hexanediamine (1:1) | 1 | 3323-53-3 | 222-037-3 | 10 | 28240 | |||||
Adipohydrazide | 1 | 1071-93-8 | 213-999-5 | 17,5 | 108476 | |||||
AERO 5100 PROMOTER | 1 | - | 434-440-3 | 0,494 | ||||||
Alanine | 1 | 56-41-7 | 200-273-8 | 226,2 | 12950 | |||||
β-Alanine | 1 | 107-95-9 | 203-536-5 | 23,509 | 531070 | |||||
beta-Alanine, N-C8-18-alkyl derivs., monopotassium salts | 1 | 90170-42-6 | 290-475-2 | 97,8 | ||||||
beta-Alanine, N-(2-carboxyethyl)-, N-coco alkyl derivs., disodium salts | 1 | 90170-43-7 | 290-476-8 | 980 | ||||||
L-Alanine, N-coco acyl derivs., sodium salts | 1 | 90170-45-9 | 290-478-9 | 12,3 | ||||||
β-Alanine, N-Coco alkyl derivates | 1 | 84812-94-2 | 284-219-9 | 9,9 | ||||||
Alcohols, C9-11, branched and linear, ethoxylated, sulfates, sodium salts | 1 | 160901-28-0 | 500-465-4 | 175 | ||||||
Alcohols, C10-16, ethoxylated, sulfates, mono(hydroxyethyl)ammonium salts | 1 | 157627-92-4 | 500-343-0 | 175 | ||||||
Alcohols, C10-16, ethoxylated, sulfates, triethanolammonium salts | 1 | 157627-94-6 | 500-344-6 | 175 | ||||||
Alcohols, C16-18 and ethoxylated C16-18 , phosphates (10 moles ethoxylation) | 1 | - | 947-820-3 | 24,68 | ||||||
Alcohols, C9-11, branched and linear, ethoxylated (1-2.5 EO) | 1 | 160901-09-7 | 500-446-0 | 294 | ||||||
Alcohols, C12-13, branched and linear, ethoxylated | 1 | 160901-19-9 | 500-457-0 | 294 | ||||||
Alcohols, C12-13, branched and linear, ethoxylated, sulphates, sodium salts (1<EO<2.5) | 1 | 161074-79-9 | 500-513-4 | 175 | ||||||
Alcohols, C12-13, ethoxylates, 1-2.5 EO | 1 | 66455-14-9 | 500-165-3 | 294 | ||||||
Alcohols, C12-14 | 1 | 80206-82-2 | 279-420-3 | 6,52 | 196,12 | |||||
Alcohols, C12-15, ethoxylated | 1 | 68131-39-5 | 500-195-7 | 294 | ||||||
Alcohols, C13-15-branched and linear | 1 | 85566-16-1 | 287-625-4 | 26,5 | ||||||
Alcohols, C16-18 | 1 | 67762-27-0 | 267-008-6 | 6,52 | 237,76 | |||||
Alcohols, C6-24, distn. residues | 1 | 102242-49-9 | 310-080-1 | 73,47 | ||||||
Alcohols, C12-18(even numbered), ethoxylated | 1 | 68213-23-0 | 500-201-8 | 294 | ||||||
Alcohols, C12-14(even numbered), ethoxylated | 1 | 68439-50-9 | 500-213-3 | 294 | ||||||
Alcohols, C9-11 ethoxylated, < 2.5 EO | 1 | 68439-46-3 | 614-482-0 | 294 | ||||||
Alcohols, C16-18 (even numbered), ethoxylated, < 2.5 EO | 1 | - | 939-518-5 | 294 | ||||||
Alcohols, C6-C8-(even numbered, linear)-ethoxylated (< 2,5 EO) | 1 | 1426148-68-6 | 800-182-9 | 4,4 | ||||||
Alcohols, C10-12 (even numbered), ethoxylated (1-2.5 EO) | 1 | - | 939-592-9 | 294 | ||||||
Alcohols, C16-18 (even numbered, C18-unsatd.), ethoxylated, and alcohols C20-22 (even numbered), sulfates, ammonium salts | 1 | - | 938-445-6 | 8,8 | ||||||
Alcohols, C12-14 (even-numbered), ethoxylated, magnesium salts, < 2.5 mol EO | 1 | - | 939-578-2 | 175 | ||||||
Alcohols, C18-unsatd and ethoxylated C18-unsatd., phosphates (5 moles ethoxylation) | 1 | - | 947-833-4 | 13,16 | ||||||
Alcohols, C12-14 (even numbered), ethoxylated (<=2.5 moles EO), sulfated, monoisopropanolamine salt | 1 | 1187742-72-8 | 932-185-7 | 175 | ||||||
Alcohols, C10-12 (even numbered), ethoxylated (1-2.5 EO), sulfated, sodium salts | 1 | - | 939-597-6 | 175 | ||||||
Alcohols, C12-14 (linear, even-numbered), ethoxylated, sulfates, ammonium salts, < 2.5 mol EO | 1 | - | 939-575-6 | 175 | ||||||
Alcohols, C12-18(even numbered), ethoxylated < 2.5 EO, sulfates, sodium salt | 1 | 68081-91-4 | 500-189-4 | 175 | ||||||
Alcohols, C12-14(even numbered), ethoxylated < 2.5 EO, sulfates, sodium salts | 1 | 68891-38-3 | 500-234-8 | 175 | ||||||
Alcohols, C8-10, ethoxylated, sulfates, sodium salts | 1 | - | 939-523-2 | 175 | ||||||
Alcohols, C16-18 and C18-unsatd., ethoxylated, sulfates, sodium salts | 1 | 157627-95-7 | 500-345-1 | 175 | ||||||
Alcohols C9-11, ethoxylated (1-2,5 EO) sulphated, ammonium salts | 1 | 160901-27-9 | 500-464-9 | 175 | ||||||
Alcohols, C16-18 (even numbered) and C18 unsaturated, propoxylated, < 2.5 PO | 1 | - | 939-600-0 | 196 | ||||||
C18-C22 Alcohols (even numbered), reaction products with Maleic anhydride and Sodium bisulfite | 1 | - | 939-404-5 | 77,2 | ||||||
Alcohols, secondary C11-15, ethoxylated | 1 | 68131-40-8 | 614-295-4 | 42,32 | ||||||
Alcohols, C16-18(even numbered) and C18 unsaturated, ethoxylated < 2.5 EO | 1 | 68920-66-1 | 500-236-9 | 294 | ||||||
Alcohols, C12-15-branched and linear | 1 | 90604-40-3 | 292-334-0 | 155 | 313 | |||||
Alkali salt of substituted alkyl amino sulfonyl triazinyl amino arylamido diazo aryl sulfonyl sulfonate | 1 | - | 58,3 | |||||||
Alkali salt of substituted aryl sulfonyl triazinyl amino hydroxy sulfonyl aryl diazo naphthalene sulfonate | 1 | - | 3,65 | |||||||
Alkaline distillation residues from epsilon-caprolactam | 1 | - | 938-820-4 | 1 | ||||||
Alkali salt of substituted amino alkyl sulfonyl aryl diazo naphthalene sulfonate | 1 | - | 432-080-1 | 58,8 | ||||||
Alkane C6-C8 (even numbered) 1-sulphonic acid, sodium salt | 1 | - | 939-625-7 | 30,32 | ||||||
C16-(branched), C20-(branched) and C24-(branched)-Alkanes | 1 | - | 700-992-1 | 29,4 | ||||||
C14-17 Alkanes, sec-mono- and disulfonic acids, phenyl esters | 1 | - | 701-257-8 | 6,5 | ||||||
Alkanoic acid and polyoxomolybdate borate alkanoate clusters | 1 | - | 26,447 | |||||||
Alkanol reaction products with bis(aminoalkyl(C=1~6))carbomonocycle, alkoxy(C=3~8)alkanol(C=2~7) and 2,4-TDI | 1 | - | 939-039-1 | 3,15 | ||||||
Alkenes, C6-10, hydroformylation products, high-boiling | 1 | 68526-82-9 | 271-230-9 | 16,75 | ||||||
Alkenes, C13-14, hydroformylation products, low boiling | 1 | - | 932-284-5 | 220 | ||||||
Alkenes, C9-11, C10-rich | 1 | 68526-56-7 | 271-213-6 | 2,31 | 2,31 | |||||
Alkenes, C11-14, hydroformylation products, distn. residues, reaction products with maleic anhydride and sodium bisulfite, sodium salts | 1 | - | 938-654-2 | 0,26 | ||||||
Alkenes, C11-12, hydroformylation products, low boiling | 1 | - | 932-235-8 | 220 | ||||||
Alkenes, C15-18 alpha-, sulfurized | 1 | 67762-55-4 | 267-023-8 | 12 | ||||||
Alkenes, C6-11 (branched), hydroformylation products, distn. residues, heavy cracked fraction | 1 | - | 701-314-7 | 16,75 | ||||||
6-(C10-13-Alkenyl-(even and odd, branched, unsaturated)-2,5-dioxopyrrolidin-1-yl)hexanoic acid | 1 | 2156592-54-8 | 701-118-1 | 0,3 | ||||||
6-[3-(C12-C18)-Alkenyl(branched, unsaturated)-2,5-dioxopyrrolidin-1-yl]hexanoic acid | 1 | - | 701-162-1 | 0,3 | ||||||
3-sec-[C15-18-(branched and linear)-Alk-2-enyl]pyrrolidine-2,5-dione | 1 | - | 701-350-3 | 8,82 | ||||||
N-(C16-C18)Alkyl(C16-C18)alkane-1-amine | 1 | 308062-60-4 | 629-721-4 | 0,88 | ||||||
N-C16-18-Alkyl-(evennumbered) C18 unsaturated) propane-1,3-diamine | 1 | 1219010-04-4 | 629-719-3 | 0,0395 | ||||||
3-C12-14-(even numbered)-Alkylamido-N,N-dimethylpropan-1-amino oxide | 1 | - | 931-324-9 | 3,53 | ||||||
3-C12-18-(even numbered)-Alkylamido-N,N-dimethylpropan-1-amino oxide | 1 | - | 939-581-9 | 3,52 | ||||||
C16-18 (evennumbered), C18 unsaturated Alkylamine ethoxylated | 1 | - | 947-515-5 | 2,11 | ||||||
C16-18-(even numbered)-Alkylamine acetate | 1 | 1273322-45-4 | 800-526-8 | 0,38 | ||||||
C16-18-(even numbered, saturated and unsaturated)-Alkylamines | 1 | 1213789-63-9 | 627-034-4 | 1 | 0,38 | |||||
C16-18-(even numbered, C18-unsaturated)-Alkylamines acetates | 1 | 1273322-47-6 | 817-198-7 | 0,38 | ||||||
(Z)-4-[C11-13 (branched) Alkylamino]-4-oxo-2-butenoic acid | 1 | - | 701-116-0 | 13,16 | ||||||
C8-18 Alkylampho(di)propionates | 1 | - | 30,6 | |||||||
Alkylated Naphthalene | 1 | - | 23,5 | |||||||
C16-18 (evennumbered, C18 unsaturated) Alkyl bis(2-hydroxyethyl) amine oxide | 1 | 2097729-23-0 | 825-356-1 | 1,48 | ||||||
C13-(branched)-Alkyl 3-(3,5-di-tert-butyl-4-hydroxyphenyl)propanoate | 1 | 847488-62-4 | 700-397-7 | 7,05 | ||||||
C7-9-Alkyl 3-(3,5-di-trans-butyl-4-hydroxyphenyl)propionate, mixture of isomers | 1 | 125643-61-0 | 406-040-9 | 6,6 | 530836 | |||||
C7-9-Alkyl 3-(3,5-di-trans-butyl-4-hydroxyphenyl)propionate, mixture of isomers | 2 | 125643-61-0 | 406-040-9 | 3 | 530836 | |||||
C7-9-Alkyl 3-(3,5-di-trans-butyl-4-hydroxyphenyl)propionate, mixture of isomers | 3 | 125643-61-0 | 406-040-9 | 2,33 | 530836 | |||||
N-C16-C18(even numbered, C18 unsaturated)-Alkyl-N,N-dimethyl-C16-C18(even numbered, C18 unsaturated)-alkyl-1-aminium chloride | 1 | 1228186-17-1 | 638-747-5 | 13,5 | ||||||
C12-16-(even numbered)-Alkyl-dimethylammonium lactate | 1 | - | 700-421-6 | 1 | ||||||
N-Alkylester N-substituted heterocyclic diazo aryl amine | 1 | - | 15 | |||||||
C12-14 Alkyl ethoxylate methyloxirane | 1 | - | 948-091-4 | 12,3 | ||||||
5-(C11-C12 Alkyl, branched)-2-hydroxy-benzaldehyde oxime | 1 | - | 944-572-8 | 0,235 | ||||||
(4E)-4-(C13-C17)Alkylidene-3-(C12-C16)alkyloxetan-2-one | 1 | - | 939-401-9 | 1,2 | ||||||
2,2'-(C16-18 (evennumbered) Alkyl imino) diethanol | 1 | 1218787-30-4 | 620-539-0 | 2,11 | ||||||
Alkylnaphthalene | 1 | - | 23,5 | |||||||
3-((C9-11-iso,C10-rich) Alkyloxy)propan-1-amine | 1 | - | 939-485-7 | 4,9 | ||||||
3-((C9-11-iso,C10-rich) Alkyloxy)propan-1-amine acetate (1:1) | 1 | - | 939-448-5 | 4,9 | ||||||
C14-16-18 Alkyl phenol | 1 | - | 931-468-2 | 1,17 | ||||||
Alkyl phosphites | 1 | - | 424-820-7 | 1,76 | ||||||
Allyl phenoxyacetate | 1 | 7493-74-5 | 231-335-2 | 2,47 | ||||||
Allyl acetoacetate | 1 | 1118-84-9 | 214-269-9 | 9,521 | 493897 | |||||
Allylamine | 1 | 107-11-9 | 203-463-9 | 0,23 | 510030 | |||||
Allyl chloride | 1 | 107-05-1 | 203-457-6 | 1,1 | 24580 | |||||
Allyl (cyclohexyloxy)acetate | 1 | 68901-15-5 | 272-657-3 | 3,16 | ||||||
Allyl 3-cyclohexylpropionate | 1 | 2705-87-5 | 220-292-5 | 15 | 113282 | |||||
Allyl glycidyl ether | 1 | 106-92-3 | 203-442-4 | 0,954 | Carcinogenic | 18420 | ||||
Allyl heptanoate | 1 | 142-19-8 | 205-527-1 | 2,97 | 102642 | |||||
Allyl hexanoate | 1 | 123-68-2 | 204-642-4 | 15 | 102109 | |||||
Allyl isothiocyanate | 1 | 57-06-7 | 200-309-2 | 0,335 | 510357 | |||||
Allyl methacrylate | 1 | 96-05-9 | 202-473-0 | 1,47 | 39590 | |||||
Allyl (3-methylbutoxy)acetate | 1 | 67634-00-8 | 266-803-5 | 4,93 | ||||||
4-(4-Allyloxy-benzenesulfonyl)-phenol | 1 | 97042-18-7 | 479-880-7 | 23,3 | 23,3 | |||||
(2-Allyloxy-1,1-dimethyl-2-oxo-ethyl) 2-chloro-5-[3,6-dihydro-3-methyl-2,6-dioxo-4-(trifluoromethyl)-1(2H)-pyrimidin-1-yl]benzoate | 1 | 134605-64-4 | 603-837-5 | 0,13 | ||||||
1-[2-(Allyloxy)ethyl-2-(2,4-dichlorophenyl)]-1H-imidazolium hydrogen sulfate | 1 | 58594-72-2 | 261-351-5 | 0,35 | 496440 | |||||
2-Allyloxymethyl-2-ethylpropanediol | 1 | 682-11-1 | 211-662-7 | 7 | 106783 | |||||
S-Allyl O-pentyl dithiocarbonate | 1 | 2956-12-9 | 220-977-9 | 0,92 | 0,92 | |||||
4-Allylveratrole | 1 | 93-15-2 | 202-223-0 | 9,87 | 101158 | |||||
Aluminium | 1 | 7429-90-5 | 231-072-3 | 3,72 | 3,72 | MAK | 7130 | |||
Aluminium | 2 | 7429-90-5 | 231-072-3 | 3,72 | MAK | 7130 | ||||
Aluminium, 4,5-dihydro-5-oxo-1-(4-sulfophenyl)-4-[(4-sulfophenyl)azo]-1H-pyrazole-3-carboxylic acid complex | 1 | 12225-21-7 | 235-428-9 | 1469,298 | 125490 | |||||
Aluminium, 6-hydroxy-5-[(2-methoxy-5-methyl-4-sulfophenyl)azo]-2-naphthalenesulfonic acid complex | 1 | 68583-95-9 | 271-524-7 | 16,4 | ||||||
Aluminium, 6-hydroxy-5-[(4-sulfophenyl)azo]-2-naphthalenesulfonic acid complex | 1 | 15790-07-5 | 239-888-1 | 1,469 | 129194 | |||||
Aluminium magnesium sodium silicate | 1 | 12040-43-6 | 234-919-5 | 3 | 125056 | |||||
Aluminium magnesium vanadium oxide | 1 | 170621-28-0 | 692-448-4 | 98,74 | ||||||
Aluminium silicate | 1 | 1335-30-4 | 215-628-2 | 3 | 109684 | |||||
Aluminium silicate | 1 | 1327-36-2 | 215-475-1 | 3 | 3 | 80380 | ||||
Aluminium ammonium sulfate | 1 | 7784-25-0 | 232-055-3 | 71,1 | 4020 | |||||
Aluminium dihydrogen phosphate | 1 | 13530-50-2 | 236-875-2 | 12,99 | 126688 | |||||
Aluminium dihydrogen triphosphate | 1 | 13939-25-8 | 237-714-9 | 11,52 | ||||||
Aluminium fluoride | 1 | 7784-18-1 | 232-051-1 | 0,047 | TRGS900 | MAK | EU | 3810 | ||
Aluminium hydroxide | 1 | 21645-51-2 | 244-492-7 | 10,76 | 10,76 | TRGS900 | MAK | 3800 | ||
Aluminium hydroxide chloride | 1 | 1327-41-9 | 215-477-2 | 16,4 | 491091 | |||||
Aluminium hypophosphite | 1 | 7784-22-7 | 479-150-8 | 0,821 | ||||||
Aluminium magnesium carbonate hydroxide | 1 | - | 943-434-4 | 490 | ||||||
Aluminium-magnesium-carbonate-hydroxide-perchlorate-hydrate | 1 | - | 422-150-1 | 0,65 | 535974 | |||||
Aluminium-magnesium-zinc-carbonate-hydroxide | 1 | 169314-88-9 | 423-570-6 | 245 | 536008 | |||||
Aluminium metaphosphate | 1 | 13776-88-0 | 237-415-3 | 3,59 | 4780 | |||||
Aluminium nitrate | 1 | 13473-90-0 | 236-751-8 | 0,5 | 491034 | |||||
Aluminium nitride | 1 | 24304-00-5 | 246-140-8 | 0,034 | 0,47 | 4980 | ||||
Aluminium oxide | 1 | 1344-28-1 | 215-691-6 | 3 | 3 | TRGS900 | MAK | 1280 | ||
Aluminium oxide | 2 | 1344-28-1 | 215-691-6 | 15,63 | 15,63 | TRGS900 | MAK | 1280 | ||
Aluminium oxide | 3 | 1344-28-1 | 215-691-6 | 15,63 | TRGS900 | MAK | 1280 | |||
Aluminium phosphate | 1 | 7784-30-7 | 232-056-9 | 4,98 | 4770 | |||||
Aluminium potassium sulfate | 1 | 10043-67-1 | 233-141-3 | 13,05 | 5000 | |||||
Aluminium silicate and Titanium oxide matrix doted with Vanadium, Nickel and Antimony | 1 | - | 931-210-9 | 10 | 10 | |||||
Aluminium sodium silicate | 1 | 1344-00-9 | 215-684-8 | 4 | 3570 | |||||
Aluminium sulfate | 1 | 10043-01-3 | 233-135-0 | 13,4 | 2320 | |||||
Aluminium sulfate | 2 | 10043-01-3 | 233-135-0 | 3 | 3 | 2320 | ||||
Aluminium tribenzoate | 1 | 555-32-8 | 209-091-3 | 63 | ||||||
Aluminium tri-sec-butanolate | 1 | 2269-22-9 | 218-871-2 | 161 | 494196 | |||||
Aluminium tri-n-butylate | 1 | 3085-30-1 | 221-394-2 | 61 | 61 | 13420 | ||||
Aluminium triformate | 1 | 7360-53-4 | 230-898-1 | 3,7 | 496558 | |||||
Aluminium-tri-isopropoxide | 1 | 555-31-7 | 209-090-8 | 500 | 510031 | |||||
Aluminium trilactate | 1 | 18917-91-4 | 242-670-9 | 10,38 | 131541 | |||||
Aluminum acetylacetonate | 1 | 13963-57-0 | 237-741-6 | 1,544 | 495015 | |||||
Aluminum chloride hydroxide sulfate | 1 | 39290-78-3 | 254-400-7 | 44,5 | 141492 | |||||
Aluminum chloride hydroxide sulfate | 2 | 39290-78-3 | 254-400-7 | 40,1 | 141492 | |||||
Aluminum, dross | 1 | 69011-71-8 | 273-708-2 | 4 | ||||||
Aluminum magnesium oxide | 1 | 11137-98-7 | 234-386-9 | 49 | ||||||
Aluminum zirconium chloride hydroxide | 1 | 57158-29-9 | 260-599-1 | 22,7 | 146928 | |||||
Ametryn | 1 | 834-12-8 | 212-634-7 | 0,621 | 510032 | |||||
Amides, C16-C18 (even numbered) | 1 | - | 931-695-7 | 979,53 | ||||||
Amides, C18 (saturated and unsaturated) | 1 | - | 938-869-1 | 979,53 | ||||||
Amides, C18, branched and linear | 1 | - | 942-773-5 | 17,63 | ||||||
Amides, C18 (unsaturated) | 1 | - | 931-801-1 | 979,53 | ||||||
Amides, C12-18(even-numbered) and C18(unsatd.), N,N-bis(hydroxyethyl) | 1 | 90622-74-5 | 931-335-9 | 73,4 | ||||||
Amides, C12-18(even-numbered) and C18(unsatd.), N-hydroxyethyl | 1 | 90622-77-8 | 931-338-5 | 73,4 | ||||||
Amides, C10-12 (even numbered) and C18 (unsaturated) alkyl, N,N-bis(hydroxyethyl) | 1 | - | 947-656-2 | 0,705 | ||||||
Amides, C18-unsatd., N,N-bis(hydroxyethyl) | 1 | 93-83-4 | 700-972-2 | 73,44 | ||||||
Amides, C8-18 (even numbered) and C18-unsatd., N, N-bis(hydroxyethyl) | 1 | - | 931-329-6 | 73,4 | ||||||
Amides, coco, N-[3-(dimethylamino)propyl], N-oxides | 1 | 68155-09-9 | 268-938-5 | 1,62 | ||||||
Amides, C18-unsatd., N-[3-(dimethylamine)propyl] | 1 | 1379524-06-7 | 800-353-8 | 14,67 | ||||||
Amides, C16-18 (even numbered), N-[(dimethylamino)propyl] | 1 | - | 940-123-5 | 1,7 | ||||||
Amides, C16-C18 (even) , N,N'-ethylenebis | 1 | 68390-94-3 | 931-299-4 | 35,26 | ||||||
Amides, fatty acids C18 unsat, reaction products with polyethylene amines | 1 | 1226892-50-7 | 629-735-0 | 10 | ||||||
Amides, Fatty acids C18 unsaturated, reaction products with tetraethylenepentamine | 1 | 1225197-81-8 | 630-459-8 | 29 | ||||||
Amides, from diethylenetriamine and hydrogenated palm oil | 1 | 1618093-67-6 | 810-543-2 | 29,2 | ||||||
Amides, from C8-10-fatty acids and tetraethylenepentamine | 1 | 85029-55-6 | 285-080-7 | 29 | ||||||
Amides, C8-18 (even numbered) and C18-unsatd., N-(hydroxyethyl) | 1 | - | 931-330-1 | 73,4 | ||||||
Amides, C18-unsatd., N-hydroxyethyl | 1 | - | 947-890-5 | 12,3 | ||||||
Amides, C8-18(even-numbered) and C18(unsatd.), N-(2-hydroxypropyl) | 1 | 1335203-30-9 | 931-596-9 | 1,64 | ||||||
Amides, tall-oil fatty, N,N-di-Me | 1 | 68308-74-7 | 269-665-4 | 0,6 | ||||||
Amides, tall-oil fatty, N-[3-(dimethylamino)propyl] | 1 | 68650-79-3 | 272-047-7 | 14,67 | ||||||
Amides, C16-18 and C18-unsatd., N,N-bis(hydroxyethyl) | 1 | 68603-38-3 | 271-653-9 | 73,44 | ||||||
Amides, vegetable-oil, N,N-bis(hydroxyethyl) | 1 | 68155-26-0 | 268-952-1 | 50 | ||||||
Amidinourea phosphate | 1 | 17675-60-4 | 241-659-6 | 16,4 | ||||||
Amines, C16-18 (even numbered)-alkyl, salts with phosphoric acid, mono- and di-C16-18 (even numbered) alkyl esters | 1 | - | 952-252-4 | 0,9 | ||||||
Amines, C12-18-(even numbered) and C18-(unsaturated) alkyl | 1 | 2156592-58-2 | 701-068-0 | 1 | 0,38 | |||||
Amines, C16-22-alkyl | 1 | 68037-92-3 | 268-215-4 | 0,07 | ||||||
Amines, C16-18-alkyl | 1 | 90640-32-7 | 292-550-5 | 1 | 0,38 | |||||
Amines, C16-18 and C18-unsatd. alkyl | 1 | 68037-95-6 | 268-219-6 | 1 | 0,38 | |||||
Amines, C12-14-alkyl, C6-10-alkyl phosphates | 1 | 68603-55-4 | 271-663-3 | 0,0548 | ||||||
Amines, C12-14-tert-alkyl, mixed sec-butyl and isobutyl phosphates | 1 | 96690-34-5 | 306-227-4 | 0,11 | ||||||
Amines, N-C16-C18-alkyl-(evennumbered, C18 unsaturated) propane-1,3-diaminium di[(9Z)-octadec-9-enoate] | 1 | 1307863-78-0 | 800-362-7 | 0,29 | ||||||
Amines, C12-14-tert-alkyl, reaction products with O,O-di-C1-14-alkyl hydrogen phosphorodithioate | 1 | 71888-91-0 | 276-159-7 | 4,28 | ||||||
Amines, N-(C16-18 (even numbered) and C18-unsatd. alkyl) trimethylenedi-, ethoxylated(NLP) | 1 | 1290049-56-7 | 800-029-6 | 0,12 | ||||||
Amines, N-(C16-18 and C18 unsaturated alkyl) trimethylenedi-, diacetates | 1 | 1313206-64-2 | 800-153-0 | 0,2 | ||||||
Amines, C16-18-alkyldimethyl | 1 | 68390-97-6 | 269-915-2 | 1 | 1 | |||||
Amines, C12-18-alkyldimethyl | 1 | 68391-04-8 | 269-923-6 | 1 | 1 | |||||
Amines, C12-16-alkyldimethyl | 1 | 68439-70-3 | 270-414-6 | 1 | 1 | |||||
Amines, C12-14-alkyldimethyl | 1 | 84649-84-3 | 283-464-9 | 1 | 1 | |||||
Amines, C14-16 (even numbered)-alkyldimethyl, N-oxides | 1 | - | 938-679-9 | 6,2 | ||||||
Amines, C12-16 (even numbered)-alkyldimethyl, N-oxides | 1 | - | 938-774-5 | 6,2 | ||||||
Amines, C12-16 Alkyl dimethyl, reaction products with Ethyl chloroacetate, 2-(2-Aminoethylamino)ethanol and 2-Propenoic acid | 1 | - | 947-965-2 | 2,06 | ||||||
Amines, C12-18(even numbered)-alkyldimethyl, N-oxides | 1 | 68955-55-5 | 931-341-1 | 6,2 | ||||||
Amines, C12-14 (even numbered)-alkyldimethyl, N-oxides | 1 | 308062-28-4 | 931-292-6 | 6,2 | ||||||
Amines, C36-alkylenedi- | 1 | 68955-56-6 | 273-282-8 | 3,5 | ||||||
Amines, N-C16-18-alkyl (evennumbered) propane-1,3-diamine | 1 | 133779-11-0 | 696-364-9 | 0,0395 | ||||||
Amines, N-C12-14-alkyltrimethylenedi- | 1 | 90640-43-0 | 292-562-0 | 0,0395 | 175325 | |||||
Amines, N-C12-18-alkyltrimethylenedi- | 1 | 68155-37-3 | 268-957-9 | 0,0395 | ||||||
Amines, N-C16-22-alkyltrimethylenedi- | 1 | 90640-45-2 | 292-564-1 | 0,12 | ||||||
Amines, N-C10–C16-alkyltrimethylenedi-, reaction products with chloroacetic acid | 1 | 139734-65-9 | 701-317-3 | 0,19 | ||||||
Amines, N-C12-18-alkyltrimethylenedi-, reaction products with chloroacetic acid, sodium salts | 1 | 2098351-38-1 | 825-246-3 | 11,1 | ||||||
Amines, N-C12–14 (even numbered)-alkyltrimethylenedi-, reaction products with chloroacetic acid and diethylenetriamine, N-C12–14 (even numbered)-alkyl derivates | 1 | - | 947-917-0 | 0,102 | ||||||
Amines, C12-14-branched alkyl, dodecylbenzenesulfonates (1:1) | 1 | 68603-62-3 | 271-668-0 | 1,18 | ||||||
Amines, C11-14-branched alkyl, monohexyl and dihexyl phosphates | 1 | 80939-62-4 | 279-632-6 | 0,2 | 163795 | |||||
Amines, (2-ethylhexyl)(hydrogenated tallow alkyl)methyl | 1 | 1078712-76-1 | 812-958-4 | 7 | ||||||
Amines, C16-18-(even numbered, saturated and unsaturated) alkyl, O,O-dibutyl phosphorothioates | 1 | - | 947-129-7 | 3,72 | ||||||
Amines, polyethylenepoly-, tetraethylenepentamine fraction | 1 | 90640-66-7 | 292-587-7 | 0,82 | ||||||
Amines, polyethylenepoly-, triethylenetetramine fraction | 1 | 90640-67-8 | 292-588-2 | 0,54 | ||||||
Amines, rosin | 1 | 61790-47-4 | 263-139-8 | 10 | ||||||
Amines, C10-14-tert-alkyl | 1 | - | 701-175-2 | 12,1 | 12,5 | |||||
Amines, tri-C8-10-alkyl | 1 | 68814-95-9 | 272-347-8 | 0,12 | ||||||
Amines, N-(C18 unsaturated, alkyl) trimethylenedi-, ethoxylated (NLP) | 1 | 1268344-02-0 | 696-616-8 | 0,12 | ||||||
Amines, (C16-18 and C18-unsatd. alkyl)dimethyl | 1 | 68037-96-7 | 268-220-1 | 1 | 1 | |||||
(2R,3S)-3-Amino-S-(4-aminophenyl)-N-tert-butyl-2-hydroxy-4-phenylbutane-1-sulfonamido | 1 | 169280-56-2 | 458-140-7 | 0,294 | ||||||
5-Amino-3-[[4-[[4-[[4-anilino-2-hydroxyphenyl]azo]phenyl]amino]-3-sulphophenyl]azo]-4-hydroxynaphthalene-2,7-disulphonic acid, sodium salt | 1 | 85223-31-0 | 286-386-3 | 5,76 | ||||||
4'-Aminoazobenzene-4-sulfonic acid | 1 | 104-23-4 | 203-187-9 | 74 | 101550 | |||||
2-Aminobenzamide | 1 | 88-68-6 | 201-851-2 | 2,47 | 10480 | |||||
2-Aminobenzenesulfonic acid | 1 | 88-21-1 | 201-810-9 | 14,693 | 491229 | |||||
4-Aminobenzoic acid | 1 | 150-13-0 | 205-753-0 | 10,58 | 18810 | |||||
3-[(4-Aminobenzoyl)amino]propanoic acid | 1 | 7377-08-4 | 616-017-7 | 0,67 | ||||||
2-Amino-1-butanol | 1 | 96-20-8 | 202-488-2 | 1,4 | TRGS900 | MAK | 492561 | |||
7-[[2-[(Aminocarbonyl)amino]-4-[(4-amino-6-chloro-1,3,5-triazin-2-yl)amino]phenyl]azo]naphthalene-1,3,6-trisulphonic acid | 1 | 35642-64-9 | 252-652-2 | 38,4 | ||||||
7-((E)-(2-((Aminocarbonyl)amino)-4-((4-chloro-6-((2-((2- hydroxyalkyl)oxy)alkyl)amino)-1,3,5-triazin-2-yl)amino)phenyl)diazenyl) polycarbocyclo, polysulfonate, sodium salt | 1 | - | 406-860-7 | 11,8 | ||||||
1-{[(6R,7R)-7-Amino-2-carboxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-3-yl]methyl}-1-methylpyrrolidin-1-ium chloride | 1 | - | 477-080-2 | 16,4 | ||||||
6-Amino-5-chloro-2-cyclopropylpyrimidine-4-carboxylic acid | 1 | 858956-08-8 | 617-769-9 | 17,22 | ||||||
4-Amino-6-[(E)-2-{5-[(5-chloro-2,6-difluoropyrimidin-4-yl)amino]-2-sulfophenyl}diazen-1-yl]-3-[(E)-2-[4-(ethenesulfonyl)phenyl]diazen-1-yl]-5-hydroxynaphthalene-2,7-disulfonic acid | 1 | - | 916-837-8 | 0,583 | ||||||
1-Amino-4-({3-[(4-chloro-6-{[(3 or 4)-sulfophenyl]amino}-1,3,5-triazin-2-yl)amino]-2,4,6-trimethyl-5-sulfophenyl}amino)-9,10-dioxo-9,10-dihydroanthracene-2-sulfonic acid, lithium sodium salts | 1 | - | 942-796-0 | 16,4 | ||||||
2-{[4-({4-[(4-Amino-6-chloro-1,3,5-triazin-2-yl)amino]-5-sulfo-1-naphthyl}diazenyl)-(6 or 7)-sulfo-1-naphthyl]diazenyl}benzene-1,4-disulfonic acid, lithium sodium salts | 1 | - | 943-097-3 | 4,93 | ||||||
2-[{6-[(4-Amino-6-chloro-1,3,5-triazin-2-yl)(methyl)amino]-1-hydroxy-3-sulfonaphthalen-2-yl}diazenyl]naphthalene-1,5-disulfonic acid, lithium sodium salts | 1 | - | 942-710-1 | 16,4 | ||||||
4-Amino-m-cresol | 1 | 2835-99-6 | 220-621-2 | 1,5 | 11210 | |||||
5-Amino-o-cresol | 1 | 2835-95-2 | 220-618-6 | 6,601 | 113528 | |||||
4-Amino-3,6-dichloropyridine-2-carboxylic acid | 1 | 150114-71-9 | 604-721-7 | 3,2 | ||||||
5-Amino-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-(ethylsulfinyl)-1H-pyrazole-3-carbonitrile | 1 | 181587-01-9 | 446-630-3 | 0,12 | ||||||
4-[(1-Amino-9,10-dihydro-4-hydroxy-9,10-dioxo-2-anthryl)oxy]-N-(3-ethoxypropyl)benzenesulphonamide | 1 | 72363-26-9 | 276-602-4 | 11,76 | ||||||
2-[(1-Amino-9,10-dihydro-4-hydroxy-9,10-dioxo-2-anthryl)oxy]ethyl ethyl carbonate | 1 | 40530-60-7 | 254-959-7 | 16,4 | ||||||
2-[(1-Amino-9,10-dihydro-4-hydroxy-9,10-dioxo-2-anthryl)oxy]ethyl phenyl carbonate | 1 | 28173-59-3 | 248-882-8 | 11,75 | ||||||
N-(4-Amino-9,10-dihydro-3-methoxy-9,10-dioxo-1-anthryl)benzenesulphonamide | 1 | 69563-51-5 | 274-040-4 | 1,167 | ||||||
N-(4-Amino-9,10-dihydro-3-methoxy-9,10-dioxo-1-anthryl)-4-methylbenzenesulphonamide | 1 | 81-68-5 | 201-369-2 | 1,167 | ||||||
4-Amino-N-(1,1-dimethylethyl)-4,5-dihydro-3-(1-methylethyl)-5-oxo-1H-1,2,4-triazole-1-carboxamide | 1 | 129909-90-6 | 603-373-3 | 0,16 | 0,16 | |||||
3-Amino-N,N-dimethylpropan-1-aminium 2-C10-13-alkyl benzenesulfonate | 1 | 1093628-27-3 | 824-801-7 | 4,11 | ||||||
6-Amino-1,3-dimethyluracil | 1 | 6642-31-5 | 229-662-0 | 109 | ||||||
4-Aminodiphenylamine | 1 | 101-54-2 | 202-951-9 | 7,1 | TRGS900 | 21710 | ||||
12-Aminododecanoic acid | 1 | 693-57-2 | 211-754-7 | 0,4 | 106841 | |||||
2-Aminoethanol | 1 | 141-43-5 | 205-483-3 | 0,51 | 1 | TRGS900 | MAK | EU | 14630 | |
2-Aminoethanol reaction products with cyclohexane and peroxidized N-butyl-2,2,6,6-tetramethyl-4-piperidinamine-2,4,6-trichloro-1,3,5-triazine reaction products | 1 | - | 426-650-9 | 11,75 | ||||||
2-Aminoethanol hydrobromide | 1 | 23382-12-9 | 245-624-6 | 8,82 | ||||||
4-Amino-6-((E)-(4-(4-(ethenylsulfonyl)butanoyl)amino)-diazenyl)-3-((E)-4- (ethenylsulfonyl)-diazenyl)-5-hydroxypolycarbocyclo, polysulfonate, polyphenyl, sodium salt | 1 | - | 401-000-7 | 2,35 | ||||||
2-(2-Aminoethoxy)ethanol | 1 | 929-06-6 | 213-195-4 | 0,67 | 1,12 | TRGS900 | MAK | 493806 | ||
N-(Aminoethyl)ethanolamine | 1 | 111-41-1 | 203-867-5 | 0,704 | 38600 | |||||
N-(2-Aminoethyl)-1,3-propanediamine | 1 | 13531-52-7 | 236-882-0 | 0,62 | ||||||
2-Amino-2-ethyl-1,3-propanediol | 1 | 115-70-8 | 204-101-2 | 58,8 | 101863 | |||||
N-(2-(4-Amino-N-ethyl-m-toluidino)ethyl)methanesulfonamide sesquisulfate | 1 | 25646-71-3 | 247-161-5 | 0,822 | 491571 | |||||
N-(2-Aminoethyl)-N'-[3-(trimethoxysilyl)propyl]ethylenediamine | 1 | 35141-30-1 | 252-390-9 | 16,45 | ||||||
N-(2-Aminoethyl)-N'-[3-(trimethoxysilyl)propyl]ethylenediamine | 2 | 35141-30-1 | 252-390-9 | 260 | 260 | |||||
Amino functional alkoxysilanes | 1 | - | 11,2 | |||||||
Amino functional alkoxysilanes | 2 | - | 0,2 | 12,9 | ||||||
Amino functional alkoxysilanes | 3 | - | 25,6 | |||||||
Amino functional alkoxysilanes | 4 | - | 1,76 | |||||||
Amino functional alkoxysilanes | 5 | - | 260 | |||||||
1-Aminoguanidinium hydrogen carbonate | 1 | 2582-30-1 | 219-956-7 | 0,34 | 570064 | |||||
2-Amino-2-(hydroxymethyl)propane-1,3-diol hydrochloride | 1 | 1185-53-1 | 214-684-5 | 152,8 | ||||||
1-Amino-4-hydroxy-2-phenoxyanthraquinone | 1 | 17418-58-5 | 241-442-6 | 3,53 | ||||||
7-Amino-4-hydroxy-3-[[4-[(4-sulphophenyl)azo]phenyl]azo]naphthalene-2-sulphonic acid, compound with 2,2',2''-nitrilotriethanol (1:2) | 1 | 64683-40-5 | 265-016-4 | 5,92 | ||||||
Aminoiminomethanesulfinic acid | 1 | 1758-73-2 | 217-157-8 | 0,94 | 11710 | |||||
(6R,7R)-7-Amino-3-(methoxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid | 1 | - | 435-680-1 | 5,2 | ||||||
DL-α-(Aminomethyl)-p-hydroxybenzylic alcohol hydrochloride | 1 | 770-05-8 | 212-216-4 | 49,3 | ||||||
2-Amino-2-methylpropane-1,3-diol | 1 | 115-69-5 | 204-100-7 | 5,17 | 492802 | |||||
1-Amino-2-methyl-2-propanethiol hydrochloride | 1 | 32047-53-3 | 434-480-1 | 2,42 | 535992 | |||||
2-Amino-2-methylpropanol | 1 | 124-68-5 | 204-709-8 | 6,5 | TRGS900 | MAK | 510037 | |||
3-Aminomethyl-3,5,5-trimethylcyclohexylamine | 1 | 2855-13-2 | 220-666-8 | 0,073 | 33270 | |||||
6-Amino-2-naphthalenesulfonic acid | 1 | 93-00-5 | 202-208-9 | 49,3 | 101154 | |||||
2-Amino-4-nitrophenol | 1 | 99-57-0 | 202-767-9 | 10,1 | 18620 | |||||
3-Aminooctan-4-ol | 1 | 1001354-72-8 | 482-070-6 | 29 | ||||||
4-Aminophenol | 1 | 123-30-8 | 204-616-2 | 2,1 | 24730 | |||||
3-Aminophenol | 1 | 591-27-5 | 209-711-2 | 0,493 | 510039 | |||||
5-[5-Amino-4-substituted-phenylazo-phenylanilino]-chloro-heteromonocyclylamino-3- (naphthalen-2-ylazo)-4-hydroxynaphthalene-polysulfonic acid, sodium salt | 1 | - | 455-860-3 | 2,35 | ||||||
(1R)-2-{[2-(4-Aminophenyl)ethyl]amino}-1-phenylethanol hydrochloride | 1 | 521284-22-0 | 700-425-8 | 0,15 | ||||||
4-[(4-Aminophenyl)methyl]aniline; 2-(chloromethyl)oxirane | 1 | 28390-91-2 | 500-062-3 | 3,5 | ||||||
2-Aminopropane-1,3-diol | 1 | 534-03-2 | 208-584-0 | 44,08 | 104845 | |||||
3-Aminopropan-1-ol | 1 | 156-87-6 | 205-864-4 | 3,3 | 24710 | |||||
N-(3-Aminopropyl)-N'-[3-(C16-18 (evennumbered), C18 unsaturated alkyl amino)propyl]propane-1,3-diamine | 1 | 1219458-11-3 | 628-862-9 | 0,44 | ||||||
N-(3-Aminopropyl)-N'-C16-18 (evennumbered), C18 unsaturated alkyl -propane-1,3-diamine | 1 | 1219458-14-6 | 628-863-4 | 0,73 | ||||||
N-(3-Aminopropyl)-N-N-(C16-18 evennumbered, C18 unsaturated)-alkylpropane-1,3-diamine | 1 | 1219826-66-0 | 629-720-9 | 2,3 | ||||||
N-(3-Aminopropyl)-N- (C12-18 even numbered) alkyl-propane-1,3-diamine | 1 | 1219458-12-4 | 812-713-1 | 0,08 | ||||||
N'-{3-[(3-Aminopropyl)amino]propyl}-N,N-di-C16-C18 (evennumbered) alkyl propane-1,3-diamine | 1 | - | 941-593-4 | 1,97 | ||||||
3-Aminopropyldiethylamine | 1 | 104-78-9 | 203-236-4 | 24,7 | 27750 | |||||
3-Aminopropyldimethylamine | 1 | 109-55-7 | 203-680-9 | 1,2 | 510184 | |||||
N'-(3-Aminopropyl)-N,N-dimethylpropane-1,3-diamine | 1 | 10563-29-8 | 234-148-4 | 3,7 | 3,7 | 124403 | ||||
N-(3-Aminopropyl)-N-dodecylpropane-1,3-diamine | 1 | 2372-82-9 | 219-145-8 | 0,789 | TRGS900 | MAK | 112395 | |||
N-(3-Aminopropyl)iminodiethanol | 1 | 4985-85-7 | 225-642-0 | 24,7 | 117597 | |||||
2-[(3-Aminopropyl)methylamino]ethanol | 1 | 41999-70-6 | 255-615-9 | 5,29 | ||||||
(Z)-N-(3-Aminopropyl)-N'-[3-(9-octadecenylamino)propyl]propane-1,3-diamine | 1 | 67228-83-5 | 266-613-2 | 0,658 | ||||||
(Z)-N-(3-Aminopropyl)-N'-9-octadecenylpropane-1,3-diamine | 1 | 28872-01-7 | 249-276-6 | 0,73 | ||||||
3-Aminopropyltriethoxysilane | 1 | 919-30-2 | 213-048-4 | 14 | 493791 | |||||
5-Aminosalicylic acid | 1 | 89-57-6 | 201-919-1 | 2,42 | 21840 | |||||
(2Z)-2-(5-Amino-1,2,4-thiadiazol-3-yl)-1-(1,3-benzothiazol-2-ylsulfanyl)-2-[(triphenylmethoxy)imino]ethan-1-one | 1 | - | 447-420-4 | 8,75 | ||||||
(Z)-[1-(2-Amino-1,3-thiazol-4-yl)-2-(1,3-benzothiazol-2-ylsulfanyl)-2-oxoethylidene]amino acetate | 1 | 104797-47-9 | 457-660-1 | 1,64 | 1,64 | |||||
3-Amino-tricyclo[3,3,1,13,7]decan-1-ol | 2 | - | 450-050-6 | 16,4 | ||||||
[μ-(5-Amino-1,3,3-trimethylcyclohexylamine-N:N')]hexafluorodiboron | 1 | 87788-32-7 | 289-348-4 | 0,88 | ||||||
Aminotri(methylenephosphonic acid) | 1 | 6419-19-8 | 229-146-5 | 9,7 | 491457 | |||||
11-Aminoundecanoic acid | 1 | 2432-99-7 | 219-417-6 | 1,86 | 494230 | |||||
Amitrole | 1 | 61-82-5 | 200-521-5 | 0,00592 | TRGS900 | MAK | EU | 16170 | ||
Ammonia, anhydrous | 1 | 7664-41-7 | 231-635-3 | 14 | 47,6 | TRGS900 | MAK | EU | 1100 | |
(p-Ammoniophenyl)bis(2-hydroxyethyl)ammonium sulphate | 1 | 54381-16-7 | 259-134-5 | 0,176 | ||||||
Ammonium iron(III) hexacyanoferrate(II) | 1 | 25869-00-5 | 247-304-1 | 176,3 | 135443 | |||||
Ammonium iron(III) trimethylenediaminetetraacetate hemihydrate | 1 | 111687-36-6 | 400-660-3 | 1,2 | 530648 | |||||
Ammonium tungstate | 1 | 11120-25-5 | 234-364-9 | 2,4 | 124578 | |||||
Ammonium zinc chloride | 1 | 52628-25-8 | 258-054-8 | 1 | 144709 | |||||
Ammonium acetate | 1 | 631-61-8 | 211-162-9 | 9,11 | 491337 | |||||
Ammonium acetate | 2 | 631-61-8 | 211-162-9 | 911,56 | 491337 | |||||
Ammonium 2-amino-4-(hydroxymethylphosphinyl)butyrate | 1 | 77182-82-2 | 278-636-5 | 0,33 | 530263 | |||||
Ammonium bifluoride | 1 | 1341-49-7 | 215-676-4 | 2,3 | TRGS900 | MAK | EU | 3850 | ||
Ammonium bis[4-[(5-chloro-2-hydroxy-phenyl)azo]-3-hydroxy-N-phenyl-2-naphthalenecarboxamidato(2-)]ferrate (1-) | 1 | - | 403-590-1 | 16,4 | ||||||
Ammonium bromide | 1 | 12124-97-9 | 235-183-8 | 4,75 | 5970 | |||||
Ammonium carbamate | 1 | 1111-78-0 | 214-185-2 | 49,8 | 4320 | |||||
Ammonium carbonate | 1 | 10361-29-2 | 233-786-0 | 369 | ||||||
Ammonium chloride | 1 | 12125-02-9 | 235-186-4 | 43,97 | 1460 | |||||
Ammonium chloride | 2 | 12125-02-9 | 235-186-4 | 33,5 | 1460 | |||||
Ammonium (di C8-C10, branched, C9 rich, alkylnaphthalene sulphonate) | 1 | - | 947-119-2 | 35 | ||||||
Ammonium difluoro[1,1,2,2-tetrafluoro-2-(pentafluoroethoxy)ethoxy]acetate | 1 | 908020-52-0 | 700-323-3 | 0,49 | ||||||
Ammonium dihydrogen phosphate | 1 | 7722-76-1 | 231-764-5 | 5,9 | 4830 | |||||
Ammonium dodecylbenzenesulphonate | 1 | 1331-61-9 | 215-559-8 | 10 | ||||||
Ammonium ferric citrate | 1 | 1185-57-5 | 214-686-6 | 9,8 | 108991 | |||||
Ammonium fluoride | 1 | 12125-01-8 | 235-185-9 | 2,5 | 2,5 | TRGS900 | MAK | EU | 500000 | |
Ammonium hydrogen carbonate | 1 | 1066-33-7 | 213-911-5 | 62,5 | 62,5 | 108420 | ||||
Ammonium hydrogensulfite | 1 | 10192-30-0 | 233-469-7 | 234 | 3540 | |||||
Ammonium iodide | 2 | 12027-06-4 | 234-717-7 | 0,07 | 124880 | |||||
Ammonium 4-isopropylbenzenesulfonate | 1 | 680972-33-2 | 811-484-5 | 26,9 | ||||||
Ammonium magnesium orthophosphate | 1 | 7785-21-9 | 232-075-2 | 24,4 | 122750 | |||||
Ammonium 2-mercaptopropionate | 1 | 13419-67-5 | 236-526-4 | 1,23E-05 | ||||||
Ammonium 2-mercaptopropionate | 2 | 13419-67-5 | 236-526-4 | 0,49 | ||||||
Ammonium metavanadate | 1 | 7803-55-6 | 232-261-3 | 0,18 | 0,64 | TRGS900 | 5260 | |||
Ammonium N-methyl-N-(1-oxododecyl)glycinate | 1 | 68003-46-3 | 268-130-2 | 141,1 | ||||||
Ammonium nitrate | 1 | 6484-52-2 | 229-347-8 | 36 | 3750 | |||||
Ammonium perchlorate | 1 | 7790-98-9 | 232-235-1 | 0,28 | 500057 | |||||
Ammonium perrhenate | 1 | 13598-65-7 | 237-075-6 | 1,3 | 126855 | |||||
Ammonium phosphate solution 1.3 | 1 | - | 913-888-8 | 6,1 | ||||||
Ammonium polyphosphate | 1 | 68333-79-9 | 269-789-9 | 18,06 | 5470 | |||||
Ammonium sodium 2-[4-[[1-[[(2-methoxy-5-methyl-4-sulphonatophenyl)amino]carbonyl]-2-oxopropyl]azo]phenyl]-6-methylbenzothiazole-7-sulphonate | 1 | 72705-24-9 | 276-770-9 | 16,5 | ||||||
Ammonium sodium vanadium oxide | 1 | 39455-80-6 | 254-463-0 | 0,16 | 0,55 | TRGS900 | 141547 | |||
Ammonium sulfamate | 1 | 7773-06-0 | 231-871-7 | 11,67 | 570069 | |||||
Ammonium sulfate | 1 | 7783-20-2 | 231-984-1 | 11,167 | 1470 | |||||
Ammonium sulfate supsension | 1 | - | 920-762-6 | 23,5 | ||||||
Ammonium sulfite | 1 | 10196-04-0 | 233-484-9 | 275 | 5580 | |||||
Ammonium 2,3,3,3-tetrafluoro-2-(heptafluoropropoxy)propanoate | 1 | 62037-80-3 | 700-242-3 | 0,14 | ||||||
Ammonium thiocyanate | 1 | 1762-95-4 | 217-175-6 | 2,8 | 3390 | |||||
Ammonium thioglycolate | 1 | 5421-46-5 | 226-540-9 | 1,41 | TRGS900 | MAK | 530183 | |||
Ammonium thiosulfate | 1 | 7783-18-8 | 231-982-0 | 350 | 3650 | |||||
Ammonium 2,2,3-trifluoro-3-(1,1,2,2,3,3-hexafluoro-3-trifluoromethoxypropoxy)propionate | 1 | - | 480-310-4 | 0,35 | ||||||
Ammonium trivanadium octaoxide | 1 | 12207-63-5 | 235-384-0 | 0,16 | 0,55 | TRGS900 | 125450 | |||
Ammonium undecafluorohexanoate | 1 | 21615-47-4 | 244-479-6 | 1,975 | 2,96 | |||||
Ammonium (xylenes and 4-ethylbenzene)sulfonates | 1 | - | 943-024-5 | 26,9 | ||||||
Amoxicillin | 1 | 26787-78-0 | 248-003-8 | 28,8 | ||||||
tert-Amylmethylether | 1 | 994-05-8 | 213-611-4 | 88,8 | 108188 | |||||
Androsta-1,4-diene-3,17-dione | 1 | 897-06-3 | 212-977-2 | 0,176 | ||||||
Androst-4-ene-3,17-dione | 1 | 63-05-8 | 200-554-5 | 0,176 | 36330 | |||||
(E)-Anethole | 1 | 4180-23-8 | 224-052-0 | 10,6 | 494492 | |||||
Aniline | 1 | 62-53-3 | 200-539-3 | 7,7 | TRGS900 | MAK | EU | 11860 | ||
4-[[5-(Anilino)carbonyl-2-methoxyphenyl]azo]-3-hydroxy-N-(3-nitrophenyl)naphthalene-2-carboxamide | 1 | 6448-96-0 | 229-246-9 | 49,3 | ||||||
2'-Anilino-6'-[ethyl(3-methylbutyl)amino]-3'-methylspiro[isobenzofuran-1(3H),9'-[9H]xanthene]-3-one | 1 | 70516-41-5 | 274-641-1 | 23,33 | 23,33 | 159338 | ||||
[4-[[4-Anilino-1-naphthyl][4-(dimethylamino)phenyl]methylene]cyclohexa-2,5-dien-1-ylidene]dimethylammonium acetate | 1 | 83803-79-6 | 280-898-0 | 1,97 | ||||||
4-Anilino-3-nitro-N-phenylbenzenesulphonamide | 1 | 5124-25-4 | 225-862-7 | 11,67 | ||||||
Anisaldehyde | 1 | 123-11-5 | 204-602-6 | 5,88 | 492862 | |||||
Anisole | 1 | 100-66-3 | 202-876-1 | 20 | 21890 | |||||
Anode, copper | 1 | - | 918-168-7 | 0,005 | ||||||
Anode, copper | 2 | - | 918-168-7 | 0,05 | 0,05 | |||||
Anthracene oil | 1 | 90640-80-5 | 292-602-7 | 0,65 | 0,65 | |||||
9,10-Anthracenedione, 1,4-diamino-, N,N'-bis(4-C7-17-branched alkylphenyl) derivs. | 1 | 97862-23-2 | 308-067-0 | 49,3 | ||||||
9,10-Anthracenedione, 1,4-diamino-, N,N'-mixed 2-ethylhexyl and hexyl and octyl derivs. | 1 | 93762-42-6 | 297-755-3 | 16,4 | ||||||
9,10-Anthracenedione, 1,4-diamino-, N,N'-mixed 2-ethylhexyl and 3-[(2-ethylhexyl)oxy]propyl and 3-methoxypropyl derivatives | 1 | 90170-70-0 | 290-505-4 | 1,1 | ||||||
9,10-Anthraquinone | 1 | 84-65-1 | 201-549-0 | 0,052 | Carcinogenic | 28300 | ||||
9,10-Anthraquinone | 2 | 84-65-1 | 201-549-0 | 2,2 | Carcinogenic | 28300 | ||||
Antimony | 1 | 7440-36-0 | 231-146-5 | 0,263 | 8390 | |||||
Antimonynickel Titanium Oxide Yellow | 1 | 8007-18-9 | 232-353-3 | 4 | TRGS900 | 500129 | ||||
Antimony pentachloride | 1 | 7647-18-9 | 231-601-8 | 0,042 | 4650 | |||||
Antimony pentoxide | 1 | 1314-60-9 | 215-237-7 | 0,456 | 10 | 520006 | ||||
Antimony(III) sulfide | 1 | 1345-04-6 | 215-713-4 | 0,365 | TRGS900 | 4590 | ||||
Antimony trichloride | 1 | 10025-91-9 | 233-047-2 | 0,492 | 500001 | |||||
Antimony trioxide | 1 | 1309-64-4 | 215-175-0 | 0,315 | TRGS900 | 3440 | ||||
Arachic acid | 1 | 506-30-9 | 208-031-3 | 555,395 | 493151 | |||||
Arginine | 1 | 74-79-3 | 200-811-1 | 552 | 100469 | |||||
(+)-L-Arginine hydrochloride | 1 | 1119-34-2 | 214-275-1 | 668,2 | 108680 | |||||
Aromatic hydrocarbons, C8 | 1 | - | 905-570-2 | 221 | 221 | |||||
Aromatic hydrocarbons, C9-12, benzene distn.; Light Oil Redistillate, high-boiling | 1 | 92062-36-7 | 295-551-9 | 150 | ||||||
Aromatic hydrocarbons, C7-8, ethylene-manuf.-by-product | 1 | 90989-43-8 | 292-699-6 | 2,31 | 2,31 | |||||
Aromatic hydrocarbons, C7-8, ethylene-manuf.-by-product | 2 | 90989-43-8 | 292-699-6 | 3,25 | ||||||
Aromatic hydrocarbons, C8, catalytic reforming-derived | 1 | 91995-18-5 | 295-279-0 | 837,5 | ||||||
Aromatic hydrocarbons, C8, catalytic reforming-derived | 2 | 91995-18-5 | 295-279-0 | 837,5 | 1,9 | |||||
Aromatic hydrocarbons, C6-8, naphtha-raffinate pyrolyzate- derived; Low boiling point thermally cracked naphtha | 1 | 68475-70-7 | 270-658-3 | 3,25 | ||||||
Aromatic hydrocarbons, C10-13, reaction products with branched nonene, sulfonated, sodium salts | 1 | 1258274-08-6 | 800-660-7 | 10 | 21,16 | |||||
Aromatic hydrocarbons, C7-12, C8-rich | 1 | 93571-75-6 | 297-401-8 | 837,5 | ||||||
Aromatic hydrocarbons, C6-10, C8-rich; Light Oil Redistil- late, low boiling | 1 | 90989-41-6 | 292-697-5 | 2,31 | 2,31 | |||||
Aromatic hydrocarbons, C6-10, C8-rich; Light Oil Redistil- late, low boiling | 2 | 90989-41-6 | 292-697-5 | 3,25 | ||||||
Arsenic | 1 | 7440-38-2 | 231-148-6 | 0,004 | 8280 | |||||
Arsenic acid | 1 | 7778-39-4 | 231-901-9 | 0,006 | EU | Carcinogenic | 500006 | |||
L-Ascorbic acid, titanium(4+) salt | 1 | 122958-50-3 | 814-615-4 | 10 | 22 | |||||
Ashes (residues), cenospheres | 1 | 93924-19-7 | 300-212-6 | 0,113 | ||||||
Ashes (residues), nonhazardous municipal solid waste | 1 | - | 937-417-0 | 1,88 | ||||||
Ashes (residues), rice husk | 1 | 71630-92-7 | 275-735-5 | 0,017 | ||||||
Asparagine | 1 | 70-47-3 | 200-735-9 | 81,4 | 100426 | |||||
Aspartic acid | 1 | 56-84-8 | 200-291-6 | 206 | 12910 | |||||
Aspartic acid, N-(3-carboxy-1-oxo-sulfopropyl)-N-(C16-C18 (even numbered), C18 unsaturated alkyl) tetrasodium salts | 1 | - | 939-704-6 | 944,55 | ||||||
Asphalt and Bitumen | 1 | 8052-42-4 | 232-490-9 | 2,88 | TRGS900 | MAK | Carcinogenic | 90230 | ||
Asphalt, oxidized | 1 | 64742-93-4 | 265-196-4 | 2,88 | ||||||
Asphalt, sulfonated, sodium salt | 1 | 68201-32-1 | 269-212-0 | 25,2 | ||||||
Azacyclotridecan-2-one | 1 | 947-04-6 | 213-424-8 | 0,88 | 40490 | |||||
7-Azatridecane-1,13-diamine | 1 | 143-23-7 | 205-593-1 | 0,1 | ||||||
Azelaic acid | 1 | 123-99-9 | 204-669-1 | 17,632 | 492870 | |||||
2,2'-Azobis[2,4-dimethylvaleronitrile] | 1 | 4419-11-8 | 224-583-8 | 691 | ||||||
Azobiscarboxamide | 1 | 123-77-3 | 204-650-8 | 0,5 | 14510 | |||||
4,4'-Azobis[4-cyanovaleric] acid | 1 | 2638-94-0 | 220-135-0 | 24,68 | ||||||
2,2'-Azobis[4-methoxy-2,4-dimethylvaleronitrile] | 1 | 15545-97-8 | 239-593-8 | 49,3 | ||||||
2,2'-Azobis[2-methylbutyronitrile] | 1 | 13472-08-7 | 236-740-8 | 0,705 | 126580 | |||||
2,2'-[Azobis(1-methylethylidene)]bis[4,5-dihydro-1H-imidazole] dihydrochloride | 1 | 27776-21-2 | 248-655-3 | 16,4 | ||||||
2,2'-Azobis(2-methylpropionamidine) dihydrochloride | 1 | 2997-92-4 | 221-070-0 | 5,88 | 530503 | |||||
BAL5287 | 1 | - | 447-970-5 | 2,92 | ||||||
Barium | 1 | 7440-39-3 | 231-149-1 | 5,8 | 8420 | |||||
Barium bis(dihydrogenorthophosphate) | 1 | 13466-20-1 | 236-715-1 | 5,43 | ||||||
Barium(2+); Oxygen(2-); Titanium(4+); Zirconium(4+); Calcium(2+) | 1 | - | 948-963-4 | 7,34 | ||||||
Barium acetate | 1 | 543-80-6 | 208-849-0 | 10 | TRGS900 | MAK | EU | 510057 | ||
Barium acetate | 2 | 543-80-6 | 208-849-0 | 8,8 | TRGS900 | MAK | EU | 510057 | ||
Barium bis(di C8-C10, branched, C9 rich, alkylnaphthalenesulphonate) | 1 | - | 939-718-2 | 1,29 | ||||||
Barium bis[2-chloro-5-[(2-hydroxy-1-naphthyl)azo]toluene-4-sulphonate] | 1 | 5160-02-1 | 225-935-3 | 2,29 | ||||||
Barium bis(2-ethylhexanoate) | 1 | 2457-01-4 | 219-535-8 | 20,49 | ||||||
Barium bis(2-ethylhexanoate) | 2 | 2457-01-4 | 219-535-8 | 32 | ||||||
Barium bis(2-ethylhexanoate) | 3 | 2457-01-4 | 219-535-8 | 8,8 | ||||||
Barium bis[2-[(2-hydroxynaphthyl)azo]naphthalenesulphonate] | 1 | 1103-38-4 | 214-160-6 | 2,29 | ||||||
Barium carbonate | 1 | 513-77-9 | 208-167-3 | 0,72 | 6,9 | 1690 | ||||
Barium chloride | 1 | 10361-37-2 | 233-788-1 | 8,8 | TRGS900 | MAK | EU | 1960 | ||
Barium 4-[(5-chloro-4-methyl-2-sulphonatophenyl)azo]-3-hydroxy-2-naphthoate | 1 | 7585-41-3 | 231-494-8 | 4,4 | 122400 | |||||
Barium chromate | 1 | 10294-40-3 | 233-660-5 | 5,8 | EU | 491196 | ||||
Barium dibenzoate | 1 | 533-00-6 | 208-551-0 | 10 | ||||||
Barium dodecairon nonadecaoxide | 1 | 12047-11-9 | 234-974-5 | 0,15 | 125105 | |||||
Barium 4-dodecylphenolate | 1 | 93922-04-4 | 300-141-0 | 0,033 | ||||||
Barium fluoride | 1 | 7787-32-8 | 232-108-0 | 2,75 | TRGS900 | MAK | EU | 5960 | ||
Barium hydroxide | 1 | 17194-00-2 | 241-234-5 | 0,62 | MAK | 4220 | ||||
Barium 3-hydroxy-4-[(4-methyl-2-sulphonatophenyl)azo]-2-naphthoate | 1 | 17852-98-1 | 241-806-4 | 4,4 | ||||||
Barium metaborate | 1 | 13701-59-2 | 237-222-4 | 2,5 | 490549 | |||||
Barium neodecanoate | 1 | 55172-98-0 | 259-509-3 | 22,41 | TRGS900 | MAK | 145985 | |||
Barium neodecanoate | 2 | 55172-98-0 | 259-509-3 | 22,04 | TRGS900 | MAK | 145985 | |||
Barium neodecanoate | 3 | 55172-98-0 | 259-509-3 | 8,8 | TRGS900 | MAK | 145985 | |||
Barium nitrate | 1 | 10022-31-8 | 233-020-5 | 2,73 | TRGS900 | MAK | EU | 4750 | ||
Barium oxide | 1 | 1304-28-5 | 215-127-9 | 0,5 | MAK | 4540 | ||||
Barium selenite | 1 | 13718-59-7 | 237-280-0 | 0,17 | TRGS900 | MAK | 127025 | |||
Barium selenite | 2 | 13718-59-7 | 237-280-0 | 0,05 | TRGS900 | MAK | 127025 | |||
Barium sulfate | 1 | 7727-43-7 | 231-784-4 | 10 | 10 | TRGS900 | MAK | 1710 | ||
Barium sulfide | 1 | 21109-95-5 | 244-214-4 | 2,3 | 6,4 | TRGS900 | MAK | EU | 4660 | |
Barium titanate (IV) | 1 | 12047-27-7 | 234-975-0 | 7,32 | 125106 | |||||
Barium m-toluate | 1 | 68092-47-7 | 268-460-7 | 1,75 | ||||||
Barium 3,5,5-trimethylhexanoate | 1 | 36211-43-5 | 252-917-2 | 1,9 | ||||||
Basic Chromium sulphate | 1 | - | 914-129-3 | 0,9 | 0,9 | |||||
Basic nickel carbonate | 1 | 12607-70-4 | 235-715-9 | 0,05 | 0,05 | TRGS900 | Carcinogenic | 125742 | ||
Bentonite, acid-leached | 1 | 70131-50-9 | 274-324-8 | 10 | ||||||
Benzaldehyde | 1 | 100-52-7 | 202-860-4 | 9,8 | 9,8 | 13380 | ||||
Benzenamine, 4-[(4-aminophenyl)(4-imino-2,5-cyclohexadien-1-ylidene)methyl]-, N-Me derivatives, molybdatephosphates | 1 | 67989-22-4 | 268-006-8 | 16,4 | ||||||
Benzenamine, N,N-dimethyl-, oxidized, molybdatetungstatephosphates | 1 | 101357-19-1 | 309-916-8 | 16,5 | ||||||
Benzenamine, N,N-dimethyl-, oxidized, molybdatetungstatephosphates | 2 | 101357-19-1 | 309-916-8 | 4,11 | ||||||
Benzenamine, oxidized | 1 | 13007-86-8 | 235-850-3 | 1,25 | 1,25 | |||||
Benzenamine, N-phenyl-, reaction products with 2,4,4-Trimethylpentene | 1 | 68411-46-1 | 270-128-1 | 0,6 | 491734 | |||||
Benzenamine, reaction products with aniline hydrochloride and nitrobenzene | 1 | 101357-15-7 | 309-912-6 | 10,58 | 190964 | |||||
Benzenamine, reaction products with aniline hydrochloride and nitrobenzene, hydrochlorides | 1 | 101357-16-8 | 309-913-1 | 11,75 | ||||||
Benzene, C15-16-alkyl derivs. | 1 | - | 940-786-0 | 7 | 7 | |||||
Benzene, C10-13-alkyl derivates | 1 | 67774-74-7 | 267-051-0 | 7 | 7 | 492237 | ||||
Benzene, C9-13-alkyl derivs., distn. residues, sulfonated, calcium salts | 1 | 97675-24-6 | 307-593-8 | 0,66 | ||||||
Benzene, ethylenated, by-products from | 1 | 68608-82-2 | 271-802-8 | 0,22 | ||||||
Benzene, mono-C10-13-alkyl derivates, distillation residues, sulfonated, barium salts | 1 | - | 947-582-0 | 17,63 | ||||||
Benzene, mono-C11-C13-branched alkyl derivatives | 1 | - | 810-801-4 | 0,158 | ||||||
Benzene mono-C10-13-alkyl derivatives, distillation residues, sulfonated, sodium salts | 1 | - | 944-207-2 | 35,26 | ||||||
Benzene, mono-C10-14-alkyl derivs., fractionation bottoms, intermediate cut, sulfonated, sodium salts | 1 | 85117-47-1 | 285-597-8 | 0,66 | ||||||
Benzene, mono-C10-13-alkyl derivs., distn. residues | 1 | 84961-70-6 | 284-660-7 | 2,2 | ||||||
Benzene, mono C10-13-alkyl derivs., fractionation bottoms, heavy ends, sulfonated, sodium salts | 1 | 148520-82-5 | 604-638-6 | 2,82 | ||||||
Benzene, 1,1'-oxybis-, tetrapropylene derivs., sulfonated, sodium salts | 1 | 119345-04-9 | 601-601-6 | 64 | ||||||
1,4-Benzenediamine, 2-(methoxymethyl)- | 1 | 337906-36-2 | 679-526-3 | 1,08 | ||||||
1,3-Benzenediamine, coupled with diazotized m-phenylenediamine, acetates | 1 | 84281-74-3 | 282-617-7 | 1,4 | 166435 | |||||
1,4-Benzenediamine, N,N'-mixed Ph and tolyl derivs. | 1 | 68953-84-4 | 273-227-8 | 1,297 | ||||||
1,2-Benzenedicarboxylic acid, benzyl isononyl alkyl esters | 1 | - | 701-339-3 | 1,32 | ||||||
1,2-Benzenedicarboxylic acid, di-C16-18-alkyl esters | 1 | 90193-76-3 | 290-580-3 | 4,8 | ||||||
1,2-Benzenedicarboxylic acid, di-C1-13 alkyl esters, manuf. of, by-products from, distn. lights | 1 | 84852-02-8 | 284-310-3 | 16,75 | ||||||
1,2-Benzenedicarboxylic acid, di-C6-10-alkyl esters | 1 | 68515-51-5 | 271-094-0 | 5,61 | ||||||
1,2-Benzenedicarboxylic acid, di-C8-10-alkyl esters | 1 | 71662-46-9 | 275-809-7 | 5,61 | ||||||
1,2-Benzenedicarboxylic acid, di-C9-11-branched alkyl esters, C10-rich | 1 | 68515-49-1 | 271-091-4 | 5,29 | ||||||
1,2-Benzenedicarboxylic acid, di-C9-11-branched and linear alkyl esters | 1 | 68515-43-5 | 271-085-1 | 0,78 | ||||||
1,3-Benzenedimethanamine, N-(2-phenylethyl) derivs. | 1 | 404362-22-7 | 445-790-1 | 0,004 | 0,18 | |||||
1,3-Benzenedimethanamine, reaction products with glycidyl tolyl ether | 1 | 90194-04-0 | 290-611-0 | 0,019 | ||||||
1,4-Benzenedisulfonic acid, 2,2'-[1,2-ethenediylbis[(3-sulfo-4,1-phenylene)imino[6-[3-substituted-heteroalkyl]-1,3,5-triazine-4,2-diyl]imino]]bis-, sodium salt | 1 | - | 59,22 | |||||||
Benzenepropanoic acid, 3,5-bis(1,1-dimethylethyl)-4-hydroxy-, 2-ethylhexyl ester | 1 | 144429-84-5 | 807-747-9 | 3 | ||||||
Benzenesulfonic acid and petroleum sulfonic acids, mono- and di-C10-40-(branched and linear)-alkyl derivatives, magnesium salts, overbased | 1 | - | 701-168-4 | 11,75 | ||||||
Benzenesulfonic acid, C14-24-branched and linear alkyl derivatives, barium salts, overbased | 1 | 120968-17-4 | 822-951-8 | 0,33 | ||||||
Benzenesulfonic acid, di-C10-14-alkyl derivs., calcium salts | 1 | - | 939-603-7 | 35,26 | ||||||
Benzenesulfonic acid, para-, monoalkylation products with C14-C18 branched olefins (C15 rich) derived from propene oligomerization, calcium salt, overbased including distillates (petroleum), hydrotreated, solvent-refined, solvent-dewaxed, or catalytic dew | 1 | - | 701-205-4 | 25,55 | ||||||
Benzenesulfonic acid | 1 | 98-11-3 | 202-638-7 | 53,6 | 24280 | |||||
Benzenesulfonic acid, 4-C10-13-sec-alkyl derivs., compds. with triethanolamine | 1 | - | 939-464-2 | 4,1 | ||||||
Benzenesulfonic acid, 4-C20-24 (even numbered) sec-alkyl derivs. | 1 | - | 701-015-1 | 11,28 | ||||||
Benzenesulfonic acid, 4-C15-16-sec-alkyl derivates | 1 | - | 941-154-7 | 12 | 12 | |||||
Benzenesulfonic acid, C10-60-alkyl derivates, barium salts | 1 | 93028-28-5 | 296-719-4 | 11,75 | ||||||
Benzenesulfonic acid, 4-C10-13-sec-alkyl derivs., compds. with 2-propanamine | 1 | 84961-74-0 | 284-664-9 | 3,33 | ||||||
Benzenesulfonic acid, C10-16-alkyl derivs., magnesium salts | 1 | 68584-26-9 | 271-533-6 | 11,75 | ||||||
Benzenesulfonic acid, C14-24-alkyl derivatives, magnesium salts, overbased | 1 | - | 947-251-0 | 0,33 | ||||||
Benzenesulfonic acid, 4-C10-13-sec-alkyl derivs., ammonium salts | 1 | 84989-13-9 | 284-902-1 | 7,55 | ||||||
Benzenesulfonic acid, 4-(branched alkyl derivs.) and benzenesulfonic acid, 4-(linear alkyl dervis.), calcium salts | 1 | - | 17,63 | |||||||
Benzenesulfonic acid, 4-C15-16-sec-alkyl derivs.-, compd. with 1-aminopropane-2-ol | 1 | - | 946-448-9 | 6 | ||||||
Benzenesulfonic acid, 4-C10-13-sec-alkyl derivs.-, compound with 1-Aminopropane-2-ol | 1 | - | 939-479-4 | 3,45 | ||||||
Benzenesulfonic acid, C10-24-branched and linear Alkyl derivs., Magnesium salts, overbased | 1 | - | 948-935-1 | 0,33 | ||||||
Benzenesulfonic acid, 4-C20-24 (even numbered) sec-alkyl derivs., sodium salts | 1 | - | 947-999-8 | 2,82 | ||||||
Benzenesulfonic acid, 4-C10-13-sec-alkyl derivs. | 1 | 85536-14-7 | 287-494-3 | 7,6 | ||||||
Benzenesulfonic acid, mono-C10-13-alkyl derivs., compds. with Ethanolamine | 1 | 85480-55-3 | 287-335-8 | 6,71 | ||||||
Benzenesulfonic acid, C10-13-alkyl derivs., sodium salts | 1 | 68411-30-3 | 270-115-0 | 7,6 | ||||||
Benzenesulfonic acid, C10-16-alkyl derivs. | 1 | 68584-22-5 | 271-528-9 | 0,66 | ||||||
Benzenesulfonic acid, C10-16-alkyl derivs., calcium salts | 1 | 68584-23-6 | 271-529-4 | 11,75 | ||||||
Benzenesulfonic acid, C10-60-alkyl derivs., calcium salts | 1 | 90194-27-7 | 290-636-7 | 0,66 | ||||||
Benzenesulfonic acid, C14-44-branched and linear alkyl derivs., calcium salts, overbased | 1 | 91696-74-1 | 294-233-7 | 0,33 | ||||||
Benzenesulfonic acid, C16-24-alkyl derivs. | 1 | 70024-67-8 | 274-262-1 | 0,332 | ||||||
Benzenesulfonic acid, mono-C16-24-alkyl derivs., calcium salts | 1 | 70024-69-0 | 274-263-7 | 11,75 | ||||||
Benzenesulfonic acid, di-C10-18-alkyl derivs., barium salts | 1 | 93820-55-4 | 298-635-3 | 11,75 | ||||||
Benzenesulfonic acid, di-C10-14-alkyl derivatives, sodium salts | 1 | - | 946-949-2 | 35,26 | ||||||
Benzenesulfonic acid, 2,2'-(1,2-ethenediyl)bis[5-nitro-, disodium salt, reaction products with 4-[(4-Aminophenyl)azo]benzenesulfonic acid, sodium salts | 1 | 1325-54-8 | 215-397-8 | 7,053 | 109493 | |||||
Benzenesulfonic acid, Methyl-, Mono-C20-24-(even numbered)-branched Alkyl derivs | 1 | - | 939-185-6 | 11,28 | ||||||
Benzenesulfonic acid, mono-C20-24 (even)-sec-alkyl derivatives, para-, sodium salts | 1 | - | 946-212-5 | 17,6 | ||||||
Benzenesulfonic acid, mono-C10-13-alkyl derivatives, compds. with diethanolamine | 1 | 90194-39-1 | 290-649-8 | 3,96 | ||||||
Benzenesulfonic acid, 4-mono-C20-24 (even numbered)-alkyl derivs., magnesium salts | 1 | 231297-75-9 | 800-309-8 | 17,63 | ||||||
Benzenesulfonic acid, mono-C11-13-branched alkyl derivs., calcium salts | 1 | 68953-96-8 | 273-234-6 | 6 | ||||||
Benzenesulfonic acid, mono-C11-13-branched alkyl derivs., sodium salts | 1 | 68608-89-9 | 271-808-0 | 12 | ||||||
Benzene-1,2:4,5-tetracarboxylic dianhydride | 1 | 89-32-7 | 201-898-9 | 70,4 | 33020 | |||||
1,2,4-Benzenetricarboxylic acid, mixed branched Tridecyl and Isodecyl esters | 1 | 70225-05-7 | 615-086-0 | 18 | ||||||
1,2,4-Benzenetricarboxylic acid, mixed Decyl and Octyl triesters | 1 | 90218-76-1 | 290-754-9 | 35,242 | ||||||
1,2,4-Benzenetricarboxylic acid, tri-C9-11-alkyl esters | 1 | 94279-36-4 | 304-780-6 | 3,53 | ||||||
Benzene-1,2,4-tricarboxylic acid 1,2-anhydride | 1 | 552-30-7 | 209-008-0 | 17,5 | TRGS900 | MAK | 41520 | |||
Benzene-1,2,4-tricarboxylic acid 1,2-anhydride, oligomeric reaction products with ethane-1,2-diol and glycerol | 1 | 68183-39-1 | 500-199-9 | 0,88 | ||||||
1-Benzhydrylpiperazine | 1 | 841-77-0 | 212-667-7 | 0,141 | ||||||
Benzidine-2,2'-disulfonic acid | 1 | 117-61-3 | 204-200-0 | 11,663 | 15380 | |||||
Benzimidazole | 1 | 51-17-2 | 200-081-4 | 19,7 | ||||||
Benzimidazole | 2 | 51-17-2 | 200-081-4 | 2,61 | ||||||
1,2-Benzisothiazol-3(2H)-one | 1 | 2634-33-5 | 220-120-9 | 6,81 | 35240 | |||||
1,2-Benzisothiazol-3(2H)-one 1,1-dioxide | 1 | 81-07-2 | 201-321-0 | 131,3 | 492442 | |||||
1,2-Benzisothiazol-3(2H)-one, 1,1-dioxide, sodium salt | 1 | 128-44-9 | 204-886-1 | 1,4 | 492890 | |||||
1,2-Benzisothiazol-3(2H)-one, 1,1-dioxide, sodium salt | 2 | 128-44-9 | 204-886-1 | 17,6 | 492890 | |||||
1,2-Benzisothiazol-3(2H)-one, 1,1-dioxide, sodium salt | 3 | 128-44-9 | 204-886-1 | 23802,63 | 492890 | |||||
Benzoic acid, 4-[ (1-oxodecyl) oxy]- | 1 | 86960-46-5 | 617-941-3 | 47 | ||||||
Benzoic acid | 1 | 65-85-0 | 200-618-2 | 0,1 | 3 | TRGS900 | MAK | 22810 | ||
Benzoic acid, C12-15-alkyl esters | 1 | 68411-27-8 | 270-112-4 | 22,86 | ||||||
Benzoic acid, 2-hydroxy-,C14-18 alkyl derivs. | 1 | - | 931-472-4 | 1,17 | ||||||
Benzoic acid, 2-hydroxy-, 5-C>13-alkyl derivs., sodium salts | 1 | 84539-60-6 | 283-049-2 | 1,17 | ||||||
Benzoic acid, 4-[[[4-[(1-oxo-2-propenyl)oxy]butoxy]carbonyl]oxy]-, 2-methyl-1,4-phenylene ester | 1 | 187585-64-4 | 428-570-1 | 10 | ||||||
Benzoic acid, C9-11 , C10-rich, branched alkyl esters | 1 | 131298-44-7 | 421-090-1 | 181 | ||||||
Benzoic acid, 2,3,4,5-tetrachloro-6-cyano-, methyl ester, reaction products with p-phenylenediamine and sodium methoxide | 1 | 106276-80-6 | 600-736-8 | 10 | ||||||
Benzoic acid, zinc salt | 1 | 553-72-0 | 209-047-3 | 5 | 37480 | |||||
Benzoic acid, zinc salt | 2 | 553-72-0 | 209-047-3 | 0,1 | 3 | 37480 | ||||
Benzoic acid, zinc salt | 3 | 553-72-0 | 209-047-3 | 22,73 | 37480 | |||||
Benzoin | 1 | 119-53-9 | 204-331-3 | 0,1 | 37800 | |||||
Benzo[rst]phenanthro[10,1,2-cde]pentaphene-9,18-dione, reaction products with 1-chlorododecane | 1 | 2180952-76-3 | 822-536-1 | 6,28 | ||||||
Benzophenone | 1 | 119-61-9 | 204-337-6 | 0,7 | 28340 | |||||
Benzophenone-3,3',4,4'-tetracarboxylic dianhydride | 1 | 2421-28-5 | 219-348-1 | 0,37 | 0,6 | 510063 | ||||
p-Benzoquinone dioxime | 1 | 105-11-3 | 203-271-5 | 0,044 | ||||||
Benzothiazole-2-thiol | 1 | 149-30-4 | 205-736-8 | 8,8 | TRGS900 | MAK | 14800 | |||
(Benzothiazol-2-ylthio)acetic acid | 1 | 6295-57-4 | 228-565-0 | 1 | 2,94 | |||||
Benzotriazol, ar-methyl-, reaction product with Formaldehyde and Diethanolamine | 1 | - | 939-703-0 | 1,3 | ||||||
Benzotriazole | 1 | 95-14-7 | 202-394-1 | 4,2 | 570075 | |||||
2-(2H-Benzotriazol-2-yl)-4,6-bis(1-methyl-1-phenylethyl)phenol | 1 | 70321-86-7 | 274-570-6 | 1,56 | 159275 | |||||
2-(2H-Benzotriazol-2-yl)-p-cresol | 1 | 2440-22-4 | 219-470-5 | 1 | 494235 | |||||
2-(2H-Benzotriazol-2-yl)-4,6-ditertpentylphenol | 1 | 25973-55-1 | 247-384-8 | 0,7 | 495416 | |||||
2-(2H-Benzotriazol-2-yl)-4-(1,1,3,3-tetramethylbutyl)phenol | 1 | 3147-75-9 | 221-573-5 | 0,7 | 494369 | |||||
2-Benzoylbenzoic acid | 1 | 85-52-9 | 201-612-2 | 16,4 | ||||||
Benzoyloxyethoxyethyl benzoate | 1 | 120-55-8 | 204-407-6 | 5,8 | 492833 | |||||
4-Benzoylphenyl 2-methylprop-2-enoate | 1 | 56467-43-7 | 611-390-2 | 17,5 | ||||||
1-[4-(4-Benzoylphenylsulfanyl)phenyl]-2-methyl-2-(4-methyl-phenylsulfonyl)propan-1-one | 1 | 272460-97-6 | 429-040-0 | 39,5 | 535713 | |||||
N-Benzyl-N-C16-18 (even numbered)-alkyl-N-methyl-C16-18 (even numbered)-alkyl-1-aminium chloride | 1 | 1228186-15-9 | 629-705-7 | 9,7 | ||||||
Benzyl acetate | 1 | 140-11-4 | 205-399-7 | 9 | 490171 | |||||
Benzylacetone | 1 | 2550-26-7 | 219-847-4 | 17,6 | 494264 | |||||
Benzyl alcohol | 1 | 100-51-6 | 202-859-9 | 22 | TRGS900 | MAK | 20370 | |||
Benzyl alcohol | 2 | 100-51-6 | 202-859-9 | 25,8 | TRGS900 | MAK | 20370 | |||
Benzyl-C12-14-alkyldimethylammonium chlorides | 1 | - | 939-350-2 | 3,96 | ||||||
Benzyl-C12-14-alkyldimethylammonium chlorides | 2 | - | 939-350-2 | 3,06 | ||||||
Benzylamine | 1 | 100-46-9 | 202-854-1 | 1 | 14,7 | 16550 | ||||
Benzyl benzoate | 1 | 120-51-4 | 204-402-9 | 5,1 | 32060 | |||||
Benzyl butyl phthalate | 1 | 85-68-7 | 201-622-7 | 4,36 | TRGS900 | MAK | 26960 | |||
Benzyl butyrate | 1 | 103-37-7 | 203-105-1 | 27,4 | ||||||
1-Benzyl-3-carboxylatopyridinium sodium chloride | 1 | 68133-60-8 | 268-692-9 | 172,85 | 154077 | |||||
Benzyl cinnamate | 1 | 103-41-3 | 203-109-3 | 7,05 | 492647 | |||||
Benzyldimethylamine | 1 | 103-83-3 | 203-149-1 | 4,9 | 16560 | |||||
2-Benzyl-2-dimethylamino-4-morpholinobutyrophenone | 1 | 119313-12-1 | 404-360-3 | 2,3 | 530803 | |||||
2-Benzyl-2-dimethylamino-4-morpholinobutyrophenone | 2 | 119313-12-1 | 404-360-3 | 1,175 | 530803 | |||||
2-Benzyl-2-dimethylamino-4-morpholinobutyrophenone | 3 | 119313-12-1 | 404-360-3 | 1 | 0,17 | 530803 | ||||
2-Benzyl-2-dimethylamino-4-morpholinobutyrophenone | 4 | 119313-12-1 | 404-360-3 | 0,82 | 530803 | |||||
Benzyl 4-hydroxybenzoate | 1 | 94-18-8 | 202-311-9 | 0,33 | ||||||
Benzyl 3-(isobutyryloxy)-1-isopropyl-2,2-dimethylpropyl phthalate | 1 | - | 701-008-3 | 9,32 | ||||||
Benzyl methacrylate | 1 | 2495-37-6 | 219-674-4 | 24,2 | 112803 | |||||
4-[2-[4-[Benzylmethyl(ethyl)amino]phenyl]vinyl]-1-(2-hydroxyethyl)pyridinium acetate | 1 | 83950-14-5 | 281-468-5 | 5,9 | ||||||
(E)-3-(Benzyl(4-((4-nitrophenyl)diazenyl)phenyl)amino)propanenitrile | 1 | - | 429-530-4 | 3,65 | ||||||
Benzyl (S)-N-(1-oxopentyl)-N-((2'-(1H-tetrazole-5-yl)-1,1'-biphenyl-4-yl)methyl)-L-valinate | 1 | 137863-20-8 | 604-047-3 | 0,352 | ||||||
Benzyl propionate | 1 | 122-63-4 | 204-559-3 | 12,3 | 102076 | |||||
Benzyl propionate | 2 | 122-63-4 | 204-559-3 | 23,705 | 102076 | |||||
Benzyl salicylate | 1 | 118-58-1 | 204-262-9 | 7,8 | 491274 | |||||
Benzyltoluene | 1 | 27776-01-8 | 248-654-8 | 4,93 | 40810 | |||||
Benzyltoluene | 2 | 27776-01-8 | 248-654-8 | 0,3 | 40810 | |||||
Benzyltriethylammonium chloride | 1 | 56-37-1 | 200-270-1 | 4,88 | 30510 | |||||
Benzyltrimethylammonium chloride | 1 | 56-93-9 | 200-300-3 | 0,88 | 30470 | |||||
Benzyltriphenylphosphonium, salt with 4,4'-[2,2,2-trifluoro-1-(trifluoromethyl)ethylidene]bis[phenol] (1:1) | 1 | 75768-65-9 | 278-305-5 | 0,72 | ||||||
Bergamot, ext. | 1 | 89957-91-5 | 289-612-9 | 6,88 | ||||||
Betaine hydrochloride | 1 | 590-46-5 | 209-683-1 | 177 | ||||||
Betaines, C12-14 (even numbered)-alkyldimethyl | 1 | - | 931-700-2 | 0,822 | ||||||
Betaines, C12-16 (even numbered) -alkyldimethyl | 1 | - | 947-036-1 | 34,5 | ||||||
Bicyclo[2.2.1]heptanebis(methylamine) | 1 | 56602-77-8 | 260-280-7 | 0,4 | ||||||
Binary salt | 1 | - | 914-103-1 | 2,68 | ||||||
Biomass residue ex B2 | 1 | - | 920-031-1 | 12,2 | ||||||
Biozan | 1 | - | 476-190-8 | 49 | ||||||
Biphenyl | 1 | 92-52-4 | 202-163-5 | 11,17 | 13450 | |||||
Biphenyl-2-ol | 1 | 90-43-7 | 201-993-5 | 19,25 | TRGS900 | MAK | 20480 | |||
Biphenyl-2-ol, ethoxylated, esters with acrylic acid | 1 | 72009-86-0 | 500-247-9 | 110 | 12 | |||||
Biphenyl-2-ylamine | 1 | 90-41-5 | 201-990-9 | 6,297 | 492500 | |||||
Bis(acetato-O)hydroxyaluminium | 1 | 142-03-0 | 205-518-2 | 17,8 | 102639 | |||||
Bis[C5-(branched)-alkyl] benzene-1,4-dicarboxylate | 1 | 2097734-13-7 | 940-272-6 | 15,7 | ||||||
Bis(C12-C13)alkyl-2-hydroxybutandioate | 1 | 149144-85-4 | 413-390-6 | 24 | ||||||
Bis(branched-alkyl) 2-{[(1-phenylethyl)amino]methyl}alkanedioate | 1 | - | 6,58 | |||||||
2,2-Bis(allyloxymethyl)butan-1-ol | 1 | 682-09-7 | 211-661-1 | 7 | 32120 | |||||
1,3-Bis(aminomethyl)cyclohexane | 1 | 2579-20-6 | 219-941-5 | 0,00947 | 113008 | |||||
N,N'-Bis(3-aminopropyl)ethylenediamine | 1 | 10563-26-5 | 234-147-9 | 1,234 | 40900 | |||||
N,N'-Bis(3-aminopropyl)methylamine | 1 | 105-83-9 | 203-336-8 | 9,8 | 14660 | |||||
3,6-Bis(biphenyl-4-yl)-2,5-dihydropyrrolo[3,4-c]pyrrole-1,4-dione | 1 | - | 413-920-6 | 3 | 5,8 | 901177 | ||||
3,6-Bis(biphenyl-4-yl)-2,5-dihydropyrrolo[3,4-c]pyrrole-1,4-dione | 2 | - | 413-920-6 | 11,75 | 901177 | |||||
3,6-Bis(biphenyl-4-yl)-2,5-dihydropyrrolo[3,4-c]pyrrole-1,4-dione | 3 | - | 413-920-6 | 3 | 98 | 901177 | ||||
Bis(4-(1,2-bis(ethoxycarbonyl)ethylamino)-3-methyl-cyclohexyl)methane | 1 | 136210-32-7 | 412-060-9 | 84 | 900910 | |||||
1,5-Bis[1,2-bis(ethoxycarbonyl)ethylamino]-2-methylpentane | 1 | - | 433-260-2 | 50 | ||||||
Bis[O,O-bis(2-ethylhexyl) dithiophosphorato-S,S']dioxodi-μ-thioxodimolybdenum | 1 | 68958-92-9 | 273-381-6 | 5,8 | ||||||
4,4'-Bis[4-[bis(2-hydroxyethyl)amino]-6-anilino-1,3,5-triazin-2-yl]amino]stilbene-2,2'-disulphonic acid | 1 | 4404-43-7 | 224-548-7 | 65 | 491419 | |||||
2,6-Bis({[bis(2-hydroxyethyl)amino]methyl})-4-[2-(3-{[bis(2-hydroxyethyl)amino]methyl}-4-hydroxyphenyl)propan-2-yl]phenol; 2,6-Bis({[bis(2-hydroxyethyl)amino]methyl})-4-[2-(4-hydroxyphenyl)propan-2-yl]phenol; 2-[(2-Hydroxyethyl)amino]ethan-1-ol; 2-{[Bis(2-hydroxyethyl)amino]methyl}-4-[2-(3-{[bis(2-hydroxyethyl)amino]methyl}-4-hydroxyphenyl)propan-2-yl]phenol; 2-{[Bis(2-hydroxyethyl)amino]methyl}-4-[2-(4-hydroxyphenyl)propan-2-yl]phenol; 4-[2-(4-Hydroxyphenyl)propan-2-yl]phenol | 1 | - | 943-503-9 | 1 | ||||||
2,6-Bis[[bis(2-hydroxyethyl)amino]methyl]-4-nonylphenol | 1 | 20073-51-2 | 243-500-6 | 4,11 | ||||||
3,9-Bis[2,4-bis(1-methyl-1-phenylethyl)phenoxy]-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane | 1 | 154862-43-8 | 421-920-2 | 3,29 | 535983 | |||||
3,9-Bis[2,4-bis(1-methyl-1-phenylethyl)phenoxy]-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane | 2 | 154862-43-8 | 421-920-2 | 25,6 | 535983 | |||||
Bis[bis(3,5,5-trimethylhexyl)dithiocarbamate-S,S']zinc | 1 | 84604-96-6 | 283-381-8 | 0,21 | ||||||
Bis[bis(3,5,5-trimethylhexyl)dithiocarbamate-S,S']zinc | 2 | 84604-96-6 | 283-381-8 | 0,0987 | ||||||
2,2-Bis(bromomethyl)propane-1,3-diol | 1 | 3296-90-0 | 221-967-7 | 0,82 | ||||||
Bis[2-[2-(2-butoxyethoxy)ethoxy]ethyl] adipate | 1 | 65520-46-9 | 265-807-4 | 9,33 | 151526 | |||||
Bis[2-[2-(2-butoxyethoxy)ethoxy]ethyl] hydrogen glutarate | 1 | 65520-42-5 | 265-805-3 | 9,33 | ||||||
Bis(2-(2-butoxyethoxy)ethoxy)methane | 1 | 143-29-3 | 205-598-9 | 23,5 | 102677 | |||||
Bis(2-(2-butoxyethoxy)ethyl) adipate | 1 | 141-17-3 | 205-465-5 | 4,937 | 102612 | |||||
Bis(2-butoxyethyl)adipate | 1 | 141-18-4 | 205-466-0 | 2,82 | 102613 | |||||
alpha,alpha'-Bis(tert-butylperoxy)-1,4-diisopropylbenzene | 1 | 2781-00-2 | 220-479-1 | 3,5 | 113430 | |||||
1,3-Bis(tert-butylperoxyisopropyl)benzene | 1 | 2212-81-9 | 218-664-7 | 10 | 14 | 494181 | ||||
N,N-Bis(carboxymethyl)-L-glutamic acid | 1 | 58976-65-1 | 261-530-8 | 7,3 | ||||||
Bis(2-chloroethoxy)methane | 1 | 111-91-1 | 203-920-2 | 1,76 | 101784 | |||||
Bis(2-chloroethoxy)methane 1,15-dichloro-3,5,8,11,13-penta-oxa pentadecane 1-(2-chloroethoxy)-2-(2-chloroethoxymethoxy)ethane | 1 | - | 940-783-4 | 1,76 | ||||||
2,2-Bis(chloromethyl)propane-1,3-diyl tetrakis(1-chloropropan-2-yl) bis(phosphate) | 1 | 1047637-37-5 | 809-920-4 | 0,15 | 0,4 | |||||
2,2-Bis(chloromethyl)trimethylene bis(bis(2-chloroethyl)phosphate) | 1 | 38051-10-4 | 253-760-2 | 0,15 | 0,4 | 140929 | ||||
2,2-Bis(chloromethyl)trimethylene bis(bis(2-chloroethyl)phosphate) | 2 | 38051-10-4 | 253-760-2 | 0,4 | 140929 | |||||
Bis(4-chlorophenyl) sulphone | 1 | 80-07-9 | 201-247-9 | 0,8 | 492426 | |||||
3,6-Bis(4-chlorophenyl)-1H,2H,4H,5H-pyrrolo[3,4-c]pyrrole-1,4-dione | 1 | - | 401-540-3 | 9,8 | ||||||
3,6-Bis(4-chlorophenyl)-1H,2H,4H,5H-pyrrolo[3,4-c]pyrrole-1,4-dione | 2 | - | 401-540-3 | 16,4 | ||||||
3,6-Bis(4-chlorophenyl)-1H,2H,4H,5H-pyrrolo[3,4-c]pyrrole-1,4-dione | 3 | - | 401-540-3 | 11,75 | ||||||
3,6-Bis(4-chlorophenyl)-1H,2H,4H,5H-pyrrolo[3,4-c]pyrrole-1,4-dione | 4 | - | 401-540-3 | 3 | 97,95 | |||||
3,6-Bis(4-chlorophenyl)-1H,2H,4H,5H-pyrrolo[3,4-c]pyrrole-1,4-dione | 5 | - | 401-540-3 | 49 | ||||||
Bisdecanoyl peroxide | 1 | 762-12-9 | 212-092-1 | 49,4 | 493688 | |||||
Bis(decyl and/or dodecyl) benzene-1,2-dicarboxylate | 1 | - | 931-251-2 | 5,61 | ||||||
1,6-Bis((dibenzylthiocarbamoyl)disulfanyl)hexane | 1 | 151900-44-6 | 429-280-6 | 23,5 | 535725 | |||||
Bis(dibutyldithiocarbamato-S,S')copper | 1 | 13927-71-4 | 237-695-7 | 16,45 | 127370 | |||||
2',3-Bis[[3-[3,5-di-tert-butyl-4-hydroxyphenyl]propionyl]]propionohydrazide | 1 | 32687-78-8 | 251-156-3 | 3 | 495568 | |||||
3,9-Bis(2,6-di-tert-butyl-4-methylphenoxy)-2,4,8,10-tetraoxa-3,9-diphosphaspiro(5.5)undecane | 1 | 80693-00-1 | 410-290-4 | 62,4 | 62,4 | 530985 | ||||
Bis(2,4-di-tert-butyl-6-methylphenyl)ethyl phosphate | 1 | 145650-60-8 | 416-140-4 | 3 | ||||||
3,9-Bis(2,4-di-tert-butylphenoxy)-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane | 1 | 26741-53-7 | 247-952-5 | 2,75 | ||||||
Bis(3,5-di-tert-butylsalicylato-O1,O2)zinc | 4 | 42405-40-3 | 403-360-0 | 0,94 | 530594 | |||||
Bis(2,4-dichlorobenzoyl) peroxide | 1 | 133-14-2 | 205-094-9 | 3,53 | 102388 | |||||
3',6'-Bis(diethylamino)spiro[isobenzofuran-1(3H),9'-[9H]xanthene]-3-one | 1 | 509-34-2 | 208-096-8 | 12,2 | ||||||
3,6-Bis(diethylamino)-9-[2-(methoxycarbonyl)phenyl]xanthylium tetrachlorozincate | 1 | 73398-89-7 | 277-459-0 | 1,11 | ||||||
Bis[[4-[[4-(diethylamino)phenyl][4-(ethylamino)-1-naphthyl]methylene]cyclohexa-2,5-dien-1-ylidene]diethylammonium] dicopper(1+) hexa(cyano-C)ferrate(4-) | 1 | 82338-76-9 | 279-935-3 | 10,1 | ||||||
7-[(4,6-Bis{[3-(diethylammonio)propyl]amino}-1,3,5-triazin-2-yl)amino]-4-hydroxy-3-[(E)-(2-oxo-2,3-dihydro-1H-benzimidazol-5-yl)diazenyl]naphthalene-2-sulfonate 2-hydroxypropanoate | 1 | 790240-84-5 | 455-600-9 | 29,4 | ||||||
1,4-Bis[(2,6-diethyl-4-methylphenyl)amino]anthraquinone | 1 | 32724-62-2 | 251-178-3 | 97,9 | 138693 | |||||
Bis(2,6-diisopropylphenyl)carbodiimide | 1 | 2162-74-5 | 218-487-5 | 0,024 | 491373 | |||||
[4-[p,p'-Bis(dimethylamino)benzhydrylidene]cyclohexa-2,5-dien-1-ylidene]dimethylammonium m-[[p-anilinophenyl]azo]benzenesufonate | 1 | 65113-55-5 | 265-449-9 | 1,84 | 151206 | |||||
Bis(2-dimethylaminoethyl)(methyl)amine | 1 | 3030-47-5 | 221-201-1 | 1,058 | 16610 | |||||
4,4'-Bis(dimethylamino)-4''-(methylamino)trityl alcohol | 1 | 561-41-1 | 209-218-2 | 0,411 | 105241 | |||||
4,4'-Bis(dimethylamino)-4''-(methylamino)trityl alcohol | 2 | 561-41-1 | 209-218-2 | 0,172 | 105241 | |||||
[4-[Bis[4-(dimethylamino)phenyl]methylene]-2,5-cyclohexadien-1-ylidene]dimethylammonium acetate | 1 | 67939-65-5 | 267-847-8 | 14,6 | ||||||
bis and tris and tetra (4-{Bis[4-(dimethylamino)phenyl]methylene}-N,N-dimethylcyclohexa-2,5-dien-1-iminium) [12,21-dihydro-29H,31H-phthalocyanine-bis and tris and tetrasulfonato-k4N29,N30,N31,N32]cuprate | 1 | - | 700-615-0 | 2,44 | ||||||
alpha,alpha-Bis[4-(dimethylamino)phenyl]-4-(phenylamino)naphthalene-1-methanol | 1 | 6786-83-0 | 229-851-8 | 0,844 | 121102 | |||||
1-[Bis[3-(dimethylamino)propyl]amino]propan-2-ol | 1 | 67151-63-7 | 266-587-2 | 0,353 | 152215 | |||||
1,1'-[(3-{Bis[3-(dimethylamino)propyl]amino}propyl)imino]dipropan-2-ol | 1 | 2044770-20-7 | 816-324-8 | 0,987 | ||||||
1,3-Bis[3-(dimethylamino)propyl]urea | 1 | 52338-87-1 | 257-861-2 | 5,8 | ||||||
Bis(alpha,alpha-dimethylbenzyl) peroxide | 1 | 80-43-3 | 201-279-3 | 5,6 | 33620 | |||||
N,N'-Bis(5,5-dimethyl-1,3,2-dioxaphosphinane-2-oxide-2-yl)ethane-1,2-diamine | 1 | 256374-76-2 | 835-272-7 | 16,4 | ||||||
Bis(4-(1,1-dimethylethyl)cyclohexyl) ester peroxydicarbonic acid | 1 | 15520-11-3 | 239-557-1 | 5,87 | 495107 | |||||
2,6-Bis(1,1-dimethylethyl)-4-(phenylenemethylene)cyclohexa-2,5-dien-1-one | 1 | 7078-98-0 | 429-460-4 | 1,75 | 535717 | |||||
3,9-Bis(1,1-dimethyl-2-hydroxy ethyl-2,4,8,10-tetraoxa spiro [5,5] undecane | 1 | 1455-42-1 | 485-230-3 | 11,76 | ||||||
1,6-Bis-[(2,2-dimethyl-3-lauroyloxy-propylidene)-amino]hexane | 1 | 613222-52-9 | 479-930-8 | 2,7 | 14,8 | |||||
1,6-Bis[2,2-dimethyl-3-(N-morpholino)-propylideneamino]-hexane | 1 | 1217271-49-2 | 700-570-7 | 24,7 | ||||||
N,N'-Bis(1,4-dimethylpentyl)-p-phenylenediamine | 1 | 3081-14-9 | 221-375-9 | 1,87 | 21780 | |||||
2,9-Bis(3,5-dimethylphenyl)anthra[2,1,9-def:6,5,10-d'e'f']diisoquinoline-1,3,8,10(2H,9H)-tetrone | 1 | 4948-15-6 | 225-590-9 | 1,25 | 1,25 | 491424 | ||||
(1R)-1-((4R,4aR,8aS)-2,6-Bis(3,4-dimethylphenyl)tetrahydro-[1,3]dioxino[5,4-d][1,3]dioxino-4-yl) ethane-1,2-diol | 1 | 135861-56-2 | 413-110-2 | 11,75 | ||||||
(1R)-1-((4R,4aR,8aS)-2,6-Bis(3,4-dimethylphenyl)tetrahydro-[1,3]dioxino[5,4-d][1,3]dioxino-4-yl) ethane-1,2-diol | 2 | 135861-56-2 | 413-110-2 | 14,33 | 14,33 | |||||
(1R)-1-((4R,4aR,8aS)-2,6-Bis(3,4-dimethylphenyl)tetrahydro-[1,3]dioxino[5,4-d][1,3]dioxino-4-yl) ethane-1,2-diol | 3 | 135861-56-2 | 413-110-2 | 28 | ||||||
(1R)-1-((4R,4aR,8aS)-2,6-Bis(3,4-dimethylphenyl)tetrahydro-[1,3]dioxino[5,4-d][1,3]dioxino-4-yl) ethane-1,2-diol | 4 | 135861-56-2 | 413-110-2 | 113,79 | ||||||
(1R)-1-((4R,4aR,8aS)-2,6-Bis(3,4-dimethylphenyl)tetrahydro-[1,3]dioxino[5,4-d][1,3]dioxino-4-yl) ethane-1,2-diol | 5 | 135861-56-2 | 413-110-2 | 14,3 | ||||||
Bis(dodecylthio)dioctylstannane | 1 | 22205-30-7 | 244-841-3 | 0,02 | ||||||
2,4-Bis(dodecylthiomethyl)-6-methyl-phenol | 1 | 110675-26-8 | 438-600-3 | 1,8 | ||||||
2,2-Bis[[3-(dodecylthio)-1-oxopropoxy]methyl]propane-1,3-diyl bis[3-(dodecylthio)propionate] | 1 | 29598-76-3 | 249-720-9 | 1,97 | ||||||
Bis[(3,4-epoxycyclohexyl)methyl] adipate | 1 | 3130-19-6 | 221-518-5 | 0,09 | ||||||
m-Bis(2,3-epoxypropoxy)benzene | 1 | 101-90-6 | 202-987-5 | 0,395 | Carcinogenic | 510067 | ||||
1,6-Bis(2,3-epoxypropoxy)hexane | 1 | 933999-84-9 | 618-939-5 | 0,44 | 10,57 | |||||
1,4-Bis[(2,3-epoxypropoxy)methyl]cyclohexane | 1 | 14228-73-0 | 238-098-4 | 3,52 | ||||||
Bis(4-(2,3-epoxypropoxy)phenyl)propane | 1 | 1675-54-3 | 216-823-5 | 4,93 | 16470 | |||||
N,N-Bis(2,3-epoxypropyl)aniline | 1 | 2095-06-9 | 218-259-5 | 1,17 | 16450 | |||||
Bis(2,3-epoxypropyl) cyclohex-4-ene-1,2-dicarboxylate | 1 | 21544-03-6 | 244-435-6 | 12,3 | ||||||
Bis(2,3-epoxypropyl) phthalate | 1 | 7195-45-1 | 230-566-6 | 0,59 | ||||||
Bis(2,3-epoxypropyl) terephthalate | 1 | 7195-44-0 | 230-565-0 | 14 | 121701 | |||||
Bis(ethyl acetoacetato-O1',O3)bis(2-methylpropan-1-olato)titanium | 1 | 83877-91-2 | 281-161-6 | 254 | 165160 | |||||
Bis(ethyl acetoacetato-O1',O3)bis(propan-2-olato)titanium | 1 | 27858-32-8 | 248-697-2 | 500 | 136585 | |||||
3,6-Bis(ethylamino)-9-[2-(methoxycarbonyl)phenyl]-2,7-dimethylxanthylium chloride | 1 | 3068-39-1 | 221-326-1 | 0,06 | ||||||
Bis(2-ethylhexan-1-olato)bis(pentane-2,4-dionato-O,O')titanium | 1 | 94233-27-9 | 304-059-6 | 54 | ||||||
Bis(2-ethylhexyl) 4,4’-{6-[4-tert-butylcarbamoyl)anilino]-1,3,5-triazine-2,4-diyldiimino}dibenzoate | 1 | 154702-15-5 | 421-450-8 | 7,347 | 7,347 | |||||
Bis(2-ethylhexyl) 4,4’-{6-[4-tert-butylcarbamoyl)anilino]-1,3,5-triazine-2,4-diyldiimino}dibenzoate | 2 | 154702-15-5 | 421-450-8 | 10,858 | ||||||
Bis(2-ethylhexyl) carbonate | 1 | 14858-73-2 | 238-925-9 | 80 | 128378 | |||||
Bis(2-ethylhexyl) cyclohexane-1,4-dicarboxylate | 1 | 84731-70-4 | 283-829-2 | 49,3 | 167522 | |||||
1,3-Bis(2-ethylhexyl)2-[(4-hydroxy-3,5-dimethoxyphenyl)methyliden]propanedioat | 1 | - | 468-890-7 | 3,29 | ||||||
Bis(2-ethylhexyl) maleate | 1 | 142-16-5 | 205-524-5 | 7 | 491299 | |||||
N,N-Bis(2-ethylhexyl)-5-methyl-1H-benzotriazole-1-methylamine, N,N-Bis(2-ethylhexyl)-4-methyl-1H-benzotriazole-1-methylamine, 2H-Benzotriazole-2-methanamine, N,N-Bis(2-ethylhexyl)-4-methyl-, 2H-Benzotriazole-2-methanamine, N,N-Bis(2-ethylhexyl)-5-methyl-, | 1 | - | 939-700-4 | 1,3 | ||||||
Bis(2-ethylhexyl) phosphorodithioate zinc salt | 1 | 4259-15-8 | 224-235-5 | 6,6 | 116443 | |||||
Bis(2-ethylhexyl) succinate | 1 | 2915-57-3 | 220-836-1 | 1 | 113699 | |||||
Bis(2-ethylhexyl)terephthalate | 1 | 6422-86-2 | 229-176-9 | 23,2 | 494750 | |||||
Bis(O,O-2-ethylhexyl-thiophosphoryl)polysulfide | 1 | 174125-93-0 | 605-708-9 | 41,1 | ||||||
N,N-Bis(2-ethylhexyl)-((1,2,4-triazol-1-yl)methyl)amine | 1 | 91273-04-0 | 401-280-0 | 1,76 | 496644 | |||||
1,4-Bis[(2-ethyl-6-methylphenyl)amino]anthraquinone | 1 | 41611-76-1 | 255-460-7 | 97,9 | 142427 | |||||
Bis[(2-ethyl-1-oxohexyl)oxy]dioctylstannane | 1 | 24577-34-2 | 246-325-3 | 0,002 | ||||||
2,6-Bis(4-ethylphenyl)perhydro-1,3,5,7-tetraoxanaphth-4-ylethane-1,2-diol | 1 | 79072-96-1 | 406-176-9 | 145,9 | ||||||
N,N'-Bis(6-fluoro-4-(3-(1-ethyl-6-hydroxy-3,4-dimethyl-heteromonocyl-5-ylazo)-phenylamino)- 1,3,5-triazine-2-yl)-phenylenediamine, polysulfonate sodium salt | 1 | - | 421-910-8 | 1,18 | ||||||
Bis(hydrogenated tallow C16-18-alkyl)hydroxylamine | 1 | 143925-92-2 | 418-370-0 | 1,76 | 536192 | |||||
1,4-Bis({3-[2-(2-hydroxyethoxy)ethoxy]propyl}amino)-9,10-dihydroanthracene-9,10-dione | 1 | 123944-63-8 | 807-560-2 | 0,97 | ||||||
N,N-Bis(2-hydroxyethyl)-C12-18(even numbered, C18 unsaturated) alkyl-1-amine oxides | 1 | - | 942-293-6 | 1 | 1 | |||||
2-[Bis(2-hydroxyethyl)amino]-2-(hydroxymethyl)propane-1,3-diol | 1 | 6976-37-0 | 230-237-7 | 4,93 | ||||||
1-(N,N-Bis(2-hydroxyethyl)amino)propan-2-ol | 1 | 6712-98-7 | 229-764-5 | 1,18 | 121026 | |||||
1,3-Bis(2-hydroxyethyl)-5,5-dimethylimidazolidine-2,4-dione | 1 | 26850-24-8 | 248-052-5 | 35,24 | ||||||
N,N-Bis(2-hydroxyethyl)dodecanamide | 1 | 120-40-1 | 204-393-1 | 73,4 | 492829 | |||||
Bis(2-hydroxyethyl)ether | 1 | 111-46-6 | 203-872-2 | 60 | 44 | TRGS900 | MAK | 11970 | ||
Bis(hydroxyethyl)methyloleylammonium chloride | 1 | 18448-65-2 | 242-332-0 | 0,88 | ||||||
Bis(2-hydroxyethyl) sulphone | 1 | 2580-77-0 | 219-948-3 | 11,75 | ||||||
Bis(hydroxylammonium) sulfate | 1 | 10039-54-0 | 233-118-8 | 0,008 | 3020 | |||||
1,3-Bis(hydroxymethyl)-5,5-dimethyl-2,4-imidazolidinedione | 1 | 6440-58-0 | 229-222-8 | 70,6 | 120562 | |||||
1-[1,3-Bis(hydroxymethyl)-2,5-dioxoimidazolidin-4-yl]-1,3-bis(hydroxymethyl)urea | 1 | 78491-02-8 | 278-928-2 | 20,5 | 163165 | |||||
2,2-Bis(hydroxymethyl)propionic acid | 1 | 4767-03-7 | 225-306-3 | 14 | 117316 | |||||
1,3-Bis(12-hydroxy-octadecamide-N-methylene)-benzene | 1 | 911674-82-3 | 423-300-7 | 4,41 | 536262 | |||||
3,3-Bis(4-hydroxyphenyl)-2-phenylisoindolin-1-one | 1 | 6607-41-6 | 455-890-7 | 21,16 | ||||||
N,N-Bis(2-hydroxypropyl)benzamide | 1 | - | 436-010-0 | 4,7 | ||||||
Bisisobutyryl peroxide | 1 | 3437-84-1 | 222-340-0 | 10,58 | ||||||
1,3-Bis(isocyanatomethyl)benzene | 1 | 3634-83-1 | 222-852-4 | 0,04 | 2,45 | 115330 | ||||
2,5-Bis-isocyanatomethylbicyclo(2.2.1)heptane | 1 | 74091-64-8 | 411-280-2 | 0,04 | 0,1 | TRGS900 | 901093 | |||
Bis(isopropyl)naphthalene, mixture of isomers | 1 | 38640-62-9 | 254-052-6 | 8,4 | 141187 | |||||
Bis(isopropyl) thioperoxydicarbonate | 1 | 105-65-7 | 203-319-5 | 3,45 | ||||||
2,2-Bis[[(mercaptoacetyl)oxy]methyl]-1,3-propanediyl bis(mercaptoacetate) | 1 | 10193-99-4 | 233-482-8 | 0,49 | ||||||
2,3-Bis(2-mercaptoethylsulfanyl)propan-1-thiole | 1 | 131538-00-6 | 411-290-7 | 0,235 | 901094 | |||||
2,3-Bis(2-mercaptoethylsulfanyl)propan-1-thiole | 2 | 131538-00-6 | 411-290-7 | 0,58 | 901094 | |||||
1,6-Bis(methoxybenzoyloxy)hexane | 1 | - | 433-470-4 | 3,52 | ||||||
2,9-Bis(p-methoxybenzyl)anthra[2,1,9-def:6,5,10-d'e'f']diisoquinoline-1,3,8,10(2H,9H)-tetrone | 1 | 83524-75-8 | 280-472-4 | 1,25 | 1,25 | 164553 | ||||
1,2-Bis-[4-{3-(4-methoxy-phenylazo)-4-hydroxy-naphthtalenyl-amino}-6-fluoro-[1,3,5]triazine-2-ylamino]-alkane, polysulfo-, Na-salt | 1 | - | 415-760-2 | 4,7 | ||||||
Bis(4-methylbenzoyl)peroxide | 1 | 895-85-2 | 407-950-9 | 23,49 | 530596 | |||||
Bis(4-methylbenzyl) oxalate | 1 | - | 406-470-7 | 1,75 | ||||||
Bis(methylcyclohexyl) phthalate | 1 | 27987-25-3 | 248-765-1 | 1,6 | ||||||
1,3-Bis((3-methyl-2,5-dioxo-pyrrol-1-yl)methyl)benzene | 1 | 119462-56-5 | 412-570-1 | 2,9 | 901077 | |||||
1,3-Bis((3-methyl-2,5-dioxo-pyrrol-1-yl)methyl)benzene | 2 | 119462-56-5 | 412-570-1 | 2 | 901077 | |||||
Bis(1-methylethyl)-dimethoxysilane | 1 | 18230-61-0 | 421-540-7 | 1,76 | 901984 | |||||
Bis[2-[2-(1-methylethyl)-3-oxazolidinyl]ethyl] hexan-1,2-diylbiscarbamate | 1 | 59719-67-4 | 261-879-6 | 80,4 | 14,8 | |||||
1,2-Bis(7-methyloctyl) (1R,2S)-cyclohexane-1,2-dicarboxylate | 1 | 166412-78-8 | 431-890-2 | 235 | ||||||
O,O-Bis(methylphenyl) hydrogen dithiophosphate | 1 | 27157-94-4 | 248-273-7 | 0,54 | ||||||
2,2-Bis(methylthio)propane | 1 | 6156-18-9 | 478-900-1 | 2,96 | ||||||
Bismuth, Powder | 1 | 7440-69-9 | 231-177-4 | 13,1 | 8520 | |||||
Bismuth vanadate | 1 | 14059-33-7 | 237-898-0 | 0,02 | TRGS900 | 127531 | ||||
Bismuth citrate | 1 | 813-93-4 | 212-390-1 | 3,8 | 107286 | |||||
Bismuth hydroxide nitrate oxide | 1 | 1304-85-4 | 215-136-8 | 2,7 | 109350 | |||||
Bismuth(III) oxide | 1 | 1304-76-3 | 215-134-7 | 70,5 | 2020 | |||||
Bismuth oxide salicylate | 1 | 14882-18-9 | 238-953-1 | 3,8 | 128400 | |||||
Bismuth(III) sulfide | 1 | 1345-07-9 | 215-716-0 | 48,2 | 4580 | |||||
Bismuth trihydroxide | 1 | 10361-43-0 | 233-790-2 | 2,7 | 124111 | |||||
Bismuth trinitrate | 1 | 10361-44-1 | 233-791-8 | 23,5 | 124112 | |||||
Bismuth trinitrate | 2 | 10361-44-1 | 233-791-8 | 21,1 | 124112 | |||||
Bismuth tris(2-ethylhexanoate) | 1 | 67874-71-9 | 267-499-7 | 0,85 | ||||||
Bis(neodecanoyloxy)dioctylstannane | 1 | 68299-15-0 | 269-595-4 | 0,0617 | ||||||
Bis[[2,2',2''-nitrilotris[ethanolato]](1-)-N,O]bis(propan-2-olato)titanium | 1 | 36673-16-2 | 253-153-2 | 500 | ||||||
4,6-Bis(octylthiomethyl)-o-cresol | 1 | 110553-27-0 | 402-860-6 | 1 | 900267 | |||||
4,6-Bis(octylthiomethyl)-o-cresol | 2 | 110553-27-0 | 402-860-6 | 8,75 | 900267 | |||||
4,6-Bis(octylthiomethyl)-o-cresol | 3 | 110553-27-0 | 402-860-6 | 24 | 900267 | |||||
Bis(5-oxo-L-prolinato-N1,O2)zinc | 1 | 15454-75-8 | 239-473-5 | 0,48 | ||||||
Bis(1,2,2,6,6-pentamethyl-4-piperidyl) [[3,5-bis(1,1-dimethylethyl)-4-hydroxyphenyl]methyl]butylmalonate | 1 | 63843-89-0 | 264-513-3 | 0,05 | 495930 | |||||
Bis(pentane-2,4-dionato-O,O')bis(propan-2-olato)titanium | 1 | 17927-72-9 | 241-866-1 | 17,75 | 130853 | |||||
Bis(pentane-2,4-dionato-O,O')magnesium | 1 | 14024-56-7 | 237-857-7 | 10 | ||||||
Bis(pentane-2,4-dionato-O,O')zinc | 1 | 14024-63-6 | 237-860-3 | 10,955 | ||||||
Bisphenol TMC | 1 | - | 404-140-7 | 1,728 | ||||||
2,9-Bis[4-(phenylazo)phenyl]anthra[2,1,9-def:6,5,10-d'e'f']diisoquinoline-1,3,8,10(2H,9H)-tetrone | 1 | 3049-71-6 | 221-264-5 | 1,25 | 1,25 | 491398 | ||||
2,9-Bis(2-phenylethyl)anthra[2,1,9-def:6,5,10-d'e'f']diisoquinoline-1,3,8,10(2H,9H)-tetrone | 1 | 67075-37-0 | 266-564-7 | 1,25 | 1,25 | 152195 | ||||
Bis(2-phenyl-2-imidazoline) pyromellitate | 1 | 54553-91-2 | 259-226-5 | 0,437 | 491644 | |||||
1,8-Bis(phenylthio)anthraquinone | 1 | 13676-91-0 | 237-167-6 | 11,76 | ||||||
Bis(piperidinothiocarbonyl) hexasulfide | 1 | 971-15-3 | 213-537-2 | 49 | 108134 | |||||
2-[2,2-Bis(2-prop-2-enoyloxyethoxymethyl)butoxy]ethyl 3-(dibutylamino)propanoate | 1 | 195008-76-5 | 606-330-7 | 26,45 | ||||||
Bis(2-propylheptyl) hexanedioate | 1 | - | 940-510-9 | 26,4 | ||||||
Bis(2-propylheptyl) phthalate | 1 | 53306-54-0 | 258-469-4 | 5 | 35,3 | 145076 | ||||
3,6-Bis(4-tert-butylphenyl)-2,5-dihydropyrrolo[3,4-c]pyrrole-1,4-dione | 1 | - | 416-250-2 | 3 | ||||||
Reaction product of: 3,5-Bis-tert-butylsalicylic acid and Aluminiumsulfate | 1 | - | 420-310-3 | 1,76 | 535080 | |||||
Bis(tetramethylazanium) chloride hypochlorite | 1 | - | 940-936-5 | 1,2 | ||||||
2,5-Bis(1,1,3,3-tetramethylbutyl)hydroquinone | 1 | 903-19-5 | 212-990-3 | 0,165 | ||||||
Bis(4-(1,1,3,3-tetramethylbutyl)phenyl)amine | 1 | 15721-78-5 | 239-816-9 | 4,11 | 129131 | |||||
Bis(4-(1,1,3,3-tetramethylbutyl)phenyl)amine | 2 | 15721-78-5 | 239-816-9 | 49,3 | 129131 | |||||
N,N'-Bis(2,2,6,6-tetramethyl-4-piperidyl)isophthalamide | 1 | 42774-15-2 | 419-710-0 | 79,3 | 902018 | |||||
Bis(2,2,6,6-tetramethyl-4-piperidyl)sebacate | 1 | 52829-07-9 | 258-207-9 | 0,68 | 495765 | |||||
1,4-Bis(p-tolylamino)anthraquinone | 1 | 128-80-3 | 204-909-5 | 11,3 | 102265 | |||||
1-(2,6-Bis(4-tolyl)-1,3-dioxano(5,4-d)-1,3-dioxan-4-yl)ethane-1,2-diol | 1 | 87826-41-3 | 402-950-5 | 8,46 | 532548 | |||||
Bis(triethoxysilylpropyl)amine | 1 | 13497-18-2 | 236-818-1 | 23,51 | ||||||
Bis[3-(triethoxysilyl)propyl] disulfide | 1 | 56706-10-6 | 260-350-7 | 4,7 | 146712 | |||||
Bis(trimethoxysilylpropyl)amine | 1 | 82985-35-1 | 280-084-5 | 32,91 | 164205 | |||||
Bis(trimethoxysilylpropyl)amine | 2 | 82985-35-1 | 280-084-5 | 260 | 260 | 164205 | ||||
Bis(3,5,5-trimethylhexanoyl) peroxide | 1 | 3851-87-4 | 223-356-0 | 1,18 | ||||||
Bis(2,8,9-trioxa-5-aza-1-silabicyclo(3.3.3)undecane-1-propane)disulfide | 1 | - | 477-700-1 | 2,35 | ||||||
Black copper, copper smelting | 1 | - | 918-452-0 | 0,05 | 0,05 | |||||
Black copper, copper smelting | 2 | - | 918-452-0 | 5 | ||||||
Black copper, copper smelting | 3 | - | 918-452-0 | 0,005 | ||||||
Black copper, copper smelting | 4 | - | 918-452-0 | 0,1 | ||||||
Black copper, copper smelting | 5 | - | 918-452-0 | 0,04 | ||||||
Boehmite | 1 | 1318-23-6 | 215-284-3 | 3,59 | 109414 | |||||
Borate(1-), tris(acetato-.kappa.O)hydro-, sodium, (T-4)- | 1 | 56553-60-7 | 435-580-8 | 3,526 | ||||||
Borate cobalt(2+) C3/C8/C10 carboxylates salts | 1 | - | 939-267-1 | 0,1538 | ||||||
Boric acid | 1 | 10043-35-3 | 233-139-2 | 8,3 | TRGS900 | MAK | 3640 | |||
Boric acid, zinc salt | 1 | 1332-07-6 | 215-566-6 | 22,4 | ||||||
(+)-Bornan-2-one | 1 | 464-49-3 | 207-355-2 | 17,632 | ||||||
(-)-Borneol | 1 | 464-45-9 | 207-353-1 | 0,208 | 103955 | |||||
DL-Borneol | 1 | 507-70-0 | 208-080-0 | 17,632 | ||||||
L-2-Bornyl acetate | 1 | 5655-61-8 | 227-101-4 | 1,058 | 39000 | |||||
Boron trifluoride acetic acid complex | 1 | 373-61-5 | 206-768-5 | 1,3 | 1,3 | 510524 | ||||
Boron oxide | 1 | 1303-86-2 | 215-125-8 | 4,66 | 1830 | |||||
Boron phosphate | 1 | 13308-51-5 | 236-337-7 | 6,64 | 5940 | |||||
Boron sodium oxide | 1 | 12007-92-0 | 234-522-7 | 9,6 | 5,5 | TRGS900 | 491162 | |||
Boron trichloride | 1 | 10294-34-5 | 233-658-4 | 8 | 16 | 6060 | ||||
Boron trichloride | 2 | 10294-34-5 | 233-658-4 | 8,3 | 6060 | |||||
Boron trifluoride | 1 | 7637-07-2 | 231-569-5 | 1 | 1 | TRGS900 | 4050 | |||
Boron trifluoride diethyl etherate | 1 | 109-63-7 | 203-689-8 | 0,9 | 0,9 | 510523 | ||||
Boron trifluoride-methyl ether complex | 1 | 353-42-4 | 206-532-1 | 0,8 | 0,8 | 28350 | ||||
branched-Nonyl 3,5,5 trimethylhexanoate | 1 | - | 701-133-3 | 1,175 | ||||||
1-Brombutane | 1 | 109-65-9 | 203-691-9 | 10,1 | 24550 | |||||
Bromine | 1 | 7726-95-6 | 231-778-1 | 0,7 | 0,7 | TRGS900 | EU | 1000 | ||
Bromoacetic acid | 1 | 79-08-3 | 201-175-8 | 2,8 | 24480 | |||||
5-[(4-Bromo-2,6-difluorophenyl)difluoromethoxy]-1,2,3-trifluorobenzene | 1 | 511540-64-0 | 610-623-5 | 4,93 | ||||||
Bromoform | 1 | 75-25-2 | 200-854-6 | 0,592 | 39820 | |||||
Bromo(hexahydro-2H-azepin-2-onato-N)magnesium | 1 | 17091-31-5 | 241-158-2 | 29,2 | ||||||
(4aR*, 8aR*)-1-Bromo-4a,5,9,10,11,12-hexahydro-3-methoxy-6H-benzofuro[3a,3,2-ef] [2]benzazepin-6-one hydrochloride (1:1) | 1 | - | 700-867-1 | 0,98 | ||||||
5-Bromo-5-nitro-1,3-dioxane | 1 | 30007-47-7 | 250-001-7 | 0,0274 | ||||||
3-[(4-{2-[2-Bromo-4-nitro-6-(trifluoromethyl)phenyl]diazen-1-yl}phenyl)(2-cyanoethyl)amino]propanenitrile | 1 | 246871-16-9 | 435-190-8 | 23,5 | ||||||
N-Bromosuccinimide | 1 | 128-08-5 | 204-877-2 | 0,53 | 40270 | |||||
2-Bromo-3,3,3-trifluoroprop-1-ene | 1 | 1514-82-5 | 627-872-0 | 95,47 | 80,54 | |||||
Bronopol | 1 | 52-51-7 | 200-143-0 | 2,5 | 3,5 | 34210 | ||||
BRUGGOLITE® FF6 | 1 | - | 432-070-7 | 22 | ||||||
1,2-Butadiene | 1 | 590-19-2 | 209-674-2 | 371 | 25050 | |||||
Butanal, reaction products with aniline | 1 | 68411-20-1 | 270-109-8 | 0,82 | ||||||
Butanamide, 2,2'-[(3,3'-dichloro[1,1'-biphenyl]-4,4'-diyl)bis(azo)]bis[3-oxo-, N,N'-bis(p-anisyl and Ph) derivs. | 1 | 90268-23-8 | 290-823-3 | 3 | ||||||
Butanamide, 2,2'-[(3,3'-dichloro[1,1'-biphenyl]-4,4'-diyl)bis(azo)]bis[3-oxo-, N,N'-bis(o-anisyl and 2,4-xylyl) derivs. | 1 | 68610-86-6 | 271-878-2 | 3 | ||||||
Butanamide, 2,2'-[(3,3'-dichloro[1,1'-biphenyl]-4,4'-diyl)bis(azo)]bis[3-oxo-, N,N'-bis(4-chloro-2,5-dimethoxyphenyl and 2,4-xylyl) derivs. | 1 | 90268-24-9 | 290-824-9 | 3 | ||||||
Butanamide, 2,2'-[(3,3'-dichloro[1,1'-biphenyl]-4,4'-diyl)bis(azo)]bis[3-oxo-, N,N'-bis(phenyl and o-tolyl) derivs. | 1 | 68910-13-4 | 272-732-0 | 10 | ||||||
Butanedioic acid, sulfo-, 4-C12-14 (even numbered)-alkyl esters, disodium salts | 1 | - | 939-638-8 | 46,67 | ||||||
Butanedioic acid, sulfo-, C-C16-18-alkyl esters, disodium salt | 1 | 91697-07-3 | 294-268-8 | 31,1 | ||||||
Butanedioic acid, sulfo-, 1-C12-18-alkyl esters, disodium salts | 1 | 90268-36-3 | 290-836-4 | 46,67 | 173775 | |||||
Butanedioic acid, 2(or3)-sulfo-, 4-[2-[(1-oxo(C12-C18(even numbered) and C18 unsaturated)alkyl)amino]ethyl]esters, disodium salts | 1 | - | 939-637-2 | 566,73 | ||||||
Butanedioic acid, 2(or 3)-sulfo-, 4-[2-[(1-oxododecyl)amino]ethyl] ester, sodium salt | 1 | - | 939-648-2 | 233,36 | ||||||
Butanedioic acid, sulfo-, mono (C16-18 and C18-unsatd. alkyl) esters, ammonium sodium salts | 1 | 147993-66-6 | 604-617-1 | 46,67 | ||||||
Butanedioic acid, sulfo-, 4-[2-[(2-hydroxyethyl)amino]ethyl] ester, N-C18-unsatd. acyl derivs., disodium salts | 1 | 97862-28-7 | 308-072-8 | 156 | ||||||
Butanedioic acid, sulfo-, monoesters with lanolin alcs., disodium salts | 1 | 90268-43-2 | 290-844-8 | 6 | ||||||
1,4-Butanediol | 1 | 110-63-4 | 203-786-5 | 136 | TRGS900 | 15800 | ||||
(R)-(-)-Butane-1,3-diol | 1 | 6290-03-5 | 228-532-0 | 353 | ||||||
(R,R)-(-)-Butane-2,3-diol | 1 | 24347-58-8 | 246-186-9 | 41,1 | ||||||
(2R,3S)-Butane-2,3-diol | 1 | 5341-95-7 | 823-920-1 | 41,1 | ||||||
1,4-Butanediol diacrylate | 1 | 1070-70-8 | 213-979-6 | 4,94 | 510087 | |||||
Butanedioldiglycidyl ether | 1 | 2425-79-8 | 219-371-7 | 4,7 | 510068 | |||||
1,4-Butanediol dimethacrylate | 1 | 2082-81-7 | 218-218-1 | 14,5 | 494158 | |||||
3,3'-[Butane-1,4-diylbis(oxy)]bispropanamine | 1 | 7300-34-7 | 230-745-9 | 1 | 59 | 491463 | ||||
Butane-1,4-diylbis(oxy-2-hydroxypropane-3,1-diyl) bisacrylate | 1 | - | 701-230-0 | 0,82 | ||||||
Butane-1,4-diylbis(oxy-2-hydroxypropane-3,1-diyl) bisacrylate | 2 | - | 701-230-0 | 4,7 | ||||||
1,4-Butanediyl 3-(2,4-dimethyl-1,3-dioxolan-2-yl)propanoate | 1 | 1259300-69-0 | 700-652-2 | 16,33 | ||||||
1,2,3,4-Butanetetracarboxylic acid, Tetramethyl ester, reaction products with 1,2,2,6,6-Pentamethyl-4-piperidinol and β,β,β',β'-Tetramethyl-2,4,8,10-tetraoxaspiro[5.5]undecane-3,9-diethanol | 1 | 85631-00-1 | 287-947-5 | 0,822 | ||||||
Butanoic acid, 4-amino-4-oxosulfo-, N-coco alkyl derivates, monosodium salts, compounds with triethanolamine | 1 | 98171-53-0 | 308-662-5 | 3,5 | ||||||
Butanoic acid, 4-amino-4-oxo-2(or 3)-sulfo-,N-(C16-C18 (even numbered), C18 unsaturated alkyl)), disodium salts | 1 | - | 939-691-7 | 188,91 | ||||||
1-Butanol | 1 | 71-36-3 | 200-751-6 | 310 | TRGS900 | MAK | 12650 | |||
2-Butanol | 1 | 78-92-2 | 201-158-5 | 600 | 27200 | |||||
Butanone | 1 | 78-93-3 | 201-159-0 | 600 | TRGS900 | MAK | EU | 13330 | ||
2-Butanone, peroxide | 1 | 1338-23-4 | 700-954-4 | 5,288 | ||||||
Butan-2-one O,O',O''-(methylsilylidyne)trioxime | 1 | 22984-54-9 | 245-366-4 | 1,02 | 491557 | |||||
2-Butanone oxime | 1 | 96-29-7 | 202-496-6 | 3,33 | 9 | TRGS900 | 16770 | |||
2-Butanone-O,O',O''-(phenylsilylidyne)trioxime | 1 | 34036-80-1 | 433-360-6 | 1,226 | 535975 | |||||
Butan-2-one O,O',O'',O'''-silanetetrayltetraoxime | 1 | 34206-40-1 | 251-882-0 | 0,942 | 139302 | |||||
Butan-2-one O,O',O''-(vinylsilylidyne)trioxime | 1 | 2224-33-1 | 218-747-8 | 1,06 | 112092 | |||||
2-Butene (cis and trans) | 1 | 107-01-7 | 203-452-9 | 768,7 | 38140 | |||||
1-Butene | 1 | 106-98-9 | 203-449-2 | 768,7 | 510088 | |||||
Butene, mixed isomers | 1 | 25167-67-3 | 246-689-3 | 768,7 | 510089 | |||||
Butene, mixed isomers | 2 | 25167-67-3 | 246-689-3 | 1530 | 769 | 510089 | ||||
cis-Butenediol | 1 | 6117-80-2 | 228-085-1 | 2 | 2 | 494710 | ||||
1-Butoxy-2,3-difluoro-4-[(1s,4r)-4-propylcyclohexyl]benzene | 1 | 208709-55-1 | 606-661-7 | 52,9 | ||||||
(Z)-α-[[2-(tert-Butoxy)-1,1-dimethyl-2-oxoethoxy]imino]-2-(tritylamino)thiazol-4-acetic acid | 1 | 68672-66-2 | 272-056-6 | 49,3 | ||||||
2-Butoxyethanol | 1 | 111-76-2 | 203-905-0 | 98 | TRGS900 | MAK | EU | 14030 | ||
2-(2-Butoxyethoxy)ethanol | 1 | 112-34-5 | 203-961-6 | 67,5 | 67,5 | TRGS900 | MAK | EU | 22420 | |
2-Butoxyethyl acetate | 1 | 112-07-2 | 203-933-3 | 133 | TRGS900 | MAK | EU | 22350 | ||
1-(2-Butoxy-1-methylethoxy)-2-propanol | 1 | 29911-28-2 | 249-951-5 | 189 | 137664 | |||||
3-Butoxypropan-2-ol | 1 | 5131-66-8 | 225-878-4 | 147 | 510092 | |||||
3-Butoxypropylamine | 1 | 16499-88-0 | 240-566-8 | 1,06 | ||||||
2-(2-(3-Butoxypropyl)-1,1-dioxo-1,2,4-benzothiadiazin-3-yl)-5'-tert-butyl-2-(5,5-dimethyl-2,4-dioxo-1,3-oxazolidin-3-yl)-2'-((2-ethylhexyl)thio)acetanilide | 1 | 727678-39-9 | 448-060-0 | 11,75 | 536257 | |||||
2-[tert-Butyl(phenylmethyl)amino]-1-[4-hydroxy-3-(hydroxymethyl)phenyl] hydrochloride | 1 | 24085-08-3 | 246-014-2 | 4,9 | ||||||
n-Butyl acetate | 1 | 123-86-4 | 204-658-1 | 300 | 300 | TRGS900 | MAK | EU | 13320 | |
n-Butyl acetate | 2 | 123-86-4 | 204-658-1 | 48 | TRGS900 | MAK | EU | 13320 | ||
tert-Butyl acetate | 1 | 540-88-5 | 208-760-7 | 159 | TRGS900 | MAK | 36860 | |||
N-tert-Butylacrylamide | 1 | 107-58-4 | 203-505-6 | 8,22 | 101681 | |||||
n-Butyl acrylate | 1 | 141-32-2 | 205-480-7 | 11 | TRGS900 | MAK | EU | 14300 | ||
tert-Butyl acrylate | 1 | 1663-39-4 | 216-768-7 | 11 | 16 | 26020 | ||||
Butylamine | 1 | 109-73-9 | 203-699-2 | 6,1 | 6,1 | TRGS900 | MAK | 10750 | ||
sec-Butylamine | 1 | 13952-84-6 | 237-732-7 | 10,1 | TRGS900 | MAK | 510035 | |||
(Butylamine)[[2,2'-thiobis[4-(1,1,3,3-tetramethylbutyl)phenolato]](2-)-O,O',S]nickel | 1 | 14516-71-3 | 238-523-3 | 0,352 | ||||||
2-[[(Butylamino)carbonyl]oxy]ethyl acrylate | 1 | 63225-53-6 | 264-036-0 | 9,9 | ||||||
2-Butylamino-ethanol | 1 | 111-75-1 | 203-904-5 | 11,85 | 40710 | |||||
2-tert-Butylaminoethyl methacrylate | 1 | 3775-90-4 | 223-228-4 | 5,87 | 510096 | |||||
tert-Butylbenzene | 1 | 98-06-6 | 202-632-4 | 7,64 | 570085 | |||||
N-Butylbenzenesulfonamide | 1 | 3622-84-2 | 222-823-6 | 2,5 | 494430 | |||||
4-tert-Butylbenzoic acid | 1 | 98-73-7 | 202-696-3 | 0,067 | TRGS900 | MAK | 37710 | |||
N-tert-butylbenzothiazole-2-sulphenamide | 1 | 95-31-8 | 202-409-1 | 14 | 14 | 15630 | ||||
2-(4-tert-Butylbenzyl)propionaldehyde | 1 | 80-54-6 | 201-289-8 | 0,44 | 100653 | |||||
Butyl 4,4-bis(tert-butyldioxy)valerate | 1 | 995-33-5 | 213-626-6 | 19,7 | ||||||
2-Butyl-6-(butylamino)-1H-benz[de]isoquinoline-1,3(2H)-dione | 1 | 19125-99-6 | 242-828-7 | 16,3 | ||||||
3-Butyl-1-[4-({4-[(butylcarbamoyl)amino]phenyl}methyl)phenyl]urea | 1 | - | 416-600-4 | 49,37 | ||||||
4-tert-Butylcatechol | 1 | 98-29-3 | 202-653-9 | 1,6 | 490122 | |||||
Butylchlorodihydroxystannane | 1 | 13355-96-9 | 236-406-1 | 0,108 | ||||||
tert-Butylchlorodimethylsilane | 1 | 18162-48-6 | 242-042-4 | 33 | ||||||
[2-Butyl-4-chloro-1-({4-[2-(2H-1,2,3,4-tetrazol-5-yl)phenyl]phenyl}methyl)-1H-imidazol-5-yl]methanol | 1 | 114798-26-4 | 601-329-8 | 0,1 | ||||||
4-[(1-Butyl-5-cyano-1,6-dihydro-2-hydroxy-4-methyl-6-oxo-3-pyridyl)azo]-N-(2-ethylhexyl)benzenesulphonamide | 1 | 55290-62-5 | 259-571-1 | 8,8 | ||||||
4-tert-Butylcyclohexanol | 1 | 98-52-2 | 202-676-4 | 4,93 | 16810 | |||||
4-tert-Butylcyclohexanol | 2 | 98-52-2 | 202-676-4 | 1,76 | 16810 | |||||
2-sec-Butylcyclohexan-1-one | 1 | 14765-30-1 | 238-830-2 | 8,87 | 3,55 | |||||
1-((2-tert-Butyl)cyclohexyloxy)-2-butanol | 1 | 139504-68-0 | 412-300-2 | 17,6 | 901006 | |||||
((3-(sec-Butyl)-4-(decyloxy)phenyl)methanetriyl)tribenzene | 1 | 1404190-37-9 | 801-941-7 | 78 | ||||||
Butyl (dialkyloxy(dibutoxyphosphoryloxy))titanium phosphate | 1 | 109037-78-7 | 401-100-0 | 6,58 | 496639 | |||||
Butyl (dialkyloxy(dibutoxyphosphoryloxy))titanium phosphate | 2 | 109037-78-7 | 401-100-0 | 2,4 | 496639 | |||||
n-Butyldiethanolamine | 1 | 102-79-4 | 203-055-0 | 1,14 | 2,22 | 492635 | ||||
tert-Butyl alpha,alpha-dimethylbenzyl peroxide | 1 | 3457-61-2 | 222-389-8 | 2,65 | 510098 | |||||
1,3-Butylene diacetate | 1 | 1117-31-3 | 214-244-2 | 17,5 | 20190 | |||||
tert-Butyl ethyl ether | 1 | 637-92-3 | 211-309-7 | 105 | 352 | 106525 | ||||
O,O-tert-Butyl O-(2-ethylhexyl) peroxycarbonate | 1 | 34443-12-4 | 252-029-5 | 59,2 | 139432 | |||||
N-Butyl-2-(1-ethylpentyl)-1,3-oxazolidine | 1 | - | 425-660-0 | 29,4 | ||||||
2-Butyl-2-ethyl-1,3-propanediol | 1 | 115-84-4 | 204-111-7 | 5,3 | 101869 | |||||
tert-Butyl glycidyl ether | 1 | 7665-72-7 | 231-640-0 | 2,61 | 8,04 | 510798 | ||||
Butyl hydrogen maleate | 1 | 925-21-3 | 213-116-3 | 1,17 | 40840 | |||||
tert-Butyl hydroperoxide | 1 | 75-91-2 | 200-915-7 | 3,69 | 3,08 | 29660 | ||||
tert-Butylhydroquinone | 1 | 1948-33-0 | 217-752-2 | 19,7 | 490351 | |||||
Butyl hydroxyanisole | 1 | 25013-16-5 | 246-563-8 | 4,93 | TRGS900 | MAK | 510796 | |||
Butyl hydroxyanisole | 2 | 25013-16-5 | 246-563-8 | 3,112 | TRGS900 | MAK | 510796 | |||
Butyl 3-hydroxybutyrate | 1 | 53605-94-0 | 258-658-1 | 2,94 | ||||||
tert-Butyl [(2S,3R)-3-hydroxy-4-(isobutylamino)-1-phenylbutan-2-yl]carbamate | 1 | 160232-08-6 | 605-203-3 | 0,39 | ||||||
Butylidenebis[2-tert-butyl-5-methyl-p-phenylene]-P,P,P',P'-tetratridecylbis(phosphine) | 1 | 13003-12-8 | 235-841-4 | 70,5 | ||||||
tert-Butyl isocyanate | 1 | 1609-86-5 | 216-544-9 | 0,04 | 110385 | |||||
O,O-tert-Butyl isopropyl monoperoxycarbonate | 1 | 2372-21-6 | 219-143-7 | 15,868 | ||||||
tert-Butyl (3S,5S)-3-isopropyl-5-((2S,4S)-tetrahydro-4-isopropyl-5-oxo-furan-2-yl)-2-oxo-pyrrolidine-carboxylate | 1 | - | 472-680-0 | 5,2 | ||||||
Butyl 3-mercaptopropionate | 1 | 16215-21-7 | 240-343-5 | 0,49 | ||||||
n-Butyl methacrylate | 1 | 97-88-1 | 202-615-1 | 409 | 415,9 | 24070 | ||||
tert-Butyl methacrylate | 1 | 585-07-9 | 209-548-7 | 409 | 415 | 496460 | ||||
tert-Butyl methyl ether | 1 | 1634-04-4 | 216-653-1 | 178,5 | TRGS900 | MAK | EU | 40480 | ||
OO-tert-Butyl monoperoxymaleate | 1 | 1931-62-0 | 217-691-1 | 2,63 | ||||||
2-Butyloctan-1-ol | 1 | 3913-02-8 | 223-470-0 | 123,3 | 115823 | |||||
tert-Butyl N-[(1S)-1-[(2R)-oxiran-2-yl]-2-phenylethyl]carbamate | 1 | - | 431-870-3 | 0,364 | ||||||
tert-Butyl perbenzoate | 1 | 614-45-9 | 210-382-2 | 4 | 36920 | |||||
tert-Butyl peroxyacetate | 1 | 107-71-1 | 203-514-5 | 4,46 | 570087 | |||||
tert-Butylperoxy-2-ethylhexanoate | 1 | 3006-82-4 | 221-110-7 | 9,8 | 113917 | |||||
tert-Butyl peroxyneodecanoate | 1 | 26748-41-4 | 247-955-1 | 2,8 | ||||||
tert-Butyl peroxypivalate | 1 | 927-07-1 | 213-147-2 | 2,8 | 510758 | |||||
tert-Butyl peroxy-3,5,5,-trimethylhexanoate | 1 | 13122-18-4 | 236-050-7 | 5,6 | 494956 | |||||
2-sec-Butylphenol | 1 | 89-72-5 | 201-933-8 | 0,941 | 11580 | |||||
2-tert-Butylphenol | 1 | 88-18-6 | 201-807-2 | 1,47 | 16540 | |||||
4-tert-Butylphenol | 1 | 98-54-4 | 202-679-0 | 0,5 | TRGS900 | MAK | 16680 | |||
2-(4-tert-Butylphenyl)-6-cyano-5-(bis(ethoxycarbonylmethyl)carbamoyloxy)-1H-pyrrolo(1,2-b)(1,2,4)triazole-7-carboxylic-acid 2,6-di-tert-butyl-4-methylcyclohexylester | 1 | 444065-11-6 | 448-050-6 | 23,51 | 536212 | |||||
2-(4-tert-Butylphenyl)-6-cyano-5-(bis(ethoxycarbonylmethyl)carbamoyloxy)-1H-pyrrolo(1,2-b)(1,2,4)triazole-7-carboxylic-acid 2,6-di-tert-butyl-4-methylcyclohexylester | 2 | 444065-11-6 | 448-050-6 | 11,75 | 536212 | |||||
N-Butyl phenyl ether | 1 | 1126-79-0 | 214-426-1 | 0,94 | ||||||
p-tert-Butylphenyl glycidyl ether | 1 | 3101-60-8 | 221-453-2 | 3,5 | 3,5 | 114192 | ||||
3-(4-tert-Butylphenyl)propionaldehyde | 1 | 18127-01-0 | 242-016-2 | 0,22 | 0,308 | 130986 | ||||
N-Butylphosphorothioic triamide | 1 | 94317-64-3 | 435-740-7 | 0,15 | ||||||
N-Butylphosphorothioic triamide | 2 | 94317-64-3 | 435-740-7 | 0,63 | ||||||
N-Butylphosphorothioic triamide | 3 | 94317-64-3 | 435-740-7 | 7,8 | ||||||
Butyl propionate | 1 | 590-01-2 | 209-669-5 | 64 | 510102 | |||||
4-trans-Butyl-4'-trans-propyl-[1,1'-bicyclohexyl] | 1 | 96624-52-1 | 619-232-4 | 1,64 | ||||||
1-Butylpyridinium heptachlorodialuminate | 1 | - | 479-330-6 | 5,73 | ||||||
tert-Butyl 2-[4-(2-pyridinyl) phenylmethyl] hydrazine carboxylate | 1 | - | 429-080-9 | 0,735 | ||||||
1-Butylpyrrolidin-2-one | 1 | 3470-98-2 | 222-437-8 | 24,1 | ||||||
Butylstannium trichloride | 1 | 1118-46-3 | 214-263-6 | 0,04 | 0,11 | TRGS900 | MAK | 510539 | ||
p-tert-Butylstyrene | 1 | 1746-23-2 | 217-126-9 | 0,329 | 110839 | |||||
Butyltinhydroxide oxide | 1 | 2273-43-0 | 218-880-1 | 0,108 | TRGS900 | MAK | 490369 | |||
Butyltinhydroxide oxide | 2 | 2273-43-0 | 218-880-1 | 32,9 | TRGS900 | MAK | 490369 | |||
Butyltris[(2-ethyl-1-oxohexyl)oxy]stannane | 1 | 23850-94-4 | 245-912-1 | 10,2 | TRGS900 | MAK | 490632 | |||
6-tert-Butyl-2,4-xylenol | 1 | 1879-09-0 | 217-533-1 | 0,14 | 494105 | |||||
2-Butyn-1,4-diol, reaction product with 1-4.5 moles of Methyloxirane | 1 | 61596-96-1 | 612-177-7 | 2,82 | ||||||
But-2-yne-1,4-diol | 1 | 110-65-6 | 203-788-6 | 0,5 | 1,25 | TRGS900 | MAK | EU | 29180 | |
2-Butyne-1,4-diol, polymer with 2-(Chloromethyl)oxirane, brominated, dehydrochlorinated, methoxylated | 1 | 68441-62-3 | 614-503-3 | 6 | ||||||
Butyric acid | 1 | 107-92-6 | 203-532-3 | 36,8 | 12610 | |||||
gamma-Butyrolactone | 1 | 96-48-0 | 202-509-5 | 130 | 28150 | |||||
n-Butyronitrile | 1 | 109-74-0 | 203-700-6 | 0,53 | 38640 | |||||
Cadmium (non-pyrophoric) | 1 | 7440-43-9 | 231-152-8 | 0,004 | EU | Carcinogenic | 8360 | |||
Cadmium telluride | 1 | 1306-25-8 | 215-149-9 | 0,004 | EU | Carcinogenic | 109355 | |||
Cadmium carbonate | 1 | 513-78-0 | 208-168-9 | 0,004 | EU | Carcinogenic | 3350 | |||
Cadmium chloride | 1 | 10108-64-2 | 233-296-7 | 0,004 | EU | Carcinogenic | 3310 | |||
Cadmium chloride | 2 | 10108-64-2 | 233-296-7 | 0,004 | EU | Carcinogenic | 3310 | |||
Cadmium hydroxide | 1 | 21041-95-2 | 244-168-5 | 0,004 | EU | Carcinogenic | 132803 | |||
Cadmium nitrate tetrahydrate | 1 | 10325-94-7 | 233-710-6 | 0,004 | EU | Carcinogenic | 500068 | |||
Cadmium oxide | 1 | 1306-19-0 | 215-146-2 | 0,004 | EU | Carcinogenic | 4510 | |||
Cadmium sulfate | 1 | 10124-36-4 | 233-331-6 | 0,004 | EU | Carcinogenic | 3340 | |||
Cadmium sulfide | 1 | 1306-23-6 | 215-147-8 | 0,004 | EU | Carcinogenic | 2150 | |||
Cadmium sulfide | 2 | 1306-23-6 | 215-147-8 | 0,004 | EU | Carcinogenic | 2150 | |||
Cadmium sulfoselenide | 1 | - | 701-229-5 | 0,004 | ||||||
Cadmium zinc sulphide yellow | 1 | - | 701-227-4 | 0,004 | ||||||
Caesium carbonate | 1 | 534-17-8 | 208-591-9 | 0,73 | ||||||
Caesium hydroxide | 1 | 21351-79-1 | 244-344-1 | 1 | 1,31 | 132957 | ||||
Caesium iodide | 1 | 7789-17-5 | 232-145-2 | 2,3 | 122794 | |||||
Caesium nitrate | 1 | 7789-18-6 | 232-146-8 | 1,71 | 122795 | |||||
Caesium tetrafluoroaluminate | 1 | 39211-00-2 | 630-337-4 | 0,35 | ||||||
Caffeine | 1 | 58-08-2 | 200-362-1 | 44,37 | 14120 | |||||
Calcines, zinc ore-conc. | 1 | 69012-79-9 | 273-776-3 | 0,004 | ||||||
Calcines, zinc ore-conc. | 2 | 69012-79-9 | 273-776-3 | 5 | ||||||
Calcines, zinc ore-conc. | 3 | 69012-79-9 | 273-776-3 | 0,005 | ||||||
Calcium | 1 | 7440-70-2 | 231-179-5 | 1 | 8160 | |||||
Calcium bromide | 1 | 7789-41-5 | 232-164-6 | 1,4 | 122804 | |||||
Calcium, carbonate hydroxy aluminum complexes | 1 | 97660-35-0 | 307-546-1 | 2,5 | ||||||
Calcium disodium ethylenediamine tetraacetate | 1 | 62-33-9 | 200-529-9 | 10 | 30 | 100308 | ||||
Calcium magnesium dihydroxide oxide | 1 | 58398-71-3 | 261-235-4 | 1 | 147488 | |||||
Calcium magnesium oxide | 1 | 37247-91-9 | 253-425-0 | 1 | 140636 | |||||
Calcium tin trioxide | 1 | 12013-46-6 | 234-585-0 | 2 | TRGS900 | Carcinogenic | 124767 | |||
Calcium zinc salts of oligomers of rosin | 1 | - | 920-105-3 | 10 | ||||||
Calcium acetate | 1 | 62-54-4 | 200-540-9 | 1020,28 | 570089 | |||||
Calcium acetylacetonate | 1 | 19372-44-2 | 243-001-3 | 10 | 10 | 131827 | ||||
Calcium bis(di C8-C10, branched, C9 rich, alkylnaphthalenesulphonate) | 1 | - | 939-717-7 | 70 | ||||||
Calcium bis(4-{[(2S,4R)-1-(biphenyl-4-yl)-5-ethoxy-4-methyl-5-oxopentan-2-yl]amino}-4-oxobutanoate) | 1 | - | 935-847-3 | 16 | ||||||
Calcium bis[4-[[1-[[(2-chlorophenyl)amino]carbonyl]-2-oxopropyl]azo]-3-nitrobenzenesulphonate] | 1 | 71832-85-4 | 276-057-2 | 3 | 13,05 | |||||
Calcium bis(2-ethylhexanoate) | 1 | 136-51-6 | 205-249-0 | 39,98 | 102488 | |||||
Calcium bis(2-ethylhexanoate) | 2 | 136-51-6 | 205-249-0 | 32 | 102488 | |||||
Calcium 1,4-bis(2-ethylhexyl) bis(2-sulphosuccinate) | 1 | 128-49-4 | 204-889-8 | 1416,82 | ||||||
Calcium bis[4-[[1-[[(2-methylphenyl)amino]carbonyl]-2-oxopropyl]azo]-3-nitrobenzenesulphonate] | 1 | 12286-66-7 | 235-558-6 | 3 | 13,05 | |||||
Calcium carbide | 1 | 75-20-7 | 200-848-3 | 2 | 1980 | |||||
Calcium carbide | 2 | 75-20-7 | 200-848-3 | 10 | 1980 | |||||
Calcium carbonate | 1 | 471-34-1 | 207-439-9 | 6,36 | 1650 | |||||
Calcium 6-[(3-carboxylatopropanoyl)amino]-2-[(3-carboxypropanoyl)amino]hexanoate | 1 | 1422423-64-0 | 800-036-4 | 88,16 | ||||||
Calcium chloride | 1 | 10043-52-4 | 233-140-8 | 5 | 1910 | |||||
Calcium 4-chloro-2-(5-hydroxy-3-methyl-1-(3-sulfonatophenyl)pyrazol-4-ylazo)-5-methylbenzenesulfonate | 1 | - | 403-530-4 | 47 | ||||||
Calcium 4-chloro-2-(5-hydroxy-3-methyl-1-(3-sulfonatophenyl)pyrazol-4-ylazo)-5-methylbenzenesulfonate | 2 | - | 403-530-4 | 23,5 | ||||||
Calcium 4-[(5-chloro-4-methyl-2-sulphonatophenyl)azo]-3-hydroxy-2-naphthoate | 1 | 7023-61-2 | 230-303-5 | 4,4 | 121477 | |||||
Calcium cyanamide | 1 | 156-62-7 | 205-861-8 | 1 | TRGS900 | MAK | 3410 | |||
Calcium (1R,2S)-cyclohexane-1,2-dicarboxylate | 1 | - | 473-820-3 | 7,3 | ||||||
Calcium 4,5-dichloro-2-[[4,5-dihydro-3-methyl-5-oxo-1-(3-sulphonatophenyl)-1H-pyrazol-4-yl]azo]benzenesulphonate | 1 | 65212-77-3 | 265-634-4 | 4,7 | ||||||
Calcium diethyl bis[[[3,5-bis(1,1-dimethylethyl)-4-hydroxyphenyl]methyl]phosphonate] | 1 | 65140-91-2 | 265-512-0 | 1 | 3 | 151263 | ||||
Calcium dihydroxide precipitated with carbon dioxide during sugar juice purification | 1 | - | 932-124-4 | 10 | ||||||
Calcium distearate | 1 | 1592-23-0 | 216-472-8 | 32,9 | 20980 | |||||
Calcium disulphamate | 1 | 13770-92-8 | 237-399-8 | 11,38 | ||||||
Calcium dodecylbenzene sulfonate, mixed isomers | 1 | 26264-06-2 | 247-557-8 | 52 | 52 | 20890 | ||||
Calcium fluoride | 1 | 7789-75-5 | 232-188-7 | 5 | TRGS900 | MAK | EU | 3620 | ||
Calcium formiate | 1 | 544-17-2 | 208-863-7 | 337 | 27120 | |||||
Calcium glycinate (1:2) | 1 | 35947-07-0 | 252-809-5 | 10 | 22 | |||||
Calcium hydrogen phosphonate | 1 | 21056-98-4 | 244-182-1 | 9 | ||||||
Calcium hydrosilicate, reaction product of natural quartz sand and technical lime by a hydrothermal and tribochemical process | 1 | - | 946-103-2 | 1,6 | 8,4 | |||||
Calcium hydroxide | 1 | 1305-62-0 | 215-137-3 | 1 | TRGS900 | MAK | EU | 1150 | ||
Calcium 3-hydroxy-4-[(1-sulphonato-2-naphthyl)azo]-2-naphthoate | 1 | 6417-83-0 | 229-142-3 | 23,7 | ||||||
Calcium iodate | 1 | 7789-80-2 | 232-191-3 | 1,881 | 122822 | |||||
Calcium magnesium(2+) oxocalcium dihydroxide carbonate | 1 | - | 923-511-9 | 5 | 5 | |||||
Calcium metaborate (Ca(BO2)2) and Calcium tetraborate (CaB4O7), amorphous reaction products of boric acid with lime | 1 | - | 701-311-0 | 8,3 | ||||||
Calcium molybdate | 1 | 7789-82-4 | 232-192-9 | 23,29 | 122823 | |||||
Calcium neodecanoate | 1 | 27253-33-4 | 248-375-1 | 1,46 | ||||||
Calcium nitrite | 1 | 13780-06-8 | 237-424-2 | 1,3 | ||||||
Calcium oxide | 1 | 1305-78-8 | 215-138-9 | 1 | TRGS900 | MAK | EU | 1200 | ||
Calcium phosphinate | 1 | 7789-79-9 | 232-190-8 | 0,821 | ||||||
Calcium polysulfides | 1 | 1344-81-6 | 215-709-2 | 7,4 | 500029 | |||||
Calcium sulfate | 1 | 7778-18-9 | 231-900-3 | 21,17 | TRGS900 | MAK | 1170 | |||
Calcium sufite | 1 | 10257-55-3 | 233-596-8 | 284 | 3920 | |||||
Calciumthioglycolate trihydrate | 1 | 29820-13-1 | 249-881-5 | 1,41 | TRGS900 | MAK | 137604 | |||
Calcium thiosufate | 1 | 10124-41-1 | 233-333-7 | 351 | 123739 | |||||
Calcium 3,5,5-trimethylhexanoate | 1 | 64216-15-5 | 264-731-9 | 15,7 | ||||||
Camphene | 1 | 79-92-5 | 201-234-8 | 110,19 | 570094 | |||||
Camphor | 1 | 76-22-2 | 200-945-0 | 17,632 | 510778 | |||||
epsilon-Caprolactam | 1 | 105-60-2 | 203-313-2 | 5 | TRGS900 | MAK | EU | 13240 | ||
epsilon-Caprolactone | 1 | 502-44-3 | 207-938-1 | 7 | 4,1 | 39250 | ||||
ε-Caprolactone, oligomeric reaction products with 2,2'-Oxydiethanol | 1 | 36890-68-3 | 500-092-7 | 12 | ||||||
Captan | 1 | 133-06-2 | 205-087-0 | 0,012 | 10870 | |||||
Carbamic acid, [1,3-phenylenebis[methyleneiminocarbonylimino(methyl-3,1-phenylene)]]bis-, diisotridecyl ester | 1 | 865536-03-4 | 617-879-7 | 16,4 | ||||||
Carbazamidine phosphate | 1 | 24413-21-6 | 246-237-5 | 7,3 | ||||||
Carbazamidine sulphate | 1 | 2834-84-6 | 220-605-5 | 7,3 | ||||||
Carbodihydrazide | 1 | 497-18-7 | 207-837-2 | 2,64 | 12460 | |||||
Carbohydrates and Sugars, hexitols, anhydro | 1 | 100683-96-3 | 309-665-4 | 23,5 | ||||||
Carbon Black | 1 | 1333-86-4 | 215-609-9 | 0,5 | 91940 | |||||
Carbon Black | 2 | 1333-86-4 | 215-609-9 | 1 | 91940 | |||||
Carbon disulfide | 1 | 75-15-0 | 200-843-6 | 15,8 | TRGS900 | MAK | EU | 1430 | ||
Carbonic acid, zinc salt, basic | 1 | 51839-25-9 | 257-467-0 | 5 | ||||||
Carbonic acid, compound with 2-Aminoethanol (1:2) | 1 | 21829-52-7 | 244-600-2 | 3,3 | 133170 | |||||
Carbon monoxide | 1 | 630-08-0 | 211-128-3 | 23 | 23 | TRGS900 | MAK | EU | 1110 | |
Carbon monoxide | 2 | 630-08-0 | 211-128-3 | 35 | TRGS900 | MAK | EU | 1110 | ||
Carbon tetrachloride | 1 | 56-23-5 | 200-262-8 | 1,29 | TRGS900 | MAK | EU | 1480 | ||
m,m'-[Carbonylbis[imino(3-methoxy-p-phenylene)azo]]bis(benzenesulphonic) acid, compound with 2,2'-iminodiethanol (1:2) | 1 | 71550-21-5 | 275-602-1 | 0,16 | ||||||
(3E)-3-[[4-(2-Carboxyethylcarbamoyl)phenyl]hydrazinylidene]-6-oxocyclohexa-1,4-diene-1-carboxylic acid | 1 | 80573-04-2 | 617-116-8 | 3,29 | ||||||
Carboxylic acids, C5-9 | 1 | 68603-84-9 | 271-676-4 | 32,9 | ||||||
Carboxylic acids, di-, C4-6 | 1 | 68603-87-2 | 271-678-5 | 5 | 34 | |||||
(Carboxymethyl)dimethyl[3-[(1-oxoundecenyl)amino]propyl]ammonium hydroxide | 1 | 98510-75-9 | 308-783-3 | 5,23 | ||||||
N-Carboxymethyliminobis(ethylenenitrilo)tetra(acetic acid) | 1 | 67-43-6 | 200-652-8 | 1,5 | 100377 | |||||
Carvacrol | 1 | 499-75-2 | 207-889-6 | 0,439 | ||||||
Carvacrol | 2 | 499-75-2 | 207-889-6 | 9,87 | ||||||
(S)-Carvone | 1 | 2244-16-8 | 218-827-2 | 47500 | 491193 | |||||
(R)-Carvone | 1 | 6485-40-1 | 229-352-5 | 0,685 | 491194 | |||||
(R)-Carvone | 2 | 6485-40-1 | 229-352-5 | 7,49 | 491194 | |||||
(R)-Carvone | 3 | 6485-40-1 | 229-352-5 | 35,7 | 491194 | |||||
Cashew (Anacardium occidentale) Nutshell Extract, Decarboxylated, Distilled | 1 | 8007-24-7 | 700-991-6 | 7,4 | ||||||
Cashew (Anacardium occidentale) Nutshell Extract, Decarboxylated, Distilled | 2 | 8007-24-7 | 700-991-6 | 16,7 | ||||||
Cashew (Anacardium occidentale) Nutshell Extract, Decarboxylated, Distilled (“Distilled Residue Grade”) | 1 | - | 941-212-1 | 0,88 | ||||||
Cashew (Anacardium occidentale) Nutshell Extract, Decarboxylated (“Technical Grade”) | 1 | - | 941-216-3 | 0,88 | ||||||
Cashew, nutshell liq., oligomeric reaction products with 1-chloro-2,3-epoxypropane | 1 | 68413-24-1 | 500-210-7 | 0,73 | ||||||
Castor oil, oxidized | 1 | 68187-84-8 | 269-128-4 | 49 | ||||||
Castor oil, hydrogenated | 1 | 8001-78-3 | 232-292-2 | 336,75 | 491475 | |||||
Castor oil, dehydrated | 1 | 64147-40-6 | 264-705-7 | 372,22 | 491679 | |||||
Castor oil, ethoxylated | 1 | 61791-12-6 | 500-151-7 | 16,4 | 28610 | |||||
Cement, alumina, chemicals | 1 | 65997-16-2 | 266-045-5 | 2,5 | ||||||
Cement copper | 1 | 67711-88-0 | 266-964-1 | 0,05 | 0,05 | |||||
Cement copper | 2 | 67711-88-0 | 266-964-1 | 0,005 | ||||||
Cement copper | 3 | 67711-88-0 | 266-964-1 | 5 | ||||||
Cement copper | 4 | 67711-88-0 | 266-964-1 | 0,004 | ||||||
Cement copper | 5 | 67711-88-0 | 266-964-1 | 0,04 | ||||||
Ceramic materials and wares, chemicals | 1 | 66402-68-4 | 266-340-9 | 15,63 | ||||||
Ceramic materials and wares, chemicals | 2 | 66402-68-4 | 266-340-9 | 15,63 | ||||||
Ceramic materials and wares, chemicals | 3 | 66402-68-4 | 266-340-9 | 3 | ||||||
Ceraphyl 55 | 1 | - | 458-930-1 | 49 | ||||||
Cerium | 1 | 7440-45-1 | 231-154-9 | 8,13 | 8430 | |||||
Cerium(3+) acetate | 1 | 537-00-8 | 208-654-0 | 1,6 | 1,9 | |||||
Cerous oxalate | 1 | 139-42-4 | 205-362-5 | 0,9 | 102552 | |||||
Cesium formate | 1 | 3495-36-1 | 222-492-8 | 0,53 | ||||||
Cesiumaluminium fluoride - Complex | 1 | 138577-01-2 | 434-690-3 | 0,05 | 0,05 | |||||
Cesium chloride | 1 | 7647-17-8 | 231-600-2 | 1,47 | 122471 | |||||
Cesium potassium fluoroaluminate | 1 | - | 0,14 | |||||||
Cesium sufate | 1 | 10294-54-9 | 233-662-6 | 0,82 | 124004 | |||||
Cetiol CC, dicaprylyl carbonate | 1 | - | 434-850-2 | 293 | ||||||
Cetyltrimethylammonium chloride | 1 | 112-02-7 | 203-928-6 | 3,32 | 492772 | |||||
CGX ANUCA 0386 | 1 | - | 456-830-2 | 70,5 | ||||||
Charcoal | 1 | 16291-96-6 | 240-383-3 | 10 | 10 | 129613 | ||||
Charcoal | 2 | 16291-96-6 | 240-383-3 | 10 | 129613 | |||||
Charcoal, coconut shell | 1 | 68647-86-9 | 271-974-4 | 10 | 10 | |||||
Chloral hydrate | 1 | 302-17-0 | 206-117-5 | 1,716 | 510108 | |||||
Chloramide | 1 | 10599-90-3 | 234-217-9 | 0,00383 | 124460 | |||||
2-Chlorobenzaldehyde | 1 | 89-98-5 | 201-956-3 | 2,06 | 15960 | |||||
Chlorendic anhydride | 1 | 115-27-5 | 204-077-3 | 33,23 | 510256 | |||||
Chlorendic anhydride | 2 | 115-27-5 | 204-077-3 | 33,23 | 15 | 510256 | ||||
Chlorhexidine digluconate | 1 | 18472-51-0 | 242-354-0 | 0,42 | 131272 | |||||
Chlorinated paraffines, C10-C13 | 1 | 85535-84-8 | 287-476-5 | 29,4 | 492006 | |||||
Chlorine | 1 | 7782-50-5 | 231-959-5 | 0,75 | 0,75 | TRGS900 | MAK | EU | 7170 | |
Chlorine dioxide | 1 | 10049-04-4 | 233-162-8 | 0,304 | TRGS900 | MAK | 1640 | |||
2-Chloroacetamide | 1 | 79-07-2 | 201-174-2 | 0,705 | 20380 | |||||
Chloroacetic acid | 1 | 79-11-8 | 201-178-4 | 2 | 4 | TRGS900 | MAK | 10910 | ||
Chloroalkanes (C14-17) | 1 | 85535-85-9 | 287-477-0 | 6,7 | TRGS900 | 532584 | ||||
4-({4-Chloro-6-amino-1,3,5-triazin-2-yl}amino)-2-{(E)-[1-ethyl-6-hydroxy-4-methyl-2-oxo-5-methyl-1,2-dihydropyridin-3-yl]diazenyl}, polysulfonates/to , polyphenyl, sodium/potassium salt (1:2) | 1 | 111850-26-1 | 402-480-0 | 11,8 | ||||||
3-Chloroaniline | 1 | 108-42-9 | 203-581-0 | 0,367 | 18790 | |||||
Chlorobenzene | 1 | 108-90-7 | 203-628-5 | 23 | TRGS900 | MAK | EU | 11950 | ||
Chlorobenzene | 2 | 108-90-7 | 203-628-5 | 42,3 | 42,3 | TRGS900 | MAK | EU | 11950 | |
4-Chlorobenzotrifluoride | 1 | 98-56-6 | 202-681-1 | 1,025 | 34620 | |||||
2-(4-Chlorobenzoyl)benzoic acid | 1 | 85-56-3 | 201-615-9 | 1,64 | 30780 | |||||
1-Chlorobutane | 1 | 109-69-3 | 203-696-6 | 3,4 | TRGS900 | 26510 | ||||
4-Chloro-m-cresol | 1 | 59-50-7 | 200-431-6 | 6,289 | 510424 | |||||
6-(2-Chloro-6-cyano-4-nitrophenylazo)-4-methoxy-3-(N-(metho-xycarbonylmethyl)-N-(1-methoxycarbonylethyl)amino)acetanilide | 1 | 204277-61-2 | 430-500-8 | 4,7 | 535951 | |||||
1-Chloro-N,N-diethyl-1,1-diphenyl-1-(phenylmethyl)-phosphoramine | 1 | 82857-68-9 | 411-370-1 | 0,098 | 901199 | |||||
5-Chloro-1,3-dihydro-1-(4-piperidinyl)-2H-benzimidazol-2-one | 1 | 53786-28-0 | 258-771-6 | 1,175 | ||||||
1-Chloro-2,3-dimethylbenzene | 1 | 608-23-1 | 480-880-4 | 2,73 | ||||||
Chlorodimethyloctadecylsilane | 1 | 18643-08-8 | 242-472-2 | 76,16 | ||||||
Chlorodimethylsilane | 1 | 1066-35-9 | 213-912-0 | 20,8 | 3120 | |||||
Chlorodimethylvinylsilane | 1 | 1719-58-0 | 217-007-1 | 26,5 | 110742 | |||||
Chloroethane | 1 | 75-00-3 | 200-830-5 | 37,7 | TRGS900 | EU | 18540 | |||
2-(2-Chloroethoxy)ethanol | 1 | 628-89-7 | 211-059-9 | 3,016 | 106366 | |||||
5-({4-Chloro-6-[ethyl(phenyl)amino]-1,3,5-triazin-2-yl}amino)-4-hydroxy-3-[(1-sulfo-2-naphthyl)diazenyl]naphthalene-2,7-disulfonic acid, lithium sodium salts | 1 | - | 942-803-7 | 16,4 | ||||||
Chloroform | 1 | 67-66-3 | 200-663-8 | 2,5 | 2,5 | TRGS900 | MAK | EU | Carcinogenic | 12870 |
4-Chloro-4'-hydroxybenzophenone | 1 | 42019-78-3 | 255-627-4 | 7,663 | 142574 | |||||
[[2-[2-[2-(3-Chloro-2-hydroxy-propoxy)propoxymethyl]-3-(2-prop-2-enoyloxypropoxy)-2-(2-prop-2-enoyloxypropoxymethyl)propoxy]-1-methyl-ethyl] prop-2-enoate | 1 | 57903-73-8 | 611-591-5 | 2,2 | ||||||
(3-Chloro-2-hydroxypropyl)trimethylammonium chloride | 1 | 3327-22-8 | 222-048-3 | 5,95 | 492120 | |||||
2-{2-Chloro-4-methanesulfonyl-3-[(oxolan-2-ylmethoxy)methyl]benzoyl}cyclohexane-1,3-dione | 1 | 473278-76-1 | 695-022-6 | 0,0158 | ||||||
4-Chloro-N-methylpiperidine | 1 | 5570-77-4 | 226-942-4 | 798,7 | ||||||
(Chloromethyl)triethoxysilane | 1 | 15267-95-5 | 239-311-3 | 154,7 | 128705 | |||||
1-[(2-Chloro-4-nitrophenyl)azo]-2-naphthol | 1 | 2814-77-9 | 220-562-2 | 2,939 | ||||||
[2-[[4-[(2-Chloro-4-nitrophenyl)azo]phenyl]ethylamino]ethyl](2-hydroxypropyl)dimethylammonium acetate | 1 | 82205-20-7 | 279-919-6 | 2,93 | ||||||
1-[2-[[4-[(2-Chloro-4-nitrophenyl)azo]phenyl]ethylamino]ethyl]pyridinium acetate | 1 | 59709-10-3 | 261-873-3 | 49,3 | ||||||
Chloroparaffin | 1 | 63449-39-8 | 264-150-0 | 63,5 | 491130 | |||||
3-Chloroperbenzoic acid | 1 | 937-14-4 | 213-322-3 | 2,64 | 510552 | |||||
1-(p-Chlorophenoxy)-3,3-dimethyl-1-(1-imidazolyl)-2-butanone | 1 | 38083-17-9 | 253-775-4 | 0,3 | 140942 | |||||
1-(3-Chlorophenyl)-4-(3-chloropropyl)piperazinium chloride | 1 | 52605-52-4 | 258-038-0 | 3,95 | 144694 | |||||
4-(2-Chlorophenyl)-N-cyclohexyl-N-ethyl-5-oxo-4,5-dihydro-1H-tetrazole-1-carboxamide | 1 | 158237-07-1 | 605-140-1 | 0,145 | ||||||
N,N'-(2-Chloro-1,4-phenylene)bis[4-[(4-chloro-2-nitrophenyl)azo]-3-hydroxynaphthalene-2-carboxamide] | 1 | 35869-64-8 | 252-772-5 | 3 | 140075 | |||||
N,N'-(2-Chloro-1,4-phenylene)bis[4-[(2,5-dichlorophenyl)azo]-3-hydroxynaphthalene-2-carboxamide] | 1 | 5280-78-4 | 226-106-9 | 3 | 117971 | |||||
2-Chloro-p-phenylenediamine | 1 | 615-66-7 | 210-441-2 | 3,29 | ||||||
Chloroprene | 1 | 126-99-8 | 204-818-0 | 0,8 | 2,4 | Carcinogenic | 11630 | |||
2-Chloro propane | 1 | 75-29-6 | 200-858-8 | 91,5 | 10650 | |||||
3-Chloro-1,2-propanediol | 1 | 96-24-2 | 202-492-4 | 0,29 | TRGS900 | MAK | 29630 | |||
(3-Chloroprop-1-enyl)benzene | 1 | 2687-12-9 | 220-246-4 | 0,129 | ||||||
(3-Chloropropyl)diethoxymethylsilane | 1 | 13501-76-3 | 236-828-6 | 17,14 | 126650 | |||||
1-(3-Chloropropyl)-1,3-dihydro-2H-benzimidazol-2-one | 1 | 62780-89-6 | 263-731-6 | 1,18 | ||||||
(3-Chloropropyl)dimethoxymethylsilane | 1 | 18171-19-2 | 242-056-0 | 16,4 | 131018 | |||||
(3-Chloropropyl)dimethoxymethylsilane | 2 | 18171-19-2 | 242-056-0 | 260 | 131018 | |||||
(3-Chloropropyl)dimethoxymethylsilane | 3 | 18171-19-2 | 242-056-0 | 16 | 131018 | |||||
3-Chloropropyltriethoxysilane | 1 | 5089-70-3 | 225-805-6 | 68 | 39670 | |||||
3-(Chloropropyl)-trimethoxysilane | 1 | 2530-87-2 | 219-787-9 | 68 | 494258 | |||||
1-(3-Chloropyridin-2-yl)-N-[4-cyano-2-methyl-6-(methylcarbamoyl)phenyl]-3-{[5-(trifluoromethyl)-2H-tetrazol-2-yl]methyl}-1H-pyrazole-5-carboxamide | 1 | 1229654-66-3 | 810-161-6 | 11,2 | ||||||
(1S)-1-[3-[(1E)-2-(7-Chloroquinolin-2-yl)ethenyl]phenyl]-3-[2-(2-hydroxypropan-2-yl)phenyl]propanol | 1 | 287930-77-2 | 608-251-3 | 1,47 | ||||||
2-[(5-Chloro-8-quinolinyl)oxy]acetic acid | 1 | 88349-88-6 | 635-476-4 | 7 | ||||||
4-Chlororesorcinol | 1 | 95-88-5 | 202-462-0 | 4,996 | 492558 | |||||
Chlorosulfonic acid | 1 | 7790-94-5 | 232-234-6 | 0,111 | 2460 | |||||
4-[(4-Chloro-6-{[(3 or 4)-sulfophenyl]amino}-1,3,5-triazin-2-yl)amino]-2-{[1-ethyl-2-hydroxy-4-methyl-6-oxo-5-(sulfonatomethyl)-1,6-dihydropyridin-3-yl]diazenyl}benzenesulfonic acid, lithium sodium salts | 1 | - | 942-795-5 | 16,4 | ||||||
5-[[4-Chloro-6-[(3-sulphophenyl)amino]-1,3,5-triazin-2-yl]amino]-4-hydroxy-3-[[4-[[2-(sulphooxy)ethyl]sulphonyl]phenyl]azo]naphthalene-2,7-disulphonic acid, sodium salt | 1 | 78952-61-1 | 279-015-1 | 15 | 491791 | |||||
(1Z)-1-Chloro-2,3,3,3-tetrafluoroprop-1-ene | 1 | 111512-60-8 | 813-937-2 | 1260 | ||||||
2-Chlorotoluene | 1 | 95-49-8 | 202-424-3 | 3,52 | 3,52 | 13950 | ||||
4,4'-[(6-Chloro-1,3,5-triazine-2,4-diyl)diimino]bis[5-hydroxy-6-[[4-[[2-(sulphooxy)ethyl]sulphonyl]phenyl]azo]naphthalene-2,7-disulphonic] acid, sodium salt | 1 | 94158-79-9 | 303-152-9 | 15 | 184871 | |||||
Chlorotrifluoroethylene | 1 | 79-38-9 | 201-201-8 | 2,77 | 34810 | |||||
4-(4-((((4-Chloro-3-(trifluoromethyl)phenyl)amino)carbonyl)amino)phenoxy)-N-methyl-2-pyridinecarboxamide | 1 | 284461-73-0 | 608-209-4 | 0,08 | ||||||
(1E)-1-Chloro-3,3,3-trifluoroprop-1-ene | 1 | 102687-65-0 | 700-486-0 | 1779 | ||||||
(1Z)-1-Chloro-2,3,3-trifluoroprop-1-ene | 1 | 1263679-68-0 | 824-458-3 | 357,2 | ||||||
Chlorotrimethylsilane | 1 | 75-77-4 | 200-900-5 | 24 | 89 | 2670 | ||||
Chlorphenesin | 1 | 104-29-0 | 203-192-6 | 1,64 | ||||||
Cholesterol | 1 | 57-88-5 | 200-353-2 | 132 | 36750 | |||||
Cholic acid | 1 | 81-25-4 | 201-337-8 | 9,8 | 100680 | |||||
Choline chloride | 1 | 67-48-1 | 200-655-4 | 338,5 | 27810 | |||||
Choline hydrogen carbonate | 1 | 78-73-9 | 201-137-0 | 200,29 | 100600 | |||||
Choline hydroxide | 1 | 123-41-1 | 204-625-1 | 146,69 | 102101 | |||||
Chromate(2-), [2,4-dihydro-4-[(2-hydroxy-4-nitrophenyl)azo]-5-methyl-2-phenyl-3H-pyrazol-3-onato(2-)][3-[(4,5-dihydro-3-methyl-5-oxo-1-phenyl-1H-pyrazol-4-yl)azo]-2-hydroxy-5-nitrobenzenesulfonato(3-)]-, disodium | 1 | 70209-87-9 | 274-386-6 | 3,5 | ||||||
Chromate(3-), [3-[(4,5-dihydro-3-methyl-5-oxo-1-phenyl-1H-pyrazol-4-yl)azo]-2-hydroxy-5-nitrobenzenesulfonato(3-)][3-hydroxy-4-[(2-hydroxy-1-naphthalenyl)azo]-7-nitro-1-naphthalenesulfonato(3-)]-, sodium | 1 | 84989-26-4 | 284-915-2 | 0,51 | ||||||
Chrome antimony titanium buff rutile | 1 | 68186-90-3 | 269-052-1 | 4 | ||||||
Chromium, Powder | 1 | 7440-47-3 | 231-157-5 | 0,5 | TRGS900 | EU | 8190 | |||
Chromium(III) acetate hydroxide | 1 | 39430-51-8 | 254-447-3 | 0,141 | 4,24 | TRGS900 | 141533 | |||
Chromium (III) hydroxynitrate | 1 | 12158-37-1 | 601-791-0 | 9 | ||||||
Chromium(III) acetate | 1 | 1066-30-4 | 213-909-4 | 0,141 | 4,24 | TRGS900 | 108419 | |||
Chromium(III) chloride | 1 | 10025-73-7 | 233-038-3 | 0,31 | 2,61 | TRGS900 | EU | 3040 | ||
Chromium(III) fluoride | 1 | 7788-97-8 | 232-137-9 | 2,4 | TRGS900 | MAK | EU | 3840 | ||
Chromium(III) nitrate nonahydrate | 1 | 13548-38-4 | 236-921-1 | 0,155 | 0,464 | TRGS900 | EU | 126725 | ||
Chromium(III) 4-oxopent-2-ene-2-olate | 1 | 21679-31-2 | 244-526-0 | 0,1983 | ||||||
Chromium potassium bis(sulphate) | 1 | 10141-00-1 | 233-401-6 | 80,4 | TRGS900 | EU | 3690 | |||
C.I. ACID YELLOW 246 | 1 | - | 400-910-1 | 2,35 | ||||||
1,8-Cineole | 1 | 470-82-6 | 207-431-5 | 7,05 | 104020 | |||||
Cinnamaldehyde | 1 | 104-55-2 | 203-213-9 | 6,11 | 491174 | |||||
Cinnamaldehyde | 2 | 104-55-2 | 203-213-9 | 2,204 | 491174 | |||||
Cinnamylacetate | 1 | 103-54-8 | 203-121-9 | 2,35 | ||||||
Cinnamyl alcohol | 1 | 104-54-1 | 203-212-3 | 2,64 | 492661 | |||||
Citral | 1 | 5392-40-5 | 226-394-6 | 9 | 70250 | |||||
Citronellal | 1 | 106-23-0 | 203-376-6 | 9 | 491257 | |||||
Citronellol | 1 | 106-22-9 | 203-375-0 | 10 | 161,6 | 492685 | ||||
Citronellyl acetate | 1 | 150-84-5 | 205-775-0 | 17 | 102794 | |||||
Citronellyl formate | 1 | 105-85-1 | 203-338-9 | 4,94 | ||||||
Clarified oils (petroleum), catalytic cracked | 1 | 64741-62-4 | 265-064-6 | 0,18 | ||||||
Clioquinol | 1 | 130-26-7 | 204-984-4 | 4,305 | 102315 | |||||
Cobalt | 1 | 7440-48-4 | 231-158-0 | 0,04 | Carcinogenic | 7270 | ||||
Cobalt, borate 2-ethylhexanoate complexes | 1 | 91782-60-4 | 295-032-7 | 0,1505 | ||||||
Cobalt, borate propionate complexes | 1 | 91782-61-5 | 295-033-2 | 0,1029 | ||||||
Cobalt Lithium Manganese Nickel Oxide | 1 | - | 480-390-0 | 0,003 | ||||||
Cobalt Lithium Manganese Nickel Oxide | 2 | - | 480-390-0 | 0,05 | 0,05 | |||||
Cobalt Lithium Manganese Nickel Oxide | 3 | - | 480-390-0 | 0,0509 | ||||||
Cobalt Lithium Manganese Nickel Oxide | 4 | - | 480-390-0 | 0,04 | ||||||
Cobalt oxalate | 1 | 814-89-1 | 212-409-3 | 0,0997 | 107299 | |||||
Cobalt(II) acetate | 1 | 71-48-7 | 200-755-8 | 0,1202 | Carcinogenic | 4210 | ||||
Cobalt(II) acetylacetonate | 1 | 14024-48-7 | 237-855-6 | 0,1745 | 495022 | |||||
Cobalt bis(2-ethylhexanoate) | 1 | 136-52-7 | 205-250-6 | 0,2351 | 530219 | |||||
Cobalt, borate neodecanoate complexes | 1 | 68457-13-6 | 270-601-2 | 0,1695 | ||||||
Cobalt(II) carbonate | 1 | 513-79-1 | 208-169-4 | 0,0807 | Carcinogenic | 104536 | ||||
Cobalt(2+) C3/C10 carboxylates salts | 1 | - | 941-064-8 | 0,1951 | ||||||
Cobalt dichloride | 1 | 7646-79-9 | 231-589-4 | 0,0881 | Carcinogenic | 2590 | ||||
Cobalt dihydroxide | 1 | 21041-93-0 | 244-166-4 | 0,0631 | Carcinogenic | 132802 | ||||
Cobalt hydroxide oxide | 1 | 12016-80-7 | 234-614-7 | 0,0624 | ||||||
Cobalt naphthenate | 1 | 61789-51-3 | 263-064-0 | 0,4494 | 91900 | |||||
Cobalt neodecanoate | 1 | 27253-31-2 | 248-373-0 | 0,2732 | 136311 | |||||
Cobalt(II) nitrate | 1 | 10141-05-6 | 233-402-1 | 0,1242 | Carcinogenic | 5340 | ||||
Cobalt(II) oxide | 1 | 1307-96-6 | 215-154-6 | 0,0509 | 3600 | |||||
Cobalt(II,III) oxide | 1 | 1308-06-1 | 215-157-2 | 0,0545 | 500063 | |||||
Cobalt(II)-propionate | 1 | 1560-69-6 | 216-333-1 | 0,1392 | 110224 | |||||
Cobalt stearate | 1 | 13586-84-0 | 237-016-4 | 0,4248 | 126806 | |||||
Cobalt sulfate | 1 | 10124-43-3 | 233-334-2 | 0,1052 | Carcinogenic | 1840 | ||||
Cobalt sulfide | 1 | 1317-42-6 | 215-273-3 | 0,0618 | Carcinogenic | 500064 | ||||
Reaction product of cocoalkyldiethanolamides and cocoalkylmonoglycerides and molybdenumtrioxide (1.75-2.2: 0.75-1.0:0.1-1.1) | 1 | 445409-27-8 | 430-380-7 | 3,53 | 535934 | |||||
Coconut oil, reaction products with glycerol esters of 3,5-Bis(1,1-dimethylethyl)-4-hydroxybenzenepropanoic acid | 1 | 179986-09-5 | 425-400-6 | 1 | 535774 | |||||
Coconut oil, reaction products with glycerol esters of 3,5-Bis(1,1-dimethylethyl)-4-hydroxybenzenepropanoic acid | 2 | 179986-09-5 | 425-400-6 | 1 | 535774 | |||||
Coconut oil, reaction products with boric acid (H3BO3), diethanolamine and glycerol | 1 | 1428353-74-5 | 806-731-9 | 0,8 | ||||||
Complex Substance of 4,11,11-Trimethyl-8-methylenebicyclo[7.2.0]undec-4-ene and 4-Allyl-2-methoxyphenol and 4-Allyl-2-methoxyphenyl acetate | 1 | 84961-50-2 | 904-912-8 | 11,02 | 4,41 | |||||
Complexation products of sodium tartrate with iron trichloride | 1 | - | 18,4 | |||||||
Condensates (petroleum), vacuum tower | 1 | 64741-49-7 | 265-049-4 | 68,34 | ||||||
Condensation products of m-phenylenebis(methylamine) with condensation products of 4-methyl-m-phenylene diisocyanate with alcohols, C10-14 (even numbered) | 1 | 207574-76-3 | 428-710-1 | 59 | ||||||
Constitutional isomers of Penta-O-allyl-beta-D-fructofurano-syl-alpha-D-glucopyranoside Constitutional isomers of Hexa-O-allyl-beta-D-fructofurano-syl-alpha-D-glucopyranoside Constitutional isomers of Hepta-O-allyl-beta-D-fructofurano-syl-alpha-D-glucopyranoside | 1 | 68784-14-5 | 419-640-0 | 13,16 | 902012 | |||||
Copolymer of benzenamine and formaldehyde, hydrogenated | 1 | 135108-88-2 | 603-894-6 | 0,2 | ||||||
Copolymer of hexahydro-2H-azepin-2-one and 1,6-diisocyanatohexane | 1 | 26776-30-7 | 607-997-7 | 0,005 | ||||||
Copolymer of hexahydro-2H-azepin-2-one and 3-isocyanatomethyl-3,5,5-trimethylcyclohexyl isocyanate | 1 | 127184-53-6 | 603-188-8 | 0,075 | ||||||
Copolymer of neodecanoic acid oxiranylmethyl ester and 4-methylbenzenesulfonic acid | 1 | 98362-33-5 | 500-281-4 | 0,8 | ||||||
Copper, diammine[5,5'-bi-1H-tetrazolato(2-)-kN1, kN1'] | 1 | 538313-26-7 | 611-056-6 | 13,3 | ||||||
Copper dichromium tetraoxide | 1 | 12018-10-9 | 234-634-6 | 1 | 1 | |||||
Copper dichromium tetraoxide | 2 | 12018-10-9 | 234-634-6 | 0,5 | ||||||
Copper, [29H,31H-phthalocyaninato(2-)-N29,N30,N31,N32]-, aminosulfonyl sulfo derivatives, sodium salts | 1 | 90295-11-7 | 291-001-7 | 2,93 | ||||||
Copper, [29H,31H-phthalocyaninato(2-)-N29,N30,N31,N32]-, [[3-(dimethylamino)propyl]amino]sulfonyl derivatives, acetates | 1 | 90295-19-5 | 291-010-6 | 2,93 | ||||||
Copper (2+), bis [N-{amino (imino-KN) methyl} urea-KO]-, nitrate (1:2) | 1 | 1071838-81-7 | 800-038-5 | 2,35 | ||||||
Copper chloride | 1 | 7758-89-6 | 231-842-9 | 1 | 1 | MAK | 3280 | |||
1:1 Copper(II)complex of sodium polysulfonato-, 2-(-(2-hydroxy-3-(4-fluoro-6- substituted amino)-1,3,5-triazin-2-ylamino)-phenylazo)benzylidene-substituted)- benzoate | 1 | - | 402-020-9 | 2,35 | ||||||
Copper cyanide | 1 | 544-92-3 | 208-883-6 | 0,47 | MAK | 3900 | ||||
Copper di(acetate) | 1 | 142-71-2 | 205-553-3 | 1 | 1 | MAK | 3030 | |||
Copper dichloride | 1 | 7447-39-4 | 231-210-2 | 1 | 1 | MAK | 2470 | |||
Copper di-D-gluconate | 1 | 527-09-3 | 208-408-2 | 0,371 | ||||||
Copper dihydroxide | 1 | 20427-59-2 | 243-815-9 | 1 | 1 | MAK | 3500 | |||
Copper dinitrate | 1 | 3251-23-8 | 221-838-5 | 1 | 1 | MAK | 492119 | |||
Copper dioleate | 1 | 1120-44-1 | 214-307-4 | 7,89 | ||||||
Copper disodium EDTA | 1 | 14025-15-1 | 237-864-5 | 1,8 | 491510 | |||||
Copper glycinate | 1 | 32817-15-5 | 251-238-9 | 10 | 22 | |||||
Copper(II) hydroxide carbonate | 1 | 12069-69-1 | 235-113-6 | 1 | 1 | MAK | 491491 | |||
Copper hydroxide nitrate | 1 | 12158-75-7 | 439-590-3 | 1 | 1 | |||||
Copper hydroxide nitrate | 2 | 12158-75-7 | 439-590-3 | 1,89 | 1,89 | |||||
Copper iodide | 1 | 7681-65-4 | 231-674-6 | 0,07 | 0,07 | MAK | 494843 | |||
Copper(2+) ion lithium(1+) ion N-(2-hydroxypropyl)-3-sulfonylpropane-1-sulfonamide {15,25,33-trirutherfordio-2,11,20,29,37,38,39,40-octaazanonacyclo[28.6.1.1³,¹⁰.1¹²,¹⁹.1²¹,²⁸.0⁴,⁹.0¹³,¹⁸.0²²,²⁷.0³¹,³⁶]tetraconta-1,3,5,7,9,11,13(18),14,16,19(39),20,22(27) | 1 | 569316-88-7 | 445-470-1 | 0,17 | ||||||
Copper(2+) ion lithium(1+) ion N-(2-hydroxypropyl)-3-sulfonylpropane-1-sulfonamide {15,25,33-trirutherfordio-2,11,20,29,37,38,39,40-octaazanonacyclo[28.6.1.1³,¹⁰.1¹²,¹⁹.1²¹,²⁸.0⁴,⁹.0¹³,¹⁸.0²²,²⁷.0³¹,³⁶]tetraconta-1,3,5,7,9,11,13(18),14,16,19(39),20,22(27) | 2 | 569316-88-7 | 445-470-1 | 1,45 | ||||||
Copper oxide | 1 | 1317-38-0 | 215-269-1 | 1 | 1 | MAK | 1990 | |||
Copper, [29H,31H-phthalocyaninato(2-)-N29,N30,N31,N32]-, aminosulfonyl sulfo derivs., ammonium sodium salts | 1 | 90295-08-2 | 290-998-6 | 2,93 | ||||||
Copper phthalocyanine | 1 | 147-14-8 | 205-685-1 | 4 | 13930 | |||||
Copper sulfate | 1 | 7758-98-7 | 231-847-6 | 1 | 1 | MAK | 1760 | |||
Copper sulphide | 1 | 1317-40-4 | 215-271-2 | 1 | 1 | MAK | 3320 | |||
Copper(2+) tetrafluoroborate(1-) | 1 | 38465-60-0 | 253-959-4 | 0,824 | ||||||
Cordierite, sintered, synthetic | 1 | 1302-88-1 | 603-401-4 | 0,026 | 0,12 | |||||
Corn, steep liquor | 1 | 66071-94-1 | 266-113-4 | 58,43 | ||||||
Coumarin | 1 | 91-64-5 | 202-086-7 | 6,78 | 490110 | |||||
p-Cresol | 1 | 106-44-5 | 203-398-6 | 3,5 | TRGS900 | MAK | 17040 | |||
m-Cresol | 1 | 108-39-4 | 203-577-9 | 3,5 | TRGS900 | MAK | 18270 | |||
o-Cresol | 1 | 95-48-7 | 202-423-8 | 3,5 | TRGS900 | MAK | 22560 | |||
Cresol, mixture of isomers | 1 | 1319-77-3 | 215-293-2 | 0,9 | 3,5 | TRGS900 | MAK | 10610 | ||
Crotonaldehyde | 1 | 4170-30-3 | 224-030-0 | 0,86 | 0,3 | 37140 | ||||
Crude Tall Oil (CTO) is obtained from the wood pulping industry. It is a dark brown viscous liquid extracted and processed from softwoods and hardwoods. CTO has a complex composition of fatty acids, resin acids, and neutrals | 1 | 8002-26-4 | 931-433-1 | 35,3 | ||||||
Cryolite, tripotassium | 1 | 60996-20-5 | 262-553-6 | 0,14 | ||||||
Crystalline silicic acid, Calcium salt | 1 | - | 935-756-9 | 10 | 10 | |||||
Crystal violet | 1 | 548-62-9 | 208-953-6 | 1,48 | 491325 | |||||
Cumene | 1 | 98-82-8 | 202-704-5 | 100 | TRGS900 | MAK | EU | 27840 | ||
p-Cumenesulphonic acid | 1 | 16066-35-6 | 240-210-1 | 53,6 | 491529 | |||||
3-p-Cumenyl-2-methylpropionaldehyde | 1 | 103-95-7 | 203-161-7 | 5,83 | 101533 | |||||
3-(p-Cumenyl)-2-methylpropionaldehyde | 1 | 6658-48-6 | 229-695-0 | 0,529 | ||||||
Cuprate(4-), [μ-[[7,7'-[[6-[(2-hydroxyethyl)amino]-1,3,5-triazine-2,4-diyl]diimino]bis[4-(hydroxy-κO)-3-[[2-(hydroxy-κO)-5-sulfophenyl]azo-κN1]-2-naphthalenesulfonato]](8-)]]di-, tetrasodium | 1 | 129874-15-3 | 820-015-3 | 16,4 | ||||||
Cuprate(4-), [2-[[[[2-hydroxy-3-sulfo-5-[[2-(sulfooxy)ethyl]sulfonyl]phenyl]azo]phenylmethyl]azo]-4-sulfobenzoato(6-)]-, sodium | 1 | 90341-71-2 | 291-103-1 | 11,67 | 174015 | |||||
Cupro, copper processing | 1 | - | 919-583-6 | 0,004 | ||||||
Cupro, copper processing | 2 | - | 919-583-6 | 0,005 | ||||||
Cupro, copper processing | 3 | - | 919-583-6 | 5 | ||||||
Cupro, copper processing | 4 | - | 919-583-6 | 0,05 | 0,05 | |||||
Cupro, copper processing | 5 | - | 919-583-6 | 0,5 | ||||||
Cupro, copper processing | 6 | - | 919-583-6 | 0,05 | ||||||
Cupro, copper processing | 7 | - | 919-583-6 | 0,04 | ||||||
Cupro, copper processing | 8 | - | 919-583-6 | 0,1 | ||||||
Cyanamide | 1 | 420-04-2 | 206-992-3 | 0,35 | TRGS900 | MAK | EU | 16160 | ||
[2-[[2-Cyano-3-[4-(diethylamino)phenyl]-1-oxoallyl]oxy]ethyl][3-[[2-cyano-3-[4-(diethylamino)phenyl]-1-oxoallyl]oxy]propyl]dimethylammonium chloride | 1 | 78181-99-4 | 278-859-8 | 29 | 163106 | |||||
[2-[[2-Cyano-3-[4-(diethylamino)phenyl]-1-oxoallyl]oxy]ethyl][3-[[2-cyano-3-[4-(diethylamino)phenyl]-1-oxoallyl]oxy]propyl]dimethylammonium chloride | 2 | 78181-99-4 | 278-859-8 | 4,66 | 163106 | |||||
2-Cyano-2-[2,3-dihydro-3-(tetrahydro-2,4,6-trioxo-5(2H)-pyrimidinylidene)-1H-isoindol-1-ylidene]-N-methylacetamide | 1 | 76199-85-4 | 278-388-8 | 3 | 162685 | |||||
3-{[2-Cyano-2-(diphenylmethylidene)acetyl]oxy}-2,2-bis({[2-cyano-2-(diphenylmethylidene)acetyl]oxy}methyl)propyl 2-cyano-3,3-diphenylprop-2-enoate | 1 | 178671-58-4 | 429-160-3 | 10 | ||||||
3-[[3-[[(2-Cyanoethyl)amino]methyl]-3,5,5-trimethylcyclohexyl]amino]propiononitrile | 1 | 93940-97-7 | 300-496-1 | 0,8 | ||||||
[2-[[2-Cyano-3-[4-[ethylbenzylamino]phenyl]-1-oxoallyl]oxy]ethyl]trimethylammonium chloride | 1 | 71550-24-8 | 275-604-2 | 70 | ||||||
2-[N-(2-Cyanoethyl)-4-[(2,6-dichloro-4-nitrophenyl)azo]anilino]ethyl acetate | 1 | 5261-31-4 | 226-070-4 | 4,11 | ||||||
2-[2-[4-[(2-Cyanoethyl)methylamino]phenyl]vinyl]-1,3,3-trimethyl-3H-indolium acetate | 1 | 65122-06-7 | 265-477-1 | 49,3 | ||||||
Cyano-1 guanidine | 1 | 461-58-5 | 207-312-8 | 15,3 | 16220 | |||||
2-[4-[[2-(Cyanoimino)hexahydro-4,6-dioxo-5-pyrimidyl]azo]phenyl]-6-methylbenzothiazole-7-sulphonic acid, compound with 2,2',2''-nitrilotris[ethanol] (1:1) | 1 | 55067-15-7 | 259-470-2 | 16,5 | ||||||
(2-Cyano-1-methylethyl)dodecylethylsulphonium tetrafluoroborate(1-) | 1 | 72140-65-9 | 276-380-9 | 0,12 | ||||||
Cyanuric acid | 1 | 108-80-5 | 203-618-0 | 21,72 | 27480 | |||||
Cyanuric chloride | 1 | 108-77-0 | 203-614-9 | 0,06 | MAK | 18330 | ||||
Cyclohexadecanone | 1 | 2550-52-9 | 438-930-8 | 1,65 | 536064 | |||||
1,3- and 1,4-Cyclohexandicarboxyaldehyde | 1 | - | 482-020-3 | 0,45 | 1,18 | |||||
Cyclohexane | 1 | 110-82-7 | 203-806-2 | 700 | 700 | TRGS900 | MAK | EU | 13790 | |
Cyclohexane, oxidized, aq. ext. | 1 | 68915-38-8 | 272-810-4 | 1 | 264 | |||||
Cyclohexane, oxidized, non-volatile residue | 1 | 68411-76-7 | 270-147-5 | 1 | 264 | |||||
Cyclohexane-1,4-dicarboxylic acid | 1 | 1076-97-7 | 214-068-6 | 20,57 | 108525 | |||||
1,4-Cyclohexanedicarboxylic acid, 1,4-diisononyl ester | 1 | - | 701-012-5 | 15,7 | ||||||
Cyclohexane-1,4-dimethanoldivinylether | 1 | 17351-75-6 | 413-370-7 | 19,6 | 900811 | |||||
N,N’-[Cyclohexane-1,3-diylbis(methylene)]bis(2-methylpropan-1-imine) | 1 | 173904-11-5 | 619-764-7 | 17,9 | ||||||
Cyclohexanol | 1 | 108-93-0 | 203-630-6 | 40,3 | 16090 | |||||
Cyclohexanone | 1 | 108-94-1 | 203-631-1 | 40 | 40 | TRGS900 | EU | 12660 | ||
Cyclohexanone oxime | 1 | 100-64-1 | 202-874-0 | 0,0088 | 32580 | |||||
Cyclohexanone peroxide, mixture | 1 | 12262-58-7 | 235-527-7 | 3,53 | 125576 | |||||
3-Cyclohexene-1-methanol, α,4-dimethyl-α-(4-methyl-3-penten-1-yl)- | 1 | 72691-24-8 | 815-521-6 | 9,8 | ||||||
Cyclohexylamine | 1 | 108-91-8 | 203-629-0 | 5 | TRGS900 | MAK | 11880 | |||
3-Cyclohexylaminopropane-1-sulphonic acid | 1 | 1135-40-6 | 214-492-1 | 1,175 | ||||||
Cyclohexylbenzene | 1 | 827-52-1 | 212-572-0 | 2,35 | ||||||
N-Cyclohexylbenzothiazole-2-sulfenamide | 1 | 95-33-0 | 202-411-2 | 11 | 11 | 14900 | ||||
N-Cyclohexylcyclohexanamine 2-[1-[[[(1R)-1-[3-[(1E)-2-(7-chloroquinolin-2-yl)ethenyl]phenyl]-3-[2-(2-hydroxypropan-2-yl)phenyl]propyl]sulfanyl]methyl]cyclopropyl]acetate | 1 | 577953-88-9 | 611-575-8 | 5,57 | ||||||
Cyclohexyldimethoxymethylsilane | 1 | 17865-32-6 | 402-140-1 | 16 | 530623 | |||||
Cyclohex-1,2-ylenediamine | 1 | 694-83-7 | 211-776-7 | 0,25 | 493658 | |||||
Cyclohex-1,4-ylenedimethanol | 1 | 105-08-8 | 203-268-9 | 30,4 | 492672 | |||||
Cyclohexyl 2-hydroxybenzoate | 3 | 25485-88-5 | 400-410-3 | 6,36 | ||||||
Cyclohexylidenebis[tert-amyl] peroxide | 1 | 15667-10-4 | 239-741-1 | 6,58 | ||||||
Cyclohexylidenebis[tert-butyl] peroxide | 1 | 3006-86-8 | 221-111-2 | 5,29 | ||||||
4,4'-Cyclohexylidenedi-o-cresol | 1 | 2362-14-3 | 219-110-7 | 11,7 | 112367 | |||||
2-Cyclohexylidene-2-phenylacetonitrile | 1 | 10461-98-0 | 423-740-1 | 1,4 | 535833 | |||||
2-Cyclohexylidene-2-phenylacetonitrile | 2 | 10461-98-0 | 423-740-1 | 20,761 | 535833 | |||||
2,2'-(Cyclohexylimino)bisethanol | 1 | 4500-29-2 | 224-809-5 | 1 | 2,2 | 23660 | ||||
Cyclohexyl methacrylate | 1 | 101-43-9 | 202-943-5 | 14,81 | 492626 | |||||
(R,S)-5-Cyclohexyl-2-methyl-pentan-1-ol | 1 | 1141487-54-8 | 700-146-1 | 2,6 | ||||||
[[4-[[2-(4-Cyclohexylphenoxy)ethyl]ethylamino]-2-methylphenyl]methylene]malononitrile | 1 | 54079-53-7 | 258-964-5 | 16,4 | ||||||
N-(Cyclohexylthio)phthalimide | 1 | 17796-82-6 | 241-774-1 | 0,301 | 130774 | |||||
Cyclohexylvinyl ether | 1 | 2182-55-0 | 218-561-7 | 11 | 42 | 111943 | ||||
cis-Cyclooctene | 1 | 931-87-3 | 213-243-4 | 30 | 40560 | |||||
Cyclopentadecanone | 1 | 502-72-7 | 207-951-2 | 3,3 | ||||||
Cyclopentane | 1 | 287-92-3 | 206-016-6 | 3000 | 27960 | |||||
Cyclopentanone | 1 | 120-92-3 | 204-435-9 | 150 | 61 | 27970 | ||||
7-Cyclopentyl-N,N-dimethyl-2-{[5-(piperazin-1-yl)pyridin-2-yl]amino}-7H-pyrrolo[2,3-d]pyrimidine-6-carboxamide | 1 | 1211441-98-3 | 807-111-0 | 1,08 | ||||||
Cyclopentyl methyl ether | 1 | 5614-37-9 | 445-090-6 | 16,9 | ||||||
[(3S,4R,4aR,6S,6aS,12R,12aS,12bS)-3-(Cyclopropanecarbonyloxy)-6,12-dihydroxy-4,6a,12b-trimethyl-11-oxo-9-(pyridin-3-yl)-1,2,3,4,4a,5,6,6a,12a,12b-decahydro-11H,12Hbenzo[f]pyrano[4,3-b]chromen-4-yl]methylcyclopropanecarboxylate | 1 | 915972-17-7 | 815-966-6 | 0,2 | ||||||
Cymbopogon winterianus, extract | 1 | 91771-61-8 | 294-954-7 | 2,73 | ||||||
p-Cymene | 1 | 99-87-6 | 202-796-7 | 0,88 | 37120 | |||||
p-Cymene | 2 | 99-87-6 | 202-796-7 | 8,24 | 37120 | |||||
Cyprosulfamide | 1 | - | 485-320-2 | 13,8 | ||||||
Cysteine hydrochloride | 1 | 52-89-1 | 200-157-7 | 1,8 | 100092 | |||||
Cytidine 3'-(dihydrogen phosphate) | 1 | 63-37-6 | 200-556-6 | 11,672 | ||||||
DAODA | 1 | - | 453-870-2 | 12 | ||||||
Dapsone | 1 | 80-08-0 | 201-248-4 | 0,35 | 2,5 | 490097 | ||||
DDA Carbonate | 1 | 894406-76-9 | 451-900-9 | 2,19 | ||||||
2,9,11,13,15,22,24,26,27,28- decaazatricyclo[21.3.1.1^(10,14)]octacosa- 1(27),10,12,14(28),23,25-hexaene-12,25-diamine, N,N'-bis(1,1,3,3-tetramethylbutyl)-2,9,15,22-tetrakis(2,2,6,6-tetramethyl-4-piperidinyl)- | 1 | - | 401-300-8 | 23,51 | ||||||
Decabromodiphenyl ether | 1 | 1163-19-5 | 214-604-9 | 6 | 493931 | |||||
Decachlorotetrasilane | 1 | 13763-19-4 | 921-774-4 | 10,2 | ||||||
Decahydronaphthalene | 1 | 91-17-8 | 202-046-9 | 24 | TRGS900 | MAK | 35140 | |||
Decamethylcyclopentasiloxane | 1 | 541-02-6 | 208-764-9 | 24,2 | 97,3 | 3200 | ||||
Decamethylenediamine | 1 | 646-25-3 | 211-471-9 | 0,023 | 493627 | |||||
Decamethyltetrasiloxane | 1 | 141-62-8 | 205-491-7 | 102 | 102625 | |||||
Decanal | 1 | 112-31-2 | 203-957-4 | 62,14 | 24,86 | 492779 | ||||
Decane-1,2-diol | 1 | 1119-86-4 | 214-288-2 | 1,18 | ||||||
1,10-Decanediyl bismethacrylate | 1 | 6701-13-9 | 229-745-1 | 4,93 | ||||||
1,10-Decanediyl diacrylate | 1 | 13048-34-5 | 235-922-4 | 5,88 | ||||||
neo-Decanoic acid | 1 | 26896-20-8 | 248-093-9 | 86 | 136088 | |||||
Decanoic acid, mixed diesters with octanoic acid and triethylene glycol | 1 | 68583-52-8 | 271-517-9 | 10,3 | ||||||
Decanoic acid, mixed esters with Dipentaerythritol, Octanoic acid and Valeric acid | 1 | 68441-66-7 | 270-470-1 | 24,5 | ||||||
Decanoic acid, mixed esters with heptanoic acid, octanoic acid and pentaerythritol | 1 | 68441-67-8 | 270-471-7 | 4,93 | ||||||
Decanoic acid, mixed esters with Heptanoic acid, Isovaleric acid, Octanoic acid and Pentaerythritol | 1 | 68130-51-8 | 268-594-6 | 32,9 | ||||||
Decanoic acid, mixed esters with Heptanoic acid, Octanoic acid and Trimethylolpropane | 1 | 68130-53-0 | 268-596-7 | 10,1 | ||||||
1-Decanol | 1 | 112-30-1 | 203-956-9 | 129 | 176 | TRGS900 | MAK | 22300 | ||
Decan-1-ol, ethoxylated | 1 | 26183-52-8 | 500-046-6 | 294 | ||||||
Decan-5-olide | 1 | 705-86-2 | 211-889-1 | 49,3 | 106932 | |||||
Decene, hydroformylation products, low boiling | 1 | - | 938-875-4 | 330 | ||||||
(3E)-Dec-3-en-2-one | 1 | 18402-84-1 | 701-234-2 | 0,931 | ||||||
Decyldimethylamine | 1 | 1120-24-7 | 214-302-7 | 1 | 1 | 108698 | ||||
Decyl methacrylate | 1 | 3179-47-3 | 221-657-1 | 2,5 | 491400 | |||||
Dehydracetic acid | 1 | 520-45-6 | 208-293-9 | 10,99 | 25250 | |||||
Denatonium benzoate | 1 | 3734-33-6 | 223-095-2 | 4,99 | 115523 | |||||
(S)-7-[[2-O-6-Deoxy-α-L-mannopyranosyl)-β-D-glucopyranosyl]oxy]-2,3-dihydro-5-hydroxy-2-(3-hydroxy-4-methoxyphenyl)-4H-1-benzopyran-4-one | 1 | 13241-33-3 | 236-216-9 | 13,22 | ||||||
7-(2-O-(6-Deoxy-α-L-mannopyranosyl)-β-D-glucopyranosyloxy)-2,3-dihydro-4',5,7-trihydroxyflavone | 1 | 10236-47-2 | 233-566-4 | 44,08 | ||||||
Destillation fraction of Chlorosilanes | 1 | - | 700-717-5 | 9,3 | 4,1 | |||||
Dexpanthenol | 1 | 81-13-0 | 201-327-3 | 146,9 | ||||||
DGEBA diacrylate | 1 | 55818-57-0 | 500-130-2 | 1,17 | ||||||
1,2-Diacetoxybut-3-ene | 1 | 18085-02-4 | 421-720-5 | 1,97 | 902275 | |||||
Diacetoxydi-tert-butoxysilane | 1 | 13170-23-5 | 236-112-3 | 150,84 | 126075 | |||||
Di C8-C10, branched, C9 rich, alkylnaphthalene sulphonic acid | 1 | - | 939-714-0 | 22,3 | ||||||
Di C8-C10, branched, C9 rich, alkylnaphthalene sulphonic acid | 2 | - | 939-714-0 | 35 | ||||||
Diallyl 2,2'-oxydiethyl dicarbonate | 1 | 142-22-3 | 205-528-7 | 151,3 | 102643 | |||||
Diallylamine | 1 | 124-02-7 | 204-671-2 | 1,23 | 510562 | |||||
Diallyl hexahydrophthalate | 1 | 13846-31-6 | 237-580-1 | 1,64 | ||||||
Diallyl isophthalate | 1 | 1087-21-4 | 214-122-9 | 3,52 | ||||||
Diallyl phthalate | 1 | 131-17-9 | 205-016-3 | 3,52 | 36910 | |||||
Dialuminium manganese tetraoxide, spinel type | 1 | 1302-69-8 | 927-806-3 | 1,25 | ||||||
Dialuminium chloride pentahydroxide | 1 | 12042-91-0 | 234-933-1 | 6,8 | 492160 | |||||
Dialuminium nickel tetraoxide | 1 | 12004-35-2 | 234-454-8 | 0,05 | 0,05 | TRGS900 | Carcinogenic | 124654 | ||
Dialuminium tris[2-(2,4,5,7-tetrabromo-6-oxido-3-oxoxanthen-9-yl)benzoate] | 1 | 15876-39-8 | 240-005-7 | 28,6 | ||||||
Dialuminium zinc tetraoxide | 1 | 12068-53-0 | 235-101-0 | 3,3 | ||||||
2,5-Diaminobenzenesulfonic acid | 1 | 88-45-9 | 201-832-9 | 49,3 | 100969 | |||||
4,4'-Diamino[1,1'-bianthracene]-9,9',10,10'-tetraone | 1 | 4051-63-2 | 223-754-4 | 3 | 116060 | |||||
1,4-Diaminobutane | 1 | 110-60-1 | 203-782-3 | 7,3 | 7,3 | 491177 | ||||
4,11-Diamino-2-[3-(2-methoxyethoxy)propyl]-1H-naphth[2,3-f]isoindole-1,3,5,10(2H)-tetrone | 1 | 65059-45-2 | 265-334-3 | 40,83 | ||||||
4,11-Diamino-2-(3-methoxypropyl)-1H-naphth[2,3-f]isoindol-1,3,5,10(2H)-tetrone | 1 | 12217-80-0 | 235-402-7 | 40,83 | ||||||
1,5-Diaminopentane | 1 | 462-94-2 | 207-329-0 | 1,175 | 493089 | |||||
L-(+)-2,5-Diaminopentanoic acid | 1 | 3184-13-2 | 221-678-6 | 849,9 | ||||||
2-(2,4-Diaminophenoxy)ethanol dihydrochloride | 1 | 66422-95-5 | 266-357-1 | 0,7 | ||||||
1,3-Diaminopropane | 1 | 109-76-2 | 203-702-7 | 3 | 491175 | |||||
1,2-Diaminotoluene, ethoxylated and propoxylated. | 1 | 67800-94-6 | 614-144-2 | 3,9 | ||||||
1,2-Diaminotoluene, propoxylated | 1 | 1228577-90-9 | 918-139-9 | 3,9 | ||||||
Diamminedichloropalladium | 1 | 14323-43-4 | 238-269-3 | 17,5 | ||||||
Diammonio(ethyl)[4-[[4-[ethyl(3-sulphonatobenzyl)amino]phenyl](2-sulphonatophenyl)methylene]cyclohexa-2,5-dien-1-ylidene](3-sulphonatobenzyl)ammonium | 1 | 2650-18-2 | 220-168-0 | 88,3 | ||||||
Diammonium bis[carbonato-O]dihydroxyzirconate | 1 | 68309-95-5 | 269-682-7 | 5,9 | 154942 | |||||
Diammonium copper ethylenediaminetetraacetate | 1 | 67989-88-2 | 268-018-3 | 1,8 | 153483 | |||||
Diammonium dimolybdate | 1 | 27546-07-2 | 248-517-2 | 19,79 | 136435 | |||||
Diammonium ethylenediaminetetraacetate | 1 | 20824-56-0 | 244-063-4 | 1,5 | 132718 | |||||
Diammonium tetrachlorozincate | 1 | 14639-97-5 | 238-687-6 | 1 | 491516 | |||||
Diammonium zinc ethylenediaminetetraacetate | 1 | 67859-51-2 | 267-400-7 | 10 | 30 | 152934 | ||||
Diammonium [N,N-bis[2-[bis(carboxymethyl)amino]ethyl]glycinato(5-)]ferrate(2-) (53 % aqueous solution) | 1 | 85959-68-8 | 289-064-0 | 10 | 22 | 172180 | ||||
Diammonium decaborate | 1 | 12007-89-5 | 234-521-1 | 7,1 | 5,4 | 124713 | ||||
Diammonium [[N,N'-ethylenebis[N-(carboxymethyl)glycinato]](4-)-N,N',O,O',ON,ON']hydroxyferrate(2-) | 1 | 68413-60-5 | 270-232-7 | 2 | 155424 | |||||
Diammonium [[N,N'-ethylenebis[N-(carboxymethyl)glycinato]](4-)-N,N',O,O',ON,ON']manganate(2-) | 1 | 94233-07-5 | 304-037-6 | 10 | ||||||
Diammonium hexachloropalladate | 1 | 19168-23-1 | 242-854-9 | 4,7 | ||||||
Diammonium hydrogen phosphate | 1 | 7783-28-0 | 231-987-8 | 5,9 | 2110 | |||||
Diammonium peroxodisulfate | 1 | 7727-54-0 | 231-786-5 | 0,824 | 2310 | |||||
Diammonium phosphonate | 1 | 22132-71-4 | 244-797-5 | 41,2 | ||||||
Diarsenic trioxide | 1 | 1327-53-3 | 215-481-4 | 0,005 | EU | Carcinogenic | 2100 | |||
3-(Diaryl)[1,3,5]triazin-2yl)-5-(alkoxy substituted)-phenol | 1 | - | 440-520-9 | 23,5 | ||||||
Diatomaceous silica, flux-calcined | 1 | 68855-54-9 | 272-489-0 | 0,05 | TRGS900 | MAK | 491121 | |||
1,4-Diazabicyclo(2.2.2)octane | 1 | 280-57-9 | 205-999-9 | 8,24 | 33370 | |||||
1,8-Diazabicyclo[5.4.0]undec-7-ene | 1 | 6674-22-2 | 229-713-7 | 10,6 | 494771 | |||||
6-Diazo-5,6-dihydro-5-oxonaphthalene-2-sulphonyl chloride | 1 | 3770-97-6 | 223-211-1 | 1,64 | ||||||
Di(benzothiazol-2-yl) disulfide | 1 | 120-78-5 | 204-424-9 | 8,8 | 14820 | |||||
6H-Dibenz[c,e][1,2]oxaphosphorin 6-oxide | 1 | 35948-25-5 | 252-813-7 | 27,5 | ||||||
Dibenzoyl peroxide | 1 | 94-36-0 | 202-327-6 | 39 | TRGS900 | MAK | 21630 | |||
Dibenzylbenzene, ar-methyl derivative | 1 | 53585-53-8 | 258-649-2 | 0,259 | ||||||
Dibenzylbenzene, ar-methyl derivative | 2 | 53585-53-8 | 258-649-2 | 3,5 | ||||||
Dibenzyl ether | 1 | 103-50-4 | 203-118-2 | 43,7 | 31430 | |||||
3,9-Dibenzyl-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane 3,9-dioxide | 1 | 20544-37-0 | 243-869-3 | 32,9 | ||||||
Dibismuth carbonate dioxide | 1 | 5892-10-4 | 227-567-9 | 3,8 | ||||||
1,2-Dibromoethane | 1 | 106-93-4 | 203-444-5 | 2,3 | TRGS900 | EU | Carcinogenic | 13440 | ||
Dibromomethane | 1 | 74-95-3 | 200-824-2 | 3 | 30900 | |||||
Dibutoxydibutylstannane | 1 | 3349-36-8 | 222-103-1 | 0,01 | TRGS900 | MAK | 490399 | |||
2,6-Di-tert-butyl-alpha-dimethylamino-p-cresol | 1 | 88-27-7 | 201-816-1 | 2,11 | 100956 | |||||
Dibutyl terephthalate | 1 | 1962-75-0 | 217-803-9 | 34,5 | 111365 | |||||
Di-n-butylamine | 1 | 111-92-2 | 203-921-8 | 5,025 | TRGS900 | 27780 | ||||
2-Dibutylaminoethanol | 1 | 102-81-8 | 203-057-1 | 1,5 | 2,22 | 71190 | ||||
6'-(Dibutylamino)-3'-methyl-2'-(phenylamino)spiro(isobenzofuran-1(3H),9-(9H)-xanthen)-3-one | 1 | 89331-94-2 | 403-830-5 | 49,3 | 530638 | |||||
6'-(Dibutylamino)-3'-methyl-2'-(phenylamino)spiro(isobenzofuran-1(3H),9-(9H)-xanthen)-3-one | 2 | 89331-94-2 | 403-830-5 | 35,26 | 530638 | |||||
Dibutyl [[bis[(2-ethylhexyl)oxy]phosphinothioyl]thio]succinate | 1 | 68413-48-9 | 270-220-1 | 49,3 | ||||||
2,6-Di-tert-butyl-4-(4,6-bis(octylthio)-1,3,5-triazin-2-ylamino)phenol | 1 | 991-84-4 | 213-590-1 | 3 | 3 | 493840 | ||||
6,6'-Di-tert-butyl-4,4'-butylidenedi-m-cresol | 1 | 85-60-9 | 201-618-5 | 9,87 | 492461 | |||||
Di-tert-butyl sec-butylidene diperoxide | 1 | 2167-23-9 | 218-507-2 | 2,65 | ||||||
2,6-Di-tert-butyl-p-cresol | 1 | 128-37-0 | 204-881-4 | 3,5 | TRGS900 | MAK | 14260 | |||
Di-tert-butyldicarbonate | 1 | 24424-99-5 | 246-240-1 | 2,42 | 495373 | |||||
Dibutyldi(2-ethylhexyloxycarbonylmethylthio)stannane | 1 | 10584-98-2 | 234-186-1 | 0,3 | TRGS900 | MAK | 490521 | |||
2,2-Dibutyl-1,3,2-dioxastannepin-4,7-dione | 1 | 78-04-6 | 201-077-5 | 0,01 | TRGS900 | MAK | 490090 | |||
Dibutyl [(dipropoxyphosphinothioyl)thio]succinate | 1 | 68413-47-8 | 270-219-6 | 2,47 | ||||||
Dibutyl ether | 1 | 142-96-1 | 205-575-3 | 13 | 28060 | |||||
1-(9,9-Dibutyl-9H-fluoren-2-yl)-2-methyl-2-morpholin-4-yl-propan-1-one | 1 | 2020359-04-8 | 819-558-9 | 11,754 | ||||||
N,N-Di-n-butylformamide | 1 | 761-65-9 | 212-090-0 | 2,4 | 531219 | |||||
Dibutyl fumarate | 1 | 105-75-9 | 203-327-9 | 2,2 | 492679 | |||||
Dibutyl hydrogen phosphate | 1 | 107-66-4 | 203-509-8 | 1 | 1,25 | 20430 | ||||
5,7-Di-tert-butyl-3-[4-(2-hydroxyethoxy)phenyl]-1-heteropolycycl-2(3H)-one | 1 | - | 0,12 | |||||||
Dibutyl maleate | 1 | 105-76-0 | 203-328-4 | 5,28 | 5,28 | 28880 | ||||
2,6-Di-tert-butyl-4-nonylphenol | 1 | 4306-88-1 | 224-320-7 | 7,84 | ||||||
Di-tert-butyl peroxide | 1 | 110-05-4 | 203-733-6 | 20 | 19060 | |||||
Dibutyl peroxydicarbonate | 1 | 16215-49-9 | 240-344-0 | 4,93 | ||||||
1,1-Di(tert-butylperoxy)-3,3,5-trimethylcyclohexane | 1 | 6731-36-8 | 229-782-3 | 1,4 | 532547 | |||||
2,6-Di-tert-butylphenol | 1 | 128-39-2 | 204-884-0 | 70,61 | 16570 | |||||
2,4-Di-tert-butylphenol | 1 | 96-76-4 | 202-532-0 | 44,1 | 492569 | |||||
2,4-Di-tert-butylphenyl 3,5-di-tert-butyl-4-hydroxybenzoate | 1 | 4221-80-1 | 224-166-0 | 10 | ||||||
N,N'-Di-sec-butyl-1,4-phenylenediamine | 1 | 101-96-2 | 202-992-2 | 0,035 | 13870 | |||||
Dibutyl phosphite | 1 | 1809-19-4 | 217-316-1 | 17,3 | 110978 | |||||
Dibutyl phthalate | 1 | 84-74-2 | 201-557-4 | 0,13 | TRGS900 | MAK | 21620 | |||
Dibutyl phthalate | 2 | 84-74-2 | 201-557-4 | 4,17 | TRGS900 | MAK | 21620 | |||
Di-tert-butyl 1,1,4,4-tetramethylbut-2-yn-1,4-ylene diperoxide | 1 | 1068-27-5 | 213-944-5 | 10,58 | ||||||
6,6'-Di-tert-butyl-4,4'-thiodi-m-cresol | 1 | 96-69-5 | 202-525-2 | 2,8 | 492568 | |||||
6,6'-Di-tert-butyl-2,2'-thiodi-p-cresol | 1 | 90-66-4 | 202-009-7 | 16,4 | ||||||
1,3-Dibutyl-2-thiourea | 1 | 109-46-6 | 203-674-6 | 0,14 | ||||||
Dibutyltin bis(methyl maleate) | 1 | 15546-11-9 | 239-594-3 | 0,01 | TRGS900 | MAK | 490570 | |||
Dibutyltin bis(acetylacetonate) | 1 | 22673-19-4 | 245-152-0 | 0,01 | TRGS900 | MAK | 133644 | |||
Dibutyltin bis(2-ethylhexanoate) | 1 | 2781-10-4 | 220-481-2 | 0,01 | TRGS900 | MAK | 490384 | |||
Di-n-butyltin diacetate | 1 | 1067-33-0 | 213-928-8 | 0,0148 | TRGS900 | MAK | 39950 | |||
Dibutyltin dichloride | 1 | 683-18-1 | 211-670-0 | 0,01 | TRGS900 | MAK | 510565 | |||
Di-n-butyltin dilaurate | 1 | 77-58-7 | 201-039-8 | 0,02 | TRGS900 | MAK | 490087 | |||
Dibutyltin oxide | 1 | 818-08-6 | 212-449-1 | 0,01 | TRGS900 | MAK | 490288 | |||
Dicerium tricarbonate | 1 | 537-01-9 | 208-655-6 | 3 | 104889 | |||||
Dichlobenil | 1 | 1194-65-6 | 214-787-5 | 0,08 | 27490 | |||||
Dichlone | 1 | 117-80-6 | 204-210-5 | 0,59 | 510156 | |||||
Dichloride titanium oxide | 1 | 13780-39-7 | 237-430-5 | 8 | 4630 | |||||
Dichloroacetic acid | 1 | 79-43-6 | 201-207-0 | 0,081 | TRGS900 | MAK | 24970 | |||
3-(Dichloroacetyl)-5-(2-furyl)-2,2-dimethyloxazolidine, 2,2-dichloro-1-[5-(2-furyl)-2,2-dimethyl-oxazolidin-3-yl]ethanone | 1 | - | 434-800-1 | 0,037 | ||||||
1,2-Dichlorobenzene | 1 | 95-50-1 | 202-425-9 | 4,2 | TRGS900 | MAK | EU | 11820 | ||
1,4-Dichlorobenzene | 1 | 106-46-7 | 203-400-5 | 46,1 | TRGS900 | MAK | EU | 15430 | ||
1,3-Dichlorobenzene | 1 | 541-73-1 | 208-792-1 | 12 | TRGS900 | MAK | 34510 | |||
2,2'-[(3,3'-Dichlorobiphenyl-4,4'-diyl)bis(azo)]bis[N-(2,4-dimethylphenyl)-3-oxobutyramide] | 1 | 5102-83-0 | 225-822-9 | 3 | MAK | 491427 | ||||
2,2'-[(3,3'-Dichloro[1,1'-biphenyl]-4,4'-diyl)bis(azo)]bis[N-(4-ethoxyphenyl)-3-oxobutyramide] | 1 | 31775-20-9 | 250-799-7 | 3 | 138380 | |||||
2,2'-[(3,3'-Dichlorobiphenyl-4,4'-diyl)bis(azo)]bis[N-(2-methylphenyl)-3-oxobutyramide] | 1 | 5468-75-7 | 226-789-3 | 3 | 491438 | |||||
2,2'-[(3,3'-Dichlorobiphenyl-4,4'-diyl)didiazene-2,1-diyl]bis[N-(2-methoxyphenyl)-3-oxobutanamide] | 1 | 4531-49-1 | 224-867-1 | 3 | 491421 | |||||
Dichlorobis(η-cyclopentadienyl)titanium | 1 | 1271-19-8 | 215-035-9 | 0,59 | ||||||
6,13-Dichloro-3,10-bis(2-(4-fluoro-6-(2-sulfophenylamino)-1,3,5-triazin-2-ylamino)propylamino)-4,11-triphenodioxazinedisulfonic acid, lithium sodium salt | 1 | 163062-28-0 | 418-000-8 | 11,8 | 901893 | |||||
2,3-Dichloro-1,3-butadiene | 1 | 1653-19-6 | 216-721-0 | 8,4 | 2,1 | 11650 | ||||
3,4-Dichloro-N-[5-chloro-4-(2-{4-[(2-hexyldecyl)oxy]benzenesulfonyl}butanamido)-2-hydroxyphenyl]benzamide | 2 | - | 459-290-6 | 14,6 | ||||||
Dichloro(3-chloropropyl)methyl silane | 1 | 7787-93-1 | 232-136-3 | 21,01 | 494860 | |||||
Dichloro(3-chloropropyl)methyl silane | 2 | 7787-93-1 | 232-136-3 | 21 | 494860 | |||||
3,4-Dichloro-N-(2-cyanophenyl)isothiazole-5-carboxamide | 1 | 224049-04-1 | 619-682-1 | 0,21 | ||||||
Dichlorocyclohexylmethylsilane | 1 | 5578-42-7 | 226-956-0 | 21,6 | 118683 | |||||
2,20-Dichloro 13,31-diethyl-4,22-dioxa-13,18,31,36-tetraazanonacyclo-[19.15.0.03,19.05,17.06,14.07,12.023,25.024,32.025,30]hexatriaconta-1(36),2,5,7,9,11,14,16,18,20,23,25,27,29,32,34-hexadecaene | 1 | 215247-95-3 | 606-790-9 | 3 | 49 | |||||
3,5-Dichloro-2,4-difluorobenzoyl fluoride | 1 | 101513-70-6 | 401-800-6 | 1,66 | 4 | 496665 | ||||
Dichlorodifluoromethane | 1 | 75-71-8 | 200-893-9 | 1656,6 | TRGS900 | MAK | 26210 | |||
Dichloro-5,12-dihydroquino[2,3-b]acridine-7,14-dione | 1 | 38720-66-0 | 254-100-6 | 147 | 141229 | |||||
Dichlorodiphenylsilane | 1 | 80-10-4 | 201-251-0 | 29,39 | 2730 | |||||
trans-1,2-Dichloroethylene | 1 | 156-60-5 | 205-860-2 | 797 | TRGS900 | MAK | 510750 | |||
3-[3,5-Dichloro-2-fluoro-4-(1,1,2,3,3,3-hexafluoropropoxy)phenyl]-1-(2,6-difluorobenzoyl)urea | 1 | 121451-02-3 | 601-779-5 | 0,05 | ||||||
1,6-Dichlorohexane | 1 | 2163-00-0 | 218-491-7 | 6,17 | 494173 | |||||
Dichloromethylbenzene, isomers | 1 | 29797-40-8 | 249-854-8 | 14,8 | TRGS900 | 492189 | ||||
2,2-Dichloro-1-(3-methyl-2,3-dihydro-4H-1,4-benzoxazin-4-yl)ethanone | 1 | 98730-04-2 | 619-372-6 | 1 | ||||||
rac-(1R,4S,4aR,8R,8aS)-9-(Dichloromethylidene)-8-hydroxyoctahydro-1,4-methanonaphthalen-5(1H)-one | 1 | - | 941-628-3 | 7,8 | ||||||
N-[9-(Dichloromethylidene)-1,2,3,4-tetrahydro-1,4-methanonaphthalen-5-yl]-3-(difluoromethyl)-1-methyl-1H-pyrazole-4-carboxamide | 1 | 1072957-71-1 | 691-719-4 | 0,478 | ||||||
Dichloromethylphenylsilane | 1 | 149-74-6 | 205-746-2 | 21 | 510638 | |||||
Dichloromethylsilane | 1 | 75-54-7 | 200-877-1 | 12,6 | 4,1 | 3150 | ||||
Dichloromethyl(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)silane | 1 | 73609-36-6 | 277-551-0 | 50,6 | ||||||
Dichloromethyl(3,3,3-trifluoropropyl)silane | 1 | 675-62-7 | 211-623-4 | 24,5 | 106758 | |||||
Dichloromethylvinylsilane | 1 | 124-70-9 | 204-710-3 | 15,5 | 4,9 | 492879 | ||||
2,4-Dichlorophenoxyacetic acid sodium salt | 1 | 2702-72-9 | 220-290-4 | 1,5 | MAK | 10930 | ||||
N,N'-(2,5-Dichloro-1,4-phenylene)bis[4-[[2-chloro-5-(trifluoromethyl)phenyl]azo]-3-hydroxynaphthalene-2-carboxamide] | 1 | 52238-92-3 | 257-776-0 | 3 | 144466 | |||||
N,N'-(2,5-Dichloro-1,4-phenylene)bis[4-[(2,5-dichlorophenyl)azo]-3-hydroxynaphthalene-2-carboxamide] | 1 | 40618-31-3 | 255-005-2 | 3 | 142028 | |||||
α-(2,4-Dichlorophenyl)-1H-imidazole-1-ethanol | 1 | 24155-42-8 | 246-042-5 | 0,235 | ||||||
2-(2,4-Dichlorophenyl)-2-(1H-imidazol-1-ylmethyl)-1,3-dioxolane-4-methanol | 1 | 84682-23-5 | 283-585-7 | 1,175 | ||||||
cis-2-(2,4-Dichlorophenyl)-2-(1H-imidazol-1-ylmethyl)-1,3-dioxolane-4-ylmethyl methanesulphonate monohydrochloride | 1 | 84145-27-7 | 282-252-3 | 0,039 | ||||||
[(2R)-2-(2,4-Dichlorophenyl)-2-(1H-1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methyl methanesulfonate hydrochloride | 1 | 155661-07-7 | 445-550-6 | 0,059 | ||||||
1,2-Dichloropropane | 1 | 78-87-5 | 201-152-2 | 28,88 | Carcinogenic | 13500 | ||||
4,11-Dichloroquinacridone | 1 | 3089-16-5 | 221-423-9 | 3 | 147 | 114170 | ||||
2,9-Dichloroquinacridone | 1 | 3089-17-6 | 221-424-4 | 3 | 147 | 114171 | ||||
4,7-Dichloroquinoline | 1 | 86-98-6 | 201-714-7 | 45,9 | ||||||
Dichlorosilane | 1 | 4109-96-0 | 223-888-3 | 11 | 39490 | |||||
4,6-Dichloro-N-(1,1,3,3-tetramethylbutyl)-1,3,5-triazin-2-amine | 1 | 72058-41-4 | 276-309-1 | 0,658 | ||||||
Dichlorotricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaene, mixed isomers | 1 | 28804-46-8 | 249-236-8 | 1,64 | ||||||
Dichromium tris(chromate) | 1 | 24613-89-6 | 246-356-2 | 0,043 | EU | Carcinogenic | 5360 | |||
Dicopper chloride trihydroxide | 1 | 1332-65-6 | 215-572-9 | 1 | 1 | MAK | 1600 | |||
Dicopper hydroxide phosphate | 1 | 12158-74-6 | 235-285-2 | 0,022 | ||||||
Dicopper oxide | 1 | 1317-39-1 | 215-270-7 | 1 | 1 | MAK | 4790 | |||
Dicopper sulphide | 1 | 22205-45-4 | 244-842-9 | 1 | 1 | MAK | 4520 | |||
3-((3,4-Dicyanophenyl)sulfonyl)-N-(2-hydroxypropyl)propane-1-sulfonamide | 1 | 569316-81-0 | 611-431-4 | 16,4 | ||||||
3,9-Dicyclohex-3-enyl-2,4,8,10-tetraoxaspiro[5.5]undecane | 1 | 6600-31-3 | 229-542-8 | 29,3 | 491461 | |||||
Dicyclohexylamine | 1 | 101-83-7 | 202-980-7 | 0,353 | TRGS900 | 14910 | ||||
N,N-Dicyclohexylbenzothiazole-2-sulfenamide | 1 | 4979-32-2 | 225-625-8 | 5 | 14920 | |||||
Dicyclohexylcarbodiimide | 1 | 538-75-0 | 208-704-1 | 0,212 | 570117 | |||||
4,8-Dicyclohexyl-6-hydroxy-2,10-dimethyl-12H-dibenzo[d,g][1,3,2]dioxaphosphocin | 1 | 73912-21-7 | 277-633-6 | 164 | ||||||
Dicyclohexyl phthalate | 1 | 84-61-7 | 201-545-9 | 35,2 | 32190 | |||||
Dicyclopentyldimethoxysilane | 1 | 126990-35-0 | 404-370-8 | 16 | 900518 | |||||
N,N-Didecyl-N-methylpoly(oxyethyl)ammonium propionate alpha.-[2-(Didecylmethylammonio)ethyl]-.omega.-hydroxy-poly(oxy-1,2-ethanediyl) propionate | 1 | 94667-33-1 | 619-057-3 | 0,5 | ||||||
2,3-Didehydro-D-erythro-hexono-1,4-lactone | 1 | 89-65-6 | 201-928-0 | 70,5 | 101014 | |||||
2,3-Didehydro-3-O-sodio-D-erythro-hexono-1,4-lactone | 1 | 6381-77-7 | 228-973-9 | 10,57 | 120353 | |||||
Di-tert-dodecyl disulphide | 1 | 27458-90-8 | 248-468-7 | 32,9 | ||||||
Didodecyl 3,3'-thiodipropionate | 1 | 123-28-4 | 204-614-1 | 24,7 | 492865 | |||||
Dierbium trioxide | 1 | 12061-16-4 | 235-045-7 | 18 | ||||||
Diesel fuel | 1 | 68476-34-6 | 270-676-1 | 68,34 | 536303 | |||||
1,4-Diethenylbenzene | 1 | 105-06-6 | 203-266-8 | 120,6 | 530309 | |||||
1,3-Diethenyl-1,1,3,3-tetramethyldisiloxane and its Platinum(0) complexes | 1 | - | 701-315-2 | 0,015 | ||||||
Diethoxydimethylsilane | 1 | 78-62-6 | 201-127-6 | 9,87 | 2700 | |||||
Diethoxymethane | 1 | 462-95-3 | 207-330-6 | 42,7 | 510559 | |||||
Diethoxy(methyl)silane | 1 | 2031-62-1 | 217-982-3 | 9,87 | ||||||
3-(Diethoxymethylsilyl)propylamine | 1 | 3179-76-8 | 221-660-8 | 14 | 114351 | |||||
1,2-Diethoxypropane | 1 | 10221-57-5 | 412-180-1 | 1,64 | 901264 | |||||
Diethylamine | 1 | 109-89-7 | 203-716-3 | 9,6 | 0,64 | TRGS900 | MAK | EU | 13900 | |
Diethylamine | 2 | 109-89-7 | 203-716-3 | 15 | TRGS900 | MAK | EU | 13900 | ||
Diethylamine hydrochloride | 1 | 660-68-4 | 211-541-9 | 1,96 | 0,985 | 491029 | ||||
2-Diethylaminoethanol | 1 | 100-37-8 | 202-845-2 | 10,7 | 18,3 | TRGS900 | MAK | 23860 | ||
2-Diethylaminoethyl methacrylate | 1 | 105-16-8 | 203-275-7 | 4,41 | 510173 | |||||
7-(Diethylamino)-4-methyl-2-benzopyrone | 1 | 91-44-1 | 202-068-9 | 49,3 | ||||||
2-[7-(Diethylamino)-2-oxo-2H-1-benzopyran-3-yl]benzoxazole-5-sulphonamide | 1 | 68427-35-0 | 270-393-3 | 8,82 | ||||||
2-[7-(Diethylamino)-2-oxo-2H-1-benzopyran-3-yl]benzoxazole-5-sulphonamide | 2 | 68427-35-0 | 270-393-3 | 49,3 | ||||||
2-[7-(Diethylamino)-2-oxo-2H-1-benzopyran-3-yl]-1,3-dimethyl-1H-benzimidazolium chloride | 1 | 29556-33-0 | 249-694-9 | 34,1 | ||||||
3-(Diethylamino)phenol | 1 | 91-68-9 | 202-090-9 | 7,346 | 492519 | |||||
[4-[[4-(Diethylamino)phenyl]phenylmethylene]-2,5-cyclohexadien-1-ylidene]diethylammonium acetate | 1 | 76994-37-1 | 278-585-9 | 2,96 | ||||||
2-[2-[4-(Diethylamino)phenyl]vinyl]-1,3,3-trimethyl-3H-indolium acetate | 1 | 64346-30-1 | 264-796-3 | 49,3 | ||||||
N,N-Diethylaniline | 1 | 91-66-7 | 202-088-8 | 0,0616 | 16870 | |||||
1,4-Diethylbenzene | 1 | 105-05-5 | 203-265-2 | 8,82 | TRGS900 | MAK | 27230 | |||
Diethylbenzene, isomers | 1 | 25340-17-4 | 246-874-9 | 21,2 | TRGS900 | MAK | 510560 | |||
Diethyl [[3,5-bis(1,1-dimethylethyl)-4-hydroxyphenyl]methyl]phosphonate | 1 | 976-56-7 | 213-551-9 | 3,9 | ||||||
Diethyl [[3,5-bis(1,1-dimethylethyl)-4-hydroxyphenyl]methyl]phosphonate | 2 | 976-56-7 | 213-551-9 | 8,5 | ||||||
Diethyl carbonate anhydrous | 1 | 105-58-8 | 203-311-1 | 69,792 | 23150 | |||||
Diethyl carbonate anhydrous | 2 | 105-58-8 | 203-311-1 | 17,6 | 23150 | |||||
Diethyl 1-(2,4-dichlorophenyl)-5-methyl-4,5-dihydro-1H-pyrazole-3,5-dicarboxylate | 1 | 135590-91-9 | 603-923-2 | 7 | ||||||
2,2'-Diethyldihexylamine | 1 | 106-20-7 | 203-372-4 | 1,76 | 27730 | |||||
1,3-Diethyldiphenylurea | 1 | 85-98-3 | 201-645-2 | 1,763 | 32170 | |||||
Diethylene glycol divinyl ether | 1 | 764-99-8 | 212-133-3 | 44,1 | 107107 | |||||
Diethylene glycol dibutyl ether | 1 | 112-73-2 | 204-001-9 | 70 | 37360 | |||||
Diethylene glycol diethyl ether | 1 | 112-36-7 | 203-963-7 | 50,05 | 12750 | |||||
Diethylene glycol dimethyl ether | 1 | 111-96-6 | 203-924-4 | 26,8 | TRGS900 | MAK | 37380 | |||
Diethylene glycol monoethyl ether | 1 | 111-90-0 | 203-919-7 | 30 | 61 | TRGS900 | MAK | 33810 | ||
Diethylene glycol monoethylether acetate | 1 | 112-15-2 | 203-940-1 | 10,45 | 490150 | |||||
Diethylene glycol mono-n-hexyl ether | 1 | 112-59-4 | 203-988-3 | 16,3 | 37890 | |||||
Diethylene glycol oleyl ether | 1 | 9004-98-2 | 500-016-2 | 294 | 535037 | |||||
Diethylenetriamine | 1 | 111-40-0 | 203-865-4 | 0,87 | 15,4 | 13400 | ||||
Diethylenetriaminepentaacetate, pentasodium salt | 1 | 140-01-2 | 205-391-3 | 1,5 | 530232 | |||||
Diethyl ether | 1 | 60-29-7 | 200-467-2 | 308 | TRGS900 | MAK | EU | 13600 | ||
Diethyl ethylphosphonate | 1 | 78-38-6 | 201-111-9 | 1,763 | ||||||
Di-(ethyl-2-hexyl) adipate | 1 | 103-23-1 | 203-090-1 | 17,8 | 38220 | |||||
Di(2-ethylhexyl) peroxydicarbonate | 1 | 16111-62-9 | 240-282-4 | 11,75 | 510520 | |||||
Di(2-ethylhexyl)phosphate | 1 | 298-07-7 | 206-056-4 | 1 | 3,52 | 492988 | ||||
N,N-Diethylhydroxylamine | 1 | 3710-84-7 | 223-055-4 | 2,92 | 49,3 | 494441 | ||||
Diethyl malonate | 1 | 105-53-3 | 203-305-9 | 8,468 | 492676 | |||||
ar,ar-Diethyl-ar-methylbenzenediamine | 1 | 68479-98-1 | 270-877-4 | 0,13 | 491745 | |||||
2-(2,6-Diethyl-4-methyl-phenyl)propanediamide | 1 | - | 452-330-3 | 0,74 | ||||||
Diethyl oxalate | 1 | 95-92-1 | 202-464-1 | 0,3 | 38420 | |||||
Diethyl phthalate | 1 | 84-66-2 | 201-550-6 | 10,56 | 32090 | |||||
N,N'-Diethylthiourea | 1 | 105-55-5 | 203-308-5 | 0,14 | 492677 | |||||
2,4-Diethyl-9H-thioxanthen-9-one | 1 | 82799-44-8 | 280-041-0 | 5,14 | ||||||
Difluoroacetic acid | 1 | 381-73-7 | 206-839-0 | 0,097 | 103570 | |||||
1,1-Difluoroethane | 1 | 75-37-6 | 200-866-1 | 2713 | 38990 | |||||
1,1-Difluoroethane | 2 | 75-37-6 | 200-866-1 | 1085,98 | 38990 | |||||
1,1-Difluoroethylene | 1 | 75-38-7 | 200-867-7 | 1045 | 41220 | |||||
Difluoromethane | 1 | 75-10-5 | 200-839-4 | 7035 | 100470 | |||||
2',6'-Difluoro-5-methyl[1,2,4]triazolo[1,5-a]pyrimidine-2-sulfoanilide | 1 | 98967-40-9 | 619-383-6 | 20 | ||||||
{Difluoro[(trifluoroethenyl)oxy]methoxy}trifluoromethane | 1 | 700874-87-9 | 615-064-0 | 40,27 | 80,4 | |||||
(2R,5S)-2-(4-{4-[Difluoro(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl}phenyl)-5-propyloxane | 1 | 700863-48-5 | 615-063-5 | 1,64 | ||||||
2-[Difluoro(3,4,5-trifluorophenoxy)methyl]-1,3-difluoro-5-(4-propylphenyl)benzene | 1 | 303186-20-1 | 608-462-0 | 0,0274 | ||||||
Diheptyl succinate | 1 | 15872-89-6 | 239-996-9 | 22,2 | ||||||
Dihexyl ether | 1 | 112-58-3 | 203-987-8 | 293 | 490153 | |||||
6,15-Dihydroanthrazine-5,9,14,18-tetrone | 1 | 81-77-6 | 201-375-5 | 1,25 | 491215 | |||||
5,12-Dihydro-2,9-dimethylquino[2,3-b]acridine-7,14-dione | 1 | 980-26-7 | 213-561-3 | 3 | 147 | 491345 | ||||
Dihydro-2,2-dioctyl-6H-1,3,2-oxathiastannin-6-one | 1 | 3033-29-2 | 221-218-4 | 0,002 | ||||||
1,3-Dihydro-1,3-dioxo-2H-isoindole-2-hexanoic acid | 1 | 4443-26-9 | 224-675-8 | 2,1 | ||||||
Dihydrogen bis[monoperoxyphthalato(2-)-O1,OO1]magnesate(2-) | 1 | 78948-87-5 | 279-013-0 | 6,12 | ||||||
Dihydrogen (ethyl)[4-[4-[ethyl(3-sulphonatobenzyl)amino](4-hydroxy-2-sulphonatobenzhydrylidene]cyclohexa-2,5-dien-1-ylidene](3-sulphonatobenzyl)ammonium, disodium salt | 1 | 2353-45-9 | 219-091-5 | 89,957 | ||||||
Dihydrogen (ethyl)[4-[[4-[ethyl(3-sulphonatobenzyl)amino]phenyl](2-sulphonatophenyl)methylene]cyclohexa-2,5-dien-1-ylidene](3-sulphonatobenzyl)ammonium, aluminium salt | 1 | 68921-42-6 | 272-939-6 | 112,918 | ||||||
Dihydrogen hexafluorotitanate(2-) 60% aqueous solution | 1 | 17439-11-1 | 241-460-4 | 3,6 | 3,6 | 130517 | ||||
Dihydrogen hexahydroxyplatinate | 1 | 51850-20-5 | 257-471-2 | 0,47 | ||||||
Dihydrogen hexahydroxyplatinate, compound with 2-aminoethanol (1:2) | 1 | 68133-90-4 | 268-717-3 | 0,14 | ||||||
Dihydrogen tetrachloropalladate(2-) | 1 | 16970-55-1 | 241-047-9 | 20,8 | ||||||
Dihydrogen wolframate | 1 | 7783-03-1 | 231-975-2 | 7,9 | ||||||
1,2-Dihydro-6-hydroxy-1,4-dimethyl-2-oxo-5-[[3-[(phenylsulphonyl)oxy]phenyl]azo]nicotinonitrile | 1 | 59312-61-7 | 261-693-5 | 11,76 | ||||||
N-[4-[(9,10-Dihydro-4-hydroxy-9,10-dioxo-1-anthryl)amino]phenyl]acetamide | 1 | 67905-17-3 | 267-636-0 | 49,3 | ||||||
2,4-Dihydro-4-(4-(4-(4-hydroxyphenyl)-1-piperazinyl)phenyl)-2-(1-methylpropyl)-3H-1,2,4-triazol-3-one | 1 | 106461-41-0 | 434-820-9 | 0,118 | 536210 | |||||
1,3-Dihydro-5-methoxy-2H-benzimidazole-2-thione | 1 | 37052-78-1 | 253-326-2 | 19,7 | 140553 | |||||
1,3-Dihydro-4(or 5)-methyl-2H-benzimidazole-2-thione | 1 | 53988-10-6 | 258-904-8 | 0,66 | 491640 | |||||
1,3-Dihydro-4(or 5)-methyl-2H-benzimidazole-2-thione, zinc salt | 1 | 61617-00-3 | 262-872-0 | 1,48 | 491662 | |||||
2-[4,5-Dihydro-4-methyl-4-(1-methylethyl)-5-oxo-1H-imidazol-2-yl]-3-pyridine carboxylate | 1 | 81334-34-1 | 617-219-8 | 58,96 | ||||||
5-[(2,3-Dihydro-6-methyl-2-oxo-1H-benzimidazol-5-yl)azo]barbituric acid | 1 | 72102-84-2 | 276-344-2 | 10 | 10 | |||||
4-[(1,5-Dihydro-3-methyl-5-oxo-1-phenyl-4H-pyrazol-4-ylidene)methyl]-2,4-dihydro-5-methyl-2-phenyl-3H-pyrazol-3-one | 1 | 4702-90-3 | 225-184-1 | 3,53 | ||||||
1,2-Dihydro-5-nitro-3H-1,2,4-triazol-3-one | 1 | 932-64-9 | 213-254-4 | 1,18 | 107914 | |||||
Dihydro-5-octylfuran-2(3H)-one | 1 | 2305-05-7 | 218-971-6 | 8,82 | ||||||
4,5-Dihydro-5-oxo-4-[[4-[[2-(sulphooxy)ethyl]sulphonyl]phenyl]azo]-1-(4-sulphophenyl)-1H-pyrazole-3-carboxylic acid, sodium salt | 1 | 85567-10-8 | 287-722-1 | 11,8 | ||||||
3,4-Dihydro-2,5,7,8-tetramethyl-2-(4,8,12-trimethyltridecyl)-2H-benzopyran-6-ol | 1 | 10191-41-0 | 233-466-0 | 44 | ||||||
1,2-Dihydro-3H-1,2,4-triazol-3-one | 1 | 930-33-6 | 213-214-6 | 0,0822 | ||||||
1,2-Dihydro-2,2,4-trimethylquinoline, oligomers | 1 | 26780-96-1 | 500-051-3 | 7 | 531435 | |||||
Dihydro-3-(tripropenyl)furan-2,5-dione | 1 | 92077-08-2 | 295-556-6 | 1 | 2,3 | |||||
1,3-Dihydroxyacetone | 1 | 96-26-4 | 202-494-5 | 16,4 | 492562 | |||||
1,4-Dihydroxyanthraquinone | 1 | 81-64-1 | 201-368-7 | 2,8 | ||||||
1,4-Dihydroxybenzene | 1 | 123-31-9 | 204-617-8 | 2,1 | 13050 | |||||
3,4-Dihydroxybenzonitrile | 1 | 17345-61-8 | 241-367-9 | 2,47 | ||||||
2,4-Dihydroxybenzophenone | 1 | 131-56-6 | 205-029-4 | 2,08 | 492897 | |||||
4,4'-Dihydroxybiphenyl | 1 | 92-88-6 | 202-200-5 | 8,82 | 15470 | |||||
3alpha,7alpha-Dihydroxy-5beta-cholanic acid | 1 | 474-25-9 | 207-481-8 | 0,67 | 530493 | |||||
2,2''-Dihydroxy-4,4''-(2-hydroxy-propane-1,3-diyldioxy)-dibenzophenone | 1 | 23911-85-5 | 424-210-0 | 11,67 | 531123 | |||||
(9Z)-N-(1,3-Dihydroxyoctadecan-2-yl)octadec-9-enamide | 1 | - | 416-630-8 | 1,64 | ||||||
3,4-Dihydroxy-1-[(Z)-octadec-9-enyl]pyrrolidine-2,5-dione | 1 | - | 9,98 | |||||||
3alpha,7alpha-dihydroxy-12-oxo-5ß-cholan-24-oic acid | 1 | 2458-08-4 | 219-542-6 | 9,8 | 112697 | |||||
2,3-Dihydroxypropyl methacrylate | 1 | 5919-74-4 | 227-642-6 | 7,4 | ||||||
1,4-Dihydroxy-2,2,6,6-tetramethylpiperidinium-2-hydroxy-1,2,3-propanetricarboxylate | 1 | 220410-74-2 | 429-370-5 | 9,8 | 535815 | |||||
2,6-Dihydroxytoluene | 1 | 608-25-3 | 210-155-8 | 4,93 | 531335 | |||||
3,5-Dihydroxy-2,6,6-tris(3-methylbuten-2-yl)-4-(3-methyl-1-oxobutyl)cyclohexa-2,4-dien-1-one | 1 | 468-28-0 | 207-405-3 | 21 | ||||||
Diiodohydroxyquinoline | 1 | 83-73-8 | 201-497-9 | 21157,895 | 100782 | |||||
Diisoamyl ether | 1 | 544-01-4 | 208-857-4 | 1,2 | 493241 | |||||
3-(Diisobutoxy-thiophosphorylsulfanyl)-2-methyl-propionic acid | 1 | - | 434-070-2 | 4,4 | ||||||
Diisobutyldimethoxysilan | 1 | - | 404-020-4 | 1,4 | ||||||
Diisobutyl hexahydrophthalate | 1 | 70969-58-3 | 275-069-5 | 11,7 | 159719 | |||||
Di-isobutyl ketone | 1 | 108-83-8 | 203-620-1 | 53 | 22370 | |||||
Diisobutyl phthalate | 1 | 84-69-5 | 201-553-2 | 2,94 | 490101 | |||||
Diisobutyl phthalate | 2 | 84-69-5 | 201-553-2 | 13,7 | 490101 | |||||
1,5-Diisocyanatopentane | 1 | 4538-42-5 | 807-040-5 | 0,035 | ||||||
Diisodecyl adipate | 1 | 27178-16-1 | 248-299-9 | 2,8 | 495454 | |||||
Diisodecyl phenyl phosphite | 1 | 25550-98-5 | 247-098-3 | 70,5 | 135274 | |||||
Diisodecyl sebacate | 1 | 28473-19-0 | 249-047-0 | 7,9 | ||||||
Diisononyl ester phthalic acid | 1 | 28553-12-0 | 249-079-5 | 51,72 | 21370 | |||||
Di-iso-octyl phtalate | 1 | 117-81-7 | 204-211-0 | 1,6 | TRGS900 | MAK | 17700 | |||
Di-isopropanolamine | 1 | 110-97-4 | 203-820-9 | 6,4 | 17860 | |||||
Diisopropyl adipate | 1 | 6938-94-9 | 230-072-0 | 11,7 | 121281 | |||||
Diisopropylamine | 1 | 108-18-9 | 203-558-5 | 5 | 5 | 27560 | ||||
5-(Diisopropylamino)-2-[[4-(dimethylamino)phenyl]azo]-3-methyl-1,3,4-thiadiazolium trichlorozincate(1-) | 1 | 93783-70-1 | 298-265-2 | 0,576 | ||||||
5-(Diisopropylamino)-2-[[4-(dimethylamino)phenyl]azo]-3-methyl-1,3,4-thiadiazolium methyl sulphate | 1 | 83969-12-4 | 281-589-3 | 1,32 | ||||||
1,3-Diisopropylbenzene | 1 | 99-62-7 | 202-773-1 | 0,57 | 490124 | |||||
1,4-Diisopropylbenzene | 1 | 100-18-5 | 202-826-9 | 0,57 | 490126 | |||||
Diisopropylbenzene hydroperoxide | 1 | 26762-93-6 | 247-988-1 | 49,3 | 491580 | |||||
Diisopropyl-1,1'-biphenyl and tris(1-methylethyl)-1,1'-biphenyl (mixture) | 1 | - | 915-589-8 | 0,192 | ||||||
Diisopropyl 3,3'-[(2,5-dichloro-1,4-phenylene)bis[iminocarbonyl(2-hydroxy-3,1-naphthylene)azo]]bis[4-methylbenzoate] | 1 | 71566-54-6 | 275-639-3 | 3 | 160231 | |||||
Diisopropyl ether | 1 | 108-20-3 | 203-560-6 | 850 | TRGS900 | MAK | 30570 | |||
N,N-Diisopropylethylamine | 1 | 7087-68-5 | 230-392-0 | 4,2 | 4,2 | 494809 | ||||
Diisopropyl peroxydicarbonate | 1 | 105-64-6 | 203-317-4 | 7,4 | 492678 | |||||
Diisotridecyl adipate | 1 | 26401-35-4 | 247-660-8 | 16,32 | 491576 | |||||
Diisotridecyl 3,3'-[(dibutylstannylene)bis(thio)]dipropionate | 1 | 84896-44-6 | 284-461-5 | 0,01 | TRGS900 | MAK | 168088 | |||
Diisotridecyl phthalate | 1 | 27253-26-5 | 248-368-3 | 44,08 | 495456 | |||||
Diisotridecyl phenyl phosphite | 1 | 67874-37-7 | 267-466-7 | 70,5 | ||||||
Diisotridecyl phosphonate | 1 | 70955-74-7 | 275-063-2 | 70,5 | ||||||
Dilauroyl peroxide | 1 | 105-74-8 | 203-326-3 | 35 | 19070 | |||||
Dilithium tetraborate | 1 | 12007-60-2 | 234-514-3 | 7,1 | ||||||
Dimantine | 1 | 124-28-7 | 204-694-8 | 1 | 1 | 491280 | ||||
Dimepranol | 1 | 108-16-7 | 203-556-4 | 2 | 570001 | |||||
Dimethoxydimethylsilane | 1 | 1112-39-6 | 214-189-4 | 88,4 | 108620 | |||||
Dimethoxydimethylsilane | 2 | 1112-39-6 | 214-189-4 | 260 | 260 | 108620 | ||||
1,2-Dimethoxyethane | 1 | 110-71-4 | 203-794-9 | 3,1 | 30730 | |||||
Dimethoxymethylsilane | 1 | 16881-77-9 | 240-914-9 | 78,39 | 130066 | |||||
Dimethoxymethylsilane | 2 | 16881-77-9 | 240-914-9 | 260 | 260 | 130066 | ||||
N-[3-(Dimethoxymethylsilyl)-2-methylpropyl]ethylenediamine | 1 | 23410-40-4 | 245-642-4 | 29,6 | 134070 | |||||
N-[3-(Dimethoxymethylsilyl)propyl]ethylenediamine | 1 | 3069-29-2 | 221-336-6 | 130 | 114099 | |||||
N-[3-(Dimethoxymethylsilyl)propyl]ethylenediamine | 2 | 3069-29-2 | 221-336-6 | 12 | 114099 | |||||
2,2-Dimethoxy-2-phenylacetophenone | 1 | 24650-42-8 | 246-386-6 | 2,11 | 134693 | |||||
N-{2-[(4,6-Dimethoxy-1,3,5-triazin-2-yl)carbonyl]-6-fluorophenyl}-1,1-difluoro-N-methylmethanesulfonamide | 1 | 874195-61-6 | 620-056-5 | 0,28 | ||||||
6,6-Dimethoxy-2,5,5-trimethylhex-2-ene | 1 | 67674-46-8 | 266-885-2 | 36,14 | 14,46 | |||||
1,3-Dimethyl 2-[2-(2-amino-6-chloro-9H-purin-9-yl)ethyl]propanedioate | 1 | - | 473-300-6 | 5,2 | ||||||
N-N-Dimethyl-C12-14-(even numbered)- alkyl-1-amines, reaction products with potassium hydroxide and chloroacetic acid | 1 | - | 939-682-8 | 42,6 | ||||||
N,N-Dimethylacetamide | 1 | 127-19-5 | 204-826-4 | 23 | TRGS900 | MAK | EU | 26970 | ||
N,N-Dimethylacetamide | 2 | 127-19-5 | 204-826-4 | 36 | TRGS900 | MAK | EU | 26970 | ||
N,N-Dimethylacrylamide | 1 | 2680-03-7 | 220-237-5 | 0,207 | 113241 | |||||
Dimethyl adipate | 1 | 627-93-0 | 211-020-6 | 8,3 | TRGS900 | 32130 | ||||
Dimethylamine | 1 | 124-40-3 | 204-697-4 | 3,8 | TRGS900 | MAK | EU | 11030 | ||
2-({2-[4-(Dimethylamino)benzoyloxy]ethyl}(methyl)amino)ethyl 4-(dimethylamino)benzoate | 1 | - | 466-080-8 | 1,64 | ||||||
6-Dimethylamino-3,3-bis(4-dimethylaminophenyl)phthalide | 1 | 1552-42-7 | 216-293-5 | 0,658 | ||||||
2-Dimethylaminoethanol | 1 | 108-01-0 | 203-542-8 | 1,76 | 1,76 | 23090 | ||||
2-[2-(Dimethylamino)ethoxy]ethanol | 1 | 1704-62-7 | 216-940-1 | 24,7 | 110692 | |||||
2-[2-(Dimethylamino)ethoxy]ethanol | 2 | 1704-62-7 | 216-940-1 | 1,07 | 0,48 | 110692 | ||||
2-[2-(Dimethylamino)ethoxy]ethyl N-{3-[2-(2-(dimethylamino)ethoxy)ethoxycarbonylaminomethyl]-3,5,5-trimethylcyclohexyl}carbamate | 1 | - | 441-100-8 | 3,53 | ||||||
2-((2-(2-(Dimethylamino)ethoxy)ethyl)methylamino)ethanol | 1 | 83016-70-0 | 406-080-7 | 3,53 | 530683 | |||||
2-Dimethylaminoethyl acrylate | 1 | 2439-35-2 | 219-460-0 | 0,9 | 0,9 | 494234 | ||||
2-Dimethylaminoethyl methacrylate | 1 | 2867-47-2 | 220-688-8 | 27 | 27 | 32000 | ||||
2-[[2-(Dimethylamino)ethyl]methylamino]ethanol | 1 | 2212-32-0 | 218-658-4 | 1,175 | ||||||
2-Dimethylamino-2-(4-methyl-benzyl)-1-(4-morpholin-4-yl-phenyl-butan-1-one | 1 | 119344-86-4 | 438-340-0 | 1,64 | ||||||
2-(Dimethylamino)-2-methylpropan-1-ol | 1 | 7005-47-2 | 230-279-6 | 52,9 | 121457 | |||||
[4-[alpha-[4-(Dimethylamino)phenyl]benzylidene]cyclohexa-2,5-dien-1-ylidene]dimethylammonium acetate | 1 | 41272-40-6 | 255-288-2 | 0,98 | 142279 | |||||
[4-[alpha-[4-(Dimethylamino)phenyl]benzylidene]cyclohexa-2,5-dien-1-ylidene]dimethylammonium acetate | 2 | 41272-40-6 | 255-288-2 | 2,96 | 142279 | |||||
[4-[[4-(Dimethylamino)phenyl][4-(methylamino)phenyl]methylene]cyclohexa-2,5-dien-1-ylidene]dimethylammonium acetate | 1 | 84434-47-9 | 282-846-2 | 7,43 | ||||||
3-(Dimethylamino)-1-propanol | 1 | 3179-63-3 | 221-659-2 | 5,09 | 8,18 | 494376 | ||||
N-[3-(Dimethylamino)propyl] C6-9 alkyl amides | 1 | - | 948-134-7 | 8,64 | ||||||
N-[3-(Dimethylamino)propyl]-C12-18(even numbered)-alkylamide | 1 | - | 932-121-8 | 5,92 | ||||||
3-[[3-(Dimethylamino)propyl]amino]propiononitrile | 1 | 69852-45-5 | 274-159-1 | 1,32 | ||||||
N'-[3-(Dimethylamino)propyl]-N,N-dimethylpropane-1,3-diamine | 1 | 6711-48-4 | 229-761-9 | 1,47 | 121024 | |||||
N-[3-(Dimethylamino)propyl]docosanamide | 1 | 60270-33-9 | 262-134-8 | 2,96 | ||||||
1,1'-[[3-(Dimethylamino)propyl]imino]bispropan-2-ol | 1 | 63469-23-8 | 264-261-4 | 5,88 | 150144 | |||||
N-[3-(Dimethylamino)propyl]methacrylamide | 1 | 5205-93-6 | 226-002-3 | 26,45 | 491430 | |||||
N-[3-(Dimethylamino)propyl]oleamide | 1 | 109-28-4 | 203-661-5 | 1 | ||||||
N-[3-(Dimethylamino)propyl]stearamide | 1 | 7651-02-7 | 231-609-1 | 1,7 | 122477 | |||||
N-[3-(Dimethylamino)propyl]-3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctanesulphonamide N-oxide | 1 | 80475-32-7 | 279-481-6 | 0,072 | ||||||
N-[3-(Dimethylamino)propyl]-N,N',N'-trimethylpropane-1,3-diamine | 1 | 3855-32-1 | 223-362-3 | 1,5 | ||||||
Dimethylammonium 2,4-dichlorophenoxyacetate | 1 | 2008-39-1 | 217-915-8 | 1,5 | MAK | 11040 | ||||
N,N'-Dimethylaniline | 1 | 121-69-7 | 204-493-5 | 3,406 | TRGS900 | MAK | 16830 | |||
N,N'-Dimethylaniline | 2 | 121-69-7 | 204-493-5 | 1,104 | TRGS900 | MAK | 16830 | |||
Dimethyl 2,2'-azobis(2-methylpropionate) | 1 | 2589-57-3 | 219-976-6 | 9,87 | ||||||
2,2'-Dimethyl-2,2'-azodipropiononitrile | 1 | 78-67-1 | 201-132-3 | 0,14 | 12740 | |||||
alpha,alpha-Dimethylbenzyl hydroperoxide | 1 | 80-15-9 | 201-254-7 | 6 | 33600 | |||||
4-(α,α-Dimethylbenzyl)phenol | 1 | 599-64-4 | 209-968-0 | 0,59 | ||||||
(1R,5S)-2-(6,6-Dimethylbicyclo[3.1.1]hept-2-en-2-yl) ethyl acetate | 1 | 35836-72-7 | 800-940-9 | 2,1 | ||||||
Dimethylbis(oleoyloxy)stannane | 1 | 3865-34-7 | 223-384-3 | 0,006 | ||||||
2,2-Dimethylbutane | 1 | 75-83-2 | 200-906-8 | 5306 | TRGS900 | MAK | 491197 | |||
2,3-Dimethylbutane | 1 | 79-29-8 | 201-193-6 | 5306 | TRGS900 | MAK | 491198 | |||
1,1'-(2,3-Dimethylbutane-2,3-diyl)bis[4-(propan-2-yl)benzene] | 1 | - | 449-400-0 | 10 | ||||||
3,3-Dimethylbutan-2-yl)({6-[(3,3-dimethylbutan-2-yl)amino]hexyl}amine) | 1 | 957787-76-7 | 682-872-8 | 0,01 | ||||||
N,N-Dimethylbutylamine | 1 | 927-62-8 | 213-156-1 | 8,41 | 8,41 | 107852 | ||||
N'-(1,3-Dimethylbutylidene)-3-hydroxy-2-naphthohydrazide | 1 | 214417-91-1 | 435-860-1 | 2,4 | 536249 | |||||
N-(1,3-Dimethylbutyl)-N'-phenyl-p-phenylenediamine | 1 | 793-24-8 | 212-344-0 | 0,69 | TRGS900 | MAK | 493733 | |||
Dimethyl carbonate | 1 | 616-38-6 | 210-478-4 | 34,9 | 510182 | |||||
Dimethyl 1,4-cyclohexanedicarboxylate | 1 | 94-60-0 | 202-347-5 | 20,57 | 491243 | |||||
Dimethylcyclohex-3-ene-1-carbaldehyde | 1 | 27939-60-2 | 248-742-6 | 7,3 | ||||||
1-(5,5-Dimethyl-1-cyclohexen-1-yl)pent-4-en-1-one | 1 | 56973-85-4 | 260-486-7 | 2,52 | ||||||
N,N-Dimethylcyclohexylamine | 1 | 98-94-2 | 202-715-5 | 8,3 | 0,53 | 16840 | ||||
(1S,1'R)-[1-(3',3'-Dimethyl-1'-cyclohexyl)ethoxycarbonyl]methyl propanoate | 1 | - | 431-700-8 | 32,44 | 535814 | |||||
N,N-Dimethyldecanamide | 1 | 14433-76-2 | 238-405-1 | 166,67 | 127945 | |||||
N,N-Dimethyl dec-9-enamide | 1 | 1356964-77-6 | 806-919-0 | 40 | ||||||
N,N-Dimethyldecylamine N-oxide | 1 | 2605-79-0 | 220-020-5 | 6,2 | 113070 | |||||
2,5-Dimethyl-2,5-di-(t-butylperoxy)hexane | 1 | 78-63-7 | 201-128-1 | 11 | 492420 | |||||
Dimethyldichlorosilane | 1 | 75-78-5 | 200-901-0 | 14,2 | 49,4 | 2770 | ||||
N-[(1R,2S)-2,6-Dimethyl-2,3-dihydro-1H-inden-1-yl]-6-[(1RS)-1-fluoroethyl]-1,3,5-triazine-2,4-diamine | 1 | 950782-86-2 | 936-023-6 | 0,536 | ||||||
(2,5-Dimethyl-2,3-dihydro-1H-inden-2-yl)methanol | 1 | - | 437-760-1 | 4,11 | ||||||
Dimethyldioctylammonium chloride | 1 | 5538-94-3 | 226-901-0 | 18,79 | ||||||
2,2-Dimethyl-1,3-dioxane-4,6-dione | 1 | 2033-24-1 | 217-992-8 | 0,93 | ||||||
(3S-cis)-3,6-Dimethyl-1,4-dioxane-2,5-dione | 1 | 4511-42-6 | 224-832-0 | 592 | ||||||
3,5-Dimethyl-1,2-dioxolane-3,5-diol | 1 | 13784-51-5 | 237-438-9 | 4,41 | ||||||
N,N'-Dimethyldiphenylthiuram disufide | 1 | 10591-84-1 | 234-196-6 | 2,3 | 124442 | |||||
1,3-Dimethyl-1,3-diphenylurea | 1 | 611-92-7 | 210-283-4 | 1,763 | 493446 | |||||
Dimethyldisulfide | 1 | 624-92-0 | 210-871-0 | 2,02 | 2,16 | 10510 | ||||
N,N-Dimethyldodecanamide | 1 | 3007-53-2 | 221-117-5 | 166,67 | ||||||
Dimethyl ether | 1 | 115-10-6 | 204-065-8 | 1894 | TRGS900 | MAK | EU | 25460 | ||
2-[(2S,3S)-3-[[(1,1Dimethylethoxy)carbonyl]amino]-2-hydroxy-4-phenylbutyl]-2-[[4-(2pyridinyl)phenyl]methyl]-,1,1-dimethylethyl ester | 1 | 198904-86-8 | 606-396-7 | 48,97 | ||||||
N-(1,1-Dimethylethyl)bis(2-benzothiazolesulfene)amide | 1 | 3741-80-8 | 407-430-1 | 38,5 | 900808 | |||||
4-(1,1-Dimethylethyl)cyclohexyl acrylate | 1 | 84100-23-2 | 282-104-8 | 2,5 | ||||||
4-(1,1-Dimethylethyl)cyclohexyl methacrylate | 1 | 46729-07-1 | 256-277-5 | 2,64 | 143144 | |||||
(6R,7R)-7-[((2Z)-2-[({2-[(1,1-Dimethylethyl)oxy]-1,1-dimethyl-2-oxoethyl}oxy)imino]-2-{2-[(triphenylmethyl)amino]-1,3-thiazol-4-yl}acetyl)amino]-8-oxo-3-(1-pyridiniumylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate | 1 | 84377-83-3 | 617-560-2 | 2,96 | ||||||
1-[4-(1,1-Dimethylethyl)phenyl]-3-(4-methoxyphenyl)propane-1,3-dione | 1 | 70356-09-1 | 274-581-6 | 22,2 | 159285 | |||||
Dimethyl formamide | 1 | 68-12-2 | 200-679-5 | 6 | TRGS900 | MAK | EU | 12220 | ||
Dimethyl glutarate | 1 | 1119-40-0 | 214-277-2 | 8,3 | TRGS900 | 530305 | ||||
2,6-Dimethylheptan-2-ol | 1 | 13254-34-7 | 236-244-1 | 10,05 | 4,02 | |||||
2,6-Dimethylhept-5-enal | 1 | 106-72-9 | 203-427-2 | 17,63 | 7,05 | |||||
N,N-Dimethylhexadecylamine | 1 | 112-69-6 | 203-997-2 | 1 | 1 | 38180 | ||||
5,5-Dimethylhydantoin | 1 | 77-71-4 | 201-051-3 | 60 | 531222 | |||||
Dimethyl [3-[(hydroxymethyl)amino]-3-oxopropyl]phosphonate | 1 | 20120-33-6 | 243-528-9 | 20 | 11,67 | |||||
1,2-Dimethylimidazole | 1 | 1739-84-0 | 217-101-2 | 4,4 | 570008 | |||||
1,3-Dimethyl-2-imidazolidinone | 1 | 80-73-9 | 201-304-8 | 1,1 | 492439 | |||||
Dimethyl isophthalate | 1 | 1459-93-4 | 215-951-9 | 10,58 | 27290 | |||||
Dimethyl itaconate | 1 | 617-52-7 | 210-519-6 | 12,3 | ||||||
Dimethyl maleate | 1 | 624-48-6 | 210-848-5 | 19,4 | 28900 | |||||
Dimethyl (p-methoxybenzylidene)malonate | 1 | 7443-25-6 | 231-185-8 | 8,8 | ||||||
N-(3-{[(Dimethyl{3-[(2-methylacryloyl)amino]propyl}ammonio)acetyl]amino}propyl)-2-hydroxy-N,N,N’,N’,N’-pentamethylpropane-1,3-diaminium trichloride | 1 | 630113-05-2 | 700-055-7 | 71,1 | ||||||
2,2'-Dimethyl-4,4'-methylenebis(cyclohexylamine) | 1 | 6864-37-5 | 229-962-1 | 1 | 0,6 | 496560 | ||||
1,1'-(1,1-Dimethyl-3-methylene-1,3-propanediyl)bisbenzene | 1 | 6362-80-7 | 228-846-8 | 0,53 | 120245 | |||||
2,4-Dimethyl-6-(1-methylpentadecyl)phenol | 1 | 134701-20-5 | 411-220-5 | 8,8 | 901031 | |||||
N-[3-({[2,2-Dimethyl-3-(morpholin-4-yl)propylidene]amino}methyl)-3,5,5-trimethylcyclohexyl]-2,2-dimethyl-3-(morpholin-4-yl)propan-1-imine | 1 | 1217271-02-7 | 700-584-3 | 11,67 | ||||||
3,7-Dimethylnona-2,6-dienenitrile | 1 | 61792-11-8 | 263-214-5 | 13,22 | 5,29 | 149211 | ||||
3,7-Dimethylnona-1,6-dien-3-ol | 1 | 10339-55-6 | 233-732-6 | 3 | 124064 | |||||
N,N-Dimethylnonanamide | 1 | 6225-08-7 | 612-975-5 | 10 | 10 | |||||
Dimethyloctadecyl[3-(trimethoxysilyl)propyl]ammonium chloride | 1 | 27668-52-6 | 248-595-8 | 4,93 | ||||||
(Z)-3,7-Dimethylocta-2,6-dienal | 1 | 106-26-3 | 203-379-2 | 9 | 101647 | |||||
(E)-3,7-Dimethyl-2,6-octadien-1-ol | 1 | 106-24-1 | 203-377-1 | 161,6 | 491258 | |||||
3,7-Dimethylocta-2,6-dienyl acetate | 1 | 16409-44-2 | 240-458-0 | 14,7 | ||||||
N,N-Dimethyloctanamide | 1 | 1118-92-9 | 214-272-5 | 166,67 | 108678 | |||||
3,7-Dimethyloctane-1,7-diol | 1 | 107-74-4 | 203-517-1 | 16,4 | ||||||
2,6-Dimethyl-6-octanol | 1 | 78-69-3 | 201-133-9 | 11,14 | 491208 | |||||
3,7-Dimethyloctan-1-ol | 1 | 106-21-8 | 203-374-5 | 5,3 | 492684 | |||||
3,7-Dimethyloctan-3-yl acetate | 1 | 20780-48-7 | 244-033-0 | 11 | ||||||
(R)-3,7-Dimethyloct-6-enal | 1 | 2385-77-5 | 219-194-5 | 9 | 112438 | |||||
3,7-Dimethyloct-6-enenitrile | 1 | 51566-62-2 | 257-288-8 | 17,6 | 144034 | |||||
(3R)-3,7-Dimethyloct-6-enenitrile | 1 | 35931-93-2 | 695-909-8 | 5,3 | ||||||
2,6-Dimethyloct-7-en-2-ol | 1 | 18479-58-8 | 242-362-4 | 73,5 | 131279 | |||||
(-)-3,7-Dimethyloct-6-en-1-ol | 1 | 7540-51-4 | 231-415-7 | 0,59 | ||||||
Dimethyl(octyl)amine | 1 | 7378-99-6 | 230-939-3 | 0,176 | ||||||
7,7-Dimethyl-3-oxa-6-azaoctan-1-ol | 1 | 87787-67-5 | 400-390-6 | 2,94 | 496622 | |||||
N-(1,1-Dimethyl-3-oxobutyl)acrylamide | 1 | 2873-97-4 | 220-713-2 | 7,3 | 494320 | |||||
N,N-Dimethyl-3-oxobutyramide solution (79,0 - 83,0 %) | 1 | 2044-64-6 | 218-059-8 | 2,917 | 111560 | |||||
2,2-Dimethyl-3-oxopropyl dodecanoate | 1 | 102985-93-3 | 468-880-2 | 14,8 | ||||||
2,4-Dimethylpentan-3-one | 1 | 565-80-0 | 209-294-7 | 3,16 | 510185 | |||||
N-(1,4-Dimethylpentyl)-N'-phenylbenzene-1,4-diamine | 1 | 3081-01-4 | 221-374-3 | 3 | 114132 | |||||
N,N'-Dimethyl-3,4,9,10-perylenedicarboximide | 1 | 5521-31-3 | 226-866-1 | 1,25 | 1,25 | 491439 | ||||
α,α-Dimethylphenethyl butyrate | 1 | 10094-34-5 | 233-221-8 | 4,4 | ||||||
α,α-Dimethylphenethyl acetate | 1 | 151-05-3 | 205-781-3 | 4,4 | ||||||
2,6-Dimethylphenol | 1 | 576-26-1 | 209-400-1 | 2 | 2 | 38870 | ||||
3-{[(2,4)and(2,5)and(2,6)-Dimethylphenyl]and[(2-ethylphenyl)]}-1-{[(2,4)and(2,5)and(2,6)-dimethylphenyl]and[(2-ethylphenyl)]}guanidinium m-[[p-anilinophenyl]azo]benzenesulfonate | 1 | - | 941-492-5 | 0,882 | ||||||
1-(2,4-Dimethylphenylazo)-2-naphthol | 1 | 3118-97-6 | 221-490-4 | 19,7 | ||||||
1,3-Dimethyl-3-phenylbutyl acetate | 1 | 68083-58-9 | 268-407-8 | 8,7 | ||||||
N,N'-(2,5-Dimethyl-1,4-phenylene)bis[4-[(5-chloro-2-methylphenyl)azo]-3-hydroxynaphthalene-2-carboxamide | 1 | 79665-24-0 | 279-211-7 | 3 | 163416 | |||||
1,1-Dimethyl-3-phenylurea | 1 | 101-42-8 | 202-941-4 | 1,411 | 490131 | |||||
Dimethyl phtalate | 1 | 131-11-3 | 205-011-6 | 66,1 | 12790 | |||||
1,4-Dimethylpiperazine | 1 | 106-58-1 | 203-412-0 | 2,23 | 492697 | |||||
2,2-Dimethyl-1,3-propanediol | 1 | 126-30-7 | 204-781-0 | 35 | 13080 | |||||
2,2-Dimethylpropane-1,3-diyl cyclohex-4-ene-1,2-dicarboxylate | 1 | 41026-17-9 | 255-180-5 | 1,25 | 142183 | |||||
2,2-Dimethylpropane-1,3-diyl dinonanoate | 1 | 15834-05-6 | 239-938-2 | 16,4 | ||||||
2,2-Dimethylpropane-1,3-diyl 2-ethylhexanoate | 1 | 28510-23-8 | 249-060-1 | 2,906 | 136895 | |||||
2,2-Dimethylpropan-1-ol, tribromo derivative | 1 | 36483-57-5 | 253-057-0 | 5,88 | 140318 | |||||
(3E)-3-[(3-{[(E)-[2,2-Dimethyl-3-(prop-1-en-2-yloxy)propylidene]amino]methyl}-3,5,5-trimethylcyclohexyl)imino]-2,2-dimethylpropyl acetate | 1 | 1064082-81-0 | 805-722-7 | 7,4 | ||||||
N,N-Dimethylisopropylamine | 1 | 996-35-0 | 213-635-5 | 3,6 | 3,6 | TRGS900 | MAK | 570220 | ||
N,N-Dimethylpropylamine | 1 | 926-63-6 | 213-139-9 | 6,1 | 5,6 | 73330 | ||||
3-[4-[[5-(1,1-Dimethylpropyl)-2-hydroxy-3-nitrophenyl]azo]-4,5-dihydro-3-methyl-5-oxo-1H-pyrazol-1-yl]benzenesulphonamide, reaction products with aqueous organic chromium(III) complex sodium salt, then laked with acidified C10-14-tert-alkyl(linear and bra | 1 | - | 939-383-2 | 10 | ||||||
4-(1,1-Dimethylpropyl)phenol | 1 | 80-46-6 | 201-280-9 | 2,47 | 492431 | |||||
2-(1,1-Dimethylpropyl)phenol | 1 | 3279-27-4 | 221-916-9 | 1,47 | ||||||
Dimethyl propylphosphonate | 1 | 18755-43-6 | 242-555-3 | 1,96 | 131442 | |||||
3,5-Dimethylpyrazole | 1 | 67-51-6 | 200-657-5 | 0,329 | 100379 | |||||
N,N-Dimethylpyridin-4-amine | 1 | 1122-58-3 | 214-353-5 | 0,05 | ||||||
N-[4-[(4,6-Dimethylpyrimidin-2-yl)sulfamoyl]phenyl]-2-methyl-prop-2-enamide | 1 | 59941-98-9 | 611-915-5 | 16,4 | ||||||
Dimethyl sebacate | 1 | 106-79-6 | 203-431-4 | 98,7 | ||||||
Dimethyl succinate | 1 | 106-65-0 | 203-419-9 | 1,1 | 6,7 | TRGS900 | 492698 | |||
Dimethyl sulfide | 1 | 75-18-3 | 200-846-2 | 12,3 | 10590 | |||||
Dimethyl sulfone | 1 | 67-71-0 | 200-665-9 | 16,4 | 492368 | |||||
Dimethyl sulfoxide | 1 | 67-68-5 | 200-664-3 | 265 | 484 | TRGS900 | MAK | 27190 | ||
Dimethyl terephthalate | 1 | 120-61-6 | 204-411-8 | 35 | 25890 | |||||
N,N-Dimethyltetradecylamine | 1 | 112-75-4 | 204-002-4 | 1 | 1 | 101807 | ||||
N,N-Dimethyltetradecylamine N-oxide | 1 | 3332-27-2 | 222-059-3 | 6,2 | 114679 | |||||
N,N-Dimethyl-N-tetradecyltetradecan-1-aminium chloride | 1 | - | 947-726-2 | 1 | 4,93 | |||||
1,3-Dimethyltetrahydro-2(1H)-pyrimidinone | 1 | 7226-23-5 | 230-625-6 | 0,411 | 494819 | |||||
Dimethyltin bis(2-ethylhexyl mercaptoacetate) | 1 | 57583-35-4 | 260-829-0 | 0,18 | TRGS900 | MAK | 490754 | |||
Dimethyltin bis(2-ethylhexyl mercaptoacetate) | 2 | 57583-35-4 | 260-829-0 | 0,01 | TRGS900 | MAK | 490754 | |||
Dimethyltin dichloride | 1 | 753-73-1 | 212-039-2 | 0,017 | TRGS900 | MAK | 490282 | |||
N,N-Dimethyl-p-toluidine | 1 | 99-97-8 | 202-805-4 | 1,224 | 510190 | |||||
N,N-Dimethyl-p-toluidine | 2 | 99-97-8 | 202-805-4 | 1,352 | 510190 | |||||
1,1-Dimethyl-3-(alpha,alpha,alpha-trifluoro-m-tolyl)urea | 1 | 2164-17-2 | 218-500-4 | 0,41 | 490363 | |||||
1,5-Dimethyl-1-vinylhept-4-enyl acetate | 1 | 61931-80-4 | 263-336-9 | 23 | ||||||
N-(Dimethylvinylsilyl)-1,1-dimethyl-1-vinylsilylamine | 1 | 7691-02-3 | 231-701-1 | 152 | 3,53 | 122544 | ||||
Dimorpholine disulfide | 1 | 103-34-4 | 203-103-0 | 0,02 | 0,17 | 492645 | ||||
2,2'-Dimorpholinyldiethyl ether | 1 | 6425-39-4 | 229-194-7 | 7,28 | 120538 | |||||
Dimyristyl peroxydicarbonate | 1 | 53220-22-7 | 258-436-4 | 10 | ||||||
Dineodymium tricarbonate | 1 | 5895-46-5 | 227-579-4 | 2,6 | 119204 | |||||
Dinickel(2+) ion sodium 3-carboxy-5-[(E)-2-(7-oxido-2,6-disulfonaphthalen-1-yl)diazen-1-yl]-1H-1,2,4-triazol-1-ide 3-carboxy-5-[(E)-2-(7-oxido-2-sulfo-6-sulfonatonaphthalen-1-yl)diazen-1-yl]-1H-1,2,4-triazol-1-die | 1 | 738587-10-5 | 443-510-2 | 3,64 | ||||||
Di(µ-2,2´,2´´-nitrilotris(ethanol)-diperchlorato)disodium | 1 | - | 480-340-8 | 0,162 | ||||||
2,4-Dinitroanisole | 1 | 119-27-7 | 204-310-9 | 1,11 | ||||||
2,4-Dinitrophenol | 1 | 51-28-5 | 200-087-7 | 0,117 | 22040 | |||||
Dinonylnaphthalenedisulphonic acid | 1 | 60223-95-2 | 262-110-7 | 7,4 | ||||||
Dinoseb | 1 | 88-85-7 | 201-861-7 | 0,04 | 510197 | |||||
Dinotefuran (ISO); 1-Methyl-2-nitro-3-(tetrahydro-3-furylmethyl)guanidine | 1 | 165252-70-0 | 605-399-0 | 17,9 | 17,9 | |||||
Dioctadecyl 3,3'-thiodipropionate | 1 | 693-36-7 | 211-750-5 | 6,17 | 493651 | |||||
Dioctadecyl disulfide | 1 | 2500-88-1 | 219-702-5 | 105,8 | 494248 | |||||
Dioctadecyl ether | 1 | 6297-03-6 | 228-567-1 | 293 | 120014 | |||||
O,O'-Dioctadecylpentaerythritol bis(phosphite) | 1 | 3806-34-6 | 223-276-6 | 11 | 494451 | |||||
8,8-Dioctyl-1,4-dioxa-7,9-dithia-8-stannacycloundecane-5,11-dione | 1 | 69226-44-4 | 273-920-5 | 0,02 | ||||||
Dioctylbis(2-ethylhexyloxycarbonylmethylthio)stannane | 1 | 26401-97-8 | 247-666-0 | 0,02 | TRGS900 | MAK | 490661 | |||
Di-n-octyl ether | 1 | 629-82-3 | 211-112-6 | 293 | 106388 | |||||
2,2-Dioctyl-1,3,2-oxathiastannolan-5-one | 1 | 15535-79-2 | 239-581-2 | 0,002 | TRGS900 | MAK | 490568 | |||
Dioctyl phosphonate | 1 | 1809-14-9 | 217-315-6 | 4,9 | 110977 | |||||
Dioctyltin dilaurate | 1 | 3648-18-8 | 222-883-3 | 0,004 | TRGS900 | MAK | 490410 | |||
Dioleamide | 1 | 72901-31-6 | 276-974-8 | 70,52 | ||||||
(1S,5R)-6,8-Dioxabicyclo[3.2.1]octan-4-one | 1 | 53716-82-8 | 807-130-4 | 3,53 | ||||||
1,4-Dioxacyclohexadecane-5,16-dione | 1 | 54982-83-1 | 259-423-6 | 176 | 145910 | |||||
1,5,2,4-Dioxadithiane 2,2,4,4-tetraoxide | 1 | 99591-74-9 | 700-464-0 | 30 | 0,056 | |||||
1,3-Dioxepane | 1 | 505-65-7 | 208-015-6 | 120 | 491321 | |||||
2,4-Dioxo-1,3-diazetidine-1,3-bis(methyl-m-phenylene) diisocyanate | 1 | 26747-90-0 | 247-953-0 | 0,02 | ||||||
(1,2-Dioxoethylene)bis(iminoethylene) bis[3-(3,5-di-tert-butyl-4-hydroxyphenyl)propionate] | 1 | 70331-94-1 | 274-572-7 | 98,7 | ||||||
1,3-Dioxolane | 1 | 646-06-0 | 211-463-5 | 3,306 | TRGS900 | MAK | 510204 | |||
3,3'-(3,6-Dioxo-2,3,5,6-tetrahydropyrrolo[3,4-c]pyrrole-1,4-diyl)dibenzonitrile | 1 | - | 412-640-1 | 3 | 901137 | |||||
Dipentaerythritol | 1 | 126-58-9 | 204-794-1 | 11,8 | 492884 | |||||
2,5-Di-t-pentylhydroquinone | 1 | 79-74-3 | 201-222-2 | 1,15 | 490096 | |||||
Di-tert-pentyl peroxide | 1 | 10508-09-5 | 234-042-8 | 20 | 531069 | |||||
1,2-Diphenoxyethane | 1 | 104-66-5 | 203-224-9 | 26 | 101569 | |||||
Diphenyl phosphonate | 1 | 4712-55-4 | 225-202-8 | 0,53 | ||||||
Diphenylacetonitrile | 1 | 86-29-3 | 201-662-5 | 9,32 | ||||||
Diphenylamine, reaction products with Styrene and 2,4,4-Trimethylpentene | 1 | 68921-45-9 | 272-940-1 | 3,53 | 157827 | |||||
Diphenyl carbonate | 1 | 102-09-0 | 203-005-8 | 1,76 | 11500 | |||||
3,6-Diphenyl-2,5-dihydropyrrolo[3,4-c]pyrrole-1,4-dione | 1 | - | 402-400-4 | 3 | 98 | |||||
1,3-Diphenylguanidine | 1 | 102-06-7 | 203-002-1 | 1,2 | 14540 | |||||
N,N'-Diphenylguanidine monohydrochloride | 1 | 24245-27-0 | 246-107-8 | 0,33 | ||||||
Diphenylmethane 4,4'-diisocyanate | 1 | 101-68-8 | 202-966-0 | 0,05 | TRGS900 | MAK | 13110 | |||
Diphenyl methylphosphonate | 1 | 7526-26-3 | 231-388-1 | 2,99 | 122314 | |||||
Diphenyl oxide | 1 | 101-84-8 | 202-981-2 | 7 | 59 | TRGS900 | MAK | EU | 13460 | |
N,N'-Diphenyl-p-phenylenediamine | 1 | 74-31-7 | 200-806-4 | 1,41 | 492383 | |||||
2-Diphenylphosphinobenzoic acid | 1 | 17261-28-8 | 241-293-7 | 0,6 | ||||||
1,3-Diphenylpropane-1,3-dione | 1 | 120-46-7 | 204-398-9 | 2,204 | ||||||
Diphenyl sulfide | 1 | 139-66-2 | 205-371-4 | 11,6 | 15260 | |||||
Diphenyl sulfone | 1 | 127-63-9 | 204-853-1 | 0,56 | 17050 | |||||
Diphenyl(2,4,6-trimethylbenzoyl)phosphine oxide | 1 | 75980-60-8 | 278-355-8 | 0,822 | 162656 | |||||
Diphosphoric acid ammonium salt | 1 | 22690-73-9 | 245-159-9 | 18,06 | ||||||
Diphosphoric acid, compound with 1,3,5-Triazine-2,4,6-triamine (1:2) | 1 | 13518-93-9 | 236-860-0 | 24,25 | ||||||
Diphosphoric acid, compound with 1,3,5-Triazine-2,4,6-triamine | 1 | 15541-60-3 | 239-590-1 | 0,529 | ||||||
Diphosphoric acid, copper salt | 1 | 10102-90-6 | 233-279-4 | 0,267 | 0,044 | MAK | 123703 | |||
Diphosphorus pentasulfide | 1 | 1314-80-3 | 215-242-4 | 1 | TRGS900 | EU | 1520 | |||
Dipotassium bis[μ-[tartrato(4-)-O1,O2:O3,O4]]diantimonate(2-) , stereoisomer | 1 | 11071-15-1 | 234-293-3 | 0,5 | 0,12 | |||||
Dipotassium 2-dodecanamidoacetate 2-tetradecanamidoacetate | 1 | 301341-58-2 | 620-582-5 | 12,3 | ||||||
Dipotassium octaborate | 1 | 12008-39-8 | 686-800-6 | 13,6 | 7,8 | |||||
Dipotassium tin hexahydroxide | 1 | 12027-61-1 | 234-721-9 | 11,9 | ||||||
Dipotassium adipate | 1 | 19147-16-1 | 242-838-1 | 6,94 | ||||||
Dipotassium dihydrogen ethylenediaminetetraacetate | 1 | 2001-94-7 | 217-895-0 | 1,5 | ||||||
Dipotassium disulfite | 1 | 16731-55-8 | 240-795-3 | 263 | 3160 | |||||
Dipotassium [[N,N'-ethylenebis[N-(carboxylatomethyl)glycinato]](4-)-N,N',O,O',ON,ON']zincate(2-) | 1 | 14689-29-3 | 238-729-3 | 10 | 10 | |||||
Dipotassium [[N,N'-ethylenebis[N-(carboxymethyl)glycinato]](4-)-N,N',O,O',ON,ON']cuprate(2-) | 1 | 74181-84-3 | 277-749-7 | 1,8 | ||||||
Dipotassium hexachloropalladate | 1 | 16919-73-6 | 240-974-6 | 5,27 | ||||||
Dipotassium hexacyanocobalt(II)-ferrate(II) | 1 | 12549-23-4 | 603-073-2 | 3,5 | ||||||
Dipotassium hexafluorotitanate | 1 | 16919-27-0 | 240-969-9 | 5,2 | 5,2 | 492167 | ||||
dipotassium hexafluorozirconate | 1 | 16923-95-8 | 240-985-6 | 6,2 | 6,2 | 130123 | ||||
Dipotassium hydrogen phosphate | 1 | 7758-11-4 | 231-834-5 | 19,1 | 5390 | |||||
Dipotassium manganese ethylenediaminetetraacetate | 1 | 68015-77-0 | 268-144-9 | 10 | 153592 | |||||
Dipotassium peroxodisulfate | 1 | 7727-21-1 | 231-781-8 | 0,824 | 1180 | |||||
Dipotassium phosphonate | 1 | 13492-26-7 | 236-809-2 | 41,2 | ||||||
Dipotassium sodium 3-[(E)-2-{4-[(E)-2-{4-[(E)-2-(5-carbamoyl-1-ethyl-2-hydroxy-4-methyl-6-oxo-1,6-dihydropyridin-3-yl)diazen-1-yl]-2-sulfonatophenyl}diazen-1-yl]-2,5-bis(2-hydroxyethoxy)phenyl}diazen-1-yl]-4,5-dihydroxynaphthalene-2,7-disulfonate | 1 | - | 458-890-5 | 0,162 | ||||||
Dipotassium tetraborate | 1 | 1332-77-0 | 215-575-5 | 13,6 | 7,8 | 109644 | ||||
Dipotassium 3,4,5,6-tetrabromophthalate | 1 | 18824-74-3 | 242-604-9 | 8,7 | ||||||
Dipraseodymium trioxide | 1 | 12036-32-7 | 234-845-3 | 5,9 | ||||||
Di(p-propylbenzylidene) alkyl sorbitol | 1 | - | 473-780-7 | 17,1 | ||||||
Dipropylene glycol, mixture of isomers | 1 | 25265-71-8 | 246-770-3 | 238 | TRGS900 | MAK | 13630 | |||
Dipropylene glycol diacrylate | 1 | 57472-68-1 | 260-754-3 | 24,48 | 147066 | |||||
Dipropylene glycol dimethyl ether | 1 | - | 404-640-5 | 133 | 900457 | |||||
Dipropylene glycol, monomethyl ether | 1 | 34590-94-8 | 252-104-2 | 308 | TRGS900 | MAK | EU | 37310 | ||
Dipropylene glycol n-propyl ether | 1 | 29911-27-1 | 249-949-4 | 84 | 137663 | |||||
Disilane, chloro Me derivs. | 1 | 68937-17-7 | 273-054-8 | 12,5 | ||||||
Disodium; 4-Amino-3-{4-[4-(2,4-diamino-phenylazo)-benzenesulfonylamino]-phenylazo}-5-hydroxy-6-phenylazo-naphthalene-2,7-disulfonate | 1 | 157577-99-6 | 605-104-5 | 3,53 | ||||||
Disodium 4,4'-bis[[6-anilino-4-[(2-hydroxyethyl)methylamino]-1,3,5-triazin-2-yl]amino]stilbene-2,2'-disulphonate | 1 | 13863-31-5 | 237-600-9 | 59,42 | 495011 | |||||
Disodium 2,2'-ethene-1,2-diylbis[5-[[4-[(3-amino-3-oxopropyl)(2-hydroxyethyl)amino]-6-anilino-1,3,5-triazin-2-yl]amino]benzenesulfonate] | 1 | 27344-06-5 | 248-420-5 | 59,42 | 136352 | |||||
Disodium 2,2'-ethene-1,2-diylbis[5-[[4-[(3-amino-3-oxopropyl)(2-hydroxyethyl)amino]-6-anilino-1,3,5-triazin-2-yl]amino]benzenesulfonate] | 2 | 27344-06-5 | 248-420-5 | 65 | 136352 | |||||
Disodium hydrogen bis[3-hydroxy-4-[(2-hydroxy-1-naphthyl)azo]naphthalene-1-sulphonato(3-)]chromate(3-) | 1 | 12392-64-2 | 235-628-6 | 24,5 | 125666 | |||||
Disodium 6-hydroxy-5-[[4-[[4-(phenylamino)-3-sulphonatophenyl]azo]naphthyl]azo]naphthalene-2-sulphonate | 1 | 6262-07-3 | 228-412-8 | 5,877 | ||||||
Disodium 8-(phenylamino)-5-[[4-[(5-sulphonatonaphthyl)azo]naphthyl]azo]naphthalenesulphonate | 1 | 3071-73-6 | 221-343-4 | 8,22 | ||||||
Disodium phosphonate | 1 | 13708-85-5 | 237-249-1 | 5,8 | ||||||
Disodium tin hexahydroxide | 1 | 12027-70-2 | 234-724-5 | 11,9 | ||||||
Disodium tin trioxide | 1 | 12058-66-1 | 235-030-5 | 11,9 | ||||||
Disodium adipate | 1 | 7486-38-6 | 231-293-5 | 264 | 122233 | |||||
Disodium 4-amino-3,6-bis[[4-[(2,4-diaminophenyl)azo]phenyl]azo]-5-hydroxynaphthalene-2,7-disufonate | 1 | 6428-31-5 | 229-208-1 | 1,88 | 491458 | |||||
Disodium 1-amino-4-[[4-[(2-bromo-1-oxoallyl)amino]-2-sulphonatophenyl]amino]-9,10-dihydro-9,10-dioxoanthracene-2-sulphonate | 1 | 70209-99-3 | 274-397-6 | 11,76 | ||||||
Disodium 4-amino-3-[[4-[(2,4-diaminophenyl)azo]phenyl]azo]-5-hydroxy-6-(phenylazo)naphthalene-2,7-disulphonate | 1 | 68877-33-8 | 272-559-0 | 1,32 | ||||||
Disodium 4-amino-6-((4-((4-(2,4-diaminophenyl)azo)phenylsulfamoyl)phenyl)azo)-5-hydroxy-3-((4-nitrophenyl)azo)naphthalene-2,7-disulfonate | 1 | 201792-73-6 | 421-880-6 | 2,47 | ||||||
Disodium 4-amino-6-{[4-({4-[(2,4-dihydroxyphenyl)diazenyl]phenyl}sulfamoyl)phenyl]diazenyl}-5-hydroxy-3-[(4-nitrophenyl)diazenyl]naphthalene-2,7-disulfonate | 1 | 1397283-80-5 | 940-267-9 | 3,53 | ||||||
Disodium 7-amino-4-hydroxy-3-[[4-[(4-sulphonatophenyl)azo]phenyl]azo]naphthalene-2-sulphonate | 1 | 6300-50-1 | 228-589-1 | 5,92 | ||||||
Disodium 7-benzamido-4-hydroxy-3-[[4-[(4-sulphonatophenyl)azo]phenyl]azo]naphthalene-2-sulphonate | 1 | 2610-11-9 | 220-028-9 | 23,51 | ||||||
Disodium 2,2'-([1,1'-biphenyl]-4,4'-diyldivinylene)bis(benzenesulphonate) | 1 | 27344-41-8 | 248-421-0 | 20,5 | 495457 | |||||
Disodium 4,4'-bis[6-anilino-[4-[bis(2-hydroxyethyl)amino]-1,3,5-triazin-2-yl]amino]stilbene-2,2'-disulphonate | 1 | 4193-55-9 | 224-073-5 | 59,42 | 494493 | |||||
Disodium 4,4'-bis[6-anilino-[4-[bis(2-hydroxyethyl)amino]-1,3,5-triazin-2-yl]amino]stilbene-2,2'-disulphonate | 2 | 4193-55-9 | 224-073-5 | 9,87 | 494493 | |||||
Disodium 4,4'-bis[6-anilino-[4-[bis(2-hydroxyethyl)amino]-1,3,5-triazin-2-yl]amino]stilbene-2,2'-disulphonate | 3 | 4193-55-9 | 224-073-5 | 65 | 494493 | |||||
Disodium 4,4'-bis[[4-anilino-6-[(2-hydroxyethyl)amino]-1,3,5-triazin-2-yl]amino]stilbene-2,2'-disulphonate | 1 | 17958-73-5 | 241-883-4 | 59,42 | 130868 | |||||
Disodium 4,4'-bis[(4-anilino-6-morpholino-1,3,5-triazin-2-yl)amino]stilbene-2,2'-disulphonate | 1 | 16090-02-1 | 240-245-2 | 130 | 495129 | |||||
Disodium 4,4'-bis[(4-anilino-6-morpholino-1,3,5-triazin-2-yl)amino]stilbene-2,2'-disulphonate | 2 | 16090-02-1 | 240-245-2 | 734,649 | 495129 | |||||
Disodium [N,N-bis[2-[bis(carboxymethyl)amino]ethyl]glycinato(5-)]ferrate(2-) | 1 | 19529-38-5 | 243-136-8 | 10 | 22 | 131938 | ||||
Disodium 4,4'-bis[(4,6-dianilino-1,3,5-triazin-2-yl)amino]stilbene-2,2'-disulfonate | 1 | 133-66-4 | 205-117-2 | 9,7 | 492900 | |||||
Disodium 7-[[4,6-bis[(2-hydroxyethyl)amino]-1,3,5-triazin-2-yl]amino]-4-hydroxy-3-[[4-[(4-sulphonatophenyl)azo]phenyl]azo]naphthalene-2-sulphonate | 1 | 68201-95-6 | 269-246-6 | 23,5 | ||||||
Disodium 4-[4-[[5-[(2-bromo-1-oxoallyl)amino]-2-sulphonatophenyl]azo]-4,5-dihydro-3-methyl-5-oxo-1H-pyrazol-1-yl]-2,5-dichlorobenzenesulphonate | 1 | 70247-70-0 | 274-499-0 | 11,67 | ||||||
Disodium 2-[[5-carbamoyl-1-ethyl-1,6-dihydro-2-hydroxy-4-methyl-6-oxo-3-pyridyl]azo]-4-[[4-chloro-6-[[3-[[2-(sulphonatooxy)ethyl]sulphonyl]phenyl]amino]-1,3,5-triazin-2-yl]amino]benzenesulphonate | 1 | 84000-63-5 | 281-619-5 | 44,6 | ||||||
Disodium 2-[(5-carbamoyl-1-ethyl-2-hydroxy-4-methyl-6-oxo-1,6-dihydropyridin-3-yl)diazenyl]-4-[[4-chloro-6-[[4-[[2-(sulfonatooxy)ethyl]sulfonyl]phenyl]amino]-1,3,5-triazin-2-yl]amino]-benzenesulfonate | 1 | - | 412-720-6 | 58,33 | ||||||
Disodium 7-{[4-chloro-6-(dodecylamino)-1,3,5-triazin-2-yl]amino}-4-hydroxy-3-(2-{4-[2-(4-sulfonatophenyl)diazen-1-yl]phenyl}diazen-1-yl)naphthalene-2-sulfonate | 1 | 145703-76-0 | 415-510-2 | 3,5 | ||||||
Disodium dihydrogen ethylenediaminetetraacetate | 1 | 139-33-3 | 205-358-3 | 1,5 | 13030 | |||||
Disodium dihydrogenpyrophosphate | 1 | 7758-16-9 | 231-835-0 | 17,63 | 4870 | |||||
Disodium dihydrogenpyrophosphate | 2 | 7758-16-9 | 231-835-0 | 44,08 | 4870 | |||||
Disodium [2,4-dihydro-4-[(2-hydroxy-5-nitrophenyl)azo]-5-methyl-2-phenyl-3H-pyrazol-3-onato(2-)][3-hydroxy-4-[(2-hydroxy-1-naphthyl)azo]-7-nitronaphthalene-1-sulphonato(3-)]chromate(2-) | 1 | 70236-60-1 | 274-490-1 | 0,94 | ||||||
Disodium 4,4'-[[2,4-dihydroxy-5-(hydroxymethyl)-1,3-phenylene]bis(azo)]bisnaphthalene-1-sulphonate | 1 | 4553-89-3 | 224-924-0 | 14,693 | ||||||
Disodium disilicate | 1 | 13870-28-5 | 237-623-4 | 11,21 | 127312 | |||||
Disodium 3,3'-dithiobis[propanesulphonate] | 1 | 27206-35-5 | 248-324-3 | 98,74 | ||||||
Disodium 5-(5-(fluoro-2-substitued-alkylamino)-heteromonocyclylamino)-2- sulphonatophenylazo)-1-alkyl-1,2-dihydro-6-hydroxy-4-alkyl-2-oxo-3- pyridinealkanesulphonate | 1 | - | 402-740-3 | 2,35 | ||||||
Disodium hexafluorosilicate | 1 | 16893-85-9 | 240-934-8 | 2,5 | 2,5 | 500031 | ||||
Disodium hydrogen phosphate | 1 | 7558-79-4 | 231-448-7 | 15,47 | 1660 | |||||
Disodium hydrogen phosphate | 2 | 7558-79-4 | 231-448-7 | 4,07 | 1660 | |||||
Disodium [1-{[2-(hydroxy-kO)-3,5-dinitrophenyl]diazenyl-kN1}naphthalen-2-olato(2-)-kO][3-(hydroxy-kO)-4-{[2-(hydroxy-kO)naphthalen-1-yl]diazenyl-kN1}-7-nitronaphthalene-1-sulfonato(3-)]chromate(2-) {SIDSep} Disodium [1-{[2-(hydroxy-kO)-3,5-dinitrophenyl]d | 1 | - | 944-038-4 | 11,76 | ||||||
Disodium 2-hydroxyethyliminodi(acetate) | 1 | 135-37-5 | 205-187-4 | 2,9 | 102448 | |||||
Disodium [4-hydroxy-3-[(2-hydroxy-4-nitrophenyl)azo]naphthalene-1-sulphonato(3-)][1-[(2-hydroxy-4-nitrophenyl)azo]-2-naphtholato(2-)]chromate(2-) | 1 | 68541-71-9 | 271-351-7 | 11,67 | ||||||
Disodium 6-hydroxy-5-[(2-methoxy-4-sufonato-m-tolyl)azo]naphthalene-2-sufonate | 1 | 25956-17-6 | 247-368-0 | 16,4 | 135498 | |||||
Disodium 2-({2-hydroxy-3-[2-(4-nonylphenoxy)ethoxy]propyl}(methyl)amino)acetate 2-{[3-({1-chloro-3-[2-(4-nonylphenoxy)ethoxy]propan-2-yl}oxy)-2-hydroxypropyl](methyl)amino}acetate | 1 | 75627-31-5 | 616-248-3 | 97,8 | ||||||
Disodium 6-hydroxy-5-[(4-sufonatophenyl)azo]naphthalene-2-sufonate | 1 | 2783-94-0 | 220-491-7 | 1469,298 | 491393 | |||||
Disodium hydroxy(sulfonato)acetate | 1 | 29736-24-1 | 608-408-6 | 21,8 | ||||||
Disodium 2-[N-hydroxy-N-(2-sulfonatoethyl)amino]ethane-1-sulfonate | 1 | 133986-51-3 | 407-370-6 | 10 | 22 | |||||
Disodium C-isodecyl sulphonatosuccinate | 1 | 37294-49-8 | 253-452-8 | 46,67 | ||||||
Disodium metasilicate | 1 | 6834-92-0 | 229-912-9 | 6,22 | 2350 | |||||
Disodium octaborate | 1 | 12008-41-2 | 234-541-0 | 6,9 | TRGS900 | 490523 | ||||
Disodium (Z)-4-(9-octadecenylamino)-4-oxo-2(or 3)-sufonatobutyrate | 1 | 58353-68-7 | 261-222-3 | 93,34 | 147478 | |||||
Disodium 4-[2-[(1-oxoundec-10-enyl)amino]ethyl] 2-sulphonatosuccinate | 1 | 26650-05-5 | 247-873-6 | 233,36 | ||||||
Disodium 2,2'-(1,4-Phenylene)bis-(1H-benzimidazole-4,6-disulfonic acid or monosulfonic acid, monosulfonate or disulfonate | 1 | 180898-37-7 | 429-750-0 | 10 | ||||||
Disodium sebacate | 1 | 17265-14-4 | 241-300-3 | 35,26 | ||||||
Disodium succinate | 1 | 150-90-3 | 205-778-7 | 41,1 | 491072 | |||||
Disodium sulfide | 1 | 1313-82-2 | 215-211-5 | 1,6 | 13,84 | 1390 | ||||
Disodium tetraborate | 1 | 1330-43-4 | 215-540-4 | 6,7 | TRGS900 | MAK | 1820 | |||
Disodium tetrachloropalladate | 1 | 13820-53-6 | 237-502-6 | 24,4 | ||||||
Disodium 2-(2,4,5,7-tetraiodo-6-oxido-3-oxoxanthen-9-yl)benzoate | 1 | 16423-68-0 | 240-474-8 | 59,935 | 129689 | |||||
Disodium tungstate | 1 | 13472-45-2 | 236-743-4 | 3 | 126583 | |||||
Disononyl adipate | 1 | 33703-08-1 | 251-646-7 | 8,9 | 495584 | |||||
Distillate of avocado oil, Persea gratissima, Lauraceae | 1 | - | 2,82 | |||||||
Distillates (coal tar); Heavy Anthracene Oil | 1 | 65996-92-1 | 266-027-7 | 1,9 | 1,28 | |||||
Distillates (coal tar), pitch; Heavy Anthracene Oil | 1 | 101316-49-8 | 309-855-7 | 1,9 | 1,28 | |||||
Distillates (Fischer-Tropsch), C8-10-branched and linear | 1 | 1345668-41-8 | 694-876-7 | 2035 | ||||||
Distillates (petroleum), catalytic reformed depentanizer | 1 | 68475-79-6 | 270-660-4 | 837,5 | ||||||
Distillates (petroleum), catalytic reformed depentanizer | 2 | 68475-79-6 | 270-660-4 | 837,5 | 1,9 | |||||
Distillates (petroleum), clay-treated heavy naphthenic | 1 | 64742-44-5 | 265-146-1 | 5,6 | 2,7 | |||||
Distillates (petroleum), clay-treated heavy naphthenic | 2 | 64742-44-5 | 265-146-1 | 5,6 | ||||||
Distillates (petroleum), clay-treated heavy naphthenic | 3 | 64742-44-5 | 265-146-1 | 5,58 | 2,73 | |||||
Distillates (petroleum), clay-treated heavy naphthenic | 4 | 64742-44-5 | 265-146-1 | 5,58 | ||||||
Distillates (petroleum), cracked, ethylene manuf. by-product, C9-10 fraction | 1 | 94733-07-0 | 305-586-4 | 2,31 | 2,31 | |||||
Distillates (petroleum), cracked stripped steam-cracked petroleum distillates, C8-10 fraction; Cracked kerosine | 1 | 68477-39-4 | 270-728-3 | 2,31 | 2,31 | |||||
Distillates (petroleum), cracked stripped steam-cracked petroleum distillates, C8-10 fraction; Cracked kerosine | 2 | 68477-39-4 | 270-728-3 | 3,25 | ||||||
Distillates (petroleum), cracked stripped steam-cracked petroleum distillates, C8-10 fraction; Cracked kerosine | 3 | 68477-39-4 | 270-728-3 | 192 | 192 | |||||
Distillates (petroleum), dewaxed light paraffinic, hydrotreated | 1 | 91995-40-3 | 295-301-9 | 5,58 | 2,73 | |||||
Distillates (petroleum), dewaxed light paraffinic, hydrotreated | 2 | 91995-40-3 | 295-301-9 | 5,58 | ||||||
Distillates (petroleum), full-range straight-run middle | 1 | 68814-87-9 | 272-341-5 | 16,4 | ||||||
Distillates (petroleum), heat-soaked steam-cracked naphtha, C5-rich; Low boiling point naphtha - unspecified | 1 | 91995-41-4 | 295-302-4 | 8,4 | ||||||
Distillates (petroleum), heat-soaked steam-cracked naphtha, C5-rich; Low boiling point naphtha - unspecified | 2 | 91995-41-4 | 295-302-4 | 2,31 | 2,31 | |||||
Distillates (petroleum), heavy catalytic cracked | 1 | 64741-61-3 | 265-063-0 | 0,18 | ||||||
Distillates (petroleum), heavy hydrocracked | 1 | 64741-76-0 | 265-077-7 | 5,58 | 2,73 | |||||
Distillates (petroleum), heavy hydrocracked | 2 | 64741-76-0 | 265-077-7 | 5,58 | ||||||
Distillates (petroleum), heavy paraffinic | 1 | 64741-51-1 | 265-052-0 | 5,58 | 2,73 | |||||
Distillates (petroleum), heavy straight-run | 1 | 68915-96-8 | 272-817-2 | 16,4 | ||||||
Distillates (petroleum), hydrodesulfurized light catalytic cracked | 1 | 68333-25-5 | 269-781-5 | 27,34 | ||||||
Distillates (petroleum), hydrodesulfurized middle | 1 | 64742-80-9 | 265-183-3 | 16,4 | ||||||
Distillates (petroleum), hydrodesulfurized middle coker | 1 | 101316-59-0 | 309-865-1 | 27,34 | ||||||
Distillates (petroleum), hydrodesulfurized thermal cracked middle | 1 | 85116-53-6 | 285-505-6 | 27,3 | ||||||
Distillates (petroleum), hydrotreated heavy naphthenic | 1 | 64742-52-5 | 265-155-0 | 5,58 | 2,73 | |||||
Distillates (petroleum), hydrotreated heavy naphthenic | 2 | 64742-52-5 | 265-155-0 | 5,58 | ||||||
Distillates (petroleum), hydrotreated heavy paraffinic | 1 | 64742-54-7 | 265-157-1 | 5,58 | 2,73 | |||||
Distillates (petroleum), hydrotreated heavy paraffinic | 2 | 64742-54-7 | 265-157-1 | 5,58 | ||||||
Distillates (petroleum), hydrotreated light catalytic cracked | 1 | 68921-07-3 | 272-930-7 | 27,3 | ||||||
Distillates (petroleum), hydrotreated light catalytic cracked | 2 | 68921-07-3 | 272-930-7 | 27,34 | ||||||
Distillates (petroleum), hydrotreated light naphthenic | 1 | 64742-53-6 | 265-156-6 | 5,58 | 2,73 | |||||
Distillates (petroleum), hydrotreated light naphthenic | 2 | 64742-53-6 | 265-156-6 | 5,58 | ||||||
Distillates (petroleum), hydrotreated light paraffinic | 1 | 64742-55-8 | 265-158-7 | 5,58 | 2,73 | |||||
Distillates (petroleum), hydrotreated light paraffinic | 2 | 64742-55-8 | 265-158-7 | 5,58 | ||||||
Distillates (petroleum), hydrotreated middle | 1 | 64742-46-7 | 265-148-2 | 16,4 | ||||||
Distillates (petroleum), hydrotreated middle, intermediate boiling; Low boiling point hydrogen treated naphtha | 1 | 68410-96-8 | 270-092-7 | 2,31 | 2,31 | |||||
Distillates (petroleum), hydrotreated middle, intermediate boiling; Low boiling point hydrogen treated naphtha | 2 | 68410-96-8 | 270-092-7 | 3,25 | ||||||
Distillates (petroleum), intermediate catalytic cracked | 1 | 64741-60-2 | 265-062-5 | 27,34 | ||||||
Distillates (petroleum), intermediate vacuum | 1 | 70592-76-6 | 274-683-0 | 0,18 | ||||||
Distillates (petroleum), light catalytic cracked | 1 | 64741-59-9 | 265-060-4 | 27,3 | ||||||
Distillates (petroleum), light catalytic cracked | 2 | 64741-59-9 | 265-060-4 | 27,34 | ||||||
Distillates (petroleum), light distillate hydrotreating process, low-boiling | 1 | 68410-97-9 | 270-093-2 | 837,5 | ||||||
Distillates (petroleum), light distillate hydrotreating process, low-boiling | 2 | 68410-97-9 | 270-093-2 | 837,5 | 1,9 | |||||
Distillates (petroleum), light hydrocracked | 1 | 64741-77-1 | 265-078-2 | 68,34 | ||||||
Distillates (petroleum), light paraffinic | 1 | 64741-50-0 | 265-051-5 | 5,58 | 2,73 | |||||
Distillates (petroleum), light straight-run gasoline fractionation stabilizer overheads | 1 | 68921-08-4 | 272-931-2 | 837,5 | ||||||
Distillates (petroleum), light straight-run gasoline fractionation stabilizer overheads | 2 | 68921-08-4 | 272-931-2 | 837,5 | 1,9 | |||||
Distillates (petroleum), light thermal cracked | 1 | 64741-82-8 | 265-084-5 | 27,34 | ||||||
Distillates (petroleum), light thermal cracked, debutanized arom.; Low boiling point thermally cracked naphtha | 1 | 68955-29-3 | 273-266-0 | 3,25 | ||||||
Distillates (petroleum), light vacuum | 1 | 70592-77-7 | 274-684-6 | 0,18 | ||||||
Distillates (petroleum), naphtha steam cracking-derived, hydrotreated light arom.; Low boiling point cat-cracked naphtha | 1 | 91995-50-5 | 295-311-3 | 3,25 | ||||||
Distillates (petroleum), petroleum residues vacuum | 1 | 68955-27-1 | 273-263-4 | 0,18 | ||||||
Distillates (petroleum), C3-6, piperylene-rich; Petroleum gas | 1 | 68477-35-0 | 270-726-2 | 8,4 | ||||||
Distillates (petroleum), polymd. steam-cracked petroleum distillates, C5-12 fraction; Low boiling point naphtha - unspecified | 1 | 68477-50-9 | 270-735-1 | 8,4 | ||||||
Distillates (petroleum), C6-rich | 1 | 93165-19-6 | 296-903-4 | 837,5 | ||||||
Distillates (petroleum), C6-rich | 2 | 93165-19-6 | 296-903-4 | 837,5 | 1,9 | |||||
Distillates (petroleum), solvent-dewaxed heavy paraffinic | 1 | 64742-65-0 | 265-169-7 | 5,58 | 2,73 | |||||
Distillates (petroleum), solvent-dewaxed heavy paraffinic | 2 | 64742-65-0 | 265-169-7 | 5,58 | ||||||
Distillates (petroleum), solvent-dewaxed light paraffinic | 1 | 64742-56-9 | 265-159-2 | 5,58 | 2,73 | |||||
Distillates (petroleum), solvent-dewaxed light paraffinic | 2 | 64742-56-9 | 265-159-2 | 5,58 | ||||||
Distillates (petroleum), solvent-refined heavy naphthenic | 1 | 64741-96-4 | 265-097-6 | 5,58 | 2,73 | |||||
Distillates (petroleum), solvent-refined heavy naphthenic | 2 | 64741-96-4 | 265-097-6 | 5,58 | ||||||
Distillates (petroleum), solvent-refined heavy paraffinic | 1 | 64741-88-4 | 265-090-8 | 5,58 | 2,73 | |||||
Distillates (petroleum), solvent-refined heavy paraffinic | 2 | 64741-88-4 | 265-090-8 | 5,58 | ||||||
Distillates (petroleum), solvent-refined hydrotreated heavy, hydrogenated | 1 | 94733-08-1 | 305-588-5 | 5,58 | 2,73 | |||||
Distillates (petroleum), solvent-refined hydrotreated heavy, hydrogenated | 2 | 94733-08-1 | 305-588-5 | 5,58 | ||||||
Distillates (petroleum), solvent-refined light naphthenic | 1 | 64741-97-5 | 265-098-1 | 5,6 | 2,7 | |||||
Distillates (petroleum), solvent-refined light naphthenic | 2 | 64741-97-5 | 265-098-1 | 5,6 | ||||||
Distillates (petroleum), solvent-refined light paraffinic | 1 | 64741-89-5 | 265-091-3 | 5,58 | 2,73 | |||||
Distillates (petroleum), solvent-refined light paraffinic | 2 | 64741-89-5 | 265-091-3 | 5,58 | ||||||
Distillates (petroleum), steam-cracked, C8-12 fraction | 1 | 68477-54-3 | 270-737-2 | 2,31 | 2,31 | |||||
Distillates (petroleum), steam-cracked; Cracked kerosine | 1 | 64742-91-2 | 265-194-3 | 3,25 | ||||||
Distillates (petroleum), steam-cracked; Cracked kerosine | 2 | 64742-91-2 | 265-194-3 | 2,31 | 2,31 | |||||
Distillates (petroleum), steam-cracked, C5-12 fraction; Low boiling point naphtha - unspecified | 1 | 68477-53-2 | 270-736-7 | 3,25 | ||||||
Distillates (petroleum), steam-cracked, C5-12 fraction; Low boiling point naphtha - unspecified | 2 | 68477-53-2 | 270-736-7 | 2,31 | 2,31 | |||||
Distillates (petroleum), straight-run light | 1 | 68410-05-9 | 270-077-5 | 837,5 | ||||||
Distillates (petroleum), straight-run light | 2 | 68410-05-9 | 270-077-5 | 837,5 | 1,9 | |||||
Distillates (petroleum), straight-run middle | 1 | 64741-44-2 | 265-044-7 | 16,4 | ||||||
Distillates (petroleum), vacuum | 1 | 70592-78-8 | 274-685-1 | 0,18 | ||||||
Distillates (petroleum), heavy thermal cracked | 1 | 64741-81-7 | 265-082-4 | 0,18 | ||||||
Distilled acetalization product between glucose and C12, C14, C18, C20 ,C22 alcohol | 1 | - | 921-820-3 | 33,6 | ||||||
Distilled Tall oil, maleated | 1 | - | 939-605-8 | 18,8 | ||||||
3-(1,5-Disubstituted-naphthalene-2-ylazo)-5-[(3-substituted-phenylamino)-fluoro- [heteromonocyclyl]-4-hydroxy-naphthalene-2,7-disulfonic acid sodium salt | 1 | 1443224-69-8 | 461-680-6 | 2,35 | ||||||
Di(succinimido) carbonate | 1 | 74124-79-1 | 277-730-3 | 1,1 | ||||||
Disulfiram | 1 | 97-77-8 | 202-607-8 | 0,146 | TRGS900 | MAK | 15120 | |||
Di-tert-dodecyl polysulfide | 1 | 68425-15-0 | 270-335-7 | 32,9 | TRGS900 | MAK | 155512 | |||
2,2-Di(tetrahydrofuryl)propane | 1 | 89686-69-1 | 700-263-8 | 4,88 | ||||||
1,1'-Dithiobis[hexahydro-2H-azepin-2-one] | 1 | 23847-08-7 | 245-910-0 | 2,63 | 134296 | |||||
N,N'-Dithiodi-o-phenylenedibenzamide | 1 | 135-57-9 | 205-201-9 | 58,7 | 102457 | |||||
5,5'-Dithiodi-1,3,4-thiadiazole-2(3H)-thione | 1 | 72676-55-2 | 276-763-0 | 3,29 | ||||||
Ditin pyrophosphate | 1 | 15578-26-4 | 239-635-5 | 0,01 | 0,15 | |||||
Ditolylether, mixture of isomers | 1 | 28299-41-4 | 248-948-6 | 4,65 | 22480 | |||||
N,N'-Di-O-tolylguanidine | 1 | 97-39-2 | 202-577-6 | 0,6 | 14550 | |||||
Ditridecyl amine, mixture of isomers | 1 | 101012-97-9 | 309-798-8 | 0,85 | 190862 | |||||
Di(trimethylol propane) | 1 | 23235-61-2 | 245-509-0 | 2,4 | 133952 | |||||
Diundecyl phthalate | 1 | 3648-20-2 | 222-884-9 | 0,34 | 494435 | |||||
Diundecyl phthalate, branched and linear | 1 | 85507-79-5 | 287-401-6 | 1,65 | ||||||
Diuron | 1 | 330-54-1 | 206-354-4 | 0,17 | 12290 | |||||
Divanadium tris(sulphate) | 1 | 13701-70-7 | 237-226-6 | 0,64 | 126978 | |||||
Divanadium pentaoxide | 1 | 1314-62-1 | 215-239-8 | 0,14 | 0,5 | TRGS900 | 1250 | |||
Divanadyl pyrophosphate | 1 | 65232-89-5 | 407-130-0 | 0,0151 | 0,056 | 530954 | ||||
Divanadyl pyrophosphate | 2 | 65232-89-5 | 407-130-0 | 1,18 | 530954 | |||||
Divinylbenzene, mixed isomers | 1 | 1321-74-0 | 215-325-5 | 120,6 | 21640 | |||||
1,3-Divinylimidazolidin-2-one | 1 | 13811-50-2 | 237-457-2 | 4,9 | ||||||
Dizinc pyrophosphate | 1 | 7446-26-6 | 231-203-4 | 13,5 | MAK | 1790 | ||||
DL-Alanine | 1 | 302-72-7 | 206-126-4 | 226,2 | ||||||
Docosanamide | 1 | 3061-75-4 | 221-304-1 | 235,09 | 114072 | |||||
Docosanoic acid | 1 | 112-85-6 | 204-010-8 | 17,632 | 492792 | |||||
Docosanoic acid | 2 | 112-85-6 | 204-010-8 | 49,3 | 492792 | |||||
Docosan-1-ol | 1 | 661-19-8 | 211-546-6 | 267 | 389 | |||||
Docosyl acrylate | 1 | 18299-85-9 | 242-182-6 | 97,9 | ||||||
Docosyltrimethylammonium methyl sufate | 1 | 81646-13-1 | 279-791-1 | 0,6 | 163939 | |||||
1,6,7,8,9,14,15,16,17,17,18,18-Dodecachloropentacyclo[12.2.1.16,9.02,13.05,10]octadeca-7,15-diene | 1 | 13560-89-9 | 236-948-9 | 10,16 | 494996 | |||||
Dodecamethyl cyclohexasiloxane | 1 | 540-97-6 | 208-762-8 | 1,22 | 11 | 104954 | ||||
Dodecamethylpentasiloxane | 1 | 141-63-9 | 205-492-2 | 102 | 102626 | |||||
Dodecanedioic acid | 1 | 693-23-2 | 211-746-3 | 127 | 40920 | |||||
tert-Dodecanethiol | 1 | 25103-58-6 | 246-619-1 | 4,2 | 492176 | |||||
Dodecanoic acid; morpholine | 1 | - | 915-372-8 | 7,4 | ||||||
Dodecan-1-ol | 1 | 112-53-8 | 203-982-0 | 155 | 313 | 35500 | ||||
Dodecan-5-olide | 1 | 713-95-1 | 211-932-4 | 16,4 | 106964 | |||||
3-({5-[3-(Dodecanoyloxy)-2,2-dimethylpropylideneamino]-1,3,3-trimethylcyclohexyl}methylimino}-2,2-dimethylpropyl docecanoate | 1 | 932742-30-8 | 700-071-4 | 10,5 | ||||||
Dodecene, hydroformylation products, high-boiling | 1 | 68526-91-0 | 271-239-8 | 29,39 | ||||||
Dodecene, hydroformylation products, low-boiling | 1 | 68526-92-1 | 271-240-3 | 0,41 | ||||||
2-Dodec-1-enylbutanedioic acid, 4-methyl ester zinc salt | 1 | - | 430-740-3 | 2,06 | 535643 | |||||
Dodecyl acrylate | 1 | 2156-97-0 | 218-463-4 | 97,9 | 111874 | |||||
Dodecylamine | 1 | 124-22-1 | 204-690-6 | 1 | 0,38 | 492876 | ||||
Dodecylbenzenesulfonic acid, isomers | 1 | 27176-87-0 | 248-289-4 | 52 | 52 | 20420 | ||||
n-Dodecyl benzenesulfonic acid, sodium salt, isomers | 1 | 25155-30-0 | 246-680-4 | 52 | 52 | 35220 | ||||
Dodecyldimethylamine | 1 | 112-18-5 | 203-943-8 | 1 | 1 | 20580 | ||||
Dodecyldimethylamine oxide | 1 | 1643-20-5 | 216-700-6 | 6,2 | ||||||
alpha-Dodecyl-omega-hydroxy-poly[oxy(hydroxymethyl)-1,2-ethanediyl] | 1 | 9022-75-7 | 470-470-3 | 1,76 | ||||||
Dodecyl(2-hydroxy-3-sulphonatopropyl)dimethylammonium | 1 | 13197-76-7 | 236-164-7 | 13 | ||||||
Dodecyl oleate | 1 | 36078-10-1 | 252-862-4 | 7,05 | ||||||
N-(Dodecylphenyl)naphthalen-1-amine | 1 | - | 437-450-6 | 1,64 | ||||||
1-Dodecylpyridinium chloride | 1 | 104-74-5 | 203-232-2 | 4,93 | ||||||
1-Dodecyl-2-pyrrolidone | 1 | 2687-96-9 | 403-730-1 | 7,6 | 900317 | |||||
3-Dodecyl-1-(2,2,6,6-tetramethyl-4-piperidyl)pyrrolidine-2,5-dione | 1 | 79720-19-7 | 279-242-6 | 0,73 | ||||||
1-(tert-Dodecylthio)propan-2-ol | 1 | 67124-09-8 | 266-582-5 | 11,8 | 152211 | |||||
Dolomite (CaMg(CO3)2), calcined | 1 | 83897-84-1 | 281-192-5 | 1 | ||||||
Dore | 1 | 69029-47-6 | 273-793-6 | 0,1 | ||||||
Dore | 2 | 69029-47-6 | 273-793-6 | 0,005 | ||||||
Dore | 3 | 69029-47-6 | 273-793-6 | 5 | ||||||
Dore | 4 | 69029-47-6 | 273-793-6 | 0,004 | ||||||
Dore | 5 | 69029-47-6 | 273-793-6 | 0,5 | ||||||
Dore | 6 | 69029-47-6 | 273-793-6 | 0,05 | 0,05 | |||||
Dore | 7 | 69029-47-6 | 273-793-6 | 0,05 | ||||||
DS-2920A-E | 1 | - | 428-880-5 | 3 | ||||||
Dust, steelmaking | 1 | 65996-72-7 | 266-005-7 | 5,88 | ||||||
DV6850 | 1 | - | 447-060-8 | 3,9 | ||||||
Eicosyl acrylate | 1 | 48076-38-6 | 256-350-1 | 97,9 | 143207 | |||||
Eldew APS-307 | 1 | - | 93,3 | 23,3 | ||||||
ELDEW PS-203 | 1 | - | 429-630-8 | 46,7 | 16,4 | |||||
Electrolytes, copper-manufg., spent | 1 | 69012-54-0 | 273-752-2 | 0,05 | ||||||
Electrolytes, copper-manufg., spent | 2 | 69012-54-0 | 273-752-2 | 5 | ||||||
Electrolytes, copper-manufg., spent | 3 | 69012-54-0 | 273-752-2 | 0,004 | ||||||
Electrolytes, copper-manufg., spent | 4 | 69012-54-0 | 273-752-2 | 0,05 | ||||||
Electrolytes, copper-manufg., spent | 5 | 69012-54-0 | 273-752-2 | 0,05 | 0,05 | |||||
Electrolytes, copper-manufg., spent | 6 | 69012-54-0 | 273-752-2 | 0,5 | ||||||
Electrolytes, copper-manufg., spent | 7 | 69012-54-0 | 273-752-2 | 0,05 | 0,05 | |||||
Electrolytes, copper-manufg., spent | 8 | 69012-54-0 | 273-752-2 | 0,1 | ||||||
Electrolytes, copper-manufg., spent | 9 | 69012-54-0 | 273-752-2 | 0,04 | ||||||
Electrolytes, copper-manufg., spent | 10 | 69012-54-0 | 273-752-2 | 0,005 | ||||||
3,4-Epoxycyclohexylmethyl 3,4-epoxycyclohexanecarboxylate | 1 | 2386-87-0 | 219-207-4 | 0,18 | 0,18 | 112450 | ||||
1,2-Epoxy-N-dodecane | 1 | 2855-19-8 | 220-667-3 | 36,7 | 491397 | |||||
1,2-Epoxypentane | 1 | 1003-14-1 | 213-701-3 | 7,2 | 7,2 | 70150 | ||||
2,3-Epoxypropan-1-ol | 1 | 556-52-5 | 209-128-3 | 0,145 | Carcinogenic | 37230 | ||||
m-(2,3-Epoxypropoxy)-N,N-bis(2,3-epoxypropyl)aniline | 1 | 71604-74-5 | 275-662-9 | 0,35 | 160252 | |||||
[3-(2,3-Epoxypropoxy)propyl]diethoxymethylsilane | 1 | 2897-60-1 | 220-780-8 | 23,5 | ||||||
3-(2,3-Epoxypropoxy)propyltrimethoxysilane | 1 | 2530-83-8 | 219-784-2 | 70,5 | 39580 | |||||
3-(2,3-Epoxypropoxy)propyltrimethoxysilane | 2 | 2530-83-8 | 219-784-2 | 260 | 39580 | |||||
2,3-Epoxypropyl neodecanoate | 1 | 26761-45-5 | 247-979-2 | 5,88 | 135990 | |||||
2,3-Epoxypropyl neodecanoate, oligomeric reaction products with cyclohexane-1,2-dicarboxylic anhydride and propylidenetrimethanol | 1 | 154565-28-3 | 500-334-1 | 24 | ||||||
2,3-Epoxypropyl neodecanoate, oligomeric reaction products with phosphorous acid | 1 | 157348-58-8 | 500-336-2 | 3,96 | ||||||
2,3-Epoxypropyl isopropyl ether | 1 | 4016-14-2 | 223-672-9 | 1,1 | 570154 | |||||
1,2-Epoxytetradecane | 1 | 3234-28-4 | 221-781-6 | 36,7 | 114452 | |||||
1,2-Epoxy-3-(o-tolyloxy)propane | 1 | 2210-79-9 | 218-645-3 | 21,12 | 494180 | |||||
Erucylamide | 1 | 112-84-5 | 204-009-2 | 43,73 | 30990 | |||||
Erucylamide | 2 | 112-84-5 | 204-009-2 | 176 | 30990 | |||||
Essential oil obtained from the fruits of Litsea cubeba (Lour.) Pers. by distillation | 1 | - | 943-438-6 | 9 | ||||||
Essential oil of Boswellia carterii (Burseraceae) obtained from gum by distillation | 1 | - | 946-037-4 | 3,8 | ||||||
Essential oil of Canarium commune (Burseraceae) obtained from gum by steam distillation | 1 | - | 945-898-3 | 6,59 | ||||||
Essential oil of Cedarwood Texas obtained from the wood of Juniperus mexicana (Cupressaceae) by distillation - Terpenes | 1 | - | 946-670-6 | 6,41 | ||||||
Essential oil of Spearmint obtained from the aerial part of Mentha spicata and/or Mentha cardiaca (Lamiaceae) obtained by distillation | 1 | - | 946-253-9 | 6,48 | ||||||
Essential oil of Ylang Ylang III obtained from the flowers of Cananga odorata (Annonaceae) by steam distillation | 1 | - | 947-049-2 | 22,24 | ||||||
Esterfification product of poly[oxy(methyl-1,2-ethanediyl)], .alpha.,.alpha.'-(2,2-dimethyl-1,3-propanediyl)bis[.omega.-hydroxy- and prop-2-enoic acid | 1 | 84170-74-1 | 617-546-6 | 32,9 | ||||||
Esterification product of 2,2-bis(hydroxymethyl)-1,3-propanediol, ethoxylated and propoxylated and prop-2-enoic acid. | 1 | 144086-02-2 | 604-394-0 | 0,94 | ||||||
Esterification product of Castor oil and Tetrahydromethyl-1,3-isobenzofuranedione | 1 | 2105830-60-0 | 700-064-6 | 4,9 | ||||||
Esterification products of 1,3-Dioxo-2-benzofuran-5-carboxylic acid with Nonan-1-ol | 1 | - | 941-303-6 | 17,64 | ||||||
Esterification products of C10-14 (even numbered) Alkyl oligomeric glycosides with Citric acid, disodium salts | 1 | - | 943-980-3 | 23,5 | ||||||
Esterification products of Fatty acids C18 unsaturated and triethanolamine | 1 | 1474044-69-3 | 939-649-8 | 14,69 | ||||||
Esterification products of 4,4'-isopropylidenediphenol, ethoxylated and 2-methylprop-2-enoic acid. | 1 | 41637-38-1 | 609-946-4 | 3,52 | ||||||
Esterification products of 4,4'-isopropylidenediphenol, ethoxylated and prop-2-enoic acid. | 1 | 64401-02-1 | 613-584-2 | 12,32 | ||||||
Esterification products of 4,4'-Isopropylidenediphenol, ethoxylated and Prop-2-enoic acid and 3,5,5-Trimethylhexanoic acid | 1 | - | 919-846-5 | 49,36 | ||||||
Esterification reaction of fatty acids, linseed-oil; phenol, 4,4-(1-methylethylidene)bis-, oligomer with (chloromethyl)oxirane and neodecanoic acid, oxiranylmethyl ester | 1 | - | 928-726-1 | 1,65 | ||||||
Esterification reaction of fatty acids, C16-18 and C18-unsatd.; 3,4-epoxycyclohexyl methyl-3,4-epoxycyclohexan carboxylate and neodecanoic acid, oxiranylmethyl ester | 1 | - | 917-830-2 | 164,5 | ||||||
Esters of rosin oligomers with glycerol | 1 | 68475-37-6 | 614-523-2 | 10 | ||||||
Esters of rosin oligomers with pentaerythritol | 1 | 65997-12-8 | 613-868-6 | 10 | ||||||
Estr-4-ene-3,17-dione | 1 | 734-32-7 | 211-995-8 | 0,176 | ||||||
Estrone | 1 | 53-16-7 | 200-164-5 | 0,002 | ||||||
Ethanaminium, N-[4-[[4-(diethylamino)phenyl][4-(ethylamino)-1-naphthalenyl]methylene]-2,5-cyclohexadien-1-ylidene]-N-ethyl-, molybdatetungstatephosphate | 1 | 1325-87-7 | 215-410-7 | 1,64 | ||||||
1,2-Ethanediamine, N-(2-Aminoethyl)-, reaction products with Glycidyl tolyl ether | 1 | 84144-79-6 | 282-199-6 | 2,35 | ||||||
1,2-Ethanediamine, N-{3-(trimethoxysilyl)propyl}-,N-{(ethenylphenyl)methyl}derivate, hydrochlorides | 1 | 171869-89-9 | 605-620-0 | 1,65 | ||||||
Ethane-1,2-diol, propoxylated | 1 | 31923-84-9 | 500-078-0 | 29,4 | 531899 | |||||
N,N'-1,2-ethanediylbis(N-acetylacetamide) | 1 | 10543-57-4 | 234-123-8 | 6,4 | 492154 | |||||
N,N'-1,2-Ethanediylbis-L-aspartic acid | 1 | 20846-91-7 | 439-840-1 | 0,86 | ||||||
Ethane-1,2-diylbis[dichloromethylsilane] | 1 | 3353-69-3 | 222-123-0 | 14 | ||||||
N,N'-Ethane-1,2-diylbisoleamide | 1 | 110-31-6 | 203-756-1 | 51,6 | 101746 | |||||
2,2'-[1,2-Ethanediylbis(oxy)]bis(ethanethiol) | 1 | 14970-87-7 | 239-044-2 | 1,23 | ||||||
Ethanesulfonic acid, 2-(methylamino)-, N-coco acyl derivs., sodium salts | 1 | 61791-42-2 | 263-174-9 | 58,77 | ||||||
Ethanethiol | 1 | 75-08-1 | 200-837-3 | 11 | TRGS900 | MAK | 38960 | |||
Ethanol | 1 | 64-17-5 | 200-578-6 | 950 | TRGS900 | MAK | 10420 | |||
Ethanol, 2,2'-[[3-[(2-hydroxyethyl)octadecylamino]propyl]imino] bis-, dihydrofluoride | 1 | - | 911-915-8 | 0,418 | ||||||
Ethanol, 2,2'-iminobis-, N-(C13-15-branched and linear alkyl) derivs. | 1 | 97925-95-6 | 308-208-6 | 0,47 | 189425 | |||||
Ethanol, 2-methoxy-, manufacture of, by-products from, esters with boric acid | 1 | 161907-80-8 | 310-290-3 | 7,44 | ||||||
Ethanol, 2,2'-oxybis-, reaction products with ammonia, morpholine derivs. residues | 1 | 68909-77-3 | 272-712-1 | 70,52 | ||||||
Ethanol, 2,2'-oxybis-, reaction products with ammonia, morpholine derivs. residues | 2 | 68909-77-3 | 272-712-1 | 29,4 | ||||||
Ethanol, 2,2'-oxybis-, reaction products with 3-(triethoxysilyl)-1- propanamine | 1 | 152261-43-3 | 688-124-7 | 60 | 44 | |||||
4,4',4''-(Ethan-1,1,1-triyl)triphenol | 1 | 27955-94-8 | 405-800-7 | 0,391 | 530656 | |||||
4,4',4''-(Ethan-1,1,1-triyl)triphenol | 2 | 27955-94-8 | 405-800-7 | 1,2 | 1,2 | 530656 | ||||
3-Ethenyl-5-methyl-2-oxazolidinone | 1 | 3395-98-0 | 809-852-5 | 4,4 | ||||||
Ethers, C5-6-branched alkyl Methyl | 1 | 91995-60-7 | 295-322-3 | 88,8 | ||||||
Ethoxybenzene | 1 | 103-73-1 | 203-139-7 | 36,732 | 101526 | |||||
Ethoxybis(pentane-2,4-dionato-O,O')(propan-2-olato)titanium | 1 | 68586-02-7 | 271-603-6 | 500 | ||||||
1-Ethoxy-2,3-difluoro-4-{4-[(1s,4r)-4-ethylcyclohexyl]phenyl}benzene | 1 | 323178-01-4 | 608-727-0 | 35,3 | ||||||
4-Ethoxy-2,3-difluoro-4'-(trans-4-propylcyclohexyl)-1,1'-biphenyl | 1 | - | 921-136-5 | 35,3 | ||||||
1-Ethoxy-2,3-difluoro-4-[4-(trans-4-propylcyclohexyl)-1-cyclohexen-1-yl]-benzene | 1 | 124728-62-7 | 603-006-7 | 1,64 | ||||||
1-Ethoxy-2,3-difluoro-4-[4-(4-propylcyclohexyl)cyclohexyl]benzene | 1 | 123560-48-5 | 602-941-8 | 0,74 | ||||||
1-Ethoxy-2,3-difluoro-4-(4-propylphenyl)benzene | 1 | 157248-24-3 | 638-734-4 | 4,93 | ||||||
1-Ethoxy-2,3-difluor-4-(trans-4-propylcyclohexyl)-benzene | 1 | 174350-05-1 | 605-718-3 | 52,9 | ||||||
3-Ethoxy-1,1,1,2,3,4,4,5,5,6,6,6-dodecafluoro-2-(trifluoromethyl)-hexane | 1 | 297730-93-9 | 435-790-1 | 1135 | 536034 | |||||
2-Ethoxyethanol | 1 | 110-80-5 | 203-804-1 | 0,083 | TRGS900 | MAK | EU | 12880 | ||
2-(2-Ethoxyethoxy)ethyl acrylate | 1 | 7328-17-8 | 230-811-7 | 77 | 2,6 | |||||
[2-(1-Ethoxyethoxy)ethyl]benzene | 1 | 2556-10-7 | 219-868-9 | 18,5 | ||||||
2-(2-Ethoxyethoxy)-2-methylpropane | 1 | 51422-54-9 | 257-196-8 | 5,9 | ||||||
2-Ethoxyethyl (2Z)-2-cyano-2-[3-(3-methoxypropylamino)cyclohex-2-en-1-ylidene]acetate | 1 | - | 700-860-3 | 10 | ||||||
2-Ethoxyethyl methacrylate | 1 | 2370-63-0 | 219-135-3 | 7,06 | ||||||
3-Ethoxy-4-hydroxybenzaldehyde | 1 | 121-32-4 | 204-464-7 | 49 | ||||||
(Ethoxymethoxy)cyclododecane | 1 | 58567-11-6 | 261-332-1 | 23,5 | 147574 | |||||
2-Ethoxy-2-methylbutane | 1 | 919-94-8 | 618-804-0 | 119 | 101 | |||||
2-Ethoxy-1-methylethyl acetate | 1 | 54839-24-6 | 259-370-9 | 152 | TRGS900 | MAK | 145864 | |||
(2-Ethoxy-1-methyl-2-oxoethyl)-5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoate | 1 | 77501-63-4 | 616-466-9 | 0,8 | ||||||
2-(Ethoxymethyl)oxolane | 1 | - | 423-630-1 | 4,6 | ||||||
N,N'-(Ethoxymethylsilylene)bis[N-methylbenzamide] | 1 | 16230-35-6 | 240-354-5 | 1,76 | ||||||
1-Ethoxy-1,1,2,2,3,3,4,4,4-nonafluorobutane | 1 | - | 425-340-0 | 1764 | 535662 | |||||
N-(2-Ethoxyphenyl)-N'-(2-ethylphenyl)oxamide | 1 | 23949-66-8 | 245-950-9 | 42,32 | 495362 | |||||
N-(2-Ethoxyphenyl)-N'-(4-isododecylphenyl)oxamide | 1 | 82493-14-9 | 279-979-3 | 29,4 | ||||||
1-Ethoxy-2-propanol | 1 | 1569-02-4 | 216-374-5 | 106 | TRGS900 | MAK | 110255 | |||
Ethoxyquine | 1 | 91-53-2 | 202-075-7 | 3,23 | 14560 | |||||
Ethoxy triethyleneglycol methacrylate | 1 | 39670-09-2 | 254-588-0 | 14,5 | 141657 | |||||
Ethoxytrimethylsilane | 1 | 1825-62-3 | 217-370-6 | 20,8 | ||||||
4-(1-Ethoxyvinyl)-3,3,5,5-tetramethylcyclohexanone | 1 | 36306-87-3 | 252-961-2 | 17,1 | 6,84 | |||||
Ethyl 1-(4-methoxyphenyl)-6-(4-nitrophenyl)-7-oxo-1H,4H,5H,6H,7H-pyrazolo[3,4-c]pyridine-3-carboxylate | 1 | 536759-91-8 | 611-033-0 | 4,898 | ||||||
Ethyl 2-methyl-1,3-dioxolane-2-acetate | 1 | 6413-10-1 | 229-114-0 | 23,5 | 120471 | |||||
Ethyl 2-methylvalerate | 1 | 39255-32-8 | 254-384-1 | 52,08 | 141477 | |||||
Ethyl phenyl(2,4,6-trimethylbenzoyl)phosphinate | 1 | 84434-11-7 | 282-810-6 | 4,93 | 166607 | |||||
Ethyl acetate | 1 | 141-78-6 | 205-500-4 | 734 | 734 | TRGS900 | MAK | EU | 12040 | |
Ethyl acetoacetate | 1 | 141-97-9 | 205-516-1 | 29,167 | 10400 | |||||
Ethyl acetoacetato-O1',O3)(pentane-2,4-dionato-O,O')[propane-1,3-diolato(2-)-O,O']titanium | 1 | 82089-64-3 | 279-899-9 | 9,87 | ||||||
Ethyl acrylate | 1 | 140-88-5 | 205-438-8 | 21 | TRGS900 | MAK | EU | 14350 | ||
Ethylamine | 1 | 75-04-7 | 200-834-7 | 9,4 | 9,4 | TRGS900 | MAK | EU | 20540 | |
2-(Ethylamino)ethanol | 1 | 110-73-6 | 203-797-5 | 0,2 | 492748 | |||||
2-Ethylanthraquinone | 1 | 84-51-5 | 201-535-4 | 0,66 | 39790 | |||||
1-Ethylazepan-2-one | 1 | 19797-08-1 | 606-384-1 | 4,94 | ||||||
Ethylbenzene | 1 | 100-41-4 | 202-849-4 | 77 | TRGS900 | MAK | EU | 16210 | ||
Ethyl benzoate | 1 | 93-89-0 | 202-284-3 | 17,5 | 490111 | |||||
Ethyl 3-[[bis(1-methylethoxy)phosphinothioyl]thio]propionate | 1 | 71735-74-5 | 275-965-6 | 2,94 | 160519 | |||||
Ethyl butyrate | 1 | 105-54-4 | 203-306-4 | 49,3 | 37450 | |||||
2-Ethylcapronaldehyde | 1 | 123-05-7 | 204-596-5 | 1,53 | 28480 | |||||
N'-(Ethylcarbonimidoyl)-N,N-dimethylpropane-1,3-diamine monohydrochloride | 1 | 25952-53-8 | 247-361-2 | 1,64 | ||||||
Ethyl cinnamate | 1 | 103-36-6 | 203-104-6 | 5,22 | 492646 | |||||
Ethyl-2-cyanoacrylate | 1 | 7085-85-0 | 230-391-5 | 9,25 | 9,25 | 510793 | ||||
Ethylcyclohexane | 1 | 1678-91-7 | 216-835-0 | 0,704 | 490339 | |||||
S-Ethyl N-cyclohexylthiocarbamate | 1 | 1134-23-2 | 214-482-7 | 2,07 | ||||||
Ethyl 3,5-dichloro-4-hexadecyloxycarbonyloxybenzoate | 1 | 115895-09-5 | 404-740-9 | 4,82 | ||||||
4'-Ethyl-2,3-difluorbiphenyl-4-boronic acid | 1 | 1123312-95-7 | 929-209-3 | 0,616 | ||||||
7a-Ethyldihydro-1H,3H,5H-oxazolo(3,4-c)oxazole | 1 | 7747-35-5 | 231-810-4 | 14,79 | 122609 | |||||
Ethyldimethylamine | 1 | 598-56-1 | 209-940-8 | 7,17 | 6,39 | TRGS900 | MAK | 31950 | ||
Ethyl 4-dimethylaminobenzoate | 1 | 10287-53-3 | 233-634-3 | 1,2 | ||||||
Ethyl 3-(2,4-dimethyl-1,3-dioxolan-2-yl)propanoate | 1 | 5413-49-0 | 700-636-5 | 16,33 | ||||||
5-Ethyl-2,8-dimethyl-5-[(propan-2-ylideneamino)oxy]-4,6-dioxa-3,7-diaza-5-silanona-2,7-diene | 1 | 58190-57-1 | 611-631-1 | 0,419 | ||||||
Ethyl 9,9-dioctyl-4,7,11-trioxo-3,8,10-trioxa-9-stannatetradeca-5,12-dien-14-oate | 1 | 68109-88-6 | 268-500-3 | 0,003 | TRGS900 | MAK | 490813 | |||
5-Ethyl-1,3-dioxane-5-methanol | 1 | 5187-23-5 | 225-967-8 | 9,7 | ||||||
[2S-[2α,5α,6β(S*)]]-6-[[[[(4-Ethyl-2,3-dioxopiperazin-1-yl)carbonyl]amino]phenylacetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid | 1 | 61477-96-1 | 262-811-8 | 26,1 | ||||||
Ethyl 5,5-diphenyl-2-isoxazoline-3-carboxylate | 1 | 163520-33-0 | 443-870-0 | 1,411 | 536139 | |||||
S-Ethyl N,N-dipropylthiocarbamate | 1 | 759-94-4 | 212-073-8 | 4 | 510224 | |||||
Ethyl N2-dodecanoyl-L-argininate hydrochloride | 1 | 60372-77-2 | 434-630-6 | 21,652 | 536097 | |||||
ETHYLE NORVALINATE S HCl | 1 | - | 482-890-4 | 11,75 | 11,75 | |||||
Ethylene carbonate | 1 | 96-49-1 | 202-510-0 | 15 | 490120 | |||||
Ethylendiaminetetraacetic acid ferrous sodium | 1 | 15651-72-6 | 927-442-5 | 2 | ||||||
Ethylene glycol | 1 | 107-21-1 | 203-473-3 | 35 | TRGS900 | MAK | EU | 12060 | ||
Ethylene bis[3,3-bis(3-tert-butyl-4-hydroxyphenyl)butyrate] | 1 | 32509-66-3 | 251-073-2 | 2,94 | 495563 | |||||
Ethylene bis(3-mercaptopropionate) | 1 | 22504-50-3 | 245-044-3 | 0,49 | ||||||
[Ethylenebis[nitrilobis(methylene)]]tetrakisphosphonic acid, calcium sodium salt | 1 | 85480-89-3 | 287-370-9 | 0,02 | ||||||
[Ethylenebis[nitrilobis(methylene)]]tetrakisphosphonic acid, sodium salt | 1 | 22036-77-7 | 244-742-5 | 0,02 | ||||||
Ethylenebis(oxyethylene) bis[3-(5-tert-butyl-4-hydroxy-m-tolyl)propionate] | 1 | 36443-68-2 | 253-039-2 | 3 | 3 | 140302 | ||||
Ethylenediamine | 1 | 107-15-3 | 203-468-6 | 25 | 32650 | |||||
Ethylenediamine, ethoxylated and propoxylated | 1 | 26316-40-5 | 500-047-1 | 35,2 | 531872 | |||||
Ethylenediamine, propoxylated | 1 | 25214-63-5 | 500-035-6 | 35,2 | ||||||
Ethylenediamine, salt with phosphoric acid | 1 | 14852-17-6 | 238-914-9 | 1,01 | 128368 | |||||
Ethylenediamine-N,N'-di(acetic acid) | 1 | 5657-17-0 | 227-105-6 | 10 | 88 | |||||
Ethylenediaminetetraacetic acid | 1 | 60-00-4 | 200-449-4 | 1,5 | 34820 | |||||
Ethylenediaminetetraacetic acid tetrasodium salt | 1 | 64-02-8 | 200-573-9 | 1,5 | 30890 | |||||
Ethylenediaminetetraacetonitrile | 1 | 5766-67-6 | 227-290-3 | 4,4 | 118968 | |||||
Ethylene dibenzoate | 1 | 94-49-5 | 202-338-6 | 10,6 | ||||||
Ethylene diformate | 1 | 629-15-2 | 211-077-7 | 3,15 | 6,3 | 106369 | ||||
Ethylene dimethacrylate | 1 | 97-90-5 | 202-617-2 | 2,45 | 510227 | |||||
1,1',1'',1'''-Ethylenedinitrilotetrapropan-2-ol | 1 | 102-60-3 | 203-041-4 | 29,4 | 492634 | |||||
2,2'-Ethylenedioxydiethyl dimethacrylate | 1 | 109-16-0 | 203-652-6 | 48,5 | 496564 | |||||
N,N'-Ethylenedi(stearamid) | 1 | 110-30-5 | 203-755-6 | 2,94 | 35530 | |||||
Ethylene di(S-thioacetate) | 1 | 123-81-9 | 204-653-4 | 0,49 | ||||||
Ethylene glycol bis(hydroxymethyl)ether | 1 | 3586-55-8 | 222-720-6 | 0,12 | 1,45 | 115218 | ||||
Ethylene glycol diacetate | 1 | 111-55-7 | 203-881-1 | 29,6 | 14050 | |||||
Ethylene glycol dinitrate | 1 | 628-96-6 | 211-063-0 | 0,06 | TRGS900 | MAK | 41300 | |||
Ethylene glycol monohexyl ether | 1 | 112-25-4 | 203-951-1 | 18,4 | 38090 | |||||
Ethylene thiourea | 1 | 96-45-7 | 202-506-9 | 0,07 | 15080 | |||||
Ethyl 2,3-epoxy-3-methyl-3-phenylpropionate | 1 | 77-83-8 | 201-061-8 | 2,45 | 31610 | |||||
Ethyl beta-ethoxypropionate | 1 | 763-69-9 | 212-112-9 | 610 | 610 | TRGS900 | MAK | 492032 | ||
Ethyl (1S,5R,6S)-5-(1-ethylpropoxy)-7-oxabicyclo[4.1.0]hept-3-ene-3-carboxylate | 1 | 204254-96-6 | 429-020-1 | 0,806 | 535808 | |||||
4'-Ethyl-3-fluorbiphenyl-4-boronic acid | 1 | 900796-46-5 | 618-440-2 | 0,2 | ||||||
Ethyl formate | 1 | 109-94-4 | 203-721-0 | 11 | TRGS900 | MAK | 20040 | |||
2-Ethyl-hexaneperoxoic acid 1,1-dimethylpropyl ester | 1 | 686-31-7 | 211-687-3 | 15,87 | 106796 | |||||
2-Ethyl-hexaneperoxoic acid 1,1,4,4-tetramethyl-1,4-butanediyl ester | 1 | 13052-09-0 | 235-935-5 | 35 | 125924 | |||||
2-Ethylhexanoic acid, zinc salt, basic | 1 | 85203-81-2 | 286-272-3 | 20,83 | 169715 | |||||
2-Ethylhexanoic acid, zinc salt, basic | 2 | 85203-81-2 | 286-272-3 | 5 | 169715 | |||||
2-Ethylhexanoic acid, zinc salt, basic | 3 | 85203-81-2 | 286-272-3 | 32 | 169715 | |||||
2-Ethylhexanoic acid | 1 | 149-57-5 | 205-743-6 | 14 | 33170 | |||||
2-Ethylhexanoic acid, (C16-18)-alkyl esters | 1 | 90411-68-0 | 291-445-1 | 6,01 | 174325 | |||||
2-Ethylhexanoic acid, compound with 2-Aminoethanol (1:1) | 1 | 74931-55-8 | 278-031-6 | 0,29 | ||||||
2-Ethylhexanoic acid, copper salt | 1 | 22221-10-9 | 244-846-0 | 0,69 | ||||||
2-Ethylhexanoic acid, iron salt | 1 | 19583-54-1 | 243-169-8 | 0,64 | ||||||
2-Ethylhexanoic acid, manganese salt | 1 | 15956-58-8 | 240-085-3 | 1,19 | ||||||
2-Ethylhexanoic acid, manganese salt | 2 | 15956-58-8 | 240-085-3 | 32 | ||||||
2-Ethylhexanoic acid, manganese salt | 3 | 15956-58-8 | 240-085-3 | 0,2 | ||||||
2-Ethylhexanoic acid, molybdenum salt | 1 | 34041-09-3 | 251-807-1 | 2,734 | 139238 | |||||
2-Ethylhexanoic acid, molybdenum salt | 2 | 34041-09-3 | 251-807-1 | 11,17 | 139238 | |||||
2-Ethylhexanoic acid, molybdenum salt | 3 | 34041-09-3 | 251-807-1 | 2,351 | 139238 | |||||
2-Ethylhexanoic acid, monoester with propane-1,2-diol | 1 | 85114-00-7 | 285-503-5 | 8,816 | ||||||
2-Ethylhexanoic acid, zinc salt | 1 | 136-53-8 | 205-251-1 | 17,33 | 492910 | |||||
2-Ethylhexanoic acid, zirconium salt | 1 | 22464-99-9 | 245-018-1 | 32,97 | TRGS900 | 133527 | ||||
2-Ethylhexanoic acid, zirconium salt | 2 | 22464-99-9 | 245-018-1 | 32 | TRGS900 | 133527 | ||||
2-Ethylhexanoic acid, zirconium salt | 3 | 22464-99-9 | 245-018-1 | 5 | TRGS900 | 133527 | ||||
2-Ethylhexanol | 1 | 104-76-7 | 203-234-3 | 53,2 | 12,8 | TRGS900 | MAK | EU | 20340 | |
2-Ethylhexyl lactate | 1 | 6283-86-9 | 228-503-2 | 8 | 119963 | |||||
2-Ethylhexyl acetate | 1 | 103-09-3 | 203-079-1 | 71 | 17 | TRGS900 | MAK | 37430 | ||
2-Ethylhexyl acrylate | 1 | 103-11-7 | 203-080-7 | 38 | TRGS900 | MAK | 15610 | |||
2-Ethylhexylamine | 1 | 104-75-6 | 203-233-8 | 4,2 | 28540 | |||||
2-Ethylhexyl benzoate | 1 | 5444-75-7 | 226-641-8 | 212 | ||||||
2-Ethylhexyl (4-chloro-2-methylphenoxy)acetate | 1 | 29450-45-1 | 249-636-2 | 0,79 | ||||||
2-Ethylhexyl-2-cyano-3-(4-methoxyphenyl)-3-phenylprop-2-enoate | 1 | 947753-66-4 | 700-213-5 | 147 | ||||||
2-Ethylhexyl 4-(dimethylamino)benzoate | 1 | 21245-02-3 | 244-289-3 | 0,5 | ||||||
2-Ethylhexyl diphenyl phosphate | 1 | 1241-94-7 | 214-987-2 | 0,26 | 26520 | |||||
2-Ethylhexyl 12-ethyl-5,5-dioctyl-9-oxo-10-oxa-4,6-dithia-5-stannahexadecanoate | 1 | 59185-95-4 | 261-645-3 | 0,051 | ||||||
2-Ethylhexyl-10-ethyl-4,4-dioctyl-7-oxo-8-oxa-3,5-dithia-4-stannatetradecanoate | 1 | 15571-58-1 | 239-622-4 | 0,062 | TRGS900 | MAK | 490573 | |||
2-Ethylhexyl 14-ethyl-6,6-dioctyl-4,8,11-trioxo-5,7,12-trioxa-6-stannaoctadeca-2,9-dienoate | 1 | 10039-33-5 | 233-117-2 | 0,00858 | ||||||
2-Ethylhexyl 10-ethyl-4-[[2-[(2-ethylhexyl)oxy]-2-oxoethyl]thio]-7-oxo-8-oxa-3,5-dithia-4-phosphatetradecanoate 4-oxide | 1 | 83547-95-9 | 280-479-2 | 0,822 | ||||||
N-(2-Ethylhexyl)isononan-1-amide | 1 | 93820-33-8 | 298-613-3 | 8,8 | ||||||
2-Ethylhexyl 3-mercaptopropionate | 1 | 50448-95-8 | 256-589-1 | 0,49 | ||||||
2-Ethylhexyl methacrylate | 1 | 688-84-6 | 211-708-6 | 2,5 | 496550 | |||||
2-Ethylhexyl (R)-2-(2-methyl-4-chlorophenoxy)propionate | 1 | 861229-15-4 | 630-324-3 | 1,34 | ||||||
N-(2-Ethylhexyl)-1-[[2-methyl-4-[(2-methylphenyl)azo]phenyl]azo]naphthalen-1-amine | 1 | 56358-09-9 | 260-124-8 | 1,75 | ||||||
2-Ethylhexyl nitrate | 1 | 27247-96-7 | 248-363-6 | 0,35 | 136303 | |||||
2-Ethylhexyl 7-oxabicyclo[4.1.0]heptane-3-carboxylate | 1 | 62256-00-2 | 263-471-3 | 1,03 | ||||||
2-[(2-Ethylhexyl)oxy]ethanol | 1 | 1559-35-9 | 216-323-7 | 1,47 | ||||||
3-(2-Ethylhexyloxy)propane-1,2-diol | 1 | 70445-33-9 | 408-080-2 | 0,875 | 530963 | |||||
O-(2-Ethylhexyl) O,O-tert-pentyl peroxycarbonate | 1 | 70833-40-8 | 274-919-2 | 4,41 | 159585 | |||||
2-Ethylhexyl salicylate | 1 | 118-60-5 | 204-263-4 | 9,03 | 101952 | |||||
2-Ethylhexyl 3,5,5-trimethylhexanoate | 1 | 70969-70-9 | 275-073-7 | 1,65 | ||||||
N-(2-Ethylhexyl)-8,9,10-trinorborn-5-ene-2,3-dicarboximide | 1 | 113-48-4 | 204-029-1 | 5,4 | 9,3 | |||||
Ethyl 4-hydroxybenzoate | 1 | 120-47-8 | 204-399-4 | 211,58 | 25860 | |||||
2-[[4-[Ethyl(2-hydroxyethyl)amino]phenyl]azo]-6-methoxy-3-methylbenzothiazolium methyl sulphate | 1 | 12270-13-2 | 235-546-0 | 0,219 | ||||||
2-[[4-[Ethyl(2-hydroxyethyl)amino]phenyl]azo]-6-methoxy-3-methylbenzothiazolium acetate | 1 | 84051-87-6 | 281-876-3 | 118,4 | ||||||
Ethyl 3-[4-(hydroxymethyl)-2-methyl-1,3-dioxolan-2-yl]propanoate | 1 | 902272-78-0 | 700-637-0 | 16,33 | ||||||
2-Ethyl-3-hydroxy-4-pyrone | 1 | 4940-11-8 | 225-582-5 | 58,7 | ||||||
5-Ethylidene-2-norbornene | 1 | 16219-75-3 | 240-347-7 | 20,3 | 129583 | |||||
N-Ethyl-2-(isopropyl)-5-methylcyclohexanecarboxamide | 1 | 39711-79-0 | 254-599-0 | 6,66 | ||||||
Ethyl lactate | 1 | 97-64-3 | 202-598-0 | 7,053 | 510235 | |||||
2-Ethyl-2-[(3-mercapto-1-oxopropoxy)methyl]propane-1,3-diyl bis[3-mercaptopropionate] | 1 | 33007-83-9 | 251-336-1 | 0,49 | ||||||
Ethyl methacrylate | 1 | 97-63-2 | 202-597-5 | 267 | 370,5 | 510236 | ||||
Ethyl 1-(4-methoxyphenyl)-7-oxo-6-(4-(2-oxo-1-piperidinyl)phenyl)-4,5,6,7-tetrahydro-1H-pyrazolo[3,4-c]pyridine-3-carboxylate | 1 | 503614-91-3 | 700-890-7 | 32,9 | ||||||
Ethyl 2-methylbutyrate | 1 | 7452-79-1 | 231-225-4 | 52,08 | 494834 | |||||
Ethyl methyl carbonate | 1 | 623-53-0 | 433-480-9 | 12,2 | ||||||
Ethyl methyl carbonate | 2 | 623-53-0 | 433-480-9 | 10,3 | ||||||
2-Ethyl-4-methylimidazole | 1 | 931-36-2 | 213-234-5 | 2,8 | 107901 | |||||
3-Ethyl-1-methyl-1H-Imidazolium salt with N-cyanocyanamide (1:1) | 1 | 370865-89-7 | 609-330-5 | 6,64 | ||||||
1-Ethyl-3-methylimidazolium ethylsulfate | 1 | - | 460-100-9 | 218,98 | ||||||
Ethyl 4-[[(methylphenylamino)methylene]amino]benzoate | 1 | 57834-33-0 | 260-976-0 | 0,6 | ||||||
Ethyl [(4-methylphenyl)sulphonyl]carbamate | 1 | 5577-13-9 | 226-952-9 | 7 | ||||||
N-Ethyl-N-[2-[1-(2-methylpropoxy)ethoxy]ethyl]-4-(phenylazo)aniline | 1 | 34432-92-3 | 252-021-1 | 0,493 | 139425 | |||||
5-Ethyl-2-methylpyridine | 1 | 104-90-5 | 203-250-0 | 0,875 | 510630 | |||||
1-Ethyl-1-methylpyrrolidiniumbromide | 1 | 69227-51-6 | 418-200-5 | 3,5 | 901940 | |||||
Ethyl methyl sulfide | 1 | 624-89-5 | 210-868-4 | 12,3 | 106260 | |||||
4-Ethylmorpholine | 1 | 100-74-3 | 202-885-0 | 2,35 | 28570 | |||||
Ethyl 2-naphthyl ether | 1 | 93-18-5 | 202-226-7 | 0,281 | ||||||
2-Ethyl-2-oxazoline | 1 | 10431-98-8 | 233-912-4 | 36,7 | ||||||
3-Ethyloxetane-3-methanol | 1 | 3047-32-3 | 221-254-0 | 35 | 114031 | |||||
4-Ethylphenol | 1 | 123-07-9 | 204-598-6 | 8,167 | 492861 | |||||
Ethyl phenylacetate | 1 | 101-97-3 | 202-993-8 | 4,9 | 491173 | |||||
5-((6-(Ethyl(phenyl)amino)-1,3,5-triazin-2-yl)amino)-3-((E)-(5-((propanoyl)amino)- phenyl)diazenyl)-4-hydroxy polycarbocyclyl, polysulfonate, polyhalogeno, sodium salt | 1 | - | 415-950-5 | 2,35 | ||||||
N-Ethylpiperidine | 1 | 766-09-6 | 212-161-6 | 7,04 | 33890 | |||||
Ethyl propionate | 1 | 105-37-3 | 203-291-4 | 56 | 28580 | |||||
4-trans-Ethyl-4'-trans-propyl-[1,1'-bicyclohexyl] | 1 | 96624-41-8 | 619-230-3 | 4,93 | ||||||
1-Ethyl-2-pyrrolidinone | 1 | 2687-91-4 | 220-250-6 | 10,05 | 16,75 | TRGS900 | MAK | 113251 | ||
Ethyl sodium xanthate | 1 | 140-90-9 | 205-440-9 | 0,67 | 491058 | |||||
Ethyl sodium xanthate | 2 | 140-90-9 | 205-440-9 | 15 | 491058 | |||||
Ethyl L-threoninate | 1 | - | 433-730-7 | 23 | ||||||
N-Ethyl-o(or p)-toluenesulphonamide | 1 | 8047-99-2 | 232-465-2 | 19,1 | ||||||
Ethyl-trans-2,2,6-trimethyl-cyclohexancarboxylate | 1 | 22471-55-2 | 412-540-8 | 0,71 | 901053 | |||||
(2E)-2-Ethyl-4-(2,2,3-trimethyl-3-cyclopenten-1-yl)-buten-1-ol | 1 | 106185-75-5 | 701-122-3 | 21 | ||||||
2-Ethyl-2-(((3,5,5-trimethylhexanoyl)oxy)methyl)propane-1,3-diyl bis(3,5,5-trimethylhexanoate) | 1 | 65870-94-2 | 613-848-7 | 35,3 | ||||||
Ethyltriphenylfosfonium bromide | 1 | 1530-32-1 | 216-223-3 | 1,48 | 494012 | |||||
Ethyltriphenylfosfonium bromide | 2 | 1530-32-1 | 216-223-3 | 1,97 | 494012 | |||||
Ethyltriphenylphosphonium acetate | 1 | 35835-94-0 | 252-743-7 | 1,23 | ||||||
1-Ethynylcyclohexanol | 1 | 78-27-3 | 201-100-9 | 14,7 | 100585 | |||||
Ethynyl cyclopropane | 1 | 6746-94-7 | 425-430-1 | 23,509 | 535651 | |||||
Etidronic acid | 1 | 2809-21-4 | 220-552-8 | 12 | 35960 | |||||
Etocrilene | 1 | 5232-99-5 | 226-029-0 | 3,53 | ||||||
Eucalyptus globulus, extract | 1 | 84625-32-1 | 283-406-2 | 3,52 | 167147 | |||||
Eucalyptus maculata citriodora, extract | 1 | 85203-56-1 | 286-249-8 | 7,5 | ||||||
Eugenol | 1 | 97-53-0 | 202-589-1 | 21,2 | 492573 | |||||
2,2'-(C12-14 even numbered Alkyl imino) diethanol | 1 | - | 946-745-3 | 2,112 | ||||||
C12-18-(even numbered, C18 unsaturated)-Alkylamines acetates | 1 | - | 946-260-7 | 0,38 | ||||||
Everzol Orange ED-G Crude | 1 | 906532-68-1 | 480-890-9 | 47 | ||||||
Extract obtained from defatted powder of Theobroma cacao (Malvaceae) by extraction with water and ethanol | 1 | - | 948-068-9 | 950 | ||||||
Extract obtained from powder of Theobroma cacao (Malvaceae) by co-extraction with ethanol and propylene glycol | 1 | - | 947-962-6 | 3,22 | ||||||
Extract residues (coal), light oil alk., acid ext., indene fraction | 1 | 101316-62-5 | 309-867-2 | 2,31 | 2,31 | |||||
Extract residues (coal), tar oil alk. | 1 | 65996-87-4 | 266-021-4 | 3,25 | ||||||
Extracts, coal tar oil alk.; Alkaline Extract | 1 | 65996-83-0 | 266-017-2 | 8 | ||||||
Extracts (petroleum), catalytic reformed light naphtha solvent | 1 | 91995-68-5 | 295-331-2 | 840 | ||||||
Extracts (petroleum), catalytic reformed light naphtha solvent | 2 | 91995-68-5 | 295-331-2 | 837,5 | ||||||
Extracts (petroleum), deasphalted vacuum residue solvent | 1 | 91995-70-9 | 295-332-8 | 136,68 | ||||||
Extracts (petroleum), heavy naphtha solvent; Kerosine - unspecified | 1 | 64741-98-6 | 265-099-7 | 192 | 192 | |||||
Extracts (petroleum), heavy naphtha solvent; Kerosine - unspecified | 2 | 64741-98-6 | 265-099-7 | 2,31 | 2,31 | |||||
Extracts (petroleum), heavy naphthenic distillate solvent | 1 | 64742-11-6 | 265-111-0 | 2,73 | ||||||
Extracts (petroleum), heavy paraffinic distillate solvent | 1 | 64742-04-7 | 265-103-7 | 2,73 | ||||||
Extracts (petroleum), light naphtha solvent | 1 | 64741-99-7 | 265-100-0 | 3,25 | ||||||
Extracts (petroleum), light paraffinic distillate solvent | 1 | 64742-05-8 | 265-104-2 | 2,73 | ||||||
Extracts (petroleum), residual oil solvent | 1 | 64742-10-5 | 265-110-5 | 136,68 | ||||||
Extracts (petroleum), solvent-refined heavy paraffinic distillate solvent | 1 | 68783-04-0 | 272-180-0 | 2,73 | ||||||
Extracts (petroleum), solvent-refined heavy paraffinic distillate solvent | 2 | 68783-04-0 | 272-180-0 | 5,58 | ||||||
Fast Pyrolysis Bio-oil | 1 | 1207435-39-9 | 692-061-0 | 22 | ||||||
FAT 41'018/A | 1 | - | 411-390-0 | 70,5 | ||||||
Fats and Glyceridic oils, vegetable, winterized, reaction products with ammonia-ethanolamine reaction products | 1 | 1419212-73-9 | 800-253-4 | 23,3 | ||||||
Fatty acid chlorides, C8-14 (even numbered), reaction products with glycine | 1 | - | 938-147-6 | 12,225 | ||||||
Fatty acid chlorides, C12-18 (even numbered) and C18 unsatd., reaction products with Sodium N-methyltaurinate | 1 | - | 939-529-5 | 66,12 | ||||||
Fatty acid chlorides, C18 unsatd., reaction products with Sodium N-methyltaurinate | 1 | - | 939-538-4 | 66,12 | ||||||
Fatty acids, C12-18 | 1 | 67701-01-3 | 266-925-9 | 17,632 | ||||||
Fatty acids, C16-22 | 1 | 68002-88-0 | 268-103-5 | 17,632 | ||||||
Fatty acids, C14-22 | 1 | 68424-37-3 | 270-298-7 | 17,632 | ||||||
Fatty acids, C12-14 | 1 | 90990-10-6 | 292-771-7 | 17,632 | ||||||
Fatty acids, C18-22 | 1 | 90990-11-7 | 292-772-2 | 17,632 | ||||||
Fatty acids, C14-C18 and C18 unsaturated, amides with 2,2’-Iminodiethanol | 1 | - | 948-052-1 | 4,93 | ||||||
Fatty acids, C16-18, barium salts | 1 | 91002-07-2 | 292-883-6 | 8,8 | ||||||
Fatty acids, C16-18, barium salts | 2 | 91002-07-2 | 292-883-6 | 29,88 | ||||||
Fatty acids, C16-18, reaction products with diethanolamine | 1 | 91032-08-5 | 293-014-3 | 24,5 | 175724 | |||||
Fatty acids, C18 unsat, reaction products with Triethylenetetramin, Tetraethylenepentamine and Pentaethylenehexamine | 1 | - | 945-133-3 | 1,7 | ||||||
Fatty acids, C8-10, C12-18-alkyl esters | 1 | 95912-86-0 | 306-082-7 | 7,05 | ||||||
Fatty acids, C16-18, C12-18-alkyl esters | 1 | 95912-87-1 | 306-083-2 | 7,05 | ||||||
Fatty acids, C16-18, C16-18-alkyl esters | 1 | 97404-33-6 | 306-797-4 | 7,05 | ||||||
Fatty acids C12-18 (even numbered); C16-20 (even numbered)-alkyl esters | 1 | - | 939-715-6 | 7,05 | ||||||
Fatty acids, C10-18 and C12-22-unsatd., C14-18 and C16-18-unsatd. alkyl esters | 1 | 85049-31-6 | 285-200-8 | 6,96 | ||||||
Fatty acids, C16-C18 (even numbered) and C18 (unsaturated) and Fatty acids, C16-C18 (even numbered) and C18 (unsaturated) methyl esters | 1 | - | 939-235-7 | 6,96 | ||||||
Fatty acids, C16-18 and C18-unsatd., branched and linear | 1 | 68955-98-6 | 273-295-9 | 282 | ||||||
Fatty acids, C6-19-branched, zinc salts | 1 | 68551-44-0 | 271-378-4 | 22,04 | ||||||
Fatty acids, C6-19-branched, zinc salts | 2 | 68551-44-0 | 271-378-4 | 26,32 | ||||||
Fatty acids, C6-19-branched, zinc salts | 3 | 68551-44-0 | 271-378-4 | 5 | ||||||
Fatty acids, C9-13-neo-, calcium salts | 1 | 68424-35-1 | 270-296-6 | 22,04 | ||||||
Fatty acids, C9-13-neo-, calcium salts | 2 | 68424-35-1 | 270-296-6 | 23,96 | ||||||
Fatty acids, coco derivs. II, reaction products with glycine, potassium salts | 1 | - | 942-063-5 | 4,11 | ||||||
Fatty acids, coco, esters with oxybis(propanediol) | 1 | 85711-49-5 | 288-309-9 | 35,3 | ||||||
Fatty acids, coco, isotridecyl esters | 1 | 91031-91-3 | 292-997-6 | 7,05 | ||||||
Fatty acids, coco, 2-sulfoethyl esters, sodium salts | 1 | 61789-32-0 | 263-052-5 | 62,5 | 149084 | |||||
Fatty acids, C16-18, compds. with C16-18-Alkyl amines | 1 | 1428547-35-6 | 800-984-9 | 0,66 | ||||||
Fatty acids, dehydrated castor-oil | 1 | 61789-45-5 | 263-061-4 | 17,632 | ||||||
Fatty-acids, C18-unsatd., dimers | 1 | 71808-39-4 | 615-494-9 | 52,26 | ||||||
Fatty acids, C18-unsatd., dimers, compds. with coco alkylamines | 1 | 68647-95-0 | 614-682-8 | 0,91 | ||||||
Fatty acids, C18-unsatd., dimers distillation product | 1 | 61788-89-4 | 500-148-0 | 52,26 | ||||||
Fatty acids, C18-unsatd., dimers, 2-ethylhexyl esters | 1 | 68334-05-4 | 500-204-4 | 22,77 | ||||||
Fatty acids, C18-unsatd., dimers, 2-ethylhexyl esters | 2 | 68334-05-4 | 500-204-4 | 45,56 | ||||||
Fatty acids, C18-unsatd., dimers, hydrogenated | 1 | 68783-41-5 | 500-231-1 | 52,26 | ||||||
Fatty acids, C18-unsatd, dimers, hydrogenated, diisopropyl esters | 1 | 103213-20-3 | 500-288-2 | 43,64 | ||||||
Fatty acids, C18-unsatd., dimers, hydrogenated, 2-ethylhexyl esters | 1 | 68440-06-2 | 500-214-9 | 53,42 | ||||||
Fatty acids, C16-18, esters with Pentaerythritol | 1 | 85116-93-4 | 285-547-5 | 76 | ||||||
Fatty acids, C18 (saturated and unsaturated) ethyl esters | 1 | - | 940-683-0 | 17,5 | ||||||
Fatty acids, C16-18 and C18-unsatd., Ethyl esters | 1 | 85049-36-1 | 285-206-0 | 6,96 | ||||||
Fatty acids, C16-18, 2-ethylhexyl esters | 1 | 91031-48-0 | 292-951-5 | 23,5 | ||||||
Fatty acids, C8-16(even numbered), 2-ethylhexyl esters | 1 | 135800-37-2 | 603-931-6 | 23,5 | ||||||
Fatty acids, C14-22, 2-ethylhexyl esters, epoxidized | 1 | 95370-96-0 | 305-962-8 | 35 | ||||||
Fatty acids, C16 and C18-20 (even numbered, unsaturated), 2-ethylhexyl esters | 1 | - | 701-259-9 | 35 | ||||||
Fatty acids, C16-18, 2-hexyldecyl esters | 1 | 101227-09-2 | 309-832-1 | 7,05 | ||||||
Fatty acids, hydrogenated tallow, distn. residues | 1 | 70084-85-4 | 274-307-5 | 17,632 | ||||||
Fatty acids, C16-18 (even numbered), Iron(III) salts | 1 | - | 947-665-1 | 16,4 | ||||||
Fatty acids, C16-C18 and C18 unsaturated isopentyl esters, epoxidized | 1 | - | 700-659-0 | 5,88 | ||||||
Fatty acids, C16-18, isotridecyl esters | 1 | 95912-88-2 | 306-084-8 | 7,05 | ||||||
Fatty acids, linseed-oil, reaction products with 2-amino-2-(hydroxymethyl)-1,3-propanediol and formaldehyde | 1 | 80584-99-2 | 279-510-2 | 1,64 | ||||||
Fatty acids, C16-18 (even numbered), Manganese(II) salts | 1 | - | 947-666-7 | 4,93 | ||||||
Fatty acids, C8-10, Me esters | 1 | 85566-26-3 | 287-636-4 | 73,06 | ||||||
Fatty acids, C16-18, Me esters | 1 | 85586-21-6 | 287-824-6 | 124,4 | ||||||
Fatty acids, C14-18 and C16-18-unsatd., Methyl esters | 1 | 67762-26-9 | 267-007-0 | 49,3 | ||||||
Fatty acids, C16-18 and C18-unsatd., Methyl esters, distn. residues | 1 | 68604-41-1 | 271-692-1 | 17,44 | ||||||
Fatty acids, C6-24 and C6-24-unsatd., Methyl esters, distn. residues | 1 | 102242-52-4 | 310-083-8 | 17,44 | ||||||
Fatty acids, C12-18 (even numbered)-methyl esters, sulfonated, sodium salts | 1 | - | 947-394-9 | 11,75 | ||||||
Fatty acids, C18 unsatd., mono- and diesters with triethanolamine, dimethyl sulfate quaternized | 1 | - | 947-936-4 | 44 | ||||||
Fatty acids, C10-20-neo- | 1 | 85116-96-7 | 285-549-6 | 11,02 | ||||||
Fatty acids, C9-13-neo-, barium salts | 1 | 92044-82-1 | 295-361-6 | 1,74 | ||||||
Fatty acids, C10-20-neo, potassium salts | 1 | - | 940-217-6 | 3,67 | ||||||
Fatty acids, C9-13-neo-, copper salts | 1 | 91031-79-7 | 292-985-0 | 1,57 | ||||||
Fatty acids, C16-18, 2-octyldodecyl esters | 1 | 96690-38-9 | 306-232-1 | 7,05 | ||||||
Fatty acids, rape-oil, hydrogenated, reaction products with diethylenetriamine, di-Me sulfate-quaternized | 1 | 97281-29-3 | 306-529-6 | 5,92 | ||||||
Fatty acids C10-20, reaction product with Diethylenetriamine | 1 | - | 940-308-0 | 0,78 | ||||||
Fatty acids, C18-unsatd., reaction products with Acrylic acid and Polyethylenepolyamines | 1 | 85586-18-1 | 287-820-4 | 3,52 | ||||||
C18 unsaturated Fatty acids, reaction products with 1-Aminopropan-2-ol, Maleic anhydride and Sodium bisulfite | 1 | - | 947-655-7 | 233,36 | ||||||
Fatty acids, C16-18 (even numbered) (linear and branched) and C18 unsatd. (linear and branched), reaction products with diethanolamine | 1 | - | 939-017-1 | 1,17 | ||||||
Fatty acids, C16-18, reaction products with Diethylenetriamine | 1 | 85711-52-0 | 288-312-5 | 11,75 | ||||||
Fatty acids, C18 unsaturated, reaction products with Diethylenetriamine | 1 | 1226892-43-8 | 629-715-1 | 1,7 | ||||||
Fatty acids, C18 unsaturated, reaction products with Diethylenetriamine | 2 | 1226892-43-8 | 629-715-1 | 0,88 | ||||||
Fatty acids, C18 unsaturated, reaction products with diethylenetriamine, acetate salts | 1 | - | 938-649-5 | 1,47 | ||||||
Fatty acids, C16-18 (even numbered) and C18 unsatd., reaction products with diethylene triamine, di-Me sulfate quaternized | 1 | - | 937-237-2 | 44 | ||||||
Fatty acids, C16-18 (even numbered), reaction products with diethylene triamine, dimethyl sulfate quaternized | 1 | - | 947-853-3 | 14,8 | ||||||
Fatty acids, C18 unsat, reaction products with pentaethylenehexamine, acetate salts | 1 | - | 939-626-2 | 3,5 | ||||||
Fatty acids, C16-18 (even numbered), reaction products with Tetraethylenepentamine, acetates (salts) | 1 | - | 939-688-0 | 44 | ||||||
Fatty acids, C16-18 (even numbered), reaction products with Triethanolamine, di-Me sulfate-quaternized | 1 | - | 931-209-3 | 44 | ||||||
Fatty acids, C16-18 (even numbered) and C18 unsatd., reaction products with Triethanolamine, di-Me sulfate-quaternized | 1 | - | 931-203-0 | 44 | ||||||
Fatty acids, C18 (even numbered) and C18 unsatd., reaction products with Triethanolamine, Dimethyl sulfate quaternized | 1 | - | 943-532-7 | 44 | ||||||
Fatty acids, C8-18 (even numbered) and C18 unsatd., reaction products with Triethanolamine, Dimethyl sulfate-quaternized | 1 | - | 947-361-9 | 10,6 | ||||||
Fatty acids, C18 unsatd., reaction products with triethanolamine, Dimethyl sulfate-quaternized | 1 | - | 931-216-1 | 44 | ||||||
Fatty acids, soybean oil, conjugated | 1 | - | 917-780-1 | 17,632 | ||||||
Fatty acids, C12-14, α-sulfo, disodium salts | 1 | - | 942-523-5 | 5,7 | ||||||
Fatty acids, C12-18 and C18-unsatd., 2-sulfoethyl esters, sodium salts | 1 | 85408-62-4 | 287-024-7 | 58,83 | ||||||
Fatty acids, C8-16, 2-sulfopropyl esters, sodium salts | 1 | - | 827-581-0 | 11,8 | ||||||
Fatty acids, sunflower-oil, conjugated | 1 | 68953-27-5 | 273-195-5 | 17,632 | 158045 | |||||
Fatty acids, sunflower-oil, conjugated, maleated, reation products with diethanolamine, maleated tall-oil fatty acids and triethanolamine | 1 | 1415316-96-9 | 800-003-4 | 5,4 | ||||||
Fatty acids, tall oil and rosin reacted with maleic anhydride | 1 | - | 940-281-5 | 1,75 | ||||||
Fatty acids, tall oil and rosin reacted with maleic anhydride | 2 | - | 940-281-5 | 1,76 | ||||||
Fatty acids, tall oil, reaction products with glycidyl neodecanoate | 1 | 80207-00-7 | 617-001-2 | 4,93 | ||||||
Fatty acids, tall-oil, compds. with N-[3-(Dimethylamino)propyl]tall-oil amides | 1 | 92128-22-8 | 295-714-4 | 1 | 14,1 | |||||
Fatty acids, tall-oil, low-boiling | 1 | 65997-03-7 | 266-039-2 | 35,3 | ||||||
Fatty acids, tall-oil, manganese salts | 1 | 8030-70-4 | 232-445-3 | 2,22 | ||||||
Fatty acids, tall-oil, reaction products with acrylic acid | 1 | - | 939-424-4 | 3,19 | ||||||
Fatty acids tall-oil, reaction products with Acrylic acid, Potassium salt | 1 | - | 947-663-0 | 7,01 | ||||||
Fatty acids, tall-oil, reaction products with 2-[(2-aminoethyl)amino]ethanol | 1 | 68919-76-6 | 272-902-4 | 0,529 | ||||||
Fatty acids, tall-oil, reaction products with bisphenol A, epichlorohydrin, glycidyl tolyl ether and triethylenetetramine | 1 | 186321-96-0 | 606-078-8 | 7,05 | ||||||
Fatty acids, tall-oil, reaction products with boric acid (H3BO3) and diethanolamine | 1 | 91770-03-5 | 294-785-9 | 22 | ||||||
Fatty acids, tall-oil, reaction products with Diethylenetriamine, Maleic anhydride, Tetraethylenepentamine and Triethylenetetramine | 1 | 68990-47-6 | 273-601-0 | 14,69 | ||||||
Fatty acids, tall-oil, reaction products with ethanolamine, ethoxylated | 1 | 61791-19-3 | 612-396-8 | 98 | ||||||
Fatty acids, tall-oil, reaction products with formaldehyde and (Z)-N-9-octadecenyl-1,3-propanediamine | 1 | 68911-83-1 | 272-789-1 | 1,18 | ||||||
Fatty acids, tall-oil, reaction products with maleic anhydride and triethylenetetramine | 1 | - | 947-785-4 | 32,9 | ||||||
Fatty acids, C18 unsaturated, trimers, hydrogenated | 1 | 1373883-45-4 | 800-426-4 | 26,1 | ||||||
Fatty acids, C8-18 and C18-unsatd | 1 | 67701-05-7 | 266-929-0 | 17,632 | ||||||
Fatty acids, C14-18 and C16-18-unsatd | 1 | 67701-06-8 | 266-930-6 | 17,632 | ||||||
Fatty acids, C18-unsatd., dimers, oligomeric reaction products with 1-Chloro-2,3-epoxypropane | 1 | 68475-94-5 | 500-215-4 | 0,274 | ||||||
Fatty acids, C18-unsatd., dimers, polymers with 2-Ethylhexanol and Neopentyl glycol | 1 | 68552-19-2 | 614-590-8 | 24,9 | ||||||
Fatty acids, C18-unsatd., phosphates | 1 | 68604-99-9 | 271-708-7 | 16,4 | ||||||
Fatty acids, C14-18 and C16-18-unsatd., barium salts | 1 | 95465-85-3 | 305-998-4 | 32,59 | ||||||
Fatty acids, C14-18 and C16-18-unsatd., barium salts | 2 | 95465-85-3 | 305-998-4 | 8,8 | ||||||
Fatty acids, C14-18 and C16-18 unsaturated, compounds with triethanolamine | 1 | 68082-25-7 | 268-369-2 | 16,4 | ||||||
Fatty acids, C16-18 and C18-unsatd., compds. with triethanolamine | 1 | 68424-19-1 | 270-279-3 | 21,2 | ||||||
Fatty acids, C18-(unsaturated) dimers and their monoesters and diesters with 2-ethylhexanol | 1 | - | 25,52 | |||||||
Fatty acids, C18-unsatd., dimers, oligomeric reaction products with fatty acids, C16-18 and C18-unsatd., branched and linear, tetraethylenepentamine and triethylenetetramine | 1 | 157707-73-8 | 500-382-3 | 3,9 | ||||||
Fatty acids, C18-unsatd., dimers, oligomeric reaction products with triethylenetetramine | 1 | 103758-99-2 | 500-290-3 | 3,9 | ||||||
Fatty acids, C18-unsatd, dimers, polymers with tall-oil fatty acids and triethylenetetramine | 1 | 68082-29-1 | 500-191-5 | 3,9 | ||||||
Fatty acids, C18-unsatd., dimers, reaction products with polyethylenepolyamines | 1 | 68410-23-1 | 614-452-7 | 3,9 | ||||||
Fatty acids, C16-18 and C18-unsatd., isooctyl esters, epoxidized | 1 | 97553-05-4 | 307-159-8 | 98 | ||||||
Fatty acids, C14-18 and C16-18-unsatd., isotridecyl esters | 1 | 85116-88-7 | 285-541-2 | 7,05 | ||||||
Fatty acids, C8-18 and C18-unsatd., Me esters | 1 | 67762-37-2 | 267-014-9 | 73,06 | ||||||
Fatty acids, C14-18 and C16-18-unsatd., mixed esters with castor oil, castor oil fatty acids, 2-ethylhexanoic acid and 2,2-bis(hydroxymethyl)-1-butanol | 1 | 92113-48-9 | 295-653-3 | 42,74 | ||||||
Fatty acids, C16 and C18 unsatd., polymers with bisphenol A, Bu glycidyl ether, epichlorohydrin and triethylenetetramine | 1 | 105839-18-7 | 600-687-2 | 7,052 | ||||||
Fatty acids, C16 and C18 unsatd., polymers with bisphenol A, Bu glycidyl ether, epichlorohydrin and triethylenetetramine | 2 | 105839-18-7 | 600-687-2 | 7,05 | ||||||
Fatty acids, C18 unsaturated, reaction product with ammonia-ethanolamine reaction by-products | 1 | 1224966-15-7 | 629-757-0 | 1,7 | ||||||
Fatty acids, C18-unsaturated, reaction products with amines, polyethylenepoly-, (tetraethylenepentamine, pentaethylenehexamine, hexaethyleneheptamine fractions) | 1 | - | 701-131-2 | 0,492 | ||||||
Fatty acids, C8-18 and C18-unsatd., reaction products with diethanolamine and propylene oxide | 1 | 1000817-22-0 | 600-026-8 | 23,5 | ||||||
Fatty acids C18 unsaturated, reaction products with polyethylene amines | 1 | 1226892-49-4 | 629-742-9 | 29 | ||||||
Fatty acids C18 unsat, reaction products with tetraethylenepentamine | 1 | 1226892-45-0 | 629-725-6 | 9,87 | ||||||
Fatty acids C18 unsaturated, reaction products with triethylenetetramine | 1 | 1226892-44-9 | 629-765-4 | 0,492 | ||||||
Fatty acids, vegetable-oil, Methyl esters | 1 | 68990-52-3 | 273-606-8 | 49,3 | ||||||
Fatty acids, C9-13-neo-, zinc salts | 1 | 92044-84-3 | 295-363-7 | 25,93 | ||||||
Fatty acids, C9-13-neo-, zinc salts | 2 | 92044-84-3 | 295-363-7 | 22,04 | ||||||
Fatty acids, C9-13-neo-, zinc salts | 3 | 92044-84-3 | 295-363-7 | 5 | ||||||
Fatty acids, C14-18 and C16-18-unsatd., zinc salts | 1 | 67701-12-6 | 266-936-9 | 50 | ||||||
Fatty acids, C16-18, zinc salts | 1 | 91051-01-3 | 293-049-4 | 50 | ||||||
Fatty acids, C18-unsatd. | 1 | 88895-93-6 | 289-450-9 | 17,632 | ||||||
Fatty acids, tall-oil, oligomeric reaction products with maleic anhydride and rosin, calcium magnesium zinc salts | 1 | 160901-14-4 | 500-451-8 | 10 | ||||||
Fatty acids, tall-oil, oligomeric reaction products with maleic anhydride and rosin, calcium magnesium zinc salts | 2 | 160901-14-4 | 500-451-8 | 19 | ||||||
Fatty acids, C16-18 and C18-unsaturated, Methyl esters | 1 | 67762-38-3 | 267-015-4 | 49,3 | 491697 | |||||
Fatty alcohols, C12-18 (even numbered), manuf. of, destn. residues | 1 | - | 939-562-5 | 23,51 | ||||||
Fatty alcohols C13-15 (odd numbered, linear and branched), reaction products with ethylene oxide, sodium chloroacetate and ethanolamine | 1 | - | 931-915-1 | 14,8 | ||||||
C36 fatty diol | 1 | 147853-32-5 | 604-608-2 | 26,1 | ||||||
Fatty acid chloride, C12, reaction product with sodium glutamate and sodium hydroxide | 1 | - | 947-842-3 | 10 | 22 | |||||
Fatty acids, C9-13-neo- | 1 | 68938-07-8 | 273-114-3 | 11,02 | ||||||
Fatty acids, coco, esters with 3,3'-oxybis[1,2-propanediol] | 1 | 85029-63-6 | 285-089-6 | 29,4 | ||||||
Fatty acids, C18-36, esters with ethylene glycol | 1 | 94944-95-3 | 305-673-7 | 106 | ||||||
Fatty acids C20-22 (even numbered), C18-22 (even numbered) alkyl esters | 1 | - | 701-233-7 | 7,05 | ||||||
Fatty acids, C9, hexaesters with dipentaerythritol | 1 | - | 946-882-9 | 16,4 | ||||||
Fatty acids, tall-oil, compounds with triethanolamine | 1 | 68132-46-7 | 268-638-4 | 0,95 | ||||||
Fatty acids, tallow, compounds with triethanolamine | 1 | 61790-67-8 | 263-158-1 | 11,75 | ||||||
FBC Ash (residues of coal combustion in fluidized bed combustion boilers) | 1 | - | 931-257-5 | 11,3 | ||||||
Feldspar minerals, hematite and quartz, calcination products of copper mining residues | 1 | - | 701-090-0 | 10 | 10 | |||||
Feldspar minerals, magnetite and quartz, calcination products of copper mining residues. | 1 | - | 944-188-0 | 10 | 10 | |||||
Feldspar minerals, magnetite and quartz, calcination products of copper mining residues. | 2 | - | 944-188-0 | 10 | ||||||
Feldspar minerals, magnetite and quartz, calcination products of copper mining residues. | 3 | - | 944-188-0 | 10 | ||||||
Fenitrothion | 1 | 122-14-5 | 204-524-2 | 0,09 | 11300 | |||||
Ferbam | 1 | 14484-64-1 | 238-484-2 | 4,56 | 570139 | |||||
Feropur | 1 | - | 931-319-1 | 0,93 | ||||||
Ferrate(4-), hexakis(cyano-C)-, Et 2-[6-(ethylamino)-3-(ethylimino)-2,7-dimethyl-3H-xanthen-9-yl]benzoate copper(2+) salts | 1 | 12237-63-7 | 235-469-2 | 16,4 | 125526 | |||||
Ferrate(4-), hexakis(cyano-C)-, methylated 4-[(4-aminophenyl)(4-imino-2,5-cyclohexadien-1-ylidene)methyl]benzenamine copper(2+) salts | 1 | 12237-62-6 | 235-468-7 | 24,7 | 125525 | |||||
Ferric molybdate | 1 | 13769-81-8 | 237-389-3 | 22,96 | 127119 | |||||
Ferrocene | 1 | 102-54-5 | 203-039-3 | 0,02 | 492633 | |||||
Ferro silicon | 1 | - | 912-631-7 | 0,3 | ||||||
Flue dust, copper-refining | 1 | 67711-90-4 | 266-966-2 | 5 | ||||||
Flue dust, copper-refining | 2 | 67711-90-4 | 266-966-2 | 0,05 | 0,05 | |||||
Flue dust, copper-refining | 3 | 67711-90-4 | 266-966-2 | 0,5 | ||||||
Flue dust, copper-refining | 4 | 67711-90-4 | 266-966-2 | 0,05 | ||||||
Flue dust, copper-refining | 5 | 67711-90-4 | 266-966-2 | 0,04 | ||||||
Flue dust, copper-refining | 6 | 67711-90-4 | 266-966-2 | 0,1 | ||||||
Flue dust, copper-refining | 7 | 67711-90-4 | 266-966-2 | 0,005 | ||||||
Flue dust, copper-refining | 8 | 67711-90-4 | 266-966-2 | 0,004 | ||||||
Flue dust, lead-refining | 1 | 69029-67-0 | 273-809-1 | 0,004 | ||||||
Flue dust, lead-refining | 2 | 69029-67-0 | 273-809-1 | 0,004 | ||||||
Flue dust, lead-refining | 3 | 69029-67-0 | 273-809-1 | 0,02 | ||||||
Flue dust, lead-refining | 4 | 69029-67-0 | 273-809-1 | 5 | ||||||
Flue dust, lead-refining | 5 | 69029-67-0 | 273-809-1 | 0,1 | ||||||
Flue dust, lead-refining | 6 | 69029-67-0 | 273-809-1 | 0,005 | ||||||
Flue dust, lead-refining | 7 | 69029-67-0 | 273-809-1 | 0,05 | 0,05 | |||||
Flue dust, lead-refining | 8 | 69029-67-0 | 273-809-1 | 0,5 | ||||||
Flue dust, lead-refining | 9 | 69029-67-0 | 273-809-1 | 0,5 | ||||||
Flue dust, lead-refining | 10 | 69029-67-0 | 273-809-1 | 0,05 | ||||||
Flue dust, lead-refining | 11 | 69029-67-0 | 273-809-1 | 0,2 | ||||||
Flue dust, lead-refining | 12 | 69029-67-0 | 273-809-1 | 1 | ||||||
Flue dust, lead-refining | 13 | 69029-67-0 | 273-809-1 | 0,107 | ||||||
Flue dust, lead-refining | 14 | 69029-67-0 | 273-809-1 | 0,04 | ||||||
Flue dust, lead-refining | 15 | 69029-67-0 | 273-809-1 | 0,0509 | ||||||
Flue dust, lead-refining | 16 | 69029-67-0 | 273-809-1 | 0,1052 | ||||||
Flue dust, lead-refining | 17 | 69029-67-0 | 273-809-1 | 11,17 | ||||||
Flue dust, lead-refining | 18 | 69029-67-0 | 273-809-1 | 3,33 | 16,76 | |||||
Flue dust, precious metal refining | 1 | 98072-44-7 | 308-496-3 | 0,05 | 0,05 | |||||
Flue dust, precious metal refining | 2 | 98072-44-7 | 308-496-3 | 131,8 | 0,1318 | |||||
Flue dust, precious metal refining | 3 | 98072-44-7 | 308-496-3 | 0,005 | ||||||
Flue dust, precious metal refining | 4 | 98072-44-7 | 308-496-3 | 0,016 | ||||||
Flue dust, precious metal refining | 5 | 98072-44-7 | 308-496-3 | 0,004 | ||||||
Flue dust, precious metal refining | 6 | 98072-44-7 | 308-496-3 | 0,05 | ||||||
4,4'-(9H-Fluoren-9-ylidene)bis(2-chloroaniline) | 1 | 107934-68-9 | 407-560-9 | 23,51 | 530726 | |||||
Fluorine | 1 | 7782-41-4 | 231-954-8 | 1,58 | 1,58 | TRGS900 | 7090 | |||
Fluorobenzene | 1 | 462-06-6 | 207-321-7 | 24 | 510581 | |||||
Fluoroboric acid solution | 1 | 16872-11-0 | 240-898-3 | 0,173 | 520034 | |||||
2-Fluoro-4-(4-butylphenyl)-phenyl boronic acid | 1 | - | 936-617-5 | 7,4 | ||||||
4-Fluoro-1,3-dioxolan-2-one | 1 | 114435-02-8 | 483-360-5 | 0,164 | ||||||
Main component 1 (isomer 1): 2-(6-Fluoro-4-(3-(2,5-disulfophenylazo)-4-hydroxy-2-sulfonapht-7-ylamino)-1,3,5-triazinylamino)-3-(6-fluoro-4-(3-(1,5-disulfonaphth-2-ylazo)-4-hydroxy-2-sulfonaphth-7-ylamino)-1,3,5-triazin-2-ylamino)-propane sodium salt Main component 1 (isomer 2): 2-(6-Fluoro-4-(3-(2,5-disulfo-phenylazo)-4-hydroxy-2-sulfonaphth-7-yl-amino))-1,3,5-triazin-2-ylamino)-3-(6-fluoro-4-(3-(2,5-di-sulfo-phenylazo)-4-hydroxy-2-sulfonaphth-7-ylamino)-1,3,5-triazin-2-ylamino)-propane sodium salt Main component 2: 2,3-Bis-(6-fluoro-4-(3-(2,5-disulfo-phenylazo)-4-hydroxy-2-sulfonaphth-7-ylamino)-1,3,5-triazin-2-ylamino)-propanesodium salt Main component 3: 2,3-Bis-(6-fluoro-4-(3-(1,5-disulfonaphth-2-ylazo)-4-hydroxy-2-sulfonaphth-7-ylamino)-1,3,5-triazin-2-ylamino)-propane sodium salt | 1 | - | 422-610-1 | 2,35 | 536218 | |||||
Fluorosilicic acid solution | 1 | 16961-83-4 | 241-034-8 | 1,875 | 3790 | |||||
2-Fluoro-6-trifluoromethylpyridine | 1 | 94239-04-0 | 428-100-3 | 0,687 | 535894 | |||||
2-(4-(4-(4-Fluoro-6-(2-(2-vinylsulfonylethoxy)ethylamino)-1,3,5-triazin-2-ylamino)phenylazo)phenylazo)naphthalene-4,6,8-trisulfonate, trisodium salt | 1 | 321679-52-1 | 442-230-8 | 2,35 | 536105 | |||||
Foots oil (petroleum) | 1 | 64742-67-2 | 265-171-8 | 5,58 | ||||||
Foots oil (petroleum) | 2 | 64742-67-2 | 265-171-8 | 5,58 | 2,73 | |||||
Foots oil (petroleum), clay-treated | 1 | 93924-32-4 | 300-226-2 | 5,6 | 2,7 | |||||
Foots oil (petroleum), clay-treated | 2 | 93924-32-4 | 300-226-2 | 5,6 | ||||||
Foots oil (petroleum), clay-treated | 3 | 93924-32-4 | 300-226-2 | 5,58 | ||||||
Foots oil (petroleum), clay-treated | 4 | 93924-32-4 | 300-226-2 | 5,58 | 2,73 | |||||
Foots oil (petroleum), hydrotreated | 1 | 92045-12-0 | 295-394-6 | 5,58 | ||||||
Foots oil (petroleum), hydrotreated | 2 | 92045-12-0 | 295-394-6 | 5,58 | 2,73 | |||||
Formaldehyde | 1 | 50-00-0 | 200-001-8 | 0,375 | 9 | TRGS900 | MAK | EU | Carcinogenic | 10520 |
Formaldehyde, oligomeric reaction products with acetone and diphenylamine | 1 | 9003-80-9 | 500-011-5 | 0,822 | ||||||
Formaldehyde, oligomeric reaction products with diethylenetriamine and phenol | 1 | 55552-95-9 | 500-129-7 | 3,52 | ||||||
Formaldehyde, oligomeric reaction products with 4,4'-isopropylidenediphenol and diethylenetriamine | 1 | 77138-45-5 | 500-263-6 | 5,87 | ||||||
Formaldehyde, oligomeric reaction products with 4,4'-isopropylidenediphenol and m-phenylenebis (methylamine) | 1 | 161278-17-7 | 500-607-5 | 3,52 | ||||||
Formaldehyde, polymer with aniline and carbonyl dichloride | 1 | 32055-14-4 | 500-079-6 | 0,05 | ||||||
Formaldehyde, polymer with nonylphenol, reaction products with diethanolamine and propylene oxide | 1 | 68610-97-9 | 614-668-1 | 7,7 | ||||||
Formaldehyde, reaction products with ethylenediamine | 1 | 84066-92-2 | 281-928-5 | 2 | 2 | |||||
Formaldehyde, telomer with 1,3-benzenedimethanamine, 1,3-benzenediol and ethenylbenzene | 1 | 710292-85-6 | 615-240-7 | 0,88 | ||||||
Formaldehyde di-n-butyl acetal | 1 | 2568-90-3 | 219-909-0 | 126,63 | 112982 | |||||
Formaldehydedimethylacetal | 1 | 109-87-5 | 203-714-2 | 126,6 | TRGS900 | MAK | 14060 | |||
Formamide | 1 | 75-12-7 | 200-842-0 | 6,6 | 17710 | |||||
Formic acid, manufacture of, by-products from | 1 | 2137881-70-8 | 701-284-5 | 2,4 | ||||||
Formic acid solution | 1 | 64-18-6 | 200-579-1 | 9,5 | TRGS900 | MAK | EU | 11490 | ||
Formula 1a: Trisodium {1-(2-carboxylato-kO-5-sulfonatophenyl)-5-[3-(2,6-difluoropyrimidin-4-ylamino)-2-olato-kO-5-sulfonatophenyl]-3-phenylformazan-5-ido-k2N1,N5}cuprate(II)Formula 2a: Trisodium {1-(2-carboxylato-kO-5-sulfonatophenyl)-5-[3-(4,6-difluoropyrimidin-2-ylamino)-2-olato-kO-5-sulfonatophenyl]-3-phenylformazan-5-ido-k2N1,N5}cuprate(II) | 1 | - | 473-160-6 | 0,82 | ||||||
N-Formylmorpholine | 1 | 4394-85-8 | 224-518-3 | 13,3 | 50,3 | 28670 | ||||
4-Formylphenylboronic acid | 1 | 87199-17-5 | 438-670-5 | 0,73 | 535962 | |||||
Frits, chemicals | 1 | 65997-18-4 | 266-047-6 | 0,05 | 0,05 | |||||
Frits, chemicals | 2 | 65997-18-4 | 266-047-6 | 0,004 | ||||||
Frits, chemicals | 3 | 65997-18-4 | 266-047-6 | 8,3 | ||||||
Frits, chemicals | 4 | 65997-18-4 | 266-047-6 | 0,5 | 5 | |||||
Frits, chemicals | 5 | 65997-18-4 | 266-047-6 | 0,009 | ||||||
Frits, chemicals | 6 | 65997-18-4 | 266-047-6 | 0,0545 | ||||||
Fuel oil, heavy, high-sulfur | 1 | 92045-14-2 | 295-396-7 | 0,18 | ||||||
Fuel oil, no. 6 | 1 | 68553-00-4 | 271-384-7 | 0,18 | ||||||
Fuel oil, residual | 1 | 68476-33-5 | 270-675-6 | 0,18 | ||||||
Fuel oil, residues-straight-run gas oils, high-sulfur | 1 | 68476-32-4 | 270-674-0 | 0,18 | ||||||
Fuel-oil no 2; Gasoil - unspecified | 1 | 68476-30-2 | 270-671-4 | 68,34 | 536302 | |||||
Fuel-oil no 4; Gasoil - unspecified | 1 | 68476-31-3 | 270-673-5 | 68,34 | ||||||
Fuels, diesel | 1 | 68334-30-5 | 269-822-7 | 68,34 | ||||||
Fumaric acid | 1 | 110-17-8 | 203-743-0 | 42,32 | 33440 | |||||
Fumes of germanium dioxide, calcium carbonate, iron oxides, sodium chloride and amorphous silica from smelting of Ge containing residues during germanium refining | 1 | - | 948-231-4 | 0,335 | ||||||
Fumes of germanium dioxide, calcium carbonate, iron oxides, sodium chloride and amorphous silica from smelting of Ge containing residues during germanium refining | 2 | - | 948-231-4 | 0,05 | ||||||
Fumes of germanium dioxide, calcium carbonate, iron oxides, sodium chloride and amorphous silica from smelting of Ge containing residues during germanium refining | 3 | - | 948-231-4 | 0,5 | 5 | |||||
Fumes of germanium dioxide, calcium carbonate, iron oxides, sodium chloride and amorphous silica from smelting of Ge containing residues during germanium refining | 4 | - | 948-231-4 | 0,05 | 0,05 | |||||
Fumes of germanium dioxide, calcium carbonate, iron oxides, sodium chloride and amorphous silica from smelting of Ge containing residues during germanium refining | 5 | - | 948-231-4 | 0,005 | ||||||
Fumes of germanium dioxide, calcium carbonate, iron oxides, sodium chloride and amorphous silica from smelting of Ge containing residues during germanium refining | 6 | - | 948-231-4 | 0,107 | ||||||
Fumes, silica | 1 | 69012-64-2 | 273-761-1 | 0,3 | ||||||
2-Furaldehyde | 1 | 98-01-1 | 202-627-7 | 8 | 4,26 | 25010 | ||||
2,5-Furandione, dihydro-, mono-C15-20-alkenyl derivs. | 1 | 68784-12-3 | 272-221-2 | 2,351 | ||||||
Furfuryl alcohol | 1 | 98-00-0 | 202-626-1 | 8 | 31 | 27380 | ||||
Further data not available | 1 | - | 935-877-7 | 47 | ||||||
[6R-[6α,7β(Z)]]-7-[2-Furyl(methoxyimino)acetamido]-3-(hydroxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid | 1 | 56271-94-4 | 260-086-2 | 49,3 | ||||||
Fusidic acid | 1 | 6990-06-3 | 230-256-0 | 28 | ||||||
Fyroflex SOL-DP | 1 | - | 479-310-7 | 23,3 | 23,3 | |||||
Gallium arsenide | 1 | 1303-00-0 | 215-114-8 | 0,02 | EU | Carcinogenic | 109337 | |||
Gas oils (petroleum), heavy atmospheric | 1 | 68783-08-4 | 272-184-2 | 0,18 | ||||||
Gas oils (petroleum), heavy vacuum | 1 | 64741-57-7 | 265-058-3 | 0,18 | ||||||
Gas oils (petroleum), hydrodesulfurized | 1 | 64742-79-6 | 265-182-8 | 16,4 | ||||||
Gas oils (petroleum), hydrodesulfurized heavy vacuum | 1 | 64742-86-5 | 265-189-6 | 0,18 | ||||||
Gas oils (petroleum), hydrodesulfurized light vacuum | 1 | 64742-87-6 | 265-190-1 | 68,34 | ||||||
Gas oils (petroleum), hydrotreated vacuum | 1 | 64742-59-2 | 265-162-9 | 0,18 | ||||||
Gas oils (petroleum), light vacuum | 1 | 64741-58-8 | 265-059-9 | 68,34 | ||||||
Gas oils (petroleum), thermal-cracked, hydrodesulfurized | 1 | 92045-29-9 | 295-411-7 | 27,34 | ||||||
Gases (petroleum), extractive, C3-5, butene-isobutylene-rich | 1 | 68477-42-9 | 270-732-5 | 1530 | ||||||
Gas oils (petroleum), hydrotreated light vacuum | 1 | 92045-24-4 | 295-407-5 | 68,34 | ||||||
Gas oils (petroleum), straight-run | 1 | 64741-43-1 | 265-043-1 | 16,4 | ||||||
Gasoline | 1 | 86290-81-5 | 289-220-8 | 837,5 | ||||||
Gasoline | 2 | 86290-81-5 | 289-220-8 | 837,5 | 1,9 | |||||
Gasoline, C5-11, high-octane stabilized reformed | 1 | 93572-29-3 | 297-458-9 | 837,5 | ||||||
Gasoline, pyrolysis, debutanizer bottoms; Low boiling point naphtha - unspecified | 1 | 68606-10-0 | 271-726-5 | 3,25 | ||||||
Gasoline, pyrolysis, hydrogenated; Low boiling point naphtha unspecified | 1 | 94114-03-1 | 302-639-3 | 3,25 | ||||||
Gasoline, straight-run, topping-plant | 1 | 68606-11-1 | 271-727-0 | 837,5 | ||||||
Gasoline, straight-run, topping-plant | 2 | 68606-11-1 | 271-727-0 | 837,5 | 1,9 | |||||
Geranyl acetate | 1 | 105-87-3 | 203-341-5 | 62,59 | 101622 | |||||
Germanium, germanium hydroxide oxides and amorphous silica, recovery products from germanium refining | 1 | - | 947-204-4 | 0,335 | ||||||
Germanium, Powder | 1 | 7440-56-4 | 231-164-3 | 0,335 | TRGS900 | 8270 | ||||
Germanium hydroxide oxides, amorphous silica and sodium chloride, recovery products from germanium refining | 1 | - | 947-836-0 | 0,335 | ||||||
Germanium hydroxide oxides, calcium sulfate, calcium carbonate, iron sulfide and amorphous silica, recovery products from germanium refining | 1 | - | 947-838-1 | 0,335 | ||||||
Germanium(IV) oxide | 1 | 1310-53-8 | 215-180-8 | 0,335 | TRGS900 | 5010 | ||||
Glass, oxide, chemicals | 1 | 65997-17-3 | 266-046-0 | |||||||
D-Glucitol, 1-deoxy-1-(methylamino)-, N-[C8-10(even numbered) acyl] derivs. | 1 | - | 940-284-1 | 10,58 | ||||||
D-Glucitol, 1-deoxy-1-(methylamino)-, N-[C18-C18 (unsaturated) acyl] derivs. | 1 | - | 940-373-5 | 10,58 | ||||||
D-Glucitol, 1-deoxy-1-(methylamino)-, N-[C8-16 (even numbered) and C18 unsaturated acyl] derivs. | 1 | - | 940-422-0 | 10,58 | ||||||
D-Glucitol, propoxylated | 1 | 52625-13-5 | 500-118-7 | 98 | ||||||
D-Gluconic acid | 1 | 526-95-4 | 208-401-4 | 59 | 493175 | |||||
D-Gluconic acid, monopotassium salt | 1 | 299-27-4 | 206-074-2 | 59 | 492990 | |||||
D-(+)-Glucono-1,5-lactone | 1 | 90-80-2 | 202-016-5 | 59 | 36070 | |||||
D-Glucopyranose, oligomeric, C10-16(even numbered) alkyl glycosides | 1 | 110615-47-9 | 600-975-8 | 420 | ||||||
D-Glucopyranose, oligomeric, C8-10 glycosides | 1 | 68515-73-1 | 500-220-1 | 420 | ||||||
D-Glucopyranose, oligomeric, heptyl glycoside | 1 | 1627851-18-6 | 807-654-3 | 70,53 | ||||||
D-Glucopyranose, oligomers, xylityl glycosides and 1,4 anhydro D-xylitol and D-xylitol | 1 | - | 446-990-1 | 23,5 | ||||||
D-Glucopyranose, oligomeric, butyl glycoside | 1 | - | 939-389-5 | 70,5 | ||||||
α-d-Glucopyranoside, β-d-fructofuranosyl, benzoate | 1 | 12738-64-6 | 235-795-5 | 0,1 | 1,7 | |||||
d-Glucose, ether with glycerol | 1 | 100402-60-6 | 309-496-6 | 416 | ||||||
D-Glucose, reaction products with Alcohols C16-18 (even numbered) | 1 | - | 947-427-7 | 32,9 | ||||||
D-Glucose, reaction products with alcohols C16-18 (even numbered) (excess) | 1 | - | 939-266-6 | 70,5 | ||||||
Glutamic acid | 1 | 56-86-0 | 200-293-7 | 10 | 12900 | |||||
l-Glutamic acid, N-coco acyl derivs., monosodium salts | 1 | 68187-32-6 | 269-087-2 | 0,321 | ||||||
Glutamine | 1 | 56-85-9 | 200-292-1 | 138,6 | 100166 | |||||
Glutaric acid | 1 | 110-94-1 | 203-817-2 | 11,52 | TRGS900 | MAK | 33910 | |||
Glutens, hydrolyzates, reaction products with lauroyl chloride, sodium salts | 1 | 161074-67-5 | 500-500-3 | 9,69 | ||||||
Glycerides, C12-18 mono-, di- and tri | 1 | 91052-53-8 | 293-214-0 | 11,75 | ||||||
Glycerides, C12-18 | 1 | 67701-26-2 | 266-944-2 | 241,41 | ||||||
Glycerides, C14-18 | 1 | 67701-27-3 | 266-945-8 | 241,41 | ||||||
Glycerides, C16-18 and C18-unsatd. mono-, di and tri- | 1 | 91744-20-6 | 294-582-5 | 124,83 | ||||||
Glycerides, C16-18 mono- and di- | 1 | 85251-77-0 | 286-490-9 | 125,04 | ||||||
Glycerides, mixed Decanoyl and Octanoyl | 1 | 73398-61-5 | 277-452-2 | 177,79 | ||||||
Glycerides, tallow sesqui-, hydrogenated, propoxylated | 1 | 68553-12-8 | 614-598-1 | 3,52 | ||||||
Glycerol | 1 | 56-81-5 | 200-289-5 | 56 | TRGS900 | MAK | 11980 | |||
Glycerol, ethoxylated, esters with Acrylic acid | 1 | 144086-03-3 | 500-322-6 | 3,46 | 3,46 | |||||
Glycerol, propoxylated | 1 | 25791-96-2 | 500-044-5 | 98 | 531869 | |||||
Glycerol, propoxylated, esters with acrylic acid, reaction products with diethylamine | 1 | 162492-10-6 | 500-744-0 | 4,92 | ||||||
Glycerol, ethoxylated (> 1 < 6,5 mol EO) | 1 | 31694-55-0 | 500-075-4 | 98 | 531897 | |||||
Glycerol triacetate | 1 | 102-76-1 | 203-051-9 | 35,275 | 32070 | |||||
Glycidyl methacrylate | 1 | 106-91-2 | 203-441-9 | 0,24 | Carcinogenic | 510223 | ||||
Glycine, N-coco acyl derivatives, sodium salts | 1 | 90387-74-9 | 291-350-5 | 16,4 | ||||||
Glycine, N-methyl-, N-coco acyl derivatives | 1 | 68411-97-2 | 270-156-4 | 141,1 | ||||||
Glycine, N-methyl-, N-coco acyl derivatives, sodium salts | 1 | 61791-59-1 | 263-193-2 | 141,1 | ||||||
Glycol 301 | 1 | - | 906-256-8 | 33,5 | 70 | |||||
Glycol Ethers Heavies | 1 | - | 907-640-8 | 260 | ||||||
Glycolic acid | 1 | 79-14-1 | 201-180-5 | 1,53 | 10,56 | 491071 | ||||
Glyoxal, aqueous solution | 1 | 107-22-2 | 203-474-9 | 0,04 | 2,96 | 28700 | ||||
Glyoxylic acid | 1 | 298-12-4 | 206-058-5 | 9,4 | 492989 | |||||
Grapefruit, ext. | 1 | 90045-43-5 | 289-904-6 | 31,1 | ||||||
Graphite | 1 | 7782-42-5 | 231-955-3 | 1,2 | 1,2 | TRGS900 | MAK | 92330 | ||
Guanidinium phosphate (55 % aqueous solution) | 1 | 5423-22-3 | 226-551-9 | 7,3 | 118333 | |||||
Guanidinium carbonate | 1 | 593-85-1 | 209-813-7 | 3,31 | 493369 | |||||
Guanidinium chloride | 1 | 50-01-1 | 200-002-3 | 3,5 | 14480 | |||||
Guanidinium nitrate | 1 | 506-93-4 | 208-060-1 | 3,5 | 510591 | |||||
Guanidinium thiocyanate | 1 | 593-84-0 | 209-812-1 | 1,092 | ||||||
Halophosphate | 1 | - | 9,4 | |||||||
Hatcol 1760 | 1 | - | 482-410-3 | 21 | ||||||
HDI oligomers, allophanate | 1 | - | 939-657-1 | 0,5 | ||||||
HDI oligomers, isocyanurate | 1 | - | 931-274-8 | 0,5 | ||||||
HDI oligomers, uretdione | 1 | - | 931-288-4 | 0,35 | ||||||
HDI oligomers, biuret | 1 | - | 939-340-8 | 0,5 | ||||||
HDI oligomers, iminooxadiazindione | 1 | - | 931-297-3 | 0,5 | ||||||
2-(2-Heptadec-8-enyl-2-imidazolin-1-yl)ethanol | 1 | 95-38-5 | 202-414-9 | 0,46 | 101255 | |||||
1,1,1,2,3,3,3-Heptafluoropropane | 1 | 431-89-0 | 207-079-2 | 61279 | 490964 | |||||
1,1,1,3,5,5,5-Heptamethyl-3-[(trimethylsilyl)oxy]trisiloxane | 1 | 17928-28-8 | 241-867-7 | 1,41 | 130854 | |||||
1,1,1,3,5,5,5-Heptamethyltrisiloxane | 1 | 1873-88-7 | 217-496-1 | 4,7 | 111122 | |||||
Heptanal | 1 | 111-71-7 | 203-898-4 | 98,7 | 491178 | |||||
Heptanal, oligomeric reaction products with aniline | 1 | 9003-50-3 | 500-007-3 | 0,822 | ||||||
n-Heptane | 1 | 142-82-5 | 205-563-8 | 2085 | TRGS900 | MAK | EU | 13820 | ||
Heptane-2-one | 1 | 110-43-0 | 203-767-1 | 394,25 | TRGS900 | EU | 37180 | |||
Heptanoic acid | 1 | 111-14-8 | 203-838-7 | 98,7 | 33160 | |||||
Heptanoic acid, ester with 2-ethyl-2-(hydroxymethyl)-1,3-propanediol pentanoate | 1 | 67762-64-5 | 267-029-0 | 34 | ||||||
Heptan-1-ol | 1 | 111-70-6 | 203-897-9 | 35,26 | 570002 | |||||
Heptan-2-yl [(5-chloroquinolin-8-yl)oxy]acetate | 1 | 99607-70-2 | 619-447-3 | 0,303 | ||||||
Hesperidin | 1 | 520-26-3 | 208-288-1 | 52,89 | 104626 | |||||
Hexaammonium heptamolybdate | 1 | 12027-67-7 | 234-722-4 | 19,36 | 124885 | |||||
Hexaammonium wolframate | 1 | 12028-48-7 | 234-733-4 | 2,2 | 124894 | |||||
Hexaboron dizinc undecaoxide | 1 | 12767-90-7 | 235-804-2 | 22,4 | MAK | 125820 | ||||
Hexabromocyclododecane, mixed isomers | 1 | 25637-99-4 | 247-148-4 | 1,43 | 15090 | |||||
3,3',3'',5,5',5''-Hexa-tert-butyl-alpha,alpha',alpha''-(mesitylene-2,4,6-triyl)tri-p-cresol | 1 | 1709-70-2 | 216-971-0 | 33,234 | 494058 | |||||
Hexacalcium hexaoxotris[sulphato(2-)]dialuminate(12-) | 1 | 12004-14-7 | 234-448-5 | 10 | 10 | 492158 | ||||
Hexachlorocyclopentadiene | 1 | 77-47-4 | 201-029-3 | 0,034 | TRGS900 | 34760 | ||||
Hexachlorodisilane | 1 | 13465-77-5 | 236-704-1 | 9,8 | ||||||
Hexadecan-1-ol | 1 | 36653-82-4 | 253-149-0 | 200 | 389 | 24650 | ||||
Hexadecan-l-ol, ethoxylated | 1 | 9004-95-9 | 500-014-1 | 294 | ||||||
Hexadecyl acrylate | 1 | 13402-02-3 | 236-492-0 | 97,9 | 126386 | |||||
(Hexadecylamidopropyl)trimethylammonium chloride | 1 | 51277-96-4 | 257-104-6 | 1 | 8,21 | |||||
Hexadecyl 3,5-bis-tert-butyl-4-hydroxybenzoate | 1 | 67845-93-6 | 267-342-2 | 7,5 | ||||||
Hexadecyl 4-chloro-3-(2-(5,5-dimethyl-2,4-dioxo-1,3-oxazolidin-3-yl)-4,4-dimethyl-3-oxopentamido)benzoate | 1 | 168689-49-4 | 418-550-9 | 11,7 | 901932 | |||||
Hexadecyldimethylamine | 1 | 1275611-65-8 | 695-101-5 | 0,0165 | ||||||
Hexadecyl 2-ethylhexanoate | 1 | 59130-69-7 | 261-619-1 | 6,01 | 147827 | |||||
Hexadecyl trichlorsilane | 1 | 5894-60-0 | 227-575-2 | 26,3 | 510595 | |||||
Hexadecyltrimethylammonium methyl sulphate | 1 | 65060-02-8 | 265-352-1 | 1 | ||||||
[N,N,N',N',N'',N''-Hexaethyl-29H,31H-phthalocyaninetrimethylaminato(2-)-N29,N30,N31,N32]copper | 1 | 28654-73-1 | 249-125-4 | 10 | 136951 | |||||
[N,N,N',N',N'',N''-Hexaethyl-29H,31H-phthalocyaninetrimethylaminato(2-)-N29,N30,N31,N32]copper tris(dodecylbenzenesufonate) | 1 | 75247-18-6 | 278-150-3 | 10 | ||||||
1,1,2,3,4,4-Hexafluorobuta-1,3-diene | 1 | 685-63-2 | 211-681-0 | 1,325 | 0,663 | |||||
(2E)-1,1,1,4,4,4-Hexafluoro-2-butene | 1 | 66711-86-2 | 811-213-0 | 2012 | ||||||
Hexafluoro-1,2-epoxypropane | 1 | 428-59-1 | 207-050-4 | 7 | 490968 | |||||
1,1,1,3,3,3-Hexafluoropropane | 1 | 690-39-1 | 425-320-1 | 4960 | ||||||
1,1,1,3,3,3-Hexafluoropropane | 2 | 690-39-1 | 425-320-1 | 4984 | ||||||
Hexafluoropropene | 1 | 116-15-4 | 204-127-4 | 0,62 | 22580 | |||||
1,1,2,2,3,3-Hexafluoro-1-trifluoromethoxy-3-trifluorovinyloxypropane | 1 | - | 442-390-9 | 5,3 | ||||||
Hexafluorozirconic acid (>= 45% (w/w) aqueous solution) | 1 | 12021-95-3 | 234-666-0 | 4,5 | 4,5 | 124835 | ||||
(3R,3aR,6S,6aR)-Hexahydrofuro[3,2-b]furan-3,6-diyl dioctanoate | 1 | 64896-70-4 | 807-840-4 | 141 | ||||||
(3R,3AS,6AR)-Hexahydrofuro[2,3-B]furan-3-ol | 1 | 156928-09-5 | 605-076-4 | 0,059 | ||||||
1-[([[(3R,3aS,6aR)-Hexahydrofuro[2,3-b]furan-3-yl]oxy]carbonyl)oxy]pyrrolidine-2,5-dione | 1 | 253265-97-3 | 813-811-7 | 0,52 | ||||||
1,3,4,6,7,8-Hexahydro-4,6,6,7,8,8-hexamethylindeno(5,6-c)pyran | 1 | 1222-05-5 | 214-946-9 | 22 | 109204 | |||||
3a,4,5,6,7,7a-Hexahydro-4,7-methano-1H-indene | 1 | 4488-57-7 | 224-778-8 | 2,3 | 2,3 | 531162 | ||||
3a,4,5,6,7,7a-Hexahydro-4,7-methanoinden-6-yl acetate | 1 | 5413-60-5 | 226-501-6 | 0,968 | 118289 | |||||
Hexahydromethanoindenyl acetate and Hexahydromethanoindenyl acetate | 1 | - | 930-859-5 | 2,93 | ||||||
Hexahydro-4,7-methano-1H-indenyl acrylate | 1 | 12542-30-2 | 235-697-2 | 97,9 | 531264 | |||||
1,2,3,5,6,7-Hexahydro-1,1,2,3,3-pentamethyl-4H-inden-4-one | 1 | 33704-61-9 | 251-649-3 | 1,47 | 139105 | |||||
[3R-(3alpha,3abeta,7beta,8aalpha)]-1-(2,3,4,7,8,8a-Hexahydro-3,6,8,8-tetramethyl-1H-3a,7-methanoazulen-5-yl)ethan-1-one | 1 | 32388-55-9 | 251-020-3 | 1,17 | 138561 | |||||
Hexahydro-1,3,5-trimethyl-1,3,5-triazine | 1 | 108-74-7 | 203-612-8 | 1,058 | 492717 | |||||
2-[4-[(Hexahydro-2,4,6-trioxo-5-pyrimidyl)azo]phenyl]-6-methylbenzothiazole-7-sulphonic acid, compound with 2,2',2''-nitrilotris[ethanol] (1:1) | 1 | 65036-46-6 | 265-314-4 | 16,4 | ||||||
Hexamethylcyclotrisiloxane | 1 | 541-05-9 | 208-765-4 | 64 | 3190 | |||||
1,1,1,3,3,3-Hexamethyldisilazane | 1 | 999-97-3 | 213-668-5 | 133 | 53 | 2920 | ||||
Hexamethyldisiloxane | 1 | 107-46-0 | 203-492-7 | 53,4 | 3210 | |||||
Hexamethylene diisocyanate, oligomerisation product, blocked with N-butyl-1-butanamine | 1 | - | 924-903-2 | 172,85 | ||||||
Hexamethylene diisocyanate, oligomers, reaction products with Bis-(trimethoxysilylpropyl)amine | 1 | - | 918-105-3 | 3,11 | 51,8 | |||||
Hexamethylene diisocyanate, oligomers, reaction products with 3-methoxypropylamine | 1 | 162492-07-1 | 500-740-9 | 16,4 | ||||||
Hexamethylene diisocyanate, oligomers, reaction products with N-(3-trimethoxysilyl)propylbutylamine and Bis-(Trimethoxysilylpropyl)amine | 1 | - | 926-191-9 | 3,11 | 3,11 | |||||
Hexamethylene diisocyanate, trimers, reaction products with 2-hydroxyethyl acrylate | 1 | 162492-01-5 | 500-734-6 | 32,9 | ||||||
Hexamethylene bis(3-(3,5-di-tert-butyl-4-hydroxyphenyl)-propionate) | 1 | 35074-77-2 | 252-346-9 | 10 | TRGS900 | MAK | 495606 | |||
Hexamethylene diacrylate | 1 | 13048-33-4 | 235-921-9 | 24,5 | 510257 | |||||
Hexamethylenediamine | 1 | 124-09-4 | 204-679-6 | 0,54 | 14670 | |||||
Hexamethylene-di-isocyanate | 1 | 822-06-0 | 212-485-8 | 0,035 | TRGS900 | MAK | 13120 | |||
Hexamethylene diisocyanate, oligomerisation product, blocked with 2-butanone oxime | 1 | 85940-94-9 | 617-779-3 | 0,502 | ||||||
Hexamethylene diisocyanate, oligomerisation product, blocked with 3,5-dimethyl-1H-pyrazole | 1 | 163206-31-3 | 605-318-9 | 0,005 | ||||||
Hexamethylenetetramine | 1 | 100-97-0 | 202-905-8 | 5,6 | 20410 | |||||
2,6,10,15,19,23-Hexamethyltetracosa-2,6,10,14,18,22-hexaene | 1 | 111-02-4 | 203-826-1 | 27,17 | 492751 | |||||
Hexanal | 1 | 66-25-1 | 200-624-5 | 16,46 | 39340 | |||||
1,6-Hexandiammonium dihydroxide, N,N'-bis-(2-hydroxypropyl)-N,N,N',N'-tetramethyl | 1 | 35132-93-5 | 442-730-6 | 1 | 3,29 | |||||
n-Hexane | 1 | 110-54-3 | 203-777-6 | 75 | TRGS900 | MAK | EU | 510789 | ||
1,6-Hexanediamine, N1,N1,N6,N6-tetramethyl-, propoxylated (>1 < 4,5 mol PO) | 1 | 158451-78-6 | 605-146-4 | 6,8 | ||||||
Hexanedioic acid, 1,6-bis[2-hydroxy-3-[(1-oxoneodecyl)oxy]propyl] ester | 1 | 876528-25-5 | 825-846-5 | 8,4 | ||||||
Hexanedioic acid, mixed esters with decanoic acid, heptanoic acid, octanoic acid and pentaerythritol | 1 | 68130-55-2 | 268-597-2 | 3,52 | ||||||
Hexanedioic acid oligomeric reaction products with 2,2'-Oxybis[ethanol] | 1 | 9010-89-3 | 618-460-1 | 80,4 | ||||||
DL-1,2-Hexanediol | 1 | 6920-22-5 | 230-029-6 | 123 | 121245 | |||||
1,6-Hexanediol | 1 | 629-11-8 | 211-074-0 | 35 | 13070 | |||||
1,6-Hexanediol dimethacrylate | 1 | 6606-59-3 | 229-551-7 | 14,5 | 531200 | |||||
N,N''-Hexane-1,6-diylbis[N'-benzylurea] | 1 | 39072-70-3 | 254-274-3 | 172,85 | 141384 | |||||
N,N'''-1,6-Hexanediylbis[N'-cyanoguanidine] | 1 | 15894-70-9 | 240-032-4 | 11,8 | 129316 | |||||
N,N'-Hexane-1,6-diylbis[3-(3,5-di-tert-butyl-4-hydroxyphenylpropionamide] | 1 | 23128-74-7 | 245-442-7 | 3 | 3 | 495348 | ||||
1,6-Hexanediyl-bis(2-(2-(1-ethylpentyl)-3-oxazolidinyl)ethyl)carbamate | 1 | - | 925-259-5 | 5,9 | ||||||
N,N'-Hexane-1,6-diylbis(hexahydro-2-oxo-1H-azepine-1-carboxamide) | 1 | 5888-87-9 | 227-563-7 | 29 | 119192 | |||||
N,N'-1,6-Hexanediylbis(N-(2,2,6,6-tetramethylpiperidin-4-yl)formamide | 1 | 124172-53-8 | 413-610-0 | 0,125 | 4,08 | 900897 | ||||
N,N'-1,6-Hexanediylbis(N-(2,2,6,6-tetramethylpiperidin-4-yl)formamide | 2 | 124172-53-8 | 413-610-0 | 23,5 | 900897 | |||||
n-Hexanoic acid | 1 | 142-62-1 | 205-550-7 | 17,632 | 28160 | |||||
Hexanoic acid, 3,5,5-trimethyl-, tin (2+)salt (2:1) | 1 | 1231728-34-9 | 700-567-0 | 9,2 | ||||||
1-Hexanol | 1 | 111-27-3 | 203-852-3 | 210 | 99 | TRGS900 | 22240 | |||
1-Hexanol, 2-ethyl-, manuf. of, by-products from, distn. residues | 1 | 68609-68-7 | 271-832-1 | 66,1 | ||||||
2,5,7,10,11,14-Hexaoxa-1,6-distibabicyclo[4.4.4]tetradecane | 1 | 29736-75-2 | 249-820-2 | 0,458 | 137552 | |||||
Hexasodium 7,7'-(carbonyldiimino)bis[4-hydroxy-3-[[2-sulphonato-4-[(4-sulphonatophenyl)azo]phenyl]azo]naphthalene-2-sulphonate] | 1 | 2610-10-8 | 220-027-3 | 23,51 | ||||||
Hexasodium 4,4'-[1,4-phenylenebis[imino(6-chloro-1,3,5-triazine-4,2-diyl)imino]]bis[5-hydroxy-6-[(2-sulphonatophenyl)azo]naphthalene-2,7-disulphonate] | 1 | 68214-04-0 | 269-284-3 | 29,3 | ||||||
Hexasodium 2,2'-[vinylenebis[(3-sulfonato-4,1-phenylene)imino[6-[bis (2-hydroxypropyl)amino]-1,3,5-triazine-4,2-diyl]imino]]bis(benzene-1,4-disulfonate) | 1 | 371756-75-1 | 609-336-8 | 65 | ||||||
Hexasodium 2,2'-[vinylenebis[(3-sulphonato-4,1-phenylene)imino[6-[bis(2-hydroxyethyl)amino]-1,3,5-triazine-4,2-diyl]imino]]bis(benzene-1,4-disulphonate) | 1 | 68971-49-3 | 273-468-9 | 59,22 | 158286 | |||||
Hexasodium 2,2'-[vinylenebis[(3-sulphonato-4,1-phenylene)imino[6-[(2-cyanoethyl)[2-(2-hydroxyethoxy)ethyl]amino]-1,3,5-triazine-4,2-diyl]imino]]bis[benzene-1,4-disulphonate] | 1 | 79135-87-8 | 279-087-4 | 3,29 | ||||||
Hexasodium 2,2'-[vinylenebis[(3-sulphonato-4,1-phenylene)imino[6-(diethylamino)-1,3,5-triazine-4,2-diyl]imino]]bis(benzene-1,4-disulphonate) | 1 | 41098-56-0 | 255-217-5 | 59,42 | 142216 | |||||
Hexasodium 2,2'-[vinylenebis[(3-sulphonato-4,1-phenylene)imino[6-(diethylamino)-1,3,5-triazine-4,2-diyl]imino]]bis(benzene-1,4-disulphonate) | 2 | 41098-56-0 | 255-217-5 | 10,9 | 142216 | |||||
Hexasodium 2,2'-[vinylenebis[(3-sulphonato-4,1-phenylene)imino[6-morpholino-1,3,5-triazine-4,2-diyl]imino]]bis(benzene-1,4-disulphonate) | 1 | 52301-70-9 | 257-827-7 | 1,94 | ||||||
Hexasodium 4,4'-[vinylenebis[(3-sulphonato-4,1-phenylene)imino[6-morpholino-1,3,5-triazine-4,2-diyl]imino]]bis[5-hydroxy-6-(phenylazo)naphthalene-2,7-disulphonate] | 1 | 17791-81-0 | 241-769-4 | 1,8 | ||||||
Hexene | 1 | 25264-93-1 | 246-768-2 | 75 | ||||||
cis-Hex-3-en-1-ol | 1 | 928-96-1 | 213-192-8 | 11,75 | 107873 | |||||
(Z)-Hex-3-enyl acetate | 1 | 3681-71-8 | 222-960-1 | 11,75 | 115415 | |||||
(Z)-3-Hexenyl salicylate | 1 | 65405-77-8 | 265-745-8 | 1,59 | 151470 | |||||
1,2,4,5,7,8-Hexoxonane, 3,6,9-trimethyl-, 3,6,9-tris(Ethyl and Propyl) derivatives (upper limit: 41% w/w; typical concentration: 38% w/w) | 1 | - | 1,06 | |||||||
Hexyl salicylate | 1 | 6259-76-3 | 228-408-6 | 1,7 | 119885 | |||||
Hexyl acetate | 1 | 142-92-7 | 205-572-7 | 48 | 570141 | |||||
Hexyl acrylate | 1 | 2499-95-8 | 219-698-5 | 12,76 | 112822 | |||||
2-Hexyldecanoic acid (4-(6-tert-butyl-7-chloro-1H-pyrazolo-(1,5-b)(1,2,4)triazol-2-yl)phenylcarbamoyl)methylester | 1 | 379268-96-9 | 448-260-8 | 11,75 | 536213 | |||||
2-Hexyldecan-1-ol, ethoxylated, < 2.5 EO | 1 | 52609-19-5 | 500-116-6 | 294 | 531931 | |||||
2-(2-Hexyldecyloxy)benzamide | 1 | 202483-62-3 | 431-230-3 | 58,8 | 536243 | |||||
Hexyl 2-(1-(diethylaminohydroxyphenyl)methanoyl)benzoate | 1 | 302776-68-7 | 443-860-6 | 10 | 536138 | |||||
Hexyl D-glucoside | 1 | 54549-24-5 | 259-217-6 | 420 | 145732 | |||||
2-Hexyl-2 ‘-hydroxy-5 ‘methyldecananilide | 1 | - | 448-250-3 | 11,75 | ||||||
3-Hexyne-2,5-diol | 1 | 3031-66-1 | 221-209-5 | 0,5 | 494353 | |||||
HFO-1234ze | 1 | - | 471-480-0 | 3902 | TRGS900 | MAK | 536342 | |||
High temperature calcination products of Titanium dioxide, Calcium carbonate, Calcium fluoride, Quartz and Antimony oxide containing lewisite and Wollastonite | 1 | - | 942-982-1 | 4 | 35,3 | |||||
Histidine | 1 | 71-00-1 | 200-745-3 | 83,38 | 492376 | |||||
Homosalate | 1 | 118-56-9 | 204-260-8 | 16,09 | 101950 | |||||
Hop, Humulus lupulus, extract, isomerized, potassium salt | 1 | 94349-84-5 | 305-203-0 | 21 | ||||||
Hop, Humulus lupulus, ext. | 1 | 8060-28-4 | 232-504-3 | 21 | ||||||
Hydrocarbons, C4-6, depentanizer lights, arom. hydrotreater | 1 | 91995-38-9 | 295-298-4 | 837,5 | ||||||
Hydrocarbons, C4-6, depentanizer lights, arom. hydrotreater | 2 | 91995-38-9 | 295-298-4 | 837,5 | 1,9 | |||||
Hydrocarbons, C5-11, nonaroms.-rich, reforming light fraction | 1 | 93572-36-2 | 297-466-2 | 837,5 | ||||||
Hydrocarbons, C5-11, nonaroms.-rich, reforming light fraction | 2 | 93572-36-2 | 297-466-2 | 837,5 | 1,9 | |||||
Hydrocarbons, C6-rich, hydrotreated light naphtha distillates, solvent-refined | 1 | 101316-67-0 | 309-871-4 | 837,5 | ||||||
Hydrocarbons, C6-rich, hydrotreated light naphtha distillates, solvent-refined | 2 | 101316-67-0 | 309-871-4 | 837,5 | 1,9 | |||||
Hydrocarbon waxes (petroleum), oxidized, calcium salts | 1 | 68603-09-8 | 271-636-6 | 0,23 | ||||||
Hydrocarbon waxes (petroleum), oxidized, Me esters, barium salts | 1 | 68603-10-1 | 271-637-1 | 0,23 | ||||||
Hydrocarbons, C≥5, C5-6-rich | 1 | 68476-50-6 | 270-690-8 | 837,5 | ||||||
Hydrocarbons, C≥5, C5-6-rich | 2 | 68476-50-6 | 270-690-8 | 837,5 | 1,9 | |||||
Hydrocarbons, C5-8 | 1 | 92128-65-9 | 295-762-6 | 3,25 | ||||||
Hydrocarbons, C5-8 | 2 | 92128-65-9 | 295-762-6 | 75 | ||||||
Hydrocarbons, C5-unsatd. | 1 | 68956-55-8 | 273-308-8 | 8,4 | ||||||
Hydrocarbons, C5-unsatd. | 2 | 68956-55-8 | 273-308-8 | 2,31 | 2,31 | |||||
Hydrocarbons, C3-11, catalytic cracker distillates | 1 | 68476-46-0 | 270-686-6 | 837,5 | ||||||
Hydrocarbons, C3-11, catalytic cracker distillates | 2 | 68476-46-0 | 270-686-6 | 837,5 | 1,9 | |||||
Hydrocarbons, C3-11, catalytic cracker distillates | 3 | 68476-46-0 | 270-686-6 | 840 | ||||||
Hydrocarbons, C4, ethylene-manuf.-by-product | 1 | 68476-52-8 | 270-691-3 | 1530 | ||||||
Hydrocarbons, C7-C8, n-Alkanes | 1 | - | 922-214-1 | 2035 | ||||||
Hydrocarbons, C5, n-alkanes, isoalkanes | 1 | - | 921-577-3 | 3000 | ||||||
Hydrocarbons, C9-C11, n-alkanes, isoalkanes | 1 | - | 941-718-2 | 871 | ||||||
Hydrocarbons, C9-C12, n-alkanes, isoalkanes, <2% aromatics | 1 | - | 940-725-8 | 1500 | ||||||
Hydrocarbons, C8-C11, n-alkanes, isoalkanes, <2% aromatics | 1 | - | 940-733-1 | 1500 | ||||||
Hydrocarbons, C13-C20, n-alkanes, isoalkanes, cyclic, aromatics (40-60%) | 1 | - | 928-812-9 | 165 | ||||||
Hydrocarbons, C7-C9, n-alkanes, isoalkanes, cyclics | 1 | - | 920-750-0 | 2035 | ||||||
Hydrocarbons, C7, n-alkanes, isoalkanes, cyclics | 1 | 64742-49-0 | 927-510-4 | 2085 | ||||||
Hydrocarbons, C8-C12, n-alkanes, isoalkanes, cyclics, aromatics (2-25%) | 1 | - | 928-136-4 | 330 | TRGS900 | 530000 | ||||
Hydrocarbons, C12-C16, n-alkanes, isoalkanes, cyclics, aromatics (2-25%) | 1 | - | 920-008-6 | 330 | ||||||
Hydrocarbons, C9-C12, n-alkanes, isoalkanes, cyclics, aromatics (2-25%) | 1 | - | 919-446-0 | 330 | ||||||
Hydrocarbons, C9-C11, n-alkanes, isoalkanes, cyclics, <2% aromatics | 1 | 64742-48-9 | 919-857-5 | 1500 | ||||||
Hydrocarbons, C9-C10, n-alkanes, isoalkanes, cyclics, <2% aromatics | 1 | - | 927-241-2 | 871 | ||||||
Hydrocarbons, C9-C10, n-alkanes, isoalkanes, cyclics, aromatics (2-25%) | 1 | - | 927-344-2 | 330 | ||||||
Hydrocarbons, C6-C7, n-alkanes, isoalkanes, cyclics, <5% n-hexane | 1 | - | 921-024-6 | 2035 | ||||||
Hydrocarbons, C6-C7, n-alkanes, isoalkanes, cyclics, >5% n-hexane | 1 | - | 924-168-8 | 145 | ||||||
Hydrocarbons, C6, n-alkanes, iso-alkanes, cyclics, n-hexane rich | 1 | - | 925-292-5 | 93 | ||||||
Hydrocarbons, C5-C6, n-alkanes, isoalkanes, <5% n-hexane | 1 | - | 922-114-8 | 1474 | ||||||
Hydrocarbons, C6-C10 (even numbered), n-alkanes, isoalkanes, >5% n-hexane | 1 | - | 701-352-4 | 230 | ||||||
Hydrocarbons, C5-C7, n-alkanes, isoalkanes, n-hexane rich | 1 | - | 930-397-4 | 93 | ||||||
Hydrocarbons, C9, aromatics | 1 | - | 918-668-5 | 150 | ||||||
Hydrocarbons, C10, aromatics, >1% naphthalene | 1 | - | 919-284-0 | 151 | ||||||
Hydrocarbons, C10-C13, aromatics, >1% naphthalene | 1 | - | 926-273-4 | 151 | ||||||
Hydrocarbons, C10, aromatics, <1% naphthalene | 1 | 1189173-42-9 | 918-811-1 | 151 | ||||||
Hydrocarbons, C10-C13, aromatics, <1% naphthalene | 1 | - | 922-153-0 | 151 | ||||||
Hydrocarbons, C9-C10, aromatics, >1% naphthalene | 1 | - | 946-365-8 | 151 | ||||||
Hydrocarbons, C7-12, C>9-arom.-rich, reforming heavy fraction | 1 | 93572-35-1 | 297-465-7 | 837,5 | ||||||
Hydrocarbons, C7-12, C>9-arom.-rich, reforming heavy fraction | 2 | 93572-35-1 | 297-465-7 | 837,5 | 1,9 | |||||
Hydrocarbons, C4, 1,3-butadiene and isobutene-free; Petroleum gas | 1 | 95465-89-7 | 306-004-1 | 769 | ||||||
Hydrocarbons, C4, 1,3-butadiene-free | 1 | 91052-98-1 | 293-260-1 | 769 | ||||||
Hydrocarbons, C4, 1,3-butadiene-free, polymd., tetraisobutylene fraction, hydrogenated | 1 | 93685-80-4 | 297-628-2 | 871 | ||||||
Hydrocarbons, C4, butane conc., n-butene-contg. | 1 | 95465-91-1 | 306-006-2 | 1530 | 769 | |||||
Hydrocarbons, C4, n-butene conc. | 1 | 95465-90-0 | 306-005-7 | 1530 | 769 | |||||
Hydrocarbons, C7-C8, cyclics | 1 | - | 927-033-1 | 2035 | ||||||
Hydrocarbons, C9-C11, cyclics, <2% aromatics | 1 | - | 925-894-8 | 871 | ||||||
Hydrocarbons, C5-rich, dicyclopentadiene-contg. | 1 | 102110-15-6 | 310-013-6 | 2,31 | 2,31 | |||||
Hydrocarbons, C5-7, C6-rich, ethylene manuf. by-products | 1 | 91723-50-1 | 294-557-9 | 3,25 | ||||||
Hydrocarbons, ethylene-manuf.-by-product distn. residues | 1 | 68921-67-5 | 272-951-1 | 3,25 | ||||||
Hydrocarbons, C5, ethylene-manuf.-by-product, hydrogenated | 1 | 92128-68-2 | 295-765-2 | 8,4 | ||||||
Hydrocarbons, C6-8, hydrogenated sorption-dearomatized, toluene raffination; Low boiling point naphtha - unspecified | 1 | 101316-66-9 | 309-870-9 | 192 | ||||||
Hydrocarbons, C6-11, hydrotreated, dearomatized | 1 | 93763-33-8 | 297-852-0 | 837,5 | ||||||
Hydrocarbons, C6-11, hydrotreated, dearomatized | 2 | 93763-33-8 | 297-852-0 | 837,5 | 1,9 | |||||
Hydrocarbons, C7-C9, isoalkanes | 1 | 64741-66-8 | 921-728-3 | 2035 | ||||||
Hydrocarbons, C8-C9, isoalkanes | 1 | - | 932-020-9 | 2035 | ||||||
Hydrocarbons, C7-C8, isoalkanes, <2% aromatics | 1 | - | 947-588-3 | 2085 | ||||||
Hydrocarbons, C9-C11, isoalkanes, cyclics, <2% aromatics | 1 | - | 920-134-1 | 871 | ||||||
Hydrocarbons, C6-C7, isoalkanes, cyclics, <5% n-hexane | 1 | - | 926-605-8 | 5306 | ||||||
Hydrocarbons, C6, isoalkanes, <5% n-hexane | 1 | 64742-49-0 | 931-254-9 | 5306 | ||||||
C4-C10 branched and linear Hydrocarbons (light) – Naphtha | 1 | 848301-65-5 | 481-730-0 | 274,7 | ||||||
Hydrocarbons, C4-11, naphtha-cracking, arom.-free | 1 | 92045-63-1 | 295-445-2 | 837,5 | ||||||
Hydrocarbons, C4-11, naphtha-cracking, arom.-free | 2 | 92045-63-1 | 295-445-2 | 837,5 | 1,9 | |||||
Hydrocarbons, C4-12, naphtha-cracking, hydrotreated; Low boiling point hydrogen treated naphtha | 1 | 92045-61-9 | 295-443-1 | 3,25 | ||||||
Hydrocarbons, C6-7, naphtha-cracking, solvent-refined | 1 | 92045-64-2 | 295-446-8 | 837,5 | ||||||
Hydrocarbons, C6-7, naphtha-cracking, solvent-refined | 2 | 92045-64-2 | 295-446-8 | 837,5 | 1,9 | |||||
Hydrocarbons, C4-6, C5-rich | 1 | 68476-43-7 | 270-684-5 | 8,4 | ||||||
Hydrocarbons, C5 rich; Low boiling point naphtha - unspecified | 1 | 68476-55-1 | 270-695-5 | 8,4 | ||||||
Hydrocarbons, C5 rich; Low boiling point naphtha - unspecified | 2 | 68476-55-1 | 270-695-5 | 3,25 | ||||||
Hydrocarbons, C5 rich; Low boiling point naphtha - unspecified | 3 | 68476-55-1 | 270-695-5 | 75 | ||||||
Hydrocarbons, C5 rich; Low boiling point naphtha - unspecified | 4 | 68476-55-1 | 270-695-5 | 837,5 | ||||||
Hydrocarbons, C5 rich; Low boiling point naphtha - unspecified | 5 | 68476-55-1 | 270-695-5 | 837,5 | 1,9 | |||||
Hydrocarbons, C3-6, C5-rich, steam-cracked naphtha; Low boiling point naphtha - unspecified | 1 | 102110-14-5 | 310-012-0 | 3,25 | ||||||
Hydrocarbons, C3-6, C5-rich, steam-cracked naphtha; Low boiling point naphtha - unspecified | 2 | 102110-14-5 | 310-012-0 | 75 | ||||||
Hydrocarbons, C4, steam-cracker distillate; Petroleum gas | 1 | 92045-23-3 | 295-405-4 | 769 | ||||||
Hydrocarbons, C4, steam-cracker distillate; Petroleum gas | 2 | 92045-23-3 | 295-405-4 | 1530 | 769 | |||||
Hydrocarbons, terpene processing by-products | 1 | 68956-56-9 | 273-309-3 | 2,9 | ||||||
Hydrocarbon waxes (petroleum), oxidized | 1 | 64743-00-6 | 265-205-1 | 0,23 | ||||||
Hydrocarbon waxes (petroleum), oxidized, Me esters, calcium salts | 1 | 68603-11-2 | 271-638-7 | 0,23 | ||||||
Hydrochloric acid solution | 1 | 7647-01-0 | 231-595-7 | 8 | TRGS900 | MAK | EU | 1050 | ||
Hydrochloric acid, reaction products with aniline and nitrobenzene, sulfonated, sodium salts | 1 | 90411-76-0 | 291-454-0 | 97,95 | ||||||
Hydrocotyle asiatica, ext. | 1 | 84696-21-9 | 283-640-5 | 16,4 | ||||||
Hydrofluoric acid | 1 | 7664-39-3 | 231-634-8 | 0,0015 | 1,5 | TRGS900 | MAK | EU | 1040 | |
Hydrogen trifluoromethoxyborate(1-), compound with methanol (1:1) | 1 | 2802-68-8 | 220-543-9 | 0,89 | 0,89 | |||||
Hydrogenated terphenyls | 1 | 61788-32-7 | 262-967-7 | 2,01 | TRGS900 | EU | 149016 | |||
Hydrogenation products of (esterification products of 2-Ethylhexan-1-ol with (Estolide formation products of Oleic acid and Fatty acids, C8-18 and C18-unsatd. (branched or linear)) | 1 | - | 696-271-3 | 35,3 | ||||||
Hydrogen bromide | 1 | 10035-10-6 | 233-113-0 | 6,7 | 6,7 | TRGS900 | MAK | EU | 1060 | |
Hydrogen cyanide | 1 | 74-90-8 | 200-821-6 | 0,78 | TRGS900 | MAK | EU | 12450 | ||
Hydrogen [4-[4-(diethylamino)-2',4'-disulphonatobenzhydrylidene]cyclohexa-2,5-dien-1-ylidene]diethylammonium, sodium salt | 1 | 129-17-9 | 204-934-1 | 13,557 | ||||||
Hydrogen peroxide solution | 1 | 7722-84-1 | 231-765-0 | 1,4 | MAK | 2430 | ||||
Hydrogen peroxide urea | 1 | 124-43-6 | 204-701-4 | 20,1 | ||||||
Hydrogen [29H,31H-phthalocyaninesulphonato(3-)-N29,N30,N31,N32]cuprate(1-) | 1 | 28901-96-4 | 249-300-5 | 16,4 | ||||||
Hydrogen [29H,31H-phthalocyaninesulphonato(3-)-N29,N30,N31,N32]cuprate(1-), compound with dodecylamine (1:1) | 1 | 73455-75-1 | 277-475-8 | 3,5 | ||||||
Hydrogen sulfide | 1 | 7783-06-4 | 231-977-3 | 7 | 7 | TRGS900 | MAK | EU | 1130 | |
Hydrolysis products of 3-(Triethoxysilyl)propan-1-amine | 1 | - | 939-125-9 | 47 | ||||||
Hydrotalcit | 1 | 11097-59-9 | 234-319-3 | 490 | 124542 | |||||
Hydroxido potassium zirconium carbonate, where there are 0, 1 or 2 hydroxide groups and 2, 3 or 4 potassium atoms and 2, 3 or 4 carbonate groups. | 1 | - | 938-677-8 | 2 | ||||||
Hydroxy acetic acid butyl ester | 1 | 7397-62-8 | 230-991-7 | 7,05 | 22340 | |||||
Hydroxyacetone | 1 | 116-09-6 | 204-124-8 | 16,46 | 32470 | |||||
4'-Hydroxyacetophenone | 1 | 99-93-4 | 202-802-8 | 2,8 | 2,8 | 492601 | ||||
Hydroxy aluminium bis(2,4,8,10-tetra-trans-butyl-6-hydroxy-12H-dibenzo(d,g)(1.3.2)dioxaphosphocin-6-oxide) | 1 | 151841-65-5 | 430-650-4 | 3,5 | 535629 | |||||
3β-Hydroxyandrost-5-en-17-one acetate | 1 | 853-23-6 | 212-714-1 | 0,031 | ||||||
2-Hydroxybenzoic acid 2-butyloctyl ester | 1 | 190085-41-7 | 431-090-3 | 8,8 | 536085 | |||||
4-Hydroxybenzoic acid | 1 | 99-96-7 | 202-804-9 | 4,8 | 2,4 | 492602 | ||||
4-Hydroxybenzophenone | 1 | 1137-42-4 | 214-507-1 | 1,64 | ||||||
1-Hydroxybenzotriazole, anhydrous | 1 | 2592-95-2 | 219-989-7 | 12,3 | 113045 | |||||
4-Hydroxybutyl acrylate | 1 | 2478-10-6 | 219-606-3 | 3 | 491382 | |||||
4-Hydroxybutyl vinyl ether | 1 | 17832-28-9 | 241-793-5 | 7,35 | 130789 | |||||
1-Hydroxycyclohexyl phenyl ketone | 1 | 947-19-3 | 213-426-9 | 21,16 | 108046 | |||||
3-Hydroxy-1,1-dimethylbutyl-2-ethyl-2-methylheptaneperoxoate | 1 | 95718-78-8 | 413-910-1 | 29,6 | 901157 | |||||
7-Hydroxy-3,7-dimethyloctanal | 1 | 107-75-5 | 203-518-7 | 18 | 32330 | |||||
2-Hydroxy-N,N-dimethyl-propanamide | 1 | 35123-06-9 | 609-066-0 | 78,4 | ||||||
2-(1-(2-Hydroxy-3,5-di-tert-pentylphenyl)ethyl)-4,6-di-tert-pentylphenyl acrylate | 1 | 123968-25-2 | 413-850-6 | 95,9 | 900883 | |||||
(1-Hydroxyethane-1,1-diyl)bis(phosphonic acid), compound with 2-aminoethanol (1:?) | 1 | 42220-47-3 | 814-283-0 | 1,32 | ||||||
2-Hydroxyethanesulfonic acid sodium salt | 1 | 1562-00-1 | 216-343-6 | 35,3 | 20770 | |||||
(Z)-N-[2-(2-Hydroxyethoxy)ethyl]-9-octadecenamide | 1 | 20429-33-8 | 243-818-5 | 12,3 | ||||||
2-[4-[2-[4-(2-Hydroxyethoxy)phenyl]propan-2-yl]phenoxy]ethanol | 1 | 32492-61-8 | 500-082-2 | 5,88 | 5,88 | 531903 | ||||
2-(2-Hydroxyethoxy)propyl prop-2-enoate; 2-[2-[2-[2-(1-Methyl-2-prop-2-enoyloxy-ethoxy)ethoxymethyl]butoxy]ethoxy]propyl 3-(dibutylamino)propanoate | 1 | 173011-06-8 | 605-658-8 | 13,23 | ||||||
2-Hydroxyethyl acrylate | 1 | 818-61-1 | 212-454-9 | 2,4 | 23120 | |||||
5-[(2-Hydroxyethyl)amino]-o-cresol | 1 | 55302-96-0 | 259-583-7 | 7,8 | ||||||
(2-Hydroxyethyl)ammonium mercaptoacetate | 1 | 126-97-6 | 204-815-4 | 0,49 | 102207 | |||||
(2-Hydroxyethyl)ammonium nitrate | 1 | 20748-72-5 | 244-005-8 | 10 | 10 | |||||
Hydroxyethylated 2-butyne-1,4-diol | 1 | 32167-31-0 | 608-711-3 | 44,1 | ||||||
N-(2-Hydroxyethyl)-N,N-dimethyl alkyl-C12-14-(even numbered)-1-aminium chloride | 1 | - | 931-275-3 | 1 | 2,2 | |||||
N-(2-Hydroxyethyl)ethylenediaminetriacetic acid | 1 | 150-39-0 | 205-759-3 | 10 | 88 | |||||
(1-Hydroxyethylidene)bisphosphonic acid, potassium salt | 1 | 67953-76-8 | 267-956-0 | 12 | ||||||
[2R-(2alpha,3Z,5alpha)]-3-(2-Hydroxyethylidene)-7-oxo-4-oxa-1-azabicyclo[3.2.0]heptane-2-carboxylic acid, compound with tert-butylamine (1:1) | 1 | 66069-34-9 | 266-104-5 | 2,58 | ||||||
1-(2-Hydroxyethyl)imidazolidin-2-one | 1 | 3699-54-5 | 223-032-9 | 44,1 | 115473 | |||||
2-Hydroxyethyl methacrylate | 1 | 868-77-9 | 212-782-2 | 4,9 | 510259 | |||||
N-(2-Hydroxyethyl)-N-[2-[(1-oxooctyl)amino]ethyl]-β-alanine | 1 | 64265-45-8 | 264-761-2 | 16,4 | ||||||
4-(2-Hydroxyethyl)piperazin-1-ylethanesulphonic acid | 1 | 7365-45-9 | 230-907-9 | 23,5 | 121990 | |||||
N-(2-Hydroxyethyl)stearamide | 1 | 111-57-9 | 203-883-2 | 73,44 | ||||||
1-[(2-Hydroxyethyl)thio]propan-2-ol | 1 | 6713-03-7 | 229-765-0 | 11,75 | ||||||
N-(2-Hydroxyethyl)-3,5,5-trimethylhexanamide | 1 | 1154308-86-7 | 800-884-5 | 2,2 | ||||||
(Hydroxyethyl)urea | 1 | 1320-51-0 | 215-304-0 | 146,67 | 109426 | |||||
12-Hydroxy-N-(2-hydroxyethyl)octadecan-1-amide | 1 | 106-15-0 | 203-367-7 | 16,4 | ||||||
3-Hydroxy-2-(hydroxymethyl)-2-methylpropionaldehyde | 1 | 18516-18-2 | 242-393-3 | 3,7 | 131304 | |||||
(2S,3S,3aR,9aS)-3-Hydroxy-2-(hydroxymethyl)-7-methyl-2,3,3a,9a-tertryhydro-6H-furo[2’,3’:4,5][1,3]oxazolo [3,2-a]pyrimidin-6-one | 1 | 433733-92-7 | 700-330-1 | 16,4 | ||||||
2-Hydroxy-1-(4-(4-(2-hydroxy-2-methylpropionyl)benzyl)phenyl)-2-methylpropan-1-one | 1 | 474510-57-1 | 444-860-9 | 0,71 | 536069 | |||||
12-Hydroxy-N-[6-(12-hydroxyoctadecanamido)hexyl]octadecanamide | 1 | - | 434-430-9 | 0,156 | ||||||
12-Hydroxy-N-[6-(12-hydroxyoctadecanamido)hexyl]octadecanamide | 2 | - | 434-430-9 | 35,24 | ||||||
2-[(1Z)-(Hydroxyimino)methyl]-4-(2-methylundecyl)phenol | 1 | 1233873-37-4 | 627-071-6 | 0,235 | ||||||
Hydroxylamine solution | 1 | 7803-49-8 | 232-259-2 | 0,003 | 570151 | |||||
Hydroxylammonium chloride | 1 | 5470-11-1 | 226-798-2 | 0,02 | 5080 | |||||
Hydroxylammonium nitrate | 1 | 13465-08-2 | 236-691-2 | 0,001 | 126540 | |||||
Hydroxymethanesulfinic acid sodium salt | 1 | 149-44-0 | 205-739-4 | 21 | 14700 | |||||
Hydroxymethanesulfinic acid sodium salt | 2 | 149-44-0 | 205-739-4 | 4,94 | 14700 | |||||
4-Hydroxymethyl-1,3-dioxolan-2-one | 1 | 931-40-8 | 213-235-0 | 41,75 | 107902 | |||||
7-[2-(2-Hydroxymethylethoxy)methylethoxy]tetramethyl-3,6,8,11-tetraoxa-7-phosphatridecane-1,13-diol | 1 | 36788-39-3 | 253-211-7 | 0,55 | ||||||
2-Hydroxymethyl-9-methyl-6-(1-methylethyl)-1,4-dioxaspiro-(4.5)decane | 1 | 63187-91-7 | 408-200-3 | 4,7 | 530946 | |||||
2-(Hydroxymethyl)-2-methyl-1,3-propanediol | 1 | 77-85-0 | 201-063-9 | 9,87 | 492407 | |||||
4-Hydroxy-4-methylpentan-2-one | 1 | 123-42-2 | 204-626-7 | 32,6 | TRGS900 | MAK | 22250 | |||
Hydroxy(2-methylprop-2-enoato-O)zinc | 1 | 63451-47-8 | 264-202-2 | 1,9 | 150090 | |||||
2-Hydroxy-2-methylpropiophenone | 1 | 7473-98-5 | 231-272-0 | 3,5 | 491466 | |||||
1-(2-Hydroxy-2-methylpropoxy)-2,2,6,6-tetramethylpiperidine-4-yl octadecanoate | 1 | - | 433-060-5 | 3 | 2,94 | |||||
3-Hydroxy-2-methyl-4-pyrone | 1 | 118-71-8 | 204-271-8 | 6,58 | ||||||
1-Hydroxy-4-methyl-6-(2,4,4-trimethylpentyl) 2(1H)-pyridinone, compd. with 2-aminoethanol (1:1) | 1 | 68890-66-4 | 272-574-2 | 14,7 | 157499 | |||||
1-Hydroxy-4-methyl-6-(2,4,4-trimethylpentyl) 2(1H)-pyridinone, compd. with 2-aminoethanol (1:1) | 2 | 68890-66-4 | 272-574-2 | 12,3 | 157499 | |||||
2-Hydroxynaphthalene-1-carbaldehyde [(2-hydroxy-1-naphthyl)methylene]hydrazone | 1 | 2387-03-3 | 219-210-0 | 16,052 | ||||||
2-Hydroxy-5-nonyl(branched)-benzaldehyde oxime | 1 | 174333-80-3 | 605-717-8 | 0,411 | ||||||
1-(2-Hydroxy-5-nonyl(branched)-phenyl)ethanone oxime | 1 | 244235-47-0 | 627-083-1 | 0,411 | ||||||
Hydroxyoctadecanoic acid, monoester with glycerol | 1 | 1323-42-8 | 215-355-9 | 141 | ||||||
12-Hydroxyoctadecanoic acid, reaction products with 1,3-Benzenedimethanamine and Hexamethylenediamine | 1 | 220926-97-6 | 432-840-2 | 0,332 | 536264 | |||||
3-alpha-Hydroxy-7-oxo-5-beta-cholan-24-oic acid | 1 | 4651-67-6 | 225-083-2 | 9,8 | 117131 | |||||
2-Hydroxy-3-phenoxypropyl acrylate | 1 | 16969-10-1 | 241-045-8 | 1,65 | ||||||
N-(4-Hydroxyphenyl)benzenesulfonamide | 1 | 5471-90-9 | 654-333-7 | 12,3 | ||||||
4-(4-Hydroxyphenyl)-2-butanone | 1 | 5471-51-2 | 226-806-4 | 114,24 | 70200 | |||||
[1-[[(2-Hydroxyphenyl)imino]methyl]-2-naphtholato(2-)-N,O,O']copper | 1 | 15680-42-9 | 239-763-1 | 2,35 | ||||||
4-[2-[2-[(2-Hydroxyphenyl)methylene]hydrazinyl]-2-oxoethyl]-4-methylmorpholinium chloride | 1 | 1254469-57-2 | 700-714-9 | 33,18 | ||||||
3-(Hydroxyphenylphosphinyl)propanoic acid | 1 | 14657-64-8 | 411-200-6 | 2,33 | 901075 | |||||
4-Hydroxyphenylsulfonic acid | 1 | 98-67-9 | 202-691-6 | 53,6 | 70750 | |||||
3-(Hydroxypivaloyloxy)-2,2-dimethylpropanol | 1 | 1115-20-4 | 214-222-2 | 10,45 | 33100 | |||||
Hydroxyprogesterone | 1 | 68-96-2 | 200-699-4 | 3,53 | ||||||
L-4-Hydroxyproline | 1 | 51-35-4 | 200-091-9 | 35,3 | ||||||
2-Hydroxy-3-(prop-2-enoyloxy)propyl 2-methyl-2-propylhexanoate | 1 | 444649-70-1 | 814-233-8 | 3,29 | ||||||
[2-Hydroxy-3-(prop-2-en-1-yloxy)propyl](3-{8-methoxy-2,4-dioxo-3-azatricyclo[7.3.1.0^{5,13}]trideca-1(12),5,7,9(13),10-pentaen-3-yl}propyl)dimethylazanium hydroxide | 1 | - | 461-080-4 | 5,547 | ||||||
Hydroxypropyl acrylate, isomers | 1 | 25584-83-2 | 247-118-0 | 2,4 | 530054 | |||||
2-[(2-Hydroxypropyl)(C16-18 sat. C18 unsat. alkyl)amino]propan-1-ol | 1 | 1309955-79-0 | 695-977-9 | 2,112 | ||||||
N-(2-Hydroxypropyl)benzenesulphonamide | 1 | 35325-02-1 | 252-512-0 | 3,5 | ||||||
N-(2-Hydroxypropyl)oleamide | 1 | 111-05-7 | 203-828-2 | 2,35 | 101758 | |||||
3-(3-Hydroxypropyl)oxazolidin-2-one | 1 | 87010-29-5 | 431-840-1 | 17 | ||||||
(2-Hydroxypropyl)trimethylammonium 2-ethylhexanoate | 1 | 62314-22-1 | 263-502-0 | 2,15 | ||||||
(2-Hydroxypropyl)trimethylammonium formate | 1 | 62314-25-4 | 263-503-6 | 11,75 | ||||||
1-({3-[(2-Hydroxypropyl)[(9E)-octadec-9-en-1-yl]amino]propyl}amino)propan-2-ol; 1-({3-[(2-Hydroxypropyl)amino]propyl}(octadecyl)amino)propan-2-ol; 1-({3-[Hexadecyl(2-hydroxypropyl)amino]propyl}amino)propan-2-ol | 1 | 68603-75-8 | 614-637-2 | 0,563 | ||||||
(2-Hydroxy-3-sulfopropyl)dimethyl[3-[(1-oxododecyl)amino]propyl]ammonium hydroxide | 1 | 19223-55-3 | 242-893-1 | 1,18 | 131732 | |||||
1-(2-Hydroxy-3-sulphonatopropyl)pyridinium | 1 | 3918-73-8 | 223-485-2 | 16,46 | ||||||
4-Hydroxy-2,2,6,6-tetramethylpiperidine-1-ethanol | 1 | 52722-86-8 | 258-132-1 | 26,5 | 144776 | |||||
4-Hydroxy-2,2,6,6-tetramethylpiperidinoxyl | 1 | 2226-96-2 | 218-760-9 | 1,2 | 112104 | |||||
3-Hydroxy-N-(o-tolyl)-4-[(2,4,5-trichlorophenyl)azo]naphthalene-2-carboxamide | 1 | 6535-46-2 | 229-440-3 | 3 | 49 | 491460 | ||||
2-Hydroxy-N,N,N-trimethyl-3-[(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)thio]propan-1-aminium chloride | 1 | 88992-45-4 | 811-523-6 | 0,822 | ||||||
Hypersol Synergist L 4722 | 1 | - | 410-510-9 | 4,4 | ||||||
Hypersol Synergist L 4722 | 2 | - | 410-510-9 | 3 | 10 | |||||
Icosan-1-ol | 1 | 629-96-9 | 211-119-4 | 244 | 389 | |||||
IDS, Na-Salt | 1 | - | 429-200-1 | 7,05 | ||||||
Imidazole | 2 | 288-32-4 | 206-019-2 | 10,6 | 27150 | |||||
1H-Imidazole-1-ethanol, 4,5-dihydro-, 2-nortall-oil alkyl derivs. | 1 | 61791-39-7 | 263-171-2 | 1,4 | ||||||
1H-Imidazole-1-ethanol, 4,5-dihydro-, 2-nortall-oil alkyl derivs. | 2 | 61791-39-7 | 263-171-2 | 0,7 | ||||||
1H-Imidazole-1-propylamine | 1 | 5036-48-6 | 225-730-9 | 10,5 | 117672 | |||||
2-Imidazolidinone | 1 | 120-93-4 | 204-436-4 | 1 | 35610 | |||||
Imidazolium compounds, 2-C17-unsatd.-alkyl-1-(2-C18-unsatd. amidoethyl)-4,5-dihydro-N-methyl, Me sulfates | 1 | - | 931-745-8 | 44 | ||||||
2,2'-Iminobis[4,6-diamino-1,3,5-triazine] | 1 | 3576-88-3 | 222-695-1 | 35 | 35 | 115198 | ||||
2,2'-Iminobisethanol, N-(C12-18)-alkyl derivates | 1 | 71786-60-2 | 276-014-8 | 0,59 | 160563 | |||||
1,1'-[Iminobis(ethyleneiminoethylene)]bis[3-(octadecenyl)pyrrolidine-2,5-dione] | 1 | 64051-50-9 | 264-637-8 | 12 | ||||||
[Iminobis(ethyleneiminomethylene)]bis(phosphonic) acid, N,N-bis(phosphonomethyl) derivative, sodium salt | 1 | 68399-68-8 | 269-979-1 | 10 | ||||||
2,2'-Iminodiethanol | 1 | 111-42-2 | 203-868-0 | 0,5 | 0,75 | TRGS900 | MAK | 10730 | ||
2,2-Iminodiethanol, propoxylated | 1 | 35176-06-8 | 500-085-9 | 98 | ||||||
1-Imino-1H-isoindol-3-amine | 1 | 3468-11-9 | 222-426-8 | 0,3 | ||||||
1H-Indene-1,3(2H)-dione, 2-(2-quinolinyl)-, sulfonated, sodium salts | 1 | 95193-83-2 | 305-897-5 | 4,93 | ||||||
Indium, powder | 1 | 7440-74-6 | 231-180-0 | 0,0063 | TRGS900 | 8370 | ||||
Indium trichloride | 1 | 10025-82-8 | 233-043-0 | 0,0063 | ||||||
Indium, cake | 1 | 69029-48-7 | 273-794-1 | 0,004 | ||||||
Indium, cake | 2 | 69029-48-7 | 273-794-1 | 0,0063 | ||||||
Indium, cake | 3 | 69029-48-7 | 273-794-1 | 0,04 | ||||||
Indium, cake | 4 | 69029-48-7 | 273-794-1 | 1 | ||||||
Indium(III) hydroxide | 1 | 20661-21-6 | 243-947-7 | 0,0063 | TRGS900 | 132616 | ||||
Indium(III) oxide | 1 | 1312-43-2 | 215-193-9 | 0,0063 | TRGS900 | 109377 | ||||
Indium trinitrate | 1 | 13770-61-1 | 237-393-5 | 0,0063 | ||||||
Indole | 1 | 120-72-9 | 204-420-7 | 9,87 | 31030 | |||||
Inorganic Phosphorus salt | 1 | - | 428-310-5 | 63,2 | ||||||
Insulin Aspart Ethyl Ester | 1 | - | 944-548-7 | 0,063 | ||||||
Insulin Aspart Precursor | 1 | - | 944-549-2 | 1,4 | ||||||
Insulin DesB30 | 1 | - | 944-550-8 | 0,063 | ||||||
Insulin Human Methyl Ester | 1 | - | 944-551-3 | 0,063 | ||||||
Iodine | 1 | 7553-56-2 | 231-442-4 | 0,07 | 1010 | |||||
Iodine pentafluoride | 1 | 7783-66-6 | 232-019-7 | 0,122 | ||||||
3-Iodo-2-propynyl butylcarbamate | 1 | 55406-53-6 | 259-627-5 | 1,16 | 0,023 | TRGS900 | MAK | 146085 | ||
Iodo(triphenylphosphino)copper | 1 | 47107-74-4 | 256-296-9 | 29,5 | ||||||
IPDA-BADGE-BUMGE | 1 | - | 3,53 | |||||||
Iron, Powder | 1 | 7439-89-6 | 231-096-4 | 3 | 8210 | |||||
Iron ores, agglomerates | 1 | 65996-65-8 | 265-996-3 | 3 | ||||||
Iron sinter | 1 | 65996-66-9 | 265-997-9 | 3 | ||||||
Iron dichloride | 1 | 7758-94-3 | 231-843-4 | 0,2 | 1490 | |||||
Iron(3+) ion dipotassium 2-({2-[bis(carboxylatomethyl)amino]ethyl} (carboxylatomethyl)amino)acetate; hydrate | 1 | 148124-40-7 | 824-774-1 | 2 | ||||||
Iron manganese trioxide | 1 | 12062-81-6 | 235-049-9 | 10 | TRGS900 | MAK | EU | 125170 | ||
Iron(III) nitrate | 1 | 10421-48-4 | 233-899-5 | 12 | 491484 | |||||
Iron(II) oxide | 1 | 1345-25-1 | 215-721-8 | 10 | 10 | 1190 | ||||
Iron(II,III) oxide | 1 | 1317-61-9 | 215-277-5 | 10 | 3170 | |||||
Iron pentacarbonyl | 1 | 13463-40-6 | 236-670-8 | 1,82 | 1,82 | TRGS900 | MAK | 4250 | ||
Iron(III) sodium ethylenediaminetetraacetate | 1 | 15708-41-5 | 239-802-2 | 2 | 129119 | |||||
Iron(II) sulfide | 1 | 1317-37-9 | 215-268-6 | 8,82 | 2190 | |||||
Iron tris(2-ethylhexanoate) | 1 | 7321-53-1 | 230-794-6 | 4,9 | ||||||
isliFe | 1 | - | 1,8 | |||||||
Iso(C10-C14)alkyl (3,5-di-tert-butyl-4-hydroxyphenyl)methyl-thioacetate | 1 | 118832-72-7 | 404-800-4 | 1,47 | 531803 | |||||
1,3-Isobenzofurandione, hexahydro-, reaction products with epichlorohydrin | 1 | 1395383-69-3 | 696-026-0 | 12,3 | ||||||
1,3-Isobenzofurandione, reaction products with methylquinoline and quinoline | 1 | 8003-22-3 | 232-318-2 | 1,045 | ||||||
(±)-Isoborneol | 1 | 124-76-5 | 204-712-4 | 0,208 | 102130 | |||||
Isobornyl acetate | 1 | 125-12-2 | 204-727-6 | 13,22 | 491983 | |||||
Isobutene | 1 | 115-11-7 | 204-066-3 | 768,7 | 13720 | |||||
Isobutyl acrylate | 1 | 106-63-8 | 203-417-8 | 11 | 510292 | |||||
Isobutylamine | 1 | 78-81-9 | 201-145-4 | 6,1 | 10 | TRGS900 | MAK | 16520 | ||
Isobutyle acetate | 1 | 110-19-0 | 203-745-1 | 300 | 300 | TRGS900 | MAK | EU | 30820 | |
O-Isobutyl ethylthiocarbamate | 1 | 55860-53-2 | 259-869-1 | 8,81 | 8,81 | |||||
Isobutylidenediurea | 1 | 6104-30-9 | 228-055-8 | 70,5 | 34120 | |||||
Isobutyl isobutyrate | 1 | 97-85-8 | 202-612-5 | 154,77 | 510612 | |||||
Isobutylisopropyldimethoxysilane | 1 | 111439-76-0 | 402-580-4 | 23,5 | 530345 | |||||
Isobutyl methacrylate | 1 | 97-86-9 | 202-613-0 | 409 | 415,9 | 510293 | ||||
3-(4-Isobutyl-2-methylphenyl)propanal | 1 | 1637294-12-2 | 811-285-3 | 2,47 | ||||||
Isobutyl vinyl ether | 1 | 109-53-5 | 203-678-8 | 8,4 | 4,2 | MAK | 29750 | |||
Isobutyraldehyde | 1 | 78-84-2 | 201-149-6 | 120 | 17450 | |||||
Isobutyric acid | 1 | 79-31-2 | 201-195-7 | 184 | 28040 | |||||
Isobutyric anhydride | 1 | 97-72-3 | 202-603-6 | 184 | 510610 | |||||
1-Isocyanato-2-((4-isocyanatophenyl)methyl)benzene | 1 | 5873-54-1 | 227-534-9 | 0,05 | TRGS900 | 510205 | ||||
1-Isocyanato-4-[(4-isocyanatophenyl)methyl]benzene homopolymer | 1 | 25686-28-6 | 500-040-3 | 0,05 | ||||||
3-Isocyanatomethyl-3,5,5-trimethylcyclohexyl isocyanate homopolymer, isocyanurate type | 1 | - | 931-312-3 | 0,29 | ||||||
1-(1-Isocyanato-1-methylethyl)-3-(1-methylethenyl)benzene | 1 | 2094-99-7 | 402-440-2 | 0,0268 | 496687 | |||||
3-Isocyanatomethyl-3,5,5-trimethylcyclohexyl isocyanate, oligomers, 2-Hydroxy-1(2)- methylethyl carbamate blocked | 1 | - | 921-910-2 | 69,1 | ||||||
3-Isocyanatomethyl-3,5,5-trimethylcyclohexyl isocyanate | 1 | 4098-71-9 | 223-861-6 | 0,045 | TRGS900 | MAK | 33350 | |||
3-Isocyanatomethyl-3,5,5-trimethylcyclohexyl isocyanate, oligomers, allophanate type | 1 | - | 933-047-9 | 0,3 | ||||||
3-Isocyanatomethyl-3,5,5-trimethylcyclohexyl isocyanate, oligomers, reaction products with 2-butanone oxime | 1 | 103170-26-9 | 500-287-7 | 0,075 | ||||||
3-Isocyanatomethyl-3,5,5-trimethylcyclohexyl isocyanate, oligomers, reaction products with 3,5-dimethyl-1H-pyrazole | 1 | 200295-52-9 | 606-423-2 | 0,075 | ||||||
Isodecyl diphenyl phosphate | 1 | 29761-21-5 | 249-828-6 | 0,18 | 495499 | |||||
Isodecyl acrylate | 1 | 1330-61-6 | 215-542-5 | 37,5 | 109619 | |||||
Isodecyl methacrylate | 1 | 29964-84-9 | 249-978-2 | 2,5 | 137687 | |||||
Isodecyl 9-octadecenoate | 1 | 59231-34-4 | 261-673-6 | 7,05 | TRGS900 | MAK | 147874 | |||
Isoheptane | 1 | 31394-54-4 | 250-610-8 | 2085 | TRGS900 | 496188 | ||||
5,5'-(1H-Isoindole-1,3(2H)-diylidene)dibarbituric acid | 1 | 36888-99-0 | 253-256-2 | 3 | 140491 | |||||
Isoleucine | 1 | 73-32-5 | 200-798-2 | 52,89 | 12930 | |||||
Isooctadecanoic acid | 1 | 30399-84-9 | 250-178-0 | 282,105 | 495521 | |||||
Isooctadecan-1-ol | 1 | 27458-93-1 | 248-470-8 | 421 | 136396 | |||||
Isooctadecyl palmitate | 1 | 72576-80-8 | 276-719-0 | 7,05 | ||||||
Isooctane | 1 | 540-84-1 | 208-759-1 | 2035 | MAK | 13510 | ||||
Isooctane | 1 | 26635-64-3 | 247-861-0 | 2035 | TRGS900 | MAK | 496186 | |||
Isooctene | 1 | 11071-47-9 | 234-294-9 | 83,75 | 492155 | |||||
Isooctyl acrylate | 1 | 29590-42-9 | 249-707-8 | 21 | 137451 | |||||
Isopentyl p-methoxycinnamate | 1 | 71617-10-2 | 275-702-5 | 7,05 | ||||||
Isophthalic acid | 1 | 121-91-5 | 204-506-4 | 8,8 | TRGS900 | MAK | 37130 | |||
Isophthaloyl dichloride | 1 | 99-63-8 | 202-774-7 | 3,94 | 24240 | |||||
Isoprene | 1 | 78-79-5 | 201-143-3 | 8,4 | TRGS900 | MAK | Carcinogenic | 12830 | ||
Isopropanolamine | 1 | 78-96-6 | 201-162-7 | 3,6 | TRGS900 | 14890 | ||||
Isopropenyl acetate | 1 | 108-22-5 | 203-562-7 | 42 | 42 | TRGS900 | MAK | 36390 | ||
2-Isopropoxyethanol | 1 | 109-59-1 | 203-685-6 | 72 | TRGS900 | MAK | 22320 | |||
(2-Isopropoxyethyl) acetate | 1 | 19234-20-9 | 242-901-3 | 1 | 131739 | |||||
2-Isopropoxyethyl salicylate | 1 | 79915-74-5 | 279-348-2 | 9,8 | ||||||
4-(4-Isopropoxyphenylsulfonyl)phenol | 1 | 95235-30-6 | 405-520-5 | 2,47 | 530666 | |||||
Isopropyl acetate | 1 | 108-21-4 | 203-561-1 | 227 | 275 | MAK | 33750 | |||
Isopropylamine | 1 | 75-31-0 | 200-860-9 | 12 | 10 | TRGS900 | MAK | 23480 | ||
Isopropyl benzoate | 1 | 939-48-0 | 213-361-6 | 70,48 | ||||||
1-Isopropyl-2,2-dimethyltrimethylene diisobutyrate | 1 | 6846-50-0 | 229-934-9 | 17,62 | 121170 | |||||
O-Isopropyl ethylthiocarbamate | 1 | 141-98-0 | 205-517-7 | 0,118 | 102638 | |||||
2-Isopropyl-N-hydroxyethyl 1,3-oxazolidine | 1 | - | 429-990-6 | 4,4 | 535899 | |||||
N-Isopropylhydroxylamine | 1 | 5080-22-8 | 225-791-1 | 1,4 | 117721 | |||||
4,4'-Isopropylidenebis[2-allylphenol] | 1 | 1745-89-7 | 217-121-1 | 1 | ||||||
1,1'-(Isopropylidene)bis[3,5-dibromo-4-(2,3-dibromo-2-methylpropoxy)benzene] | 1 | 97416-84-7 | 306-832-3 | 7,05 | ||||||
1,1'-(Isopropylidene)bis[3,5-dibromo-4-(2,3-dibromopropoxy)benzene] | 1 | 21850-44-2 | 244-617-5 | 23,3 | 24390 | |||||
2,2'-Isopropylidenebis(p-phenyleneoxy)diethanol | 1 | 901-44-0 | 212-985-6 | 7,4 | 107723 | |||||
4,4'-[(Isopropylidene)bis(p-phenyleneoxy)]diphthalic dianhydride | 1 | 38103-06-9 | 253-781-7 | 0,2 | 140947 | |||||
1,1'-(Isopropylidenebis(p-phenyleneoxy))di-2-propanol | 1 | 116-37-0 | 204-137-9 | 17,7 | 101878 | |||||
4,4'-Isopropylidenedi-o-cresol | 1 | 79-97-0 | 201-240-0 | 4,11 | ||||||
4,4'-Isopropylidenedicyclohexanol | 1 | 80-04-6 | 201-244-2 | 4,93 | 100634 | |||||
4,4'-Isopropylidenedicyclohexanol, oligomeric reaction products with 1-Chloro-2,3-epoxypropane | 1 | 30583-72-3 | 500-070-7 | 3,25 | ||||||
4,4'-Isopropylidenediphenol | 1 | 80-05-7 | 201-245-8 | 2 | 2 | TRGS900 | MAK | EU | 13980 | |
4,4'-Isopropylidenediphenol, condensation product with diphenyl carbonate | 1 | - | 926-571-4 | 8 | 8 | |||||
4,4'-Isopropylidenediphenol, ethoxylated, esters with fatty acids, coco | 1 | 115340-85-7 | 500-303-2 | 23,51 | ||||||
4,4'-Isopropylidenediphenol, oligomeric reaction products with 1-chloro-2,3-epoxypropane, reaction products with biphenyl-4-ol | 1 | 161308-15-2 | 500-655-7 | 23,3 | ||||||
4,4'-Isopropylidenediphenol, oligomeric reaction products with 1-chloro-2,3-epoxypropane, reaction products with diethylenetriamine | 1 | 31326-29-1 | 500-072-8 | 0,529 | ||||||
4,4'-Isopropylidenediphenol, oligomeric reaction products with 1-chloro-2,3-epoxypropane, reaction products with [(dimethylamino)methyl]phenol and piperazine | 1 | 159034-96-5 | 500-429-8 | 0,603 | ||||||
4,4'-Isopropylidenediphenol, oligomeric reaction products with 1-chloro-2,3-epoxypropane, reaction products with ethylenediamine | 1 | 72480-18-3 | 500-253-1 | 0,529 | ||||||
4,4'-Isopropylidenediphenol, oligomeric reaction products with 1-chloro-2,3-epoxypropane, reaction products with fatty acids, C18-unsatd., dimers | 1 | 67989-52-0 | 500-180-5 | 39,2 | 39,2 | |||||
4,4'-Isopropylidenediphenol, oligomeric reaction products with 1-chloro-2,3-epoxypropane, reaction products with maleic anhydride and methacrylic acid | 1 | 36425-16-8 | 500-090-6 | 35,2 | ||||||
4,4'-Isopropylidenediphenol, oligomeric reaction products with 1-chloro-2,3-epoxypropane, reaction products with 4,4'-methylenebis(cyclohexylamine) | 1 | 38294-67-6 | 500-103-5 | 0,58 | ||||||
4,4'-Isopropylidenediphenol, oligomeric reaction products with 1-chloro-2,3-epoxypropane, reaction products with 2-methylimidazole | 1 | 68002-42-6 | 500-181-0 | 4,93 | ||||||
4,4'-Isopropylidenediphenol, oligomeric reaction products with 1-chloro-2,3-epoxypropane, reaction products with triethylenetetramine | 1 | 38294-69-8 | 500-104-0 | 0,529 | ||||||
4,4'-Isopropylidenedi-2,6-xylol | 1 | 5613-46-7 | 227-033-5 | 0,29 | ||||||
Isopropyl N-lauroyl sarcosinate | 1 | - | 440-990-5 | 9,3 | 3,29 | |||||
N-Isopropylmethacrylamide | 1 | 13749-61-6 | 237-331-7 | 4,89 | 127069 | |||||
(R)-5-Isopropyl-2-methylcyclohexa-1,3-diene | 1 | 4221-98-1 | 224-167-6 | 1,85 | ||||||
1-Isopropyl-4-methylcyclohexane | 1 | 99-82-1 | 202-790-4 | 31,6 | 491255 | |||||
2-Isopropyl-5-methyl-cyclohexanone | 1 | - | 905-013-3 | 26,1 | ||||||
Isopropyl myristate | 1 | 110-27-0 | 203-751-4 | 23,5 | 492738 | |||||
Isopropylnaphthalene, mixture of isomers | 1 | 29253-36-9 | 249-535-3 | 6 | 137303 | |||||
Isopropylpalmitate | 1 | 142-91-6 | 205-571-1 | 25,85 | 102663 | |||||
N-Isopropyl-N'-phenyl-p-phenylenediamine | 1 | 101-72-4 | 202-969-7 | 0,8 | TRGS900 | MAK | 491081 | |||
2-Isopropyl-9H-thioxanthen-9-one | 1 | 5495-84-1 | 226-827-9 | 0,73 | ||||||
Isosorbide diesters | 1 | - | 700-073-5 | 141 | ||||||
Isostearic acid monoisopropanolamide | 1 | - | 431-540-9 | 3,29 | 535956 | |||||
Isotridecanol, ethoxylated | 1 | 69011-36-5 | 500-241-6 | 294 | 532042 | |||||
Isotridecanol, mixture of isomers | 1 | 27458-92-0 | 248-469-2 | 26,5 | TRGS900 | 136395 | ||||
Juniper, Juniperus mexicana, extract | 1 | 91722-61-1 | 294-461-7 | 6,41 | ||||||
Juniper, Juniperus virginiana, extract | 1 | 85085-41-2 | 285-370-3 | 6,41 | ||||||
Kaolin, calcined | 1 | 92704-41-1 | 296-473-8 | 3 | 3 | |||||
Kerosine (petroleum), straight-run wide-cut | 1 | 92045-37-9 | 295-418-5 | 837,5 | ||||||
Kerosine (petroleum), straight-run wide-cut | 2 | 92045-37-9 | 295-418-5 | 837,5 | 1,9 | |||||
Lactic acid | 1 | 50-21-5 | 200-018-0 | 592 | 13000 | |||||
Lanthanum carbonate | 1 | 587-26-8 | 209-599-5 | 108,9 | 105481 | |||||
Lanthanum(III) chloride | 1 | 10099-58-8 | 233-237-5 | 108,44 | 123673 | |||||
Lanthanum(III) oxide | 1 | 1312-81-8 | 215-200-5 | 61,5 | 5410 | |||||
Lauraldehyde | 1 | 112-54-9 | 203-983-6 | 49,7 | 492784 | |||||
Lauramidopropyl betaine | 1 | 4292-10-8 | 224-292-6 | 44 | 116491 | |||||
Lauric acid, monoester with Propane-1,2-diol | 1 | 27194-74-7 | 248-315-4 | 12,3 | ||||||
Lauric acid | 1 | 143-07-7 | 205-582-1 | 17,632 | TRGS900 | MAK | 27100 | |||
Lauronitrile | 1 | 2437-25-4 | 219-440-1 | 14 | 494233 | |||||
N-Lauroylsarcosine | 1 | 97-78-9 | 202-608-3 | 141,053 | 101318 | |||||
Lavender, Lavandula angustifolia, extract | 1 | 90063-37-9 | 289-995-2 | 0,877 | ||||||
Lavender, Lavandula hybrida, extract | 1 | 91722-69-9 | 294-470-6 | 0,877 | ||||||
Leach residues, zinc ore, lead-contg. | 1 | 91053-49-5 | 293-314-4 | 0,005 | ||||||
Leach residues, zinc ore, lead-contg. | 2 | 91053-49-5 | 293-314-4 | 0,004 | ||||||
Leach residues, zinc ore, lead-contg. | 3 | 91053-49-5 | 293-314-4 | 1 | ||||||
Leach residues, zinc ore, lead-contg. | 4 | 91053-49-5 | 293-314-4 | 0,05 | 0,05 | |||||
Lead alloy, base, Pb,Sn, dross | 1 | 69011-60-5 | 273-701-4 | 0,1 | ||||||
Lead alloy, base, Pb,Sn, dross | 2 | 69011-60-5 | 273-701-4 | 0,107 | ||||||
Lead alloy, base, Pb,Sn, dross | 3 | 69011-60-5 | 273-701-4 | 0,004 | ||||||
Lead alloy, base, Pb,Sn, dross | 4 | 69011-60-5 | 273-701-4 | 5 | ||||||
Lead alloy, base, Pb,Sn, dross | 5 | 69011-60-5 | 273-701-4 | 0,5 | 5 | |||||
Lead alloy, base, Pb,Sn, dross | 6 | 69011-60-5 | 273-701-4 | 1 | ||||||
Lead alloy, base, Pb,Sn, dross | 7 | 69011-60-5 | 273-701-4 | 0,05 | 0,05 | |||||
Lead alloy, base, Pb,Sn, dross | 8 | 69011-60-5 | 273-701-4 | 0,5 | ||||||
Lead alloy, base, Pb,Sn, dross | 9 | 69011-60-5 | 273-701-4 | 0,005 | ||||||
Lead alloy, base, Pb,Sn, dross | 10 | 69011-60-5 | 273-701-4 | 0,04 | ||||||
Lead alloy, base, Pb,Sn, dross | 11 | 69011-60-5 | 273-701-4 | 0,0509 | ||||||
Lead alloy, base, Pb,Sn, dross | 12 | 69011-60-5 | 273-701-4 | 0,1052 | ||||||
Lead alloy, base, Pb,Sn, dross | 13 | 69011-60-5 | 273-701-4 | 0,05 | ||||||
Lead alloy, base, Pb,Sn, dross | 14 | 69011-60-5 | 273-701-4 | 11,17 | ||||||
Lead alloy, base, Pb,Sn, dross | 15 | 69011-60-5 | 273-701-4 | 3 | 16,76 | |||||
Lead, antimonial, dross | 1 | 69029-51-2 | 273-795-7 | 0,107 | ||||||
Lead, antimonial, dross | 2 | 69029-51-2 | 273-795-7 | 0,004 | ||||||
Lead, antimonial, dross | 3 | 69029-51-2 | 273-795-7 | 0,004 | ||||||
Lead, antimonial, dross | 4 | 69029-51-2 | 273-795-7 | 0,04 | ||||||
Lead, antimonial, dross | 5 | 69029-51-2 | 273-795-7 | 0,02 | ||||||
Lead, antimonial, dross | 6 | 69029-51-2 | 273-795-7 | 5 | ||||||
Lead, antimonial, dross | 7 | 69029-51-2 | 273-795-7 | 0,1 | ||||||
Lead, antimonial, dross | 8 | 69029-51-2 | 273-795-7 | 0,005 | ||||||
Lead, antimonial, dross | 9 | 69029-51-2 | 273-795-7 | 0,05 | 0,05 | |||||
Lead, antimonial, dross | 10 | 69029-51-2 | 273-795-7 | 0,5 | ||||||
Lead, antimonial, dross | 11 | 69029-51-2 | 273-795-7 | 0,05 | ||||||
Lead, bullion | 1 | 97808-88-3 | 308-011-5 | 0,1 | ||||||
Lead, bullion | 2 | 97808-88-3 | 308-011-5 | 0,107 | ||||||
Lead, bullion | 3 | 97808-88-3 | 308-011-5 | 0,004 | ||||||
Lead, bullion | 4 | 97808-88-3 | 308-011-5 | 5 | ||||||
Lead, bullion | 5 | 97808-88-3 | 308-011-5 | 0,5 | 5 | |||||
Lead, bullion | 6 | 97808-88-3 | 308-011-5 | 1 | ||||||
Lead, bullion | 7 | 97808-88-3 | 308-011-5 | 0,05 | 0,05 | |||||
Lead, bullion | 8 | 97808-88-3 | 308-011-5 | 0,5 | ||||||
Lead, bullion | 9 | 97808-88-3 | 308-011-5 | 0,04 | ||||||
Lead, bullion | 10 | 97808-88-3 | 308-011-5 | 0,0509 | ||||||
Lead, bullion | 11 | 97808-88-3 | 308-011-5 | 0,1052 | ||||||
Lead, bullion | 12 | 97808-88-3 | 308-011-5 | 0,05 | ||||||
Lead, bullion | 13 | 97808-88-3 | 308-011-5 | 11,17 | ||||||
Lead, bullion | 14 | 97808-88-3 | 308-011-5 | 3 | 16,76 | |||||
Lead, bullion | 15 | 97808-88-3 | 308-011-5 | 0,005 | ||||||
Lead, bullion | 16 | 97808-88-3 | 308-011-5 | 0,107 | ||||||
Lead, bullion | 17 | 97808-88-3 | 308-011-5 | 0,004 | ||||||
Lead, bullion | 18 | 97808-88-3 | 308-011-5 | 0,02 | ||||||
Lead, bullion | 19 | 97808-88-3 | 308-011-5 | 5 | ||||||
Lead, bullion | 20 | 97808-88-3 | 308-011-5 | 0,1 | ||||||
Lead, bullion | 21 | 97808-88-3 | 308-011-5 | 0,2 | ||||||
Lead, bullion | 22 | 97808-88-3 | 308-011-5 | 0,1052 | ||||||
Lead, bullion | 23 | 97808-88-3 | 308-011-5 | 3,33 | 16,76 | |||||
Lead bullion, Platinum Group Metals rich | 1 | - | 931-607-7 | 0,05 | 0,05 | |||||
Lead bullion, Platinum Group Metals rich | 2 | - | 931-607-7 | 0,005 | ||||||
Lead bullion, Platinum Group Metals rich | 3 | - | 931-607-7 | 0,5 | ||||||
Lead bullion, Platinum Group Metals rich | 4 | - | 931-607-7 | 0,05 | ||||||
Lead, dross | 1 | 69029-52-3 | 273-796-2 | 0,1 | ||||||
Lead, dross | 2 | 69029-52-3 | 273-796-2 | 0,107 | ||||||
Lead, dross | 3 | 69029-52-3 | 273-796-2 | 0,004 | ||||||
Lead, dross | 4 | 69029-52-3 | 273-796-2 | 5 | ||||||
Lead, dross | 5 | 69029-52-3 | 273-796-2 | 0,5 | 5 | |||||
Lead, dross | 6 | 69029-52-3 | 273-796-2 | 1 | ||||||
Lead, dross | 7 | 69029-52-3 | 273-796-2 | 0,05 | 0,05 | |||||
Lead, dross | 8 | 69029-52-3 | 273-796-2 | 0,5 | ||||||
Lead, dross | 9 | 69029-52-3 | 273-796-2 | 0,0509 | ||||||
Lead, dross | 10 | 69029-52-3 | 273-796-2 | 0,04 | ||||||
Lead, dross | 11 | 69029-52-3 | 273-796-2 | 0,05 | ||||||
Lead, dross | 12 | 69029-52-3 | 273-796-2 | 0,005 | ||||||
Lead, dross, antimony-rich | 1 | 69029-45-4 | 273-791-5 | 0,107 | ||||||
Lead, dross, antimony-rich | 2 | 69029-45-4 | 273-791-5 | 0,004 | ||||||
Lead, dross, antimony-rich | 3 | 69029-45-4 | 273-791-5 | 0,004 | ||||||
Lead, dross, antimony-rich | 4 | 69029-45-4 | 273-791-5 | 0,04 | ||||||
Lead, dross, antimony-rich | 5 | 69029-45-4 | 273-791-5 | 0,02 | ||||||
Lead, dross, antimony-rich | 6 | 69029-45-4 | 273-791-5 | 5 | ||||||
Lead, dross, antimony-rich | 7 | 69029-45-4 | 273-791-5 | 0,1 | ||||||
Lead, dross, antimony-rich | 8 | 69029-45-4 | 273-791-5 | 0,005 | ||||||
Lead, dross, antimony-rich | 9 | 69029-45-4 | 273-791-5 | 0,05 | 0,05 | |||||
Lead, dross, antimony-rich | 10 | 69029-45-4 | 273-791-5 | 0,5 | ||||||
Lead, dross, antimony-rich | 11 | 69029-45-4 | 273-791-5 | 0,05 | ||||||
Lead, dross, antimony-rich | 12 | 69029-45-4 | 273-791-5 | 0,2 | ||||||
Lead, dross, antimony-rich | 13 | 69029-45-4 | 273-791-5 | 0,0509 | ||||||
Lead, dross, antimony-rich | 14 | 69029-45-4 | 273-791-5 | 1 | ||||||
Lead, dross, antimony-rich | 15 | 69029-45-4 | 273-791-5 | 0,1052 | ||||||
Lead, dross, antimony-rich | 16 | 69029-45-4 | 273-791-5 | 11,17 | ||||||
Lead, dross, antimony-rich | 17 | 69029-45-4 | 273-791-5 | 3,33 | 16,76 | |||||
Lead, dross, bismuth-rich | 1 | 69029-46-5 | 273-792-0 | 0,1 | ||||||
Lead, dross, bismuth-rich | 2 | 69029-46-5 | 273-792-0 | 0,107 | ||||||
Lead, dross, bismuth-rich | 3 | 69029-46-5 | 273-792-0 | 0,004 | ||||||
Lead, dross, bismuth-rich | 4 | 69029-46-5 | 273-792-0 | 5 | ||||||
Lead, dross, bismuth-rich | 5 | 69029-46-5 | 273-792-0 | 0,5 | 5 | |||||
Lead, dross, bismuth-rich | 6 | 69029-46-5 | 273-792-0 | 1 | ||||||
Lead, dross, bismuth-rich | 7 | 69029-46-5 | 273-792-0 | 0,05 | 0,05 | |||||
Lead, dross, bismuth-rich | 8 | 69029-46-5 | 273-792-0 | 0,5 | ||||||
Lead, dross, bismuth-rich | 9 | 69029-46-5 | 273-792-0 | 0,04 | ||||||
Lead, dross, bismuth-rich | 10 | 69029-46-5 | 273-792-0 | 0,0509 | ||||||
Lead, dross, bismuth-rich | 11 | 69029-46-5 | 273-792-0 | 0,1052 | ||||||
Lead, dross, bismuth-rich | 12 | 69029-46-5 | 273-792-0 | 0,05 | ||||||
Lead, dross, bismuth-rich | 13 | 69029-46-5 | 273-792-0 | 11,17 | ||||||
Lead, dross, bismuth-rich | 14 | 69029-46-5 | 273-792-0 | 3 | 16,76 | |||||
Lead, dross, bismuth-rich | 15 | 69029-46-5 | 273-792-0 | 0,005 | ||||||
Lead, dross, copper-rich | 1 | 69227-11-8 | 273-925-2 | 0,05 | 0,05 | |||||
Lead, dross, copper-rich | 2 | 69227-11-8 | 273-925-2 | 0,5 | ||||||
Lead, dross, copper-rich | 3 | 69227-11-8 | 273-925-2 | 0,04 | ||||||
Lead, dross, copper-rich | 4 | 69227-11-8 | 273-925-2 | 0,005 | ||||||
Lead, dross, copper-rich | 5 | 69227-11-8 | 273-925-2 | 0,004 | ||||||
Lead, dross, copper-rich | 6 | 69227-11-8 | 273-925-2 | 1 | ||||||
Lead, dross, copper-rich | 7 | 69227-11-8 | 273-925-2 | 0,5 | ||||||
Lead, dross, copper-rich | 8 | 69227-11-8 | 273-925-2 | 0,004 | ||||||
Lead, dross, copper-rich | 9 | 69227-11-8 | 273-925-2 | 0,1052 | ||||||
Lead, dross, copper-rich | 10 | 69227-11-8 | 273-925-2 | 0,2 | ||||||
Lead, dross, copper-rich | 11 | 69227-11-8 | 273-925-2 | 5 | ||||||
Lead, dross, copper-rich | 12 | 69227-11-8 | 273-925-2 | 11,17 | ||||||
Lead, dross, copper-rich | 13 | 69227-11-8 | 273-925-2 | 0,107 | ||||||
Lead, dross, copper-rich | 14 | 69227-11-8 | 273-925-2 | 0,05 | ||||||
Lead, dross, copper-rich | 15 | 69227-11-8 | 273-925-2 | 0,1 | ||||||
Lead, dross, copper-rich | 16 | 69227-11-8 | 273-925-2 | 0,0509 | ||||||
Lead, dross, copper-rich | 17 | 69227-11-8 | 273-925-2 | 0,02 | ||||||
Lead, dross, copper-rich | 18 | 69227-11-8 | 273-925-2 | 3,33 | 16,76 | |||||
λ²-Lead(2+) ion sulfanylidenezinc sulfanylidene sulfate | 1 | - | 936-276-2 | 0,1 | ||||||
Lecithins, acetylated | 1 | 91053-50-8 | 293-316-5 | 11,75 | ||||||
Lecithins, hydrogenated | 1 | 92128-87-5 | 295-786-7 | 10,6 | ||||||
Lemon, ext. | 1 | 84929-31-7 | 284-515-8 | 23,3 | ||||||
L-Leucine | 1 | 61-90-5 | 200-522-0 | 293,5 | 12920 | |||||
Leucophor 1111X | 1 | - | 700-932-4 | 9,9 | ||||||
LiFePO4 | 1 | 15365-14-7 | 476-700-9 | 4,2 | ||||||
Ligroine | 1 | 8032-32-4 | 232-453-7 | 837,5 | TRGS900 | 536301 | ||||
Ligroine | 2 | 8032-32-4 | 232-453-7 | 837,5 | 1,9 | TRGS900 | 536301 | |||
Ligroine | 3 | 8032-32-4 | 232-453-7 | 840 | TRGS900 | 536301 | ||||
Lime (chemical), hydraulic | 1 | 85117-09-5 | 285-561-1 | 1 | ||||||
Lime (Citrus aurantifolia), ext. | 1 | 90063-52-8 | 290-010-3 | 18,7 | ||||||
D-Limonene | 1 | 5989-27-5 | 227-813-5 | 66,7 | ||||||
L-Limonene | 1 | 5989-54-8 | 227-815-6 | 33,3 | ||||||
Linalyl acetate | 1 | 115-95-7 | 204-116-4 | 2,75 | 32550 | |||||
Linalyl alcohol | 1 | 78-70-6 | 201-134-4 | 2,8 | 32370 | |||||
Linseed oil, epoxidized | 1 | 8016-11-3 | 232-401-3 | 35 | 494865 | |||||
Linseed oil, oxidized | 1 | 68649-95-6 | 272-038-8 | 49 | ||||||
Linseed oil, polymerized | 1 | 67746-08-1 | 614-114-9 | 1,76 | ||||||
Liraglutide precursor | 1 | - | 944-552-9 | 0,26 | ||||||
Lithium | 1 | 7439-93-2 | 231-102-5 | 4,2 | 8010 | |||||
Lithium amide | 1 | 7782-89-0 | 231-968-4 | 10 | ||||||
Lithium 3-((3,4-dicyanophenyl)thio)propane-1-sulfonate | 1 | 769953-18-6 | 700-787-7 | 3,48 | ||||||
Lithium magnesium sodium silicate | 1 | 53320-86-8 | 258-476-2 | 10 | 10 | TRGS900 | MAK | 145082 | ||
Lithium Nickel Cobalt Aluminium Oxide | 1 | 177997-13-6 | 700-042-6 | 0,05 | 0,05 | |||||
Lithium Nickel Cobalt Aluminium Oxide | 2 | 177997-13-6 | 700-042-6 | 0,04 | ||||||
Lithium Nickel Cobalt Aluminium Oxide | 3 | 177997-13-6 | 700-042-6 | 0,0509 | ||||||
Lithium tetrafluoroborate, anhydrous | 1 | 14283-07-9 | 238-178-9 | 0,588 | ||||||
Lithium titanium oxide | 1 | 12031-95-7 | 619-916-2 | 29 | ||||||
Lithium acetate | 1 | 546-89-4 | 208-914-3 | 10 | ||||||
Lithium benzoate | 1 | 553-54-8 | 209-042-6 | 5,6 | ||||||
Lithium bis[ethanedioato(2-)-κO1,κO2]difluorophosphate(1-) | 1 | 678966-16-0 | 695-938-6 | 0,114 | ||||||
Lithium bis(fluorosulfonyl)imide | 1 | 171611-11-3 | 686-526-7 | 2,116 | ||||||
Lithium bis(oxalato)borate | 1 | 244761-29-3 | 456-990-3 | 1,17 | ||||||
Lithium bis(trifluoromethylsulfonyl)imide | 1 | 90076-65-6 | 415-300-0 | 0,24 | 901060 | |||||
Lithium bromide | 1 | 7550-35-8 | 231-439-8 | 3,8 | TRGS900 | MAK | 5780 | |||
Lithium carbonate | 1 | 554-13-2 | 209-062-5 | 10 | TRGS900 | MAK | 5270 | |||
Lithium chloride | 1 | 7447-41-8 | 231-212-3 | 10 | TRGS900 | MAK | 3710 | |||
Lithium cobalt dioxide | 1 | 12190-79-3 | 235-362-0 | 0,0664 | MAK | Carcinogenic | 125431 | |||
Lithium 3-((3,4-dicyanophenyl)sulfonyl)propane-1-sulfonate) | 1 | - | 700-777-2 | 5,9 | ||||||
Lithium dodecyl sulfate | 1 | 2044-56-6 | 218-058-2 | 7,6 | 111559 | |||||
Lithium fluoride | 1 | 7789-24-4 | 232-152-0 | 10 | TRGS900 | MAK | EU | 531227 | ||
Lithium hexafluorophosphate(1-) | 1 | 21324-40-3 | 244-334-7 | 0,931 | 132948 | |||||
Lithium hydroxide | 1 | 1310-65-2 | 215-183-4 | 10 | 5650 | |||||
Lithium neodecanoate | 1 | 27253-30-1 | 248-372-5 | 1,37 | ||||||
Lithium nitrate | 1 | 7790-69-4 | 232-218-9 | 1,4 | 122846 | |||||
Lithium phosphorodifluoridate | 1 | 24389-25-1 | 643-080-8 | 0,132 | ||||||
Lithium sodium 3-(4-(5-Amino-4-sulfonato-2-(3-(2-sulfatoethanesulfonyl)-phenylazo)-phenylamino)-6-cyanoamino-(1,3,5)triazin-2-ylamino)-benzenesulfonate (1:?:?) | 1 | - | 413-090-5 | 43,75 | ||||||
Lithium sufate | 1 | 10377-48-7 | 233-820-4 | 10 | 531067 | |||||
Lithium tetrahydroxyborate | 1 | 12006-96-1 | 818-953-3 | 7,1 | ||||||
Lithol rubine B | 1 | 5858-81-1 | 227-497-9 | 47,3 | 119138 | |||||
Lithol rubine BK | 1 | 5281-04-9 | 226-109-5 | 4,4 | 117973 | |||||
Lithol rubine BK | 2 | 5281-04-9 | 226-109-5 | 16,4 | 117973 | |||||
long chain alkyl thio carbamide metal complex | 1 | - | 457-320-2 | 3,52 | ||||||
Lubricating oils | 1 | 74869-22-0 | 278-012-2 | 5,58 | 2,73 | |||||
Lubricating oils | 2 | 74869-22-0 | 278-012-2 | 5,58 | ||||||
Lubricating oils (petroleum), base oils, paraffinic | 1 | 93572-43-1 | 297-474-6 | 5,6 | 2,7 | |||||
Lubricating oils (petroleum), base oils, paraffinic | 2 | 93572-43-1 | 297-474-6 | 5,6 | ||||||
Lubricating oils (petroleum), C15-30, hydrotreated neutral oil-based | 1 | 72623-86-0 | 276-737-9 | 5,58 | 2,73 | |||||
Lubricating oils (petroleum), C15-30, hydrotreated neutral oil-based | 2 | 72623-86-0 | 276-737-9 | 5,58 | ||||||
Lubricating oils (petroleum), C20-50, hydrotreated neutral oil-based | 1 | 72623-87-1 | 276-738-4 | 5,58 | 2,73 | |||||
Lubricating oils (petroleum), C20-50, hydrotreated neutral oil-based | 2 | 72623-87-1 | 276-738-4 | 5,58 | ||||||
Lubricating oils (petroleum), C20-50, hydrotreated neutral oil-based, high-viscosity | 1 | 72623-85-9 | 276-736-3 | 5,58 | 2,73 | |||||
Lubricating oils (petroleum), C20-50, hydrotreated neutral oil-based, high-viscosity | 2 | 72623-85-9 | 276-736-3 | 5,58 | ||||||
Lubricating oils (petroleum), C18-40, solvent-dewaxed hydrocracked distillate-based | 1 | 94733-15-0 | 305-594-8 | 5,58 | 2,73 | |||||
Lubricating oils (petroleum), C18-40, solvent-dewaxed hydrocracked distillate-based | 2 | 94733-15-0 | 305-594-8 | 5,58 | ||||||
Lubricating oils (petroleum), C>25, solvent-extd., deasphalted, dewaxed, hydrogenated | 1 | 101316-69-2 | 309-874-0 | 5,58 | 2,73 | |||||
Lubricating oils (petroleum), C>25, solvent-extd., deasphalted, dewaxed, hydrogenated | 2 | 101316-69-2 | 309-874-0 | 5,58 | ||||||
Lubricating oils (petroleum), C24-50, solvent-extd., dewaxed, hydrogenated | 1 | 101316-72-7 | 309-877-7 | 5,58 | 2,73 | |||||
Lubricating oils (petroleum), C24-50, solvent-extd., dewaxed, hydrogenated | 2 | 101316-72-7 | 309-877-7 | 5,58 | ||||||
Lubricating oils, used | 1 | 70514-12-4 | 274-635-9 | 5,4 | 5,4 | |||||
Lysine monohydrochloride | 1 | 657-27-2 | 211-519-9 | 67,1 | 106681 | |||||
Magnesium | 1 | 7439-95-4 | 231-104-6 | 10 | 7120 | |||||
Magnesium | 2 | 7439-95-4 | 231-104-6 | 10 | 10 | 7120 | ||||
Magnesium, EDTA cobalt copper iron manganese zinc complexes | 1 | 234446-82-3 | 607-234-8 | 12 | ||||||
Magnesium thiosulphate | 1 | 10124-53-5 | 233-340-5 | 322,3 | ||||||
Magnesium acetate | 1 | 142-72-3 | 205-554-9 | 918,02 | 13060 | |||||
Magnesium acrylate | 1 | 5698-98-6 | 227-177-9 | 14,8 | 14,8 | 118873 | ||||
Magnesium bis(dihydrogenorthophosphate) | 1 | 13092-66-5 | 236-004-6 | 8,14 | 125984 | |||||
Magnesium bis(dinonylnaphthalenesulphonate) | 1 | 28015-99-8 | 248-777-7 | 2,23 | ||||||
Magnesium bis(2-ethylbutanoate) | 1 | - | 421-140-2 | 3,52 | ||||||
Magnesium bis(2-ethylbutanoate) | 2 | - | 421-140-2 | 8,5 | ||||||
Magnesium bisulfite | 1 | 13774-25-9 | 237-403-8 | 222 | 5620 | |||||
Magnesium diethyl dicarbonate | 1 | 16891-37-5 | 240-926-4 | 16,45 | ||||||
Magnesium disodium ethylenediaminetetraacetate | 1 | 14402-88-1 | 238-372-3 | 10 | 30 | 127917 | ||||
Magnesium 2-ethylhexanoate | 1 | 15602-15-0 | 239-685-8 | 0,63 | ||||||
Magnesium fluoride | 1 | 7783-40-6 | 231-995-1 | 24,7 | TRGS900 | MAK | EU | 122706 | ||
Magnesium hexafluorosilicate | 1 | 16949-65-8 | 241-022-2 | 2,5 | 2,5 | 3830 | ||||
Magnesium hydroxide | 1 | 1309-42-8 | 215-170-3 | 117,54 | 1720 | |||||
Magnesium hydroxide sulphate trihydrate | 1 | 12508-61-1 | 483-390-9 | 1,7 | ||||||
Magnesium metaborate | 1 | 13703-82-7 | 237-235-5 | 5,49 | ||||||
Magnesium methanolate | 1 | 109-88-6 | 203-715-8 | 260 | 16,5 | |||||
Magnesium methanolate | 2 | 109-88-6 | 203-715-8 | 260 | 260 | |||||
Magnesium methanolate | 3 | 109-88-6 | 203-715-8 | 16,5 | ||||||
Magnesium neodecanoate | 1 | 57453-97-1 | 260-742-8 | 1,41 | ||||||
Magnesium octadecylbenzenesulphonate | 1 | 31242-17-8 | 250-528-2 | 7,05 | ||||||
Magnesium potassium fluoride silicate | 1 | - | 949-694-5 | 12,3 | ||||||
Magnesium Potassium Titanium oxide | 1 | - | 436-900-9 | 4,2 | ||||||
Magnesium sulfate | 1 | 7487-88-9 | 231-298-2 | 37,6 | 2330 | |||||
Malachite green oxalate | 1 | 18015-76-4 | 241-922-5 | 0,98 | ||||||
Maleic acid | 1 | 110-16-7 | 203-742-5 | 3 | 3 | 14640 | ||||
Maleic anhydride | 1 | 108-31-6 | 203-571-6 | 0,081 | 0,081 | TRGS900 | MAK | 17110 | ||
Maleic anhydride | 3 | 108-31-6 | 203-571-6 | 0,32 | 0,19 | TRGS900 | MAK | 17110 | ||
Malic acid | 1 | 617-48-1 | 210-514-9 | 32 | 5,33 | |||||
Malic acid | 1 | 6915-15-7 | 230-022-8 | 36,6 | 34290 | |||||
Malonic acid | 1 | 141-82-2 | 205-503-0 | 4,2 | 37590 | |||||
Mandarin orange, ext. | 1 | 84929-38-4 | 284-521-0 | 23,3 | ||||||
Manganese, Powder | 1 | 7439-96-5 | 231-105-1 | 0,2 | TRGS900 | MAK | EU | 8200 | ||
Manganese, Powder | 2 | 7439-96-5 | 231-105-1 | 0,0101 | TRGS900 | MAK | EU | 8200 | ||
Manganese, 4-[(5-chloro-4-methyl-2-sulfophenyl)azo]-3-hydroxy-2-naphthalenecarboxylic acid complex | 1 | 5280-66-0 | 226-102-7 | 1,7 | 530195 | |||||
Manganese, 4-[(4-chloro-5-methyl-2-sulfophenyl)azo]-3-hydroxy-2-naphthalenecarboxylic acid complex | 1 | 12238-31-2 | 235-471-3 | 1,7 | 530196 | |||||
Manganese Disodium Ethylenediaminetetraacetate | 1 | 15375-84-5 | 239-407-5 | 10 | 128786 | |||||
Manganese(II) acetate | 1 | 638-38-0 | 211-334-3 | 158 | TRGS900 | MAK | EU | 5030 | ||
Manganese Antimony Titanium buff rutile | 1 | 68412-38-4 | 270-185-2 | 4 | ||||||
Manganese bis(dihydrogen phosphate) | 1 | 18718-07-5 | 242-520-2 | 0,2 | ||||||
Manganese(II) carboante | 1 | 598-62-9 | 209-942-9 | 0,2 | TRGS900 | MAK | EU | 6020 | ||
Manganese(II) chloride | 1 | 7773-01-5 | 231-869-6 | 0,2 | TRGS900 | MAK | EU | 6250 | ||
Manganese dioxide | 1 | 1313-13-9 | 215-202-6 | 0,2 | TRGS900 | MAK | EU | 3240 | ||
Manganese ferrite black spinel | 1 | 68186-94-7 | 269-056-3 | 10 | ||||||
Manganese glycinate, reaction product of manganese sulphate with glycine | 1 | - | 945-591-4 | 0,268 | 4450 | |||||
Manganese neodecanoate | 1 | 27253-32-3 | 248-374-6 | 1,33 | ||||||
Manganese(II) nitrate | 1 | 10377-66-9 | 233-828-8 | 0,2 | TRGS900 | MAK | EU | 124142 | ||
Manganese(II) nitrate | 2 | 10377-66-9 | 233-828-8 | 1 | TRGS900 | MAK | EU | 124142 | ||
Manganese(II)oxide | 1 | 1344-43-0 | 215-695-8 | 0,2 | TRGS900 | MAK | EU | 1530 | ||
Manganese sulfide | 1 | 18820-29-6 | 242-599-3 | 0,2 | TRGS900 | MAK | EU | 131480 | ||
Man-made vitreous (silicate) fibres with random orientation with alkaline oxide and alkali earth oxide (Na2O+K2O+CaO+MgO+BaO) content greater than 18 % by weight | 1 | - | 926-771-1 | 9 | ||||||
Materials for reclaim, precious metal production by-products | 1 | - | 931-663-2 | 0,5 | ||||||
Materials for reclaim, precious metal production by-products | 2 | - | 931-663-2 | 0,005 | ||||||
Materials for reclaim, precious metal production by-products | 3 | - | 931-663-2 | 0,05 | ||||||
Materials for reclaim, precious metal production by-products | 4 | - | 931-663-2 | 0,05 | 0,05 | |||||
Materials for reclaim, Precious Metals in Bricks, Pots, Crucibles and trays, etc. | 1 | - | 931-674-2 | 0,5 | ||||||
Materials for reclaim, Precious Metals in Bricks, Pots, Crucibles and trays, etc. | 2 | - | 931-674-2 | 0,05 | 0,05 | |||||
Matte, copper | 1 | 67711-91-5 | 266-967-8 | 0,05 | 0,05 | |||||
Matte, copper | 2 | 67711-91-5 | 266-967-8 | 0,05 | ||||||
Matte, copper | 3 | 67711-91-5 | 266-967-8 | 0,4 | ||||||
Matte, copper | 4 | 67711-91-5 | 266-967-8 | 0,04 | ||||||
Matte, copper | 5 | 67711-91-5 | 266-967-8 | 0,1 | ||||||
Matte, copper | 6 | 67711-91-5 | 266-967-8 | 0,004 | ||||||
Matte, copper | 7 | 67711-91-5 | 266-967-8 | 5 | ||||||
Matte, copper | 8 | 67711-91-5 | 266-967-8 | 0,005 | ||||||
Matte, copper | 9 | 67711-91-5 | 266-967-8 | 0,5 | ||||||
Matte, lead | 1 | 84195-51-7 | 282-356-9 | 0,107 | ||||||
Matte, lead | 2 | 84195-51-7 | 282-356-9 | 0,004 | ||||||
Matte, lead | 3 | 84195-51-7 | 282-356-9 | 0,004 | ||||||
Matte, lead | 4 | 84195-51-7 | 282-356-9 | 0,04 | ||||||
Matte, lead | 5 | 84195-51-7 | 282-356-9 | 0,02 | ||||||
Matte, lead | 6 | 84195-51-7 | 282-356-9 | 5 | ||||||
Matte, lead | 7 | 84195-51-7 | 282-356-9 | 0,1 | ||||||
Matte, lead | 8 | 84195-51-7 | 282-356-9 | 0,005 | ||||||
Matte, lead | 9 | 84195-51-7 | 282-356-9 | 0,05 | 0,05 | |||||
Matte, lead | 10 | 84195-51-7 | 282-356-9 | 0,5 | ||||||
Matte, lead | 11 | 84195-51-7 | 282-356-9 | 0,05 | ||||||
Matte, lead | 12 | 84195-51-7 | 282-356-9 | 0,2 | ||||||
Matte, lead | 13 | 84195-51-7 | 282-356-9 | 0,0509 | ||||||
Matte, lead | 14 | 84195-51-7 | 282-356-9 | 1 | ||||||
Matte, lead | 15 | 84195-51-7 | 282-356-9 | 0,1052 | ||||||
Matte, lead | 16 | 84195-51-7 | 282-356-9 | 11,17 | ||||||
Matte, lead | 17 | 84195-51-7 | 282-356-9 | 3,33 | 16,76 | |||||
Matte, precious metal | 1 | 98072-52-7 | 308-506-6 | 0,05 | 0,05 | |||||
Matte, precious metal | 2 | 98072-52-7 | 308-506-6 | 0,005 | ||||||
Matte, precious metal | 3 | 98072-52-7 | 308-506-6 | 0,004 | ||||||
Matte, precious metal | 4 | 98072-52-7 | 308-506-6 | 0,5 | ||||||
Mecrilate | 1 | 137-05-3 | 205-275-2 | 9,2 | 11,6 | TRGS900 | MAK | 41150 | ||
Melaleuca alternifolia, extract | 1 | 85085-48-9 | 285-377-1 | 0,658 | ||||||
Melamine cyanurate | 1 | 37640-57-6 | 253-575-7 | 0,21 | 490713 | |||||
Mentha arvensis, ext. | 1 | 90063-97-1 | 290-058-5 | 35,3 | 173076 | |||||
p-Mentha-1,4(8)-diene | 1 | 586-62-9 | 209-578-0 | 3,6 | 510697 | |||||
p-Mentha-1,4(8)-diene | 2 | 586-62-9 | 209-578-0 | 5,88 | 510697 | |||||
p-Mentha-1,4-diene | 1 | 99-85-4 | 202-794-6 | 2,939 | ||||||
p-Mentha-1,3-diene | 1 | 99-86-5 | 202-795-1 | 2,939 | ||||||
Menthane, monohydroperoxy derivative | 1 | 26762-92-5 | 247-987-6 | 0,62 | 135996 | |||||
L-Menthan-3-one | 1 | 14073-97-3 | 237-926-1 | 26,1 | 127555 | |||||
p-Menth-1-en-8-ol | 1 | 10482-56-1 | 233-986-8 | 0,588 | ||||||
Menthol | 1 | 89-78-1 | 201-939-0 | 46,4 | 17330 | |||||
L-Menthol | 1 | 2216-51-5 | 218-690-9 | 10 | 132 | |||||
D-Menthol | 1 | 15356-60-2 | 239-387-8 | 52,5 | 52,5 | |||||
trans-Menthone | 1 | 89-80-5 | 201-941-1 | 39,5 | ||||||
(±)-Menthone | 1 | 1074-95-9 | 214-049-2 | 6,99 | ||||||
L-Menthyl acetate | 1 | 2623-23-6 | 220-076-0 | 33,6 | ||||||
Menthyl acetate | 1 | 89-48-5 | 201-911-8 | 33,6 | 101009 | |||||
Mequinol | 1 | 150-76-5 | 205-769-8 | 3 | 23690 | |||||
2-Mercaptobenzimidazole | 1 | 583-39-1 | 209-502-6 | 0,352 | 15000 | |||||
2-Mercaptoethanol | 1 | 60-24-2 | 200-464-6 | 0,17 | 28910 | |||||
2-Mercaptopropionic acid | 1 | 79-42-5 | 201-206-5 | 0,49 | 492422 | |||||
3-Mercaptopropionic acid | 1 | 107-96-0 | 203-537-0 | 2,08 | 492709 | |||||
Mercury | 1 | 7439-97-6 | 231-106-7 | 0,02 | TRGS900 | MAK | EU | 8490 | ||
Mesityl oxide | 1 | 141-79-7 | 205-502-5 | 20,4 | 20,4 | TRGS900 | MAK | 28920 | ||
4-Mesyl-2-nitrotoluene | 1 | 1671-49-4 | 430-550-0 | 0,53 | 535845 | |||||
Metformin hydrochloride | 1 | 1115-70-4 | 214-230-6 | 3,81 | ||||||
Methacrylamide | 1 | 79-39-0 | 201-202-3 | 2,54 | 7,89 | 14340 | ||||
Methacrylic acid | 1 | 79-41-4 | 201-204-4 | 88 | 29,6 | TRGS900 | MAK | 14310 | ||
Methacrylic acid, monoester with propane-1,2-diol | 1 | 27813-02-1 | 248-666-3 | 14,7 | 531357 | |||||
Methacrylic acid anhydride | 1 | 760-93-0 | 212-084-8 | 78,8 | 26,5 | 490284 | ||||
Methacrylonitrile | 1 | 126-98-7 | 204-817-5 | 1,26 | 510282 | |||||
Methanal, reaction products with 1,3-bis(aminomethyl)benzene and hydroxybenzen | 1 | 1950616-36-0 | 701-207-5 | 0,6 | 0,02 | |||||
Methanaminium N,N,N-trimethyl-, salt with 2,2-Dimethylpropanoic acid | 1 | - | 478-310-4 | 0,7 | ||||||
Methanesulfonic acid | 1 | 75-75-2 | 200-898-6 | 0,7 | 6,76 | TRGS900 | 36430 | |||
4-[2-Methanesulfonyl-4-(trifluoromethyl)benzoyl]-1,3-dimethyl-1H-pyrazol-5-ol | 1 | 365400-11-9 | 609-256-3 | 0,099 | ||||||
Methanethiol | 1 | 74-93-1 | 200-822-1 | 0,76 | TRGS900 | MAK | 16100 | |||
Methanol | 1 | 67-56-1 | 200-659-6 | 130 | 130 | TRGS900 | MAK | EU | 11240 | |
4,7-Methanooctahydro-1H-indene-diyldimethylbis(cyclohexane-1,2-dicarboxylate) | 1 | - | 407-410-2 | 1,47 | 900843 | |||||
Methansulfonic acid (1,6-hexanediyl-diimino)bis[1-oxo, disodium salt | 1 | 38632-47-2 | 690-526-2 | 10 | ||||||
Methionine | 1 | 63-68-3 | 200-562-9 | 110,4 | 27240 | |||||
Methomyl | 1 | 16752-77-5 | 240-815-0 | 0,11 | 510284 | |||||
4'-Methoxyacetophenone | 1 | 100-06-1 | 202-815-9 | 4,937 | ||||||
p-Methoxybenzyl acetate | 1 | 104-21-2 | 203-185-8 | 2,468 | ||||||
4-Methoxybenzyl alcohol | 1 | 105-13-5 | 203-273-6 | 2,468 | 492673 | |||||
4-Methoxybenzyl alcohol | 2 | 105-13-5 | 203-273-6 | 4,93 | 492673 | |||||
2-[(Methoxycarbonyl)amino]-3,3-dimethylbutanoic acid | 1 | - | 431-620-3 | 7,3 | ||||||
[2-((N-Methoxycarbonyl)phenylamino)phenyl] acetic acid | 1 | - | 439-530-6 | 7,4 | ||||||
3-Methoxy-N,N-dimethylpropionamide | 1 | 53185-52-7 | 258-420-7 | 2,45 | ||||||
2-Methoxyethanol | 1 | 109-86-4 | 203-713-7 | 0,31 | TRGS900 | MAK | EU | 10630 | ||
2-(2-Methoxyethoxy)ethanol | 1 | 111-77-3 | 203-906-6 | 50,1 | TRGS900 | EU | 20530 | |||
9-[2-(2-Methoxyethoxy)ethoxy]-9-[3-(oxiranylmethoxy)propyl]-2,5,8,10,13,16-hexaoxa-9-silaheptadecane | 1 | 88127-84-8 | 289-390-3 | 8,82 | ||||||
2-Methoxyethyl methacrylate | 1 | 6976-93-8 | 230-241-9 | 3,52 | ||||||
2-Methoxyethyl acrylate | 1 | 3121-61-7 | 221-499-3 | 0,12 | 114227 | |||||
(2-Methoxyethyl)benzene | 1 | 3558-60-9 | 222-619-7 | 49,3 | 115135 | |||||
3-Methoxy-3-methylbutan-1-ol | 1 | 56539-66-3 | 260-252-4 | 18 | 495842 | |||||
3-Methoxy-3-methylbutyl acetate | 1 | 103429-90-9 | 700-408-5 | 2,47 | ||||||
2-Methoxy-1-methylethyl acetate | 1 | 108-65-6 | 203-603-9 | 275 | TRGS900 | MAK | EU | 510715 | ||
2-Methoxy-4-methylphenyl methyl carbonate | 1 | 132638-45-0 | 700-673-7 | 7,64 | ||||||
2-Methoxynaphthalene | 1 | 93-04-9 | 202-213-6 | 0,822 | 25550 | |||||
1-(6-Methoxy-2-naphthyl)ethan-1-one | 1 | 3900-45-6 | 223-453-8 | 1,751 | 115809 | |||||
2-[(2-Methoxy-4-nitrophenyl)azo]-N-(2-methoxyphenyl)-3-oxobutyramide | 1 | 6358-31-2 | 228-768-4 | 3 | 49 | 491455 | ||||
4-[[2-Methoxy-4-[(4-nitrophenyl)azo]phenyl]azo]phenol | 1 | 19800-42-1 | 243-325-5 | 0,56 | ||||||
2-Methoxyphenol, reaction products with 2,2-dimethyl-3-methylenebicyclo[2.2.1]heptane, hydrogenated | 1 | 70955-71-4 | 275-062-7 | 1,16 | ||||||
4-Methoxyphenylacetic acid | 1 | 104-01-8 | 203-166-4 | 73 | ||||||
Bis-[[2-(4-Methoxy-phenylazo)-1-hydroxy-naphtalene-6-ylamino]-fluoroheteromonocyclylamino]- methylalkan polysulfonate Na/K-salt | 1 | - | 413-970-9 | 0,59 | ||||||
4-(4-Methoxyphenyl)butan-2-one | 1 | 104-20-1 | 203-184-2 | 12,34 | ||||||
2-[[(4-Methoxyphenyl)methylhydrazono]methyl]-1,3,3-trimethyl-3H-indolium acetate | 1 | 58798-47-3 | 261-448-2 | 1,12 | ||||||
2-[[(4-Methoxyphenyl)methylhydrazono]methyl]-1,3,3-trimethyl-3H-indolium acetate | 2 | 58798-47-3 | 261-448-2 | 28 | ||||||
2-[[(4-Methoxyphenyl)methylhydrazono]methyl]-1,3,3-trimethyl-3H-indolium methyl sulphate | 1 | 54060-92-3 | 258-946-7 | 1,12 | ||||||
3-(p-Methoxyphenyl)-2-methylpropionaldehyde | 1 | 5462-06-6 | 226-749-5 | 6,35 | ||||||
2,2'-[6-(4-Methoxyphenyl)-1,3,5-triazine-2,4-diyl]bis{5-[(2-ethylhexyl)oxy]phenol} | 1 | 187393-00-6 | 425-950-7 | 10 | ||||||
1-Methoxy-2-propanol | 1 | 107-98-2 | 203-539-1 | 369 | TRGS900 | MAK | EU | 71430 | ||
(E)-2-Methoxy-4-(1-propenyl)phenol | 1 | 5932-68-3 | 227-678-2 | 6 | 119284 | |||||
(E)-2-Methoxy-4-prop-1-en-1-ylphenyl acetate | 1 | 5912-87-8 | 813-782-0 | 7,54 | ||||||
3-Methoxypropylamine | 1 | 5332-73-0 | 226-241-3 | 8,82 | 28960 | |||||
2-Methoxy-4-propylphenol | 1 | 2785-87-7 | 220-499-0 | 6,07 | ||||||
Methyl dihydrojasmonate | 1 | 24851-98-7 | 246-495-9 | 29,3 | 134785 | |||||
Methyl N-{[dimethoxy(methyl)silyl]methyl}carbamate | 1 | 23432-65-7 | 457-690-5 | 1,1 | ||||||
Methyl N-{[dimethoxy(methyl)silyl]methyl}carbamate | 2 | 23432-65-7 | 457-690-5 | 260 | 260 | |||||
Methyl acetate | 1 | 79-20-9 | 201-185-2 | 620 | 300 | TRGS900 | MAK | 13310 | ||
Methyl acetoacetate | 1 | 105-45-3 | 203-299-8 | 29,167 | 33960 | |||||
4'-Methylacetophenone | 1 | 122-00-9 | 204-514-8 | 20,36 | 492845 | |||||
Methyl-N-(3-acetylamino)-4-(2-cyano-4-nitrophenylazo)phenyl)-N-((1-methoxy)acetyl)-glycinate | 1 | 149850-30-6 | 413-040-2 | 1,16 | 901296 | |||||
Methyl acrylate | 1 | 96-33-3 | 202-500-6 | 18 | TRGS900 | MAK | EU | 13020 | ||
Methylamine anhydrous | 1 | 74-89-5 | 200-820-0 | 0,427 | 0,72 | TRGS900 | MAK | 16060 | ||
Methyl 2-aminobenzoate | 1 | 134-20-3 | 205-132-4 | 5,28 | 32560 | |||||
2-Methylaminoethanol | 1 | 109-83-1 | 203-710-0 | 9,2 | 9,2 | 18020 | ||||
2-(Methylamino)ethanol, compound with sulfur dioxide | 1 | 21049-70-7 | 244-169-0 | 3 | 3 | |||||
N-Methylaniline | 1 | 100-61-8 | 202-870-9 | 0,0495 | TRGS900 | MAK | 15170 | |||
4-Methylanisole | 1 | 104-93-8 | 203-253-7 | 1,64 | 492668 | |||||
4-Methylanisole | 2 | 104-93-8 | 203-253-7 | 2,9 | 492668 | |||||
2-Methylanthraquinone | 1 | 84-54-8 | 201-539-6 | 49,8 | ||||||
Methyl benzoate | 1 | 93-58-3 | 202-259-7 | 39,3 | 27280 | |||||
α-Methyl-1,3-benzodioxole-5-propionaldehyde | 1 | 1205-17-0 | 214-881-6 | 1,2 | ||||||
3-Methylbenzoic acid | 1 | 99-04-7 | 202-723-9 | 1,18 | 492590 | |||||
4-Methylbenzophenone | 1 | 134-84-9 | 205-159-1 | 0,7 | ||||||
Methyl-1H-benzotriazole | 1 | 29385-43-1 | 249-596-6 | 8,8 | 491063 | |||||
Methyl 2-benzoylbenzoate | 1 | 606-28-0 | 210-112-3 | 0,367 | ||||||
6-Methyl-2,4-bis(methylthio)phenylene-1,3-diamine | 1 | 106264-79-3 | 403-240-8 | 3,4 | 900310 | |||||
4-Methyl-2,6-bis-p-tolylamino-5-(2-trifluoromethyl-phenylazo)-nicotinonitrile | 1 | 669005-94-1 | 444-370-5 | 3 | 98 | |||||
Methyl N-[4-[(2-bromo-6-chloro-4-nitrophenyl)azo]phenyl]-N-(3-methoxy-3-oxopropyl)-β-alaninate | 1 | 59709-38-5 | 261-874-9 | 4,11 | ||||||
3-Methyl-1,3-butandiol | 1 | - | 459-270-7 | 16,4 | ||||||
2-Methylbutane | 1 | 78-78-4 | 201-142-8 | 3000 | TRGS900 | MAK | EU | 30860 | ||
3-Methyl-1-butanol | 1 | 123-51-3 | 204-633-5 | 73,16 | TRGS900 | MAK | EU | 29140 | ||
2-Methyl-1-butanol | 1 | 137-32-6 | 205-289-9 | 73,16 | TRGS900 | MAK | 510043 | |||
2-Methyl-2-butanol | 1 | 75-85-4 | 200-908-9 | 267,8 | 17,2 | TRGS900 | MAK | 510287 | ||
3-Methylbut-3-en-1-ol | 1 | 763-32-6 | 212-110-8 | 0,274 | 493692 | |||||
3-Methyl-2-butenyl acetate | 1 | 1191-16-8 | 214-730-4 | 5,77 | 109023 | |||||
2-Methylbutyl acrylate | 1 | 44914-03-6 | 256-170-3 | 3,3 | 12,8 | 143051 | ||||
2-Methyl-3-butyn-2-ol | 1 | 115-19-5 | 204-070-5 | 3,2 | 3,2 | TRGS900 | 492799 | |||
Methyl chloride | 1 | 74-87-3 | 200-817-4 | 12,5 | TRGS900 | MAK | EU | 11220 | ||
Methylchlorosilane | 1 | 993-00-0 | 213-600-4 | 17,7 | 62 | 491001 | ||||
Methyl cinnamate | 1 | 103-26-4 | 203-093-8 | 28,2 | 492642 | |||||
3-Methylcrotonaldehyde | 1 | 107-86-8 | 203-527-6 | 3 | 3 | 492707 | ||||
Methylcyclohexane | 1 | 108-87-2 | 203-624-3 | 64,3 | TRGS900 | MAK | 30950 | |||
4-Methylcyclohexanone | 1 | 589-92-4 | 209-665-3 | 2,47 | 493343 | |||||
2-(4-Methylcyclohex-3-en-1-yl)propan-2-ol | 1 | - | 701-188-3 | 44,8 | ||||||
2-[2-(4-Methyl-3-cyclohexen-1-yl)propyl]cyclopentanone | 1 | 95962-14-4 | 404-240-0 | 4,51 | 900406 | |||||
2-[2-(4-Methyl-3-cyclohexen-1-yl)propyl]cyclopentanone | 2 | 95962-14-4 | 404-240-0 | 1,4 | 900406 | |||||
2-Methylcyclohexyl acetate | 1 | 5726-19-2 | 227-231-1 | 26,44 | 118918 | |||||
Methyl cyclopentadienyl manganese tricarbonyl | 1 | 12108-13-3 | 235-166-5 | 0,6 | 125264 | |||||
Methyl decanoate | 1 | 110-42-9 | 203-766-6 | 61,4 | 491979 | |||||
4-Methyl-3-decen-5-ol | 1 | 81782-77-6 | 279-815-0 | 88,16 | 98,7 | 163960 | ||||
Methyl 3-alpha,7-alpha-diacetoxy-12-alpha-hydroxy-5-beta-cholan-24-oate | 1 | 3749-87-9 | 223-151-6 | 9,8 | 115569 | |||||
Methyldiacetoxyisopropoxy silane | 1 | - | 442-070-9 | 5,29 | ||||||
Methyl 3-alpha,7-alpha-diacetoxy-12-oxo-5-beta-cholan-24-oate | 1 | 28535-81-1 | 249-070-6 | 9,8 | ||||||
N-Methyldicyclohexylamine | 1 | 7560-83-0 | 231-453-4 | 0,7 | 122367 | |||||
N-Methyldiethanolamine | 1 | 105-59-9 | 203-312-7 | 7,9 | 23610 | |||||
Methyl dihydrogen phosphate | 1 | 812-00-0 | 212-379-1 | 7,4 | ||||||
3-Methyl-1,1-diphenylurea | 1 | 13114-72-2 | 236-039-7 | 4,114 | ||||||
11-Methyldodecyl laurate | 1 | 94134-83-5 | 302-853-7 | 2,47 | ||||||
2,2'-Methylenebis(6-(2H-benzotriazol-2-yl)-4-(1,1,3,3-tetra-methylbutyl)phenol) | 1 | 103597-45-1 | 403-800-1 | 23,5 | 530625 | |||||
2,2'-Methylenebis(6-(2H-benzotriazol-2-yl)-4-(1,1,3,3-tetra-methylbutyl)phenol) | 2 | 103597-45-1 | 403-800-1 | 21,16 | 530625 | |||||
4,4'-Methylenebis[N,N-bis(2,3-epoxypropyl)aniline] | 1 | 28768-32-3 | 249-204-3 | 3,5 | 137017 | |||||
4,4'-Methylenebis[N-sec-butylaniline] | 1 | 5285-60-9 | 226-122-6 | 7,3 | ||||||
4,4'-Methylenebis(N-sec-butylcyclohexamine) | 1 | 154279-60-4 | 679-514-8 | 0,12 | ||||||
4,4'-Methylenebiscyclohexylamine | 1 | 1761-71-3 | 217-168-8 | 1 | 570053 | |||||
4,4'-Methylenebiscyclohexylamine | 2 | 1761-71-3 | 217-168-8 | 0,9 | 570053 | |||||
2,2'-Methylenebis(6-cyclohexyl-p-cresol) | 1 | 4066-02-8 | 223-773-8 | 8,22 | 16200 | |||||
4,4'-Methylenebis(2,6-di-tert-butylphenol) | 1 | 118-82-1 | 204-279-1 | 1 | 31010 | |||||
2,2'-Methylenebis(4,6-di-tert-butyl-phenyl)-2-ethylhexyl phosphite | 1 | 126050-54-2 | 418-310-3 | 130 | 903976 | |||||
4,4'-Methylenebis[2,6-diethylaniline] | 1 | 13680-35-8 | 237-185-4 | 0,083 | ||||||
N,N''-Methylenebis[N'-[3-(hydroxymethyl)-2,5-dioxoimidazolidin-4-yl]urea] | 1 | 39236-46-9 | 254-372-6 | 24,5 | 141466 | |||||
1,1'-Methylenebis(2-isocyanatobenzene) | 1 | 2536-05-2 | 219-799-4 | 0,05 | TRGS900 | 510426 | ||||
1,1'-Methylenebis(4-isocyanatobenzene) and oligomeric reaction products of 1,1'-methylenebis(4-isocyanatobenzene) and oxydipropanol and oligomerization reaction products of oxydipropanol | 1 | - | 701-041-3 | 0,05 | ||||||
1'-Methylenebis(4-isocyanatobenzene) and oligomeric reaction products with 1,1'-[Propane-1,2-diylbis(oxy)]dipropan-1-ol and 1,1-Oxydi-2-propanol | 1 | - | 701-072-2 | 0,05 | ||||||
2,2'-Methylenebis(4-methyl-6-tert-butylphenol) | 1 | 119-47-1 | 204-327-1 | 1,25 | 16190 | |||||
2,2'-Methylenebis[6-(1-methylcyclohexyl)-p-cresol] | 1 | 77-62-3 | 201-044-5 | 32,9 | ||||||
3,3'-Methylenebis[5-methyloxazolidine] | 1 | 66204-44-2 | 266-235-8 | 0,12 | 1,45 | 151907 | ||||
2,2'-Methylenebis(6-nonyl-p-cresol) | 1 | 7786-17-6 | 232-092-5 | 2,8 | ||||||
3,3'-(Methylenebis(oxymethylene))bisheptane | 1 | 22174-70-5 | 244-815-1 | 0,34 | 133354 | |||||
1,1'-Methylenebis(4-isocyanatobenzene) and its oligomeric reaction products with [(methylethylene)bis(oxy)]dipropanol | 1 | - | 701-124-4 | 0,05 | ||||||
Methylene chloride | 1 | 75-09-2 | 200-838-9 | 176 | TRGS900 | MAK | EU | 12630 | ||
4,4'-Methylenedi(cyclohexyl isocyanate) | 1 | 5124-30-1 | 225-863-2 | 0,3 | 510170 | |||||
Methylenediphenyl diisocyanate | 1 | - | 905-806-4 | 0,05 | ||||||
4,4'-Methylenediphenyldiisocyanate and 2,4'-Diisocyanatodiphenylmethane and their oligomerisation reaction products with 2,2'-Oxydiethanol, propane-1,2-diol and Butane-1,3-diol | 1 | - | 701-276-1 | 0,05 | ||||||
4,4'-Methylenediphenyl diisocyanate, oligomeric reaction products with Butane-1,3-diol, 2,4'-diisocyanatodiphenylmethane, 1,1'-methylenebis(4-isocyanatobenzene) homopolymer, [(methylethylene)bis(oxy)]dipropanol and Propane-1,2-diol | 1 | - | 500-313-7 | 0,05 | ||||||
Methylenediphenyl diisocyanate, oligomers (Polyisocyanurate-type) | 1 | 109331-54-6 | 500-297-1 | 0,05 | ||||||
Methylenediphenyl diisocyanate, oligomers, reaction products with 2-Ethylhexan-l-ol | 1 | - | 700-674-2 | 0,05 | 0,05 | |||||
N,N'-(Methylenedi-p-phenylene)bis[hexahydro-2-oxo-1H-azepine-1-carboxamide] | 1 | 54112-23-1 | 258-981-8 | 32,9 | 145523 | |||||
N,N''-(Methylenedi-4,1-phenylene)bis(N'-octyl)urea | 1 | - | 445-760-8 | 44 | 535972 | |||||
4,4'-Methylenedi-2,6-xylenol | 1 | 5384-21-4 | 226-378-9 | 16,4 | ||||||
Methylenesuccinic acid | 1 | 97-65-4 | 202-599-6 | 22,05 | 39850 | |||||
Methyl ester of fatty acids, Cx-Cy, Hydroxymethylated | 1 | - | 23,5 | |||||||
(1-Methyl-1,2-ethanediyl)bis(oxy(methyl-2,1-ethanediyl))diacrylate | 1 | 42978-66-5 | 256-032-2 | 2,35 | 491625 | |||||
(1-Methylethyl)benzenesulfonic acid, sodium salt | 1 | 28348-53-0 | 248-983-7 | 4,02 | 4,02 | 492187 | ||||
(1-Methylethyl)-1,1'-biphenyl | 1 | 25640-78-2 | 247-156-8 | 7,05 | ||||||
(1-Methylethyl)cyclohexane | 1 | 696-29-7 | 211-792-4 | 32,4 | 40800 | |||||
2,2'-[(1-Methylethylidene)bis[(2,6-dibromo-4,1-phenylene)oxymethylene]]bisoxirane | 1 | 3072-84-2 | 221-346-0 | 7 | ||||||
(1-Methylethylidene)di-4,1-phenylenetetraphenyl diphosphate | 1 | 5945-33-5 | 425-220-8 | 19,5 | 535635 | |||||
(1-Methylethylidene)di-4,1-phenylenetetraphenyl diphosphate | 2 | 5945-33-5 | 425-220-8 | 11,75 | 535635 | |||||
(1-Methylethylidene)di-4,1-phenylenetetraphenyl diphosphate | 3 | 5945-33-5 | 425-220-8 | 16,4 | 535635 | |||||
Methylethylketone peroxide trimer | 1 | 24748-23-0 | 429-320-2 | 1,8 | 535958 | |||||
Methyl 2-fluoroprop-2-enoate | 1 | 2343-89-7 | 607-233-2 | 0,035 | ||||||
N-Methylformanilide | 1 | 93-61-8 | 202-262-3 | 11,1 | 20390 | |||||
Methyl formate | 1 | 107-31-3 | 203-481-7 | 120 | 120 | TRGS900 | MAK | EU | 29040 | |
Methyl α-D-glucoside | 1 | 97-30-3 | 202-571-3 | 8,2 | ||||||
5-Methylheptan-3-one | 1 | 541-85-5 | 208-793-7 | 10,759 | TRGS900 | MAK | EU | 37630 | ||
5-Methylheptan-3-one oxime | 1 | 22457-23-4 | 245-010-8 | 176,32 | 70,53 | |||||
6-Methyl-5-hepten-2-one | 1 | 110-93-0 | 203-816-7 | 29,39 | 29060 | |||||
5-Methylhexan-2-one | 1 | 110-12-3 | 203-737-8 | 100,25 | TRGS900 | MAK | EU | 21750 | ||
Methyl 2-hexyl-3-oxocyclopentanecarboxylate | 1 | 37172-53-5 | 253-379-1 | 4,937 | ||||||
2-Methylhydroquinone | 1 | 95-71-6 | 202-443-7 | 3,16 | 490114 | |||||
Methyl 4-hydroxybenzoate | 1 | 99-76-3 | 202-785-7 | 58,76 | 25810 | |||||
Methyl 12-hydroxyoctadecanoate | 1 | 141-23-1 | 205-471-8 | 296 | ||||||
2-Methylimidazole | 1 | 693-98-1 | 211-765-7 | 0,3 | 27140 | |||||
1-Methylimidazole | 1 | 616-47-7 | 210-484-7 | 7,9 | 570004 | |||||
1,1'-(Methylimino)bis-2-propanol | 1 | 4402-30-6 | 224-536-1 | 9,6 | 13100 | |||||
N,N'-[(Methylimino)bis(trimethylene)]bis(stearamide) | 1 | 13483-58-4 | 236-793-7 | 16,4 | ||||||
N,N'-[(Methylimino)dipropane-1,3-diyl]dioleamide | 1 | 45320-65-8 | 256-233-5 | 16,4 | ||||||
Methyl iodide | 1 | 74-88-4 | 200-819-5 | 4,64 | 1,2 | 28110 | ||||
Methylionone | 1 | 1335-46-2 | 215-635-0 | 26,1 | 109688 | |||||
N-Methylisopropylamine | 1 | 4747-21-1 | 225-266-7 | 4 | 117285 | |||||
Methyl isopropyl ketone | 1 | 563-80-4 | 209-264-3 | 265,52 | 23380 | |||||
2-Methyl-4-isothiazolin-3-one | 1 | 2682-20-4 | 220-239-6 | 0,021 | 570030 | |||||
Methyl isothiocyanate | 1 | 556-61-6 | 209-132-5 | 0,65 | 0,13 | 34230 | ||||
Methyl-(+)-lactate | 1 | 17392-83-5 | 241-420-6 | 3,2 | 1,6 | |||||
Methyl-(-)-lactate | 1 | 27871-49-4 | 248-704-9 | 3,2 | 1,6 | |||||
Methyl methacrylate | 1 | 80-62-6 | 201-297-1 | 208 | 348,4 | TRGS900 | MAK | EU | 13350 | |
Methyl N-methylanthranilate | 1 | 85-91-6 | 201-642-6 | 12 | ||||||
Methyl N-methylanthranilate | 2 | 85-91-6 | 201-642-6 | 9,442 | ||||||
β-Methyl-3-(1-methylethyl)benzenepropanal | 1 | 125109-85-5 | 412-050-4 | 8,82 | 4,93 | 900903 | ||||
3-[[5-Methyl-2-(1-methylethyl)cyclohexyl]oxy]propane-1,2-diol | 1 | 87061-04-9 | 289-296-2 | 0,98 | ||||||
1-[[2-Methyl-4-[(2-methylphenyl)azo]phenyl]azo]-N-tridecylnaphthalen-2-amine | 1 | 57712-94-4 | 260-913-7 | 1,75 | ||||||
2-Methyl-1-(4-methylthiophenyl)-2-morpholinopropan-1-one | 1 | 71868-10-5 | 400-600-6 | 2,82 | 530358 | |||||
2-Methyl-1-(4-methylthiophenyl)-2-morpholinopropan-1-one | 2 | 71868-10-5 | 400-600-6 | 0,32 | 530358 | |||||
4-Methyl morpholine | 1 | 109-02-4 | 203-640-0 | 1,3 | 24290 | |||||
4-Methylmorpholine N-oxide | 1 | 7529-22-8 | 231-391-8 | 3,53 | 29090 | |||||
4-Methylmorpholine N-oxide | 2 | 7529-22-8 | 231-391-8 | 1,96 | 29090 | |||||
Methyl myristate | 1 | 124-10-7 | 204-680-1 | 79,69 | 492873 | |||||
Methyl 5-nitrohydrogen isophthalate | 1 | 1955-46-0 | 217-793-6 | 12,1 | 494116 | |||||
2-[Methyl[(nonafluorobutyl)sulphonyl]amino]ethyl methacrylate | 1 | 67584-59-2 | 266-737-7 | 3,5 | ||||||
2-[Methyl[(nonafluorobutyl)sulphonyl]amino]ethyl acrylate | 1 | 67584-55-8 | 266-733-5 | 3,5 | ||||||
2-Methyloctane-1,8-diamine | 1 | 148528-05-6 | 700-111-0 | 0,71 | ||||||
6-Methyl-1,2,3-oxathiazin-4(3H)-one 2,2-dioxide, potassium salt | 1 | 55589-62-3 | 259-715-3 | 450 | 146162 | |||||
6-Methyl-2-oxoperhydropyrimidin-4-ylurea | 1 | 1129-42-6 | 214-447-6 | 117,11 | 27830 | |||||
2-Methyl-1-oxoprop-2-en-1-aminium C10-C13 alkyl benzenesulfonate | 1 | 1024700-50-2 | 688-489-2 | 5,29 | ||||||
Methylpentane | 1 | 43133-95-5 | 639-864-4 | 5306 | ||||||
2-Methylpentane-1,5-diamine | 1 | 15520-10-2 | 239-556-6 | 0,25 | 128918 | |||||
3-Methyl-1,5-pentanediol | 1 | 4457-71-0 | 224-709-1 | 14,7 | 116825 | |||||
2-Methylpentane-2,4-diol | 1 | 107-41-5 | 203-489-0 | 49 | 44,4 | MAK | 37280 | |||
3-Methyl-1,5-pentanediyl diacrylate | 1 | 64194-22-5 | 264-727-7 | 14,81 | ||||||
4-Methylpentan-2-ol | 1 | 108-11-2 | 203-551-7 | 83 | 83 | TRGS900 | MAK | 32210 | ||
4-Methylpentan-2-one | 1 | 108-10-1 | 203-550-1 | 83 | 83 | TRGS900 | MAK | EU | 10780 | |
2-(4-Methyl-3-pentenyl)anthraquinone | 1 | 71308-16-2 | 428-320-1 | 0,37 | 535709 | |||||
3-Methyl-2-pent-2-enylcyclopent-2-enone | 1 | 488-10-8 | 207-668-4 | 4,514 | ||||||
Methyl phenylacetate | 1 | 101-41-7 | 202-940-9 | 4,9 | 32950 | |||||
Methyl phenylacetate | 2 | 101-41-7 | 202-940-9 | 27,4 | 32950 | |||||
(2E)-2-Methyl-3-phenylacrylaldehyde | 1 | 15174-47-7 | 701-219-0 | 13,3 | 13,3 | |||||
2-Methyl-4-phenylbutan-2-ol | 1 | 103-05-9 | 203-074-4 | 2,19 | ||||||
8-[4-(4-Methylphenyl)-3-cyclohexen-1-yl]-1,4-dioxaspiro[4.5]decane | 1 | 125962-78-9 | 603-101-3 | 0,548 | ||||||
1,1'-(4-Methyl-1,3-phenylene)bis-1H-pyrrole-2,5-dione | 1 | 6422-83-9 | 229-175-3 | 1,64 | ||||||
2-Methyl-p-phenylenediamine | 1 | 95-70-5 | 202-442-1 | 0,27 | 11770 | |||||
2-Methyl-1,4-phenylenediammonium sulfate | 1 | 615-50-9 | 210-431-8 | 0,49 | 22690 | |||||
4-(1-Methyl-1-phenylethyl)-N-[4-(1-methyl-1-phenylethyl)phenyl]aniline | 1 | 10081-67-1 | 233-215-5 | 7,05 | 123653 | |||||
1-Methyl-1-phenylethyl peroxyneodecanoate | 1 | 26748-47-0 | 247-956-7 | 4,93 | ||||||
2,2'-[(4-Methylphenyl)imino]bisethanol | 1 | 3077-12-1 | 221-359-1 | 3,29 | 19830 | |||||
3-Methyl-5-phenylpentanol | 1 | 55066-48-3 | 259-461-3 | 0,88 | 145944 | |||||
4-Methyl-4-phenylpentan-2-ol | 1 | 2035-93-0 | 218-002-7 | 4,7 | ||||||
3-Methyl-5-phenylpent-2-enenitrile | 1 | 93893-89-1 | 299-682-2 | 0,588 | ||||||
2-Methyl-1-phenylpropan-2-ol | 1 | 100-86-7 | 202-896-0 | 2,19 | ||||||
4-Methyl-1-phenyl-3-pyrazolidone | 1 | 2654-57-1 | 220-180-6 | 1,48 | ||||||
6-[[(4-Methylphenyl)sufonyl]amino]hexanoic acid | 1 | 78521-39-8 | 278-934-5 | 28 | 163170 | |||||
4-(4-Methylphenylthio)benzophenone | 1 | 83846-85-9 | 281-064-9 | 21,16 | ||||||
1-Methylpiperazine | 1 | 109-01-3 | 203-639-5 | 0,015 | 1,08 | 70010 | ||||
1-Methylpiperidin-4-ol | 1 | 106-52-5 | 203-406-8 | 15 | ||||||
2-Methyl-2-propanethiol | 1 | 75-66-1 | 200-890-2 | 18,6 | 14,5 | MAK | 491187 | |||
2-Methyl-2-propanol | 1 | 75-65-0 | 200-889-7 | 2,7 | TRGS900 | MAK | 12730 | |||
2-Methyl-1-propanol | 1 | 78-83-1 | 201-148-0 | 310 | TRGS900 | MAK | 15690 | |||
4,4',4''-(1-Methylpropanyl-3-ylidene)tris[6-tert-butyl-m-cresol] | 1 | 1843-03-4 | 217-420-7 | 3,53 | 494098 | |||||
2-[2-[2-[2-(1-Methyl-2-prop-2-enoyloxy-ethoxy)ethoxymethyl]-2-[2-(2-prop-2-enoyloxypropoxy)ethoxymethyl]butoxy]ethoxy]propyl prop-2-enoate | 1 | 118800-30-9 | 601-566-7 | 26,6 | ||||||
N-[(2-Methylpropoxy)methyl]acrylamide | 1 | 16669-59-3 | 240-715-7 | 8,49 | ||||||
2-[(1-Methylpropyl)amino]ethanol | 1 | 35265-04-4 | 252-471-9 | 0,84 | 0,6 | 139814 | ||||
1-Methyl-4-[(trans,trans)-4'-propyl[1,1'-bicyclohexyl]-4-yl] -benzene | 1 | 84656-75-7 | 617-606-1 | 0,37 | ||||||
(1-Methylpropylidene)bis[tert-butyl] peroxide | 1 | 13653-62-8 | 237-136-7 | 3,7 | ||||||
2,2'-(2-Methylpropylidene)bis[4,6-xylenol] | 1 | 33145-10-7 | 251-394-8 | 0,329 | ||||||
Methyl propyl ketone | 1 | 107-87-9 | 203-528-1 | 209,38 | 30960 | |||||
cis-2-Methyl-4-propyl-1,3-oxathiane | 1 | 59323-76-1 | 261-699-8 | 3,53 | ||||||
3-Methylpyrazole | 1 | 1453-58-3 | 215-925-7 | 2,1 | 493983 | |||||
3-Methyl pyridine | 1 | 108-99-6 | 203-636-9 | 2,5 | 30080 | |||||
N-Methyl-2-pyrrolidone | 1 | 872-50-4 | 212-828-1 | 40 | 14,4 | TRGS900 | MAK | EU | 13700 | |
Methyl salicylate | 1 | 119-36-8 | 204-317-7 | 17,5 | 25440 | |||||
Methylsilanetriyl triacetate | 1 | 4253-34-3 | 224-221-9 | 31 | 116431 | |||||
O,O',O''-(Methylsilylidyne)trioxime 2-pentanone | 1 | - | 484-460-1 | 0,229 | ||||||
O,O',O''-(Methylsilylidyne)trioxime 2-pentanone | 2 | - | 484-460-1 | 0,735 | ||||||
Methyl stearate | 2 | 112-61-8 | 203-990-4 | 137,2 | 492787 | |||||
4-Methylstyrene | 1 | 622-97-9 | 210-762-8 | 5,83 | TRGS900 | MAK | 20500 | |||
2-Methyl-N-(4-sulfamoylphenyl) prop-2-enamide | 1 | - | 438-940-2 | 11,75 | ||||||
2-Methyl tetrahydrofuran anhydrous | 1 | 96-47-9 | 202-507-4 | 200,196 | 510639 | |||||
3-Methyltetrahydrothiophene 1,1-dioxide | 1 | 872-93-5 | 212-833-9 | 6,2 | ||||||
3-Methylthiazolidine-2-thione | 1 | 1908-87-8 | 217-614-1 | 0,781 | ||||||
2-Methyl-1,2-thiazol-3(2H)-one - 5-chloro-2-methyl-1,2-thiazol-3(2H)-one | 1 | 55965-84-9 | 911-418-6 | 0,02 | ||||||
4-Methylthiosemicarbazide | 1 | 6610-29-3 | 229-563-2 | 0,03 | 120854 | |||||
N-Methyl-3-(trimethoxysilyl)propylamine | 1 | 3069-25-8 | 221-334-5 | 11,75 | ||||||
N-Methyl-3-(trimethoxysilyl)propylamine | 2 | 3069-25-8 | 221-334-5 | 260 | 260 | |||||
Methyl [3-(trimethoxysilyl)propyl]carbamate | 1 | 23432-62-4 | 245-659-7 | 3,3 | ||||||
Methyl [3-(trimethoxysilyl)propyl]carbamate | 2 | 23432-62-4 | 245-659-7 | 260 | 260 | |||||
3-Methyl-4-(2,6,6-trimethyl-2-cyclohexen-1-yl)-3-buten-2-one | 1 | 127-51-5 | 204-846-3 | 8,22 | ||||||
(E)-3-Methyl-4-(2,6,6-trimethylcyclohex-2-en-1-yl)but-3-en-2-one | 1 | 15789-90-9 | 695-097-5 | 29,39 | 11,75 | |||||
(2E)-Methyl-4-(2,2,3-trimethylcyclopent-3-en-1-yl) but-2-en-1-ol | 1 | 106155-02-6 | 813-338-6 | 1,76 | ||||||
3-Methyl-5-(2,2,3-trimethyl-3-cyclopenten-1-yl)pent-4-en-2-ol | 1 | 67801-20-1 | 267-140-4 | 92,75 | 152705 | |||||
3-Methyl-5-(2,2,3-trimethyl-3-cyclopenten-1-yl)pent-3-en-2-one | 1 | 65113-95-3 | 265-450-4 | 92,75 | ||||||
1-Methyltrimethylene dimethacrylate | 1 | 1189-08-8 | 214-711-0 | 14,5 | 491349 | |||||
Methyl trimethyl-3-[(1-oxododecyl)amino]propylammonium sufate | 1 | 10595-49-0 | 234-204-8 | 10,1 | 494930 | |||||
Methyltrioctylammonium chloride | 1 | 5137-55-3 | 225-896-2 | 4,93 | ||||||
Methyltris(2-ethylhexyloxycarbonylmethylthio)stannane | 1 | 57583-34-3 | 260-828-5 | 5,75 | TRGS900 | MAK | 490753 | |||
Methyltris(2-ethylhexyloxycarbonylmethylthio)stannane | 2 | 57583-34-3 | 260-828-5 | 0,086 | TRGS900 | MAK | 490753 | |||
2-Methylundecanal | 1 | 110-41-8 | 203-765-0 | 92,21 | 36,89 | 101751 | ||||
Methyl 10-undecenoate | 1 | 111-81-9 | 203-910-8 | 4,23 | 492768 | |||||
N-Methyl-N-[C18-(unsaturated)alkanoyl]glycine | 1 | - | 701-177-3 | 0,8 | ||||||
Methyl vinyl ether | 1 | 107-25-5 | 203-475-4 | 339 | 24,2 | TRGS900 | MAK | 29130 | ||
3-Methyl-1-vinyl-1H-imidazolium chloride | 1 | 13474-25-4 | 236-752-3 | 11,75 | ||||||
3-Methyl-1-vinyl-1H-imidazolium methyl sufate | 1 | 26591-72-0 | 247-832-2 | 172,85 | 135869 | |||||
Mill scale (ferrous metal) | 1 | 65996-74-9 | 266-007-8 | 3 | ||||||
Miristalkonium chloride | 1 | 139-08-2 | 205-352-0 | 1 | ||||||
Mixed LOF | 1 | - | 931-285-8 | 840 | ||||||
A mixture mainly based on: 2,3-Dihydro-6-(2-hydroxy-2-methyl-1-oxopropyl)-1,1,3-trimethyl-3-[4-(2-hydroxy-2-methyl-1-oxopropyl)phenyl]-1H-indene; 2,3-Dihydro-5-(2-hydroxy-2-methyl-1-oxopropyl)-1,1,3-trimethyl-3-[4-(2-hydroxy-2-methyl-1-oxopropyl)phenyl]-1 | 1 | 163702-01-0 | 402-990-3 | 1,175 | ||||||
Mixture of N,N'-Ethane-1,2-diylbis(decanamide); 12-Hydroxy-N-(2-(1-oxydecyl)amino)ethyl)octadecanamide and N,N'-Ethane-1,2-diylbis(12-hydroxyoctadecanamide) | 1 | - | 430-050-2 | 17,62 | 903494 | |||||
Mixture of 7-Amino-3,8-bis-(4-(2-sulfoxyethylsulfonyl)phenylazo)-4-hydroxynaphthalene-2-sulfonic acid, Na/K salt, 7-Amino-3-(4-(2-sulfoxyethylsulfonyl)phenylazo)-4-hydroxy-8-(4-(2-sulfoxyethylsulfonyl)-2-sulfophenylazo)naphthalene-2-sulfonic acid, Na/K salt, 7-Amino-8-(4-(2-sulfoxyethylsulfonyl)-phenylazo)-4-hydroxy-3-(4-(2-sulfoxyethylsulfonyl)-2-sulfophenylazo)naphthalene-2-sulfonic acid, Na/K salt and 7-Amino-3,8-bis-(4-(2-sulfoxyethylsulfonyl)-2-sulfophenylazo)-4-hydroxynaphthalene-2-sulfonic acid, Na/K salt | 1 | 214362-06-8 | 429-070-4 | 6,58 | 535853 | |||||
Mixture of 4-Amino-3-(4-ethenesulfonyl-2-sulfonatophenyl-azo)-5-hydroxy-6-(5-(4-chloro-6-(4-(2-sulfonatooxyethanesulfonyl)phenylamino)-1,3,5-triazin-2-ylamino)-2-sulfonato-phenylazo)naphthalene-2,7-disulfonate potassium/sodium and 4-Amino-5-hydroxy-6-(5-(4-chloro-6-(4-(2-sulfonatooxyethane-sulfonyl)phenylamino)-1,3,5-triazin-2-ylamino)-2-sulfonato-phenylazo)-3-(2-sulfonato-4-(2-sulfonatooxyethanesulfonyl)-phenylazo)naphthalene-2,7-disulfonate potassium/sodium | 1 | 586372-44-3 | 451-440-9 | 4,66 | 536201 | |||||
Mixture of alpha-3-(3-(2H-Benzotriazol-2-yl)-5-tert-butyl-4-hydroxyphenyl)propionyl-omega-hydroxypoly(oxy-ethylene) and alpha-3-(3-(2H-benzotriazol-2-yl)-5-tert-butyl-4-hydroxyphenyl)propionyl-omega-3-(3-(2H-benzotriazol-2-yl)-5-tert-butyl-4-hydroxyphenyl)propionyloxypoly(oxyethylene) | 1 | - | 400-830-7 | 0,35 | 496633 | |||||
Mixture of alpha-3-(3-(2H-Benzotriazol-2-yl)-5-tert-butyl-4-hydroxyphenyl)propionyl-omega-hydroxypoly(oxy-ethylene) and alpha-3-(3-(2H-benzotriazol-2-yl)-5-tert-butyl-4-hydroxyphenyl)propionyl-omega-3-(3-(2H-benzotriazol-2-yl)-5-tert-butyl-4-hydroxyphenyl)propionyloxypoly(oxyethylene) | 2 | - | 400-830-7 | 0,398 | 496633 | |||||
Mixture of Bis(2,2,6,6-tetramethyl-1-octyloxypiperidin-4-yl)-1,10-decandioate and 1,8-Bis((2,2,6,6-tetramethyl-4-((2,2,6,6-tetramethyl-1-octyloxypiperidin-4-yl)decan-1,10-dioyl)piperidin-1-yl)oxy)octane | 1 | 129757-67-1 | 406-750-9 | 0,9 | ||||||
Mixture of Bis(2,2,6,6-tetramethyl-1-octyloxypiperidin-4-yl)-1,10-decandioate and 1,8-Bis((2,2,6,6-tetramethyl-4-((2,2,6,6-tetramethyl-1-octyloxypiperidin-4-yl)decan-1,10-dioyl)piperidin-1-yl)oxy)octane | 2 | 129757-67-1 | 406-750-9 | 0,44 | ||||||
Mixture of branched and linear C7-C9 Alkyl 3-(3-(2H-benzotriazol-2-yl)-5-(1,1-dimethylethyl)-4-hydroxyphenyl)-propionates | 1 | 127519-17-9 | 407-000-3 | 0,35 | 530681 | |||||
Mixture of branched and linear C7-C9 Alkyl 3-(3-(2H-benzotriazol-2-yl)-5-(1,1-dimethylethyl)-4-hydroxyphenyl)-propionates | 2 | 127519-17-9 | 407-000-3 | 0,575 | 530681 | |||||
Mixture of branched and linear C7-C9 Alkyl 3-(3-(2H-benzotriazol-2-yl)-5-(1,1-dimethylethyl)-4-hydroxyphenyl)-propionates | 3 | 127519-17-9 | 407-000-3 | 1,65 | 530681 | |||||
Mixture of: but-1,3-diyl didecanoate; but-1,3-diyl dioctanoate; but-1,3-diyl 1-decanoate-3-octanoate; but-1,3-diyl 1-octanoate-3-decanoate | 1 | - | 424-180-9 | 44,08 | ||||||
Mixture of (R,R)-1,1,1,2,2,3,4,5,5,5-Decafluoropentane and (S,S)-1,1,1,2,2,3,4,5,5,5-Decafluoropentane | 1 | 138495-42-8 | 420-640-8 | 2072 | 535657 | |||||
Mixture of 1-Deoxy-1-(methyl-(1-oxododecyl)amino)-D-glucitol and 1-Deoxy-1-(methyl-(1-oxotetradecyl)amino)-D-glucitol (3:1) | 1 | - | 407-290-1 | 10,58 | 900746 | |||||
Mixture of Dicalcium (bis(2-hydroxy-5-tetrapropenylphenylmethyl)methylamine)dihydroxide; Tricalcium (tris(2-hydroxy-5-tetrapropenylphenylmethyl)methylamine)trihydroxide and Poly(calcium ((2-hydroxy-5-tetrapropenylphenylmethyl)methylamine)hydroxide) | 1 | - | 420-470-4 | 8,7 | 902197 | |||||
A mixture of: 1) a mixture of: a) dicholest-5-en-3-β-yl N-lauroylglutamate; b) 1-(cholest-5-en-3-β-yl)-5-(2-octyldodecyl) N-lauroylglutamate; c) 5-(cholest-5-en-3-β-yl)-1-(2-octyldodecyl) N-lauroylglutamate; d) 1-(cholest-5-en-3-β-yl) 5-docosanyl N-lauroylglutamate; e) 5-(cholest-5-en-3-β-yl) 1-docosanyl N-lauroylglutamate; 2) a mixture of: a) bis(2-octyldodecyl) N-lauroylglutamate; b) didocosanyl N-lauroylglutamate; c) 1-docosanyl 5-(2-octyldodecyl) N-lauroylglutamate; d) 5-docosanyl 1-(2-octyldodecyl) N-lauroylglutamate | 1 | - | 415-370-2 | 46,7 | 11,7 | |||||
Mixture of 1,1'-((Dihydroxyphenylen)bis(azo-3,1-phenylen-azo(1-(3-(dimethylamino)propyl)-1,2-dihydro-6-hydroxy-4-methyl-2-oxopyridin-5,3-di-yl)))dipyridinium dichloride, dihydrochloride, mixed isomers and 1-(1-(3-Dimethylaminopropyl)-5-(3-((4-(1-(3-dimethylamino-propyl)-1,6-dihydro-2-hydroxy-4-methyl-6-oxo-5-pyridino-3-pyridylazo)phenylazo)-2,4(or 2,6 or 3,5)-dihydroxy-phenylazo)phenylazo)-1,2-dihydro-6-hydroxy-4-methyl-2-oxo-3-pyridyl)pyridinium dichloride | 1 | - | 404-540-1 | 11,75 | 900537 | |||||
Mixture of O,O-Di(1-methylethyl)trithio-bis-thioformate; O,O-Di(1-methylethyl)tetrathio-bis-thioformate and O,O-Di(1-methylethyl)pentathio-bis-thioformate | 1 | 137398-54-0 | 403-030-6 | 0,822 | 900381 | |||||
Mixture of 1,2-Dimethylpropylidene dihydroperoxide and Dimethyl 1,2-benzenedicarboxylate | 1 | - | 442-480-8 | 5,288 | 536268 | |||||
Mixture of N,N'-Ethane-1,2-diylbis(hexanamide); 12-Hydroxy-N-(2-((1-oxyhexyl)amino)ethyl)octadecanamide and N,N'-Ethane-1,2-diylbis(12-hydroxyoctadecanamide) | 1 | - | 432-430-3 | 35,24 | 536263 | |||||
Mixture of Ethyl (2R,3R)-3-isopropylbicyclo(2.2.1)hept-5-ene-2-carboxylate and Ethyl (2S,3S)-3-isopropylbicyclo(2.2.1)hept-5-ene-2-carboxylate | 1 | 116044-44-1 | 427-090-8 | 4,4 | 536123 | |||||
Mixture of 2,2',2'',2'''-(Ethylenedinitrilotetrakis-N,N-di(C16)alkylacetamide and 2,2',2'',2'''-(Ethylenedinitrilo)tetrakis-N,N-di(C18)alkylacetamide | 1 | 136920-07-5 | 406-640-0 | 35,26 | 900646 | |||||
Mixture of 2-Ethylhexyl mono-D-glucopyranoside and 2-Ethylhexyl di-D-glucopyranoside | 1 | - | 414-420-0 | 10,6 | 901409 | |||||
Mixture of 2,2-Iminodiethanol 6-methyl-2-(4-(2,4,6-triamino-pyrimidin-5-ylazo)phenyl)benzothiazol-7-sulfonate; N,N-Diethylpropan-1,3-diamin 6-methyl-2-(4-(2,4,6-triamino-pyrimidin-5-ylazo)phenyl)benzothiazol-7-sulfonate and 2-Methylaminoethanol 6-methyl-2-(4-(2,4,6-triaminopyrimidin-5-ylazo)phenyl)benzothiazol-7-sulfonate | 1 | 114565-65-0 | 403-410-1 | 11,75 | 900299 | |||||
Mixture of 2,2-Iminodiethanol 6-methyl-2-(4-(2,4,6-triamino-pyrimidin-5-ylazo)phenyl)benzothiazol-7-sulfonate; N,N-Diethylpropan-1,3-diamin 6-methyl-2-(4-(2,4,6-triamino-pyrimidin-5-ylazo)phenyl)benzothiazol-7-sulfonate and 2-Methylaminoethanol 6-methyl-2-(4-(2,4,6-triaminopyrimidin-5-ylazo)phenyl)benzothiazol-7-sulfonate | 2 | 114565-65-0 | 403-410-1 | 11,75 | 900299 | |||||
Mixture of isomers | 1 | 30025-38-8 | 405-820-6 | 392 | ||||||
Mixture of Isomers of 2-(2H-benzotriazol-2-yl)-4-methyl-(n)-dodecylphenol; Isomers of 2-(2H-benzotriazol-2-yl)-4-methyl-(n)-tetracosylphenol and Isomers of 2-(2H-benzotriazol-2-yl)-4-methyl-5,6-didodecyl-phenol. n = 5 or 6 | 1 | - | 401-680-5 | 11,75 | 900155 | |||||
Mixture of 2-(2-((Oxo(phenyl)acetyl)oxy)ethoxy)ethyloxo(phenyl)acetate and (2-(2-Hydroxyethoxy)ethyl) oxo(phenyl)acetate | 1 | - | 442-300-8 | 23,51 | 536078 | |||||
A mixture of: Propan-2-one-O,O'-(methoxymethylsilandiyl)dioxime; Propan-2-one-O-(dimethoxymethylsilyl)oxime; Propan-2-one-O,O',O''-(methylsilantriyl)trioxime | 1 | - | 460-110-3 | 0,235 | ||||||
Mixture of reaction products of substituted copper phthalocyanine, hydrogenated resin acids, alkaline earth metal chlorides, and copper phthalocyanine | 1 | - | 12,2 | |||||||
A mixture of RR and RS isomers of: (2-(2-Methoxy-1-methyl)ethoxy)-1-methylethyl acetate; (2-(2-Methoxy-2-methyl)ethoxy)-1-methylethyl acetate; (2-(2-Methoxy-2-methyl)ethoxy)-2-methylethyl acetate; (2-(2-Methoxy-1-methyl)ethoxy)-2-methylethyl acetate | 1 | 88917-22-0 | 406-880-6 | 1556 | ||||||
Mixture of Sodium/Potassium 7-(((3-((4-((2-hydroxy-naphthyl)azo)phenyl)azo)phenyl)sulfonyl)amino)-naphthalene-1,3-disulfonate | 1 | 141880-36-6 | 410-070-8 | 0,588 | 901026 | |||||
Mixture of Succinic acid, Monopersuccinic acid, Dipersuccinic acid, Monomethyl ester of Succinic acid, Monomethyl ester of Persuccinic acid, Dimethyl succinate, Glutaric acid, Monoperglutaric acid, Diperglutaric acid, Monomethyl ester of glutaric acid, Monomethyl ester of perglutaric acid, Dimethyl glutarate, Adipic acid, Monoperadipic acid, Diperadipic acid, Monomethyl ester of adipic acid, Monomethyl ester of peradipic acid, Dimethyl adipate, Hydrogen peroxide, Methanol and Water | 1 | 847871-03-8 | 432-790-1 | 6,7 | 535827 | |||||
Mixture of terpenes from the rectification of Dihydromyrcenol | 1 | - | 947-968-9 | 29,6 | ||||||
Mixture of 4,5,6,7-tetrachloro-3-{[3-methyl-4-({4-[(4,5,6,7-tetrachloro-1-oxo-1H-isoindol-3-yl)amino]phenyl}diazenyl)phenyl]amino}-1H-isoindol-1-one and monomethoxy-heptachloro derivative of 3-[[3-methyl-4-[[4-[(1-oxo-1H-isoindol-3-yl)amino]phenyl]azo]phenyl]amino]-1H-isoindol-1-one and N-[4-[[2-methyl-4-[(4,5,6,7-tetrachloro-3-oxo-isoindolin-1-ylidene)amino]phenyl]azo]phenyl]acetamide and 4,5,6,7-tetrachloro-3-[3-methyl-4-[m-tolylazo]phenyl]imino-isoindolin-1-one | 1 | 106276-78-2 | 600-734-7 | 10 | ||||||
Mixture of 2,2,6,6-Tetramethylpiperidin-4-yl-hexadecanoate and 2,2,6,6-Tetramethylpiperidin-4-yl-octadecanoate | 6 | 86403-32-9 | 415-430-8 | 2,5 | 900881 | |||||
Mixture of Tetrasodium 7-(4-(4-fluoro-6-(4-(2-sulfonato-ethylsulfonyl)phenylamino)-1,3,5-triazin-2-ylamino)-2-ureidophenylazo)naphthalene-1,3,6-trisulfonate and Tetrasodium 7-(4-(4-hydroxy-6-(4-(2-sulfonatoethylsulfonyl)phenylamino)-1,3,5-traizin-2-ylamino)-2-ureidophenylazo)naphthalene-1,3,6-trisulfonate | 1 | - | 427-650-1 | 58,8 | 535796 | |||||
Mixture of Tetrasodium 7-(4-(4-fluoro-6-(4-(2-sulfonato-ethylsulfonyl)phenylamino)-1,3,5-triazin-2-ylamino)-2-ureidophenylazo)naphthalene-1,3,6-trisulfonate and Tetrasodium 7-(4-(4-hydroxy-6-(4-(2-sulfonatoethylsulfonyl)phenylamino)-1,3,5-traizin-2-ylamino)-2-ureidophenylazo)naphthalene-1,3,6-trisulfonate | 2 | - | 427-650-1 | 3,65 | 535796 | |||||
Mixture of Tetrasodium phosphonoethane-1,2-dicarboxylate and Hexasodium phosphonobutane-1,2,3,4-tetracarboxylate | 1 | - | 410-800-5 | 10,6 | 901243 | |||||
Mixture of Thiobis(4,1-phenylene)-S,S,S',S'-tetraphenyldisulfonium bishexafluorophosphate and Diphenyl(4-phenylthiophenyl)sulfonium hexafluorophosphate | 1 | - | 404-986-7 | 0,16 | 900358 | |||||
Mixture of 2,4,6-Tri(butylcarbamoyl)-1,3,5-triazine; 2,4,6-Tri(methylcarbamoyl)-1,3,5-triazine; ((2-Butyl-4,6-dimethyl)tricarbamoyl)-1,3,5-triazine and ((2,4-Dibutyl-6-methyl)tricarbamoyl)-1,3,5-triazine | 1 | 187547-46-2 | 420-390-1 | 0,754 | 902308 | |||||
Mixture of Triphenylthiophosphate and tertiary butylated phenyl derivatives | 1 | 192268-65-8 | 421-820-9 | 1,76 | 902286 | |||||
Mixture of Triphenylthiophosphate and tertiary butylated phenyl derivatives | 2 | 192268-65-8 | 421-820-9 | 1,2 | 902286 | |||||
Mixture (2:1:1) of Trisodium N(1')-N(2):N(1''')-N(2'')-eta-6-(2-amino-4-(or 6)-hydroxy-(or 4-amino-2-hydroxy)phenyl-azo)-6''-(1-carbaniloyl-2-hydroxyprop-1-enylazo)-5',5'''-disulfamoyl-3,3''-disulfonatobis(naphthalene-2,1'-azo-benzene-1,2'-diolato-O(1),O(2'))-chromate; Trisodium N(1')-N(2):N(1''')-N(2'')-eta-6,6''-bis-(1-carbaniloyl-2-hydroxyprop-1-enylazo)-5',5'''-disulfamoyl-3,3''-disulfonatobis(naphthalene-2,1'-azobenzene-1,2'-diolato-O(1),O(2'))-chromate and Trisodium N(1')-N(2):N(1''')-N(2'')-eta-6,6''-bis(2-amino-4-(or 6)-hydroxy-(or 4-amino-2-hydroxy)phenylazo)-5',5'''-disulfamoyl-3,3''-disulfonatobis(naphthalene-2,1'-azobenzene-1,2'-diolato-O(1),O(2')benzol-1,2'-diolato-O(1),O(2'))-chromate | 1 | - | 402-850-1 | 1,64 | 900268 | |||||
Mixture of two components: 1. N-(1,3-Dimethylbutyl)-N´-phenyl-p-phenylenediamine; 2. N1-(1,3-Dimethylbutyl)-N4-(4-(1-methyl-1-phenylethyl)phenyl)benzene-1,4-diamine | 1 | - | 448-020-2 | 0,059 | ||||||
Mixture, with or without stabilising agents, of calcium hydroxide and copper(II) sulphate | 1 | - | 910-853-9 | 1 | 1 | |||||
Molybdenum, Powder | 1 | 7439-98-7 | 231-107-2 | 11,7 | 8330 | |||||
Molybdenum, bis(dibutylcarbamodithioato)di-μ-oxodioxodi-, sulfurized | 1 | 68412-26-0 | 270-180-5 | 49,3 | ||||||
Molybdenum carbide | 1 | 12069-89-5 | 235-115-7 | 1,6 | 125225 | |||||
Molybdenum disilicide | 1 | 12136-78-6 | 235-231-8 | 16,4 | ||||||
Molybdenum(IV) oxide | 1 | 18868-43-4 | 242-637-9 | 14,9 | 131514 | |||||
Molybdenum sulfide | 1 | 12612-50-9 | 235-721-1 | 18,64 | ||||||
Molybdenum sulfide (MoS2), roasted | 1 | 86089-09-0 | 289-178-0 | 3 | 16,92 | |||||
Molybdenum trioxide | 1 | 1313-27-5 | 215-204-7 | 3 | 16,76 | 2030 | ||||
Molybdenum trioxide, reaction products with Bis[O,O-bis(2-ethylhexyl)] hydrogen dithiophosphate | 1 | - | 947-946-9 | 4,93 | ||||||
Molybdic acid | 1 | 7782-91-4 | 231-970-5 | 11,17 | ||||||
Monalazone disodium | 1 | 61477-95-0 | 262-810-2 | 0,194 | ||||||
Mono- and/or di- and/or tri(1-phenylethyl)-m-cresol and p-cresol | 1 | - | 700-427-9 | 10,58 | ||||||
Monoethanolamine oleate | 1 | 2272-11-9 | 218-878-0 | 146,9 | 112191 | |||||
Monosilane | 1 | 7803-62-5 | 232-263-4 | 0,67 | 500073 | |||||
Monosodium aqua-(5-((2,4-dihydroxy-5-((2-hydroxy-3,5-dinitrophenyl)azo)phenyl)azo)-2-naphthalensulfonate), iron complex | 1 | - | 400-720-9 | 0,32 | 900063 | |||||
Mixture of isomers of mono-(2-tetradecyl)naphthalene; di-(2-tetradecyl)naphthalene and tri-(2-tetradecyl)naphthalene | 1 | 132983-41-6 | 410-190-0 | 10 | 900986 | |||||
Morpholine | 1 | 110-91-8 | 203-815-1 | 36 | 91 | TRGS900 | MAK | EU | 25520 | |
Morpholine, 4-C12-14-alkyl derivs. | 1 | 1402434-48-3 | 800-906-3 | 2,1 | ||||||
Morpholine, 4-[(triethoxysilyl)methyl]- | 1 | 21743-27-1 | 480-370-1 | 17,5 | ||||||
Morpholinium toluene-4-sufonate | 1 | 13732-62-2 | 237-301-3 | 10 | 10 | |||||
2-(Morpholinothio)benzothiazole | 1 | 102-77-2 | 203-052-4 | 7 | 7 | 15520 | ||||
4-[(Morpholinothio)thioxomethyl]morpholine | 1 | 13752-51-7 | 237-335-9 | 1,789 | Carcinogenic | 127073 | ||||
Mullite | 1 | 1302-93-8 | 215-113-2 | 3 | 109336 | |||||
Multi-Walled Carbon Nanotubes (MWCNT), synthetic graphite in tubular shape | 1 | - | 936-414-1 | 0,05 | ||||||
Multi-Walled Carbon Nanotubes (MWCNT), synthetic graphite in tubular shape | 2 | - | 936-414-1 | 0,02 | 0,02 | |||||
Musk ketone | 1 | 81-14-1 | 201-328-9 | 0,247 | 100674 | |||||
Naphtha; Low boiling point naphtha | 1 | 8030-30-6 | 232-443-2 | 840 | TRGS900 | Carcinogenic | 35130 | |||
Naphtha (petroleum), arom | 1 | 68603-08-7 | 271-635-0 | 837,5 | ||||||
Naphtha (petroleum), arom | 2 | 68603-08-7 | 271-635-0 | 837,5 | 1,9 | |||||
Naphtha (petroleum), arom | 3 | 68603-08-7 | 271-635-0 | 840 | ||||||
Naphtha (petroleum), catalytic dewaxed | 1 | 64742-66-1 | 265-170-2 | 837,5 | ||||||
Naphtha (petroleum), catalytic dewaxed | 2 | 64742-66-1 | 265-170-2 | 837,5 | 1,9 | |||||
Naphtha (petroleum), catalytic reformed | 1 | 68955-35-1 | 273-271-8 | 837,5 | ||||||
Naphtha (petroleum), catalytic reformed | 2 | 68955-35-1 | 273-271-8 | 837,5 | 1,9 | |||||
Naphtha (petroleum), catalytic reformed, co-processed with hydrocarbons derived from thermally cracked waste plastics | 1 | - | 951-918-1 | 840 | ||||||
Naphtha (petroleum), catalytic reformed light, arom.-free fraction | 1 | 85116-59-2 | 285-510-3 | 837,5 | ||||||
Naphtha (petroleum), catalytic reformed light, arom.-free fraction | 2 | 85116-59-2 | 285-510-3 | 837,5 | 1,9 | |||||
Naphtha (petroleum), full-range alkylate | 1 | 64741-64-6 | 265-066-7 | 837,5 | 150866 | |||||
Naphtha (petroleum), full-range alkylate | 2 | 64741-64-6 | 265-066-7 | 837,5 | 1,9 | 150866 | ||||
Naphtha (petroleum), full-range alkylate, butane-contg. | 1 | 68527-27-5 | 271-267-0 | 837,5 | ||||||
Naphtha (petroleum), full-range alkylate, butane-contg. | 2 | 68527-27-5 | 271-267-0 | 837,5 | 1,9 | |||||
Naphtha (petroleum), full-range coker | 1 | 68513-02-0 | 270-991-4 | 837,5 | ||||||
Naphtha (petroleum), full-range coker | 2 | 68513-02-0 | 270-991-4 | 837,5 | 1,9 | |||||
Naphtha (petroleum), full-range reformed | 1 | 68919-37-9 | 272-895-8 | 837,5 | ||||||
Naphtha (petroleum), full-range reformed | 2 | 68919-37-9 | 272-895-8 | 837,5 | 1,9 | |||||
Naphtha (petroleum), full-range straight-run | 1 | 64741-42-0 | 265-042-6 | 837,5 | ||||||
Naphtha (petroleum), full-range straight-run | 2 | 64741-42-0 | 265-042-6 | 837,5 | 1,9 | |||||
Naphtha (petroleum), heavy catalytic cracked | 1 | 64741-54-4 | 265-055-7 | 837,5 | ||||||
Naphtha (petroleum), heavy catalytic cracked | 2 | 64741-54-4 | 265-055-7 | 837,5 | 1,9 | |||||
Naphtha (petroleum), heavy catalytic cracked, sweetened | 1 | 92045-50-6 | 295-431-6 | 837,5 | ||||||
Naphtha (petroleum), heavy catalytic reformed | 1 | 64741-68-0 | 265-070-9 | 837,5 | ||||||
Naphtha (petroleum), heavy catalytic reformed | 2 | 64741-68-0 | 265-070-9 | 837,5 | 1,9 | |||||
Naphtha (petroleum), heavy hydrocracked | 1 | 64741-78-2 | 265-079-8 | 837,5 | ||||||
Naphtha (petroleum), heavy hydrocracked | 2 | 64741-78-2 | 265-079-8 | 837,5 | 1,9 | |||||
Naphtha (petroleum), heavy straight-run | 1 | 64741-41-9 | 265-041-0 | 837,5 | ||||||
Naphtha (petroleum), heavy straight-run | 2 | 64741-41-9 | 265-041-0 | 837,5 | 1,9 | |||||
Naphtha (petroleum), heavy straight-run | 3 | 64741-41-9 | 265-041-0 | 840 | ||||||
Naphtha (petroleum), heavy thermal cracked | 1 | 64741-83-9 | 265-085-0 | 837,5 | ||||||
Naphtha (petroleum), heavy thermal cracked | 2 | 64741-83-9 | 265-085-0 | 837,5 | 1,9 | |||||
Naphtha (petroleum), hydrodesulfurized full-range | 1 | 92045-52-8 | 295-433-7 | 837,5 | ||||||
Naphtha (petroleum), hydrodesulfurized full-range | 2 | 92045-52-8 | 295-433-7 | 837,5 | 1,9 | |||||
Naphtha (petroleum), hydrodesulfurized full-range coker | 1 | 101316-76-1 | 309-879-8 | 837,5 | ||||||
Naphtha (petroleum), hydrodesulfurized full-range coker | 2 | 101316-76-1 | 309-879-8 | 837,5 | 1,9 | |||||
Naphtha (petroleum), hydrodesulfurized heavy | 1 | 64742-82-1 | 265-185-4 | 837,5 | ||||||
Naphtha (petroleum), hydrodesulfurized heavy | 2 | 64742-82-1 | 265-185-4 | 837,5 | 1,9 | |||||
Naphtha (petroleum), hydrodesulfurized heavy, co-processed with hydrocarbons derived from thermally cracked waste plastics | 1 | - | 951-219-1 | 840 | ||||||
Naphtha (petroleum), hydrodesulfurized light | 1 | 64742-73-0 | 265-178-6 | 837,5 | ||||||
Naphtha (petroleum), hydrodesulfurized light | 2 | 64742-73-0 | 265-178-6 | 837,5 | 1,9 | |||||
Naphtha (petroleum), hydrotreated heavy | 1 | 64742-48-9 | 265-150-3 | 837,5 | ||||||
Naphtha (petroleum), hydrotreated heavy | 2 | 64742-48-9 | 265-150-3 | 837,5 | 1,9 | |||||
Naphtha (petroleum), hydrotreated light; Low boiling point hydrogen treated naphtha | 1 | 64742-49-0 | 265-151-9 | 837,5 | ||||||
Naphtha (petroleum), hydrotreated light; Low boiling point hydrogen treated naphtha | 2 | 64742-49-0 | 265-151-9 | 837,5 | 1,9 | |||||
Naphtha (petroleum), hydrotreated light steam-cracked; Low boiling point hydrogen treated naphtha | 1 | 92045-57-3 | 295-438-4 | 3,25 | ||||||
Naphtha (petroleum), isomerization | 1 | 64741-70-4 | 265-073-5 | 837,5 | ||||||
Naphtha (petroleum), isomerization | 2 | 64741-70-4 | 265-073-5 | 837,5 | 1,9 | |||||
Naphtha (petroleum), isomerization, C6-fraction | 1 | 92045-58-4 | 295-440-5 | 837,5 | ||||||
Naphtha (petroleum), isomerization, C6-fraction | 2 | 92045-58-4 | 295-440-5 | 837,5 | 1,9 | |||||
Naphtha (petroleum), light alkylate | 1 | 64741-66-8 | 265-068-8 | 837,5 | ||||||
Naphtha (petroleum), light alkylate | 2 | 64741-66-8 | 265-068-8 | 837,5 | 1,9 | |||||
Naphtha (petroleum), light catalytic cracked | 1 | 64741-55-5 | 265-056-2 | 837,5 | ||||||
Naphtha (petroleum), light catalytic cracked | 2 | 64741-55-5 | 265-056-2 | 837,5 | 1,9 | |||||
Naphtha (petroleum), light catalytic cracked sweetened | 1 | 92045-59-5 | 295-441-0 | 837,5 | ||||||
Naphtha (petroleum), light catalytic cracked sweetened | 2 | 92045-59-5 | 295-441-0 | 837,5 | 1,9 | |||||
Naphtha (petroleum), light catalytic reformed | 1 | 64741-63-5 | 265-065-1 | 837,5 | ||||||
Naphtha (petroleum), light catalytic reformed | 2 | 64741-63-5 | 265-065-1 | 837,5 | 1,9 | |||||
Naphtha (petroleum), light catalytic reformed, arom.-free | 1 | 68513-03-1 | 270-993-5 | 837,5 | ||||||
Naphtha (petroleum), light catalytic reformed, arom.-free | 2 | 68513-03-1 | 270-993-5 | 837,5 | 1,9 | |||||
Naphtha (petroleum), light hydrocracked | 1 | 64741-69-1 | 265-071-4 | 837,5 | ||||||
Naphtha (petroleum), light hydrocracked | 2 | 64741-69-1 | 265-071-4 | 837,5 | 1,9 | |||||
Naphtha (petroleum), light polymn. | 1 | 68783-11-9 | 614-725-0 | 837,5 | ||||||
Naphtha (petroleum), light polymn. | 2 | 68783-11-9 | 614-725-0 | 837,5 | 1,9 | |||||
Naphtha (petroleum), light, C5-rich, sweetened | 1 | 92045-60-8 | 295-442-6 | 837,5 | ||||||
Naphtha (petroleum), light, C5-rich, sweetened | 2 | 92045-60-8 | 295-442-6 | 837,5 | 1,9 | |||||
Naphtha (petroleum), light steam cracked; Low boiling point naphtha - unspecified | 1 | 64742-83-2 | 265-187-5 | 3,25 | ||||||
Naphtha (petroleum), light steam cracked; Low boiling point naphtha - unspecified | 2 | 64742-83-2 | 265-187-5 | 2,31 | 2,31 | |||||
Naphtha (petroleum), light steam-cracked arom.; Low boiling point naphtha - unspecified | 1 | 68527-23-1 | 271-264-4 | 3,25 | ||||||
Naphtha (petroleum), light steam-cracked, debenzenized; Low boiling point naphtha - unspecified | 1 | 68527-26-4 | 271-266-5 | 3,25 | ||||||
Naphtha (petroleum), light steam-cracked, debenzenized; Low boiling point naphtha - unspecified | 2 | 68527-26-4 | 271-266-5 | 2,31 | 2,31 | |||||
Naphtha (petroleum), light steam-cracked, thermally treated; Low boiling point naphtha - unspecified | 1 | 98219-47-7 | 308-714-7 | 3,25 | ||||||
Naphtha (petroleum), light straight-run | 1 | 64741-46-4 | 265-046-8 | 837,5 | ||||||
Naphtha (petroleum), light straight-run, co-processed with hydrocarbons derived from thermally cracked waste plastics | 1 | - | 951-589-4 | 840 | ||||||
Naphtha (petroleum), light, sweetened | 1 | 68783-66-4 | 272-206-0 | 837,5 | ||||||
Naphtha (petroleum), light thermal cracked | 1 | 64741-74-8 | 265-075-6 | 837,5 | ||||||
Naphtha (petroleum), light thermal cracked | 2 | 64741-74-8 | 265-075-6 | 837,5 | 1,9 | |||||
Naphtha (petroleum), polymn. | 1 | 64741-72-6 | 613-683-0 | 837,5 | ||||||
Naphtha (petroleum), polymn. | 2 | 64741-72-6 | 613-683-0 | 837,5 | 1,9 | |||||
Naphtha (petroleum), solvent-refined light; Low boiling point modified naphtha | 1 | 64741-84-0 | 265-086-6 | 837,5 | ||||||
Naphtha (petroleum), solvent-refined light; Low boiling point modified naphtha | 2 | 64741-84-0 | 265-086-6 | 837,5 | 1,9 | |||||
Naphtha (petroleum), solvent-refined light; Low boiling point modified naphtha | 3 | 64741-84-0 | 265-086-6 | 2,31 | 2,31 | |||||
Naphtha (petroleum), solvent-refined light; Low boiling point modified naphtha | 4 | 64741-84-0 | 265-086-6 | 3,25 | ||||||
Naphtha (petroleum), solvent-refined light; Low boiling point modified naphtha | 5 | 64741-84-0 | 265-086-6 | 75 | ||||||
Naphtha (petroleum), steam-cracked, C8-10 aromatic hydrocarbon fraction, alkylated and oligomerised | 1 | - | 701-299-7 | 1,41 | ||||||
Naphtha (petroleum), steam-cracked, hydrotreated, C9-10- arom.-rich; Cracked kerosine | 1 | 90641-13-7 | 292-637-8 | 3,25 | ||||||
Naphtha (petroleum), steam-cracked, light hydrotreated, solvent refined | 1 | - | 701-214-3 | 3,25 | ||||||
Naphtha (petroleum), steam-cracked, light hydrotreated, solvent refined | 2 | - | 701-214-3 | 75 | ||||||
Naphtha (petroleum), steam-cracked middle arom.; Low boiling point naphtha - unspecified | 1 | 68516-20-1 | 271-138-9 | 3,25 | ||||||
Naphtha (petroleum), steam-cracked middle arom.; Low boiling point naphtha - unspecified | 2 | 68516-20-1 | 271-138-9 | 2,31 | 2,31 | |||||
Naphtha (petroleum), steam-cracked middle arom.; Low boiling point naphtha - unspecified | 3 | 68516-20-1 | 271-138-9 | 192 | 192 | |||||
Naphtha (petroleum), steam-cracked middle arom.; Low boiling point naphtha - unspecified | 4 | 68516-20-1 | 271-138-9 | 192 | ||||||
Naphtha (petroleum), sweetened | 1 | 64741-87-3 | 265-089-2 | 837,5 | ||||||
Naphtha (petroleum), sweetened | 2 | 64741-87-3 | 265-089-2 | 837,5 | 1,9 | |||||
Naphtha (petroleum), sweetened light | 1 | 101795-01-1 | 309-976-5 | 837,5 | ||||||
Naphtha (petroleum), sweetened light | 2 | 101795-01-1 | 309-976-5 | 837,5 | 1,9 | |||||
Naphtha (petroleum), unsweetened | 1 | 68783-12-0 | 272-186-3 | 837,5 | ||||||
Naphtha (petroleum), unsweetened | 2 | 68783-12-0 | 272-186-3 | 837,5 | 1,9 | |||||
Naphthalene | 1 | 91-20-3 | 202-049-5 | 25 | 25 | TRGS900 | 15510 | |||
1,8-Naphthalenediamine | 1 | 479-27-6 | 207-529-8 | 2,63 | 0,5 | 17010 | ||||
Naphthalene-2,6-dicarboxylic acid | 1 | 1141-38-4 | 214-527-0 | 4,93 | ||||||
2,7-Naphthalenedisulfonic acid, 4-amino-5-hydroxy-, coupled with 3-aminophenol, diazotized 5-amino-2-[(4-aminophenyl)amino]benzenesulfonic acid and diazotized benzenamine, sodium salts | 1 | 93281-13-1 | 297-025-4 | 5,76 | ||||||
1,3-Naphthalenedisulfonic acid, 4-amino-5-hydroxy-, diazotized, coupled with diazotized 2-amino-4,6-dinitrophenol, diazotized 4-amino-5-hydroxy-2,7-naphthalenedisulfonic acid, diazotized 4-amino-3-methylbenzenesulfonic acid, diazotized 4-nitrobenzenamine and resorcin, sodium salts | 1 | 72480-09-2 | 276-684-1 | 4,9 | ||||||
2,7-Naphthalenedisulfonic acid, 4-amino-5-hydroxy-, diazotized, coupled with diazotized 2-amino-4,6-dinitrophenol, diazotized 4-nitrobenzenamine and resorcinol, sodium salts | 1 | 8011-86-7 | 232-380-0 | 1,15 | 122964 | |||||
7-Naphthalenedisulfonic acid, 5-(chloro-(2-(2-substitutedalkoxy)alkylamino)- heteromonocyclylamino)-3-(4-substitutedphenyl)azo)-4-hydroxy-, potassium sodium salt | 1 | - | 401-420-0 | 1,18 | ||||||
2,7-Naphthalenedisulfonic acid, 4-substituted-6-[[5-[(substituted-chloroheteromonocyclyl)substituted]-2-substituted-phenyl]azo]-3-[(2,5-disubstituted-phenyl)-azo]-5-hydroxy-, lithium sodium salt | 1 | - | 415-420-3 | 0,588 | ||||||
N,N'-Naphthalene-1,5-diylbis[4-[(2,3-dichlorophenyl)azo]-3-hydroxynaphthalene-2-carboxamide] | 1 | 68516-75-6 | 271-178-7 | 3 | 156256 | |||||
N,N''-Naphthalene-1,5-diylbis[N'-[3-[(2-ethylhexyl)oxy]propyl]urea] | 1 | 71216-01-8 | 275-276-0 | 10 | ||||||
2-Naphthalenesulfonic acid | 1 | 120-18-3 | 204-375-3 | 50 | 20730 | |||||
Naphthalenesulfonic acid, bis(1-methylethyl)-, methyl derivatives, sodium salts | 1 | 68909-82-0 | 272-715-8 | 1,48 | ||||||
Naphthalenesulfonic acid, butyl-, Me derivatives, sodium salts | 1 | 68909-83-1 | 272-716-3 | 1,48 | ||||||
Naphthalenesulfonic acid, dibutyl-, Me derivs., sodium salts | 1 | 68909-84-2 | 272-717-9 | 1,48 | ||||||
Naphthalene sulfonic acid, reaction products with Isobutanol, sodium salts | 1 | - | 947-977-8 | 1,48 | ||||||
Naphthalenesulfonic acids, branched and linear Bu derivs., sodium salts | 1 | 91078-64-7 | 293-346-9 | 0,005 | ||||||
2-Naphthalenol, 1-[[2-Methyl-4-[(2-methylphenyl)azo]phenyl]azo]-, ar-styrenated | 1 | 85203-90-3 | 286-282-8 | 16,4 | ||||||
2-Naphthalenol, 1-[[4-(phenylazo)phenyl]azo]-, ar-heptyl ar',ar''-methyl derivates | 1 | 92257-31-3 | 296-120-8 | 0,07 | ||||||
2-Naphthalenol, 1-[[4-(phenylazo)phenyl]azo]-, ar',ar''-Me derivs. | 1 | 70879-65-1 | 274-972-1 | 18,366 | ||||||
Naphthenic acids, Bismuth salts | 1 | 85736-59-0 | 288-470-5 | 4,47 | ||||||
Naphthenic acids, lithium salts | 1 | 61788-56-5 | 262-987-6 | 1,18 | ||||||
Naphthenic acids, nickel salts | 1 | 61788-71-4 | 263-000-1 | 0,46 | 0,46 | |||||
Naphthenic acids, reaction products with Diethylenetriamine | 1 | 68131-13-5 | 268-610-1 | 1 | 1 | |||||
Naphthenic acids, reaction products with Diethylenetriamine | 2 | 68131-13-5 | 268-610-1 | 0,0513 | 0,0513 | |||||
Naphthenic acids, zinc salts, basic | 1 | 84418-50-8 | 282-762-6 | 4,93 | ||||||
1-Naphthol | 1 | 90-15-3 | 201-969-4 | 4,58 | 16990 | |||||
4-[3-(1-Naphthylamino)propyl]morpholine | 1 | 5235-82-5 | 226-033-2 | 5,55 | ||||||
1,5-Naphthylene diisocyanate | 1 | 3173-72-6 | 221-641-4 | 0,05 | 0,05 | TRGS900 | 34160 | |||
1,4-Naphtoquinone | 1 | 130-15-4 | 204-977-6 | 0,033 | 27450 | |||||
Napthalic acid, zinc salts | 1 | 12001-85-3 | 234-409-2 | 1,18 | 124616 | |||||
Napthenic acids | 1 | 1338-24-5 | 215-662-8 | 21,3 | 570196 | |||||
Napthenic acids, copper salts | 1 | 1338-02-9 | 215-657-0 | 0,63 | 570170 | |||||
Natrlquest E30 | 1 | 178949-82-1 | 416-530-4 | 1,1 | ||||||
Natural gas condensates (petroleum); Low boiling point naphtha - unspecified | 1 | 64741-47-5 | 265-047-3 | 3,25 | ||||||
Natural gas condensates (petroleum); Low boiling point naphtha - unspecified | 2 | 64741-47-5 | 265-047-3 | 837,5 | ||||||
Neodecanoic acid, iron salt | 1 | 51818-55-4 | 257-446-6 | 38,1 | ||||||
Neodymium(III) oxide | 1 | 1313-97-9 | 215-214-1 | 18 | 109387 | |||||
(±)-Neomenthol | 1 | 3623-51-6 | 222-824-1 | 10 | 66,1 | |||||
Neononanoic acid | 1 | 59354-78-8 | 261-716-9 | 22,04 | ||||||
Nerol | 1 | 106-25-2 | 203-378-7 | 4,4 | 101646 | |||||
Nerolidol, mixture of isomers | 1 | 7212-44-4 | 230-597-5 | 10 | 494817 | |||||
Neryl acetate | 1 | 141-12-8 | 205-459-2 | 7,24 | ||||||
Neryl acetate | 2 | 141-12-8 | 205-459-2 | 4,4 | ||||||
Nickel powder | 1 | 7440-02-0 | 231-111-4 | 0,05 | 0,05 | TRGS900 | 8230 | |||
Nickel(II)-acetate | 1 | 373-02-4 | 206-761-7 | 0,05 | 0,05 | TRGS900 | Carcinogenic | 103506 | ||
Nickel bis(dibutyldithiocarbamate) | 1 | 13927-77-0 | 237-696-2 | 0,0024 | ||||||
Nickel bis(dihydrogen phosphate) | 1 | 18718-11-1 | 242-522-3 | 0,05 | 0,05 | TRGS900 | Carcinogenic | 131414 | ||
Nickel bis(2-ethylhexanoate) | 1 | 4454-16-4 | 224-699-9 | 0,05 | 0,05 | TRGS900 | Carcinogenic | 116817 | ||
Nickel bis(sulfamidate) | 1 | 13770-89-3 | 237-396-1 | 0,05 | 0,05 | TRGS900 | Carcinogenic | 127125 | ||
Nickel carbonate tetra(dihydroxide) | 1 | - | 941-652-4 | 0,05 | 0,05 | |||||
Nickel(II) chloride | 1 | 7718-54-9 | 231-743-0 | 0,05 | 0,05 | TRGS900 | Carcinogenic | 3300 | ||
Nickel difluoride | 1 | 10028-18-9 | 233-071-3 | 0,08 | 0,08 | TRGS900 | Carcinogenic | 123553 | ||
Nickel dihydroxide | 1 | 12054-48-7 | 235-008-5 | 0,05 | 0,05 | TRGS900 | Carcinogenic | 490525 | ||
Nickel dinitrate | 1 | 13138-45-9 | 236-068-5 | 0,05 | 0,05 | TRGS900 | Carcinogenic | 6310 | ||
Nickel matte | 1 | 69012-50-6 | 273-749-6 | 0,05 | 0,05 | TRGS900 | Carcinogenic | 158539 | ||
Nickel matte | 2 | 69012-50-6 | 273-749-6 | 0,04 | TRGS900 | Carcinogenic | 158539 | |||
Nickel matte | 3 | 69012-50-6 | 273-749-6 | 0,005 | TRGS900 | Carcinogenic | 158539 | |||
Nickel oxide | 1 | 1313-99-1 | 215-215-7 | 0,05 | 0,05 | TRGS900 | Carcinogenic | 1230 | ||
Nickel(III) oxy hydroxide | 1 | - | 700-710-7 | 0,05 | 0,05 | |||||
Nickel subsulfide | 1 | 12035-72-2 | 234-829-6 | 0,05 | 0,05 | TRGS900 | Carcinogenic | 570206 | ||
Nickel sulfate | 1 | 7786-81-4 | 232-104-9 | 0,05 | 0,05 | TRGS900 | Carcinogenic | 3890 | ||
Nickel sulfide | 1 | 16812-54-7 | 240-841-2 | 0,05 | 0,05 | TRGS900 | Carcinogenic | 4990 | ||
Nicotinamide | 1 | 98-92-0 | 202-713-4 | 43,75 | 40300 | |||||
Nicotine | 1 | 54-11-5 | 200-193-3 | 0,0313 | TRGS900 | EU | 41410 | |||
Nicotine dihydrogen ditartrate | 1 | 65-31-6 | 200-607-2 | 0,0811 | 496478 | |||||
Nicotinic acid | 1 | 59-67-6 | 200-441-0 | 0,5 | 40310 | |||||
Niobium, Powder | 1 | 7440-03-1 | 231-113-5 | 23,5 | 7410 | |||||
Nitrapyrin | 1 | 1929-82-4 | 217-682-2 | 0,7 | 490350 | |||||
Nitric acid, reaction products with cyclododecanol and cyclododecanone, by-products from, high-boiling fraction | 1 | 72162-23-3 | 276-431-5 | 127 | ||||||
Nitrilotriacetic acid | 1 | 139-13-9 | 205-355-7 | 3,7 | TRGS900 | MAK | 29200 | |||
Nitrilotriacetic acid | 2 | 139-13-9 | 205-355-7 | 0,2 | 0,2 | TRGS900 | MAK | 29200 | ||
2, 2', 2'' - Nitrilotriethanol, propoxylated | 1 | 37208-53-0 | 500-094-8 | 98 | ||||||
2,2',2''-Nitrilotriethanol citrate | 1 | 29340-81-6 | 249-576-7 | 2,82 | 8,37 | |||||
1,1',1''-Nitrilotripropan-2-ol | 1 | 122-20-3 | 204-528-4 | 86 | 23790 | |||||
[Nitrilotris(methylene)]trisphosphonic acid, ammonium salt | 1 | 34274-28-7 | 251-908-0 | 9,7 | ||||||
[Nitrilotris(methylene)]trisphosphonic acid, potassium salt | 1 | 27794-93-0 | 248-660-0 | 9,7 | ||||||
[Nitrilotris(methylene)]trisphosphonic acid, sodium salt | 1 | 20592-85-2 | 243-900-0 | 9,7 | ||||||
4-Nitroaniline | 1 | 100-01-6 | 202-810-1 | 0,201 | 17030 | |||||
4-Nitrobenzenesulphonyl chloride | 1 | 98-74-8 | 202-697-9 | 2,35 | ||||||
3-Nitrobenzoic acid | 1 | 121-92-6 | 204-508-5 | 1,17 | 25370 | |||||
Nitroethane | 1 | 79-24-3 | 201-188-9 | 25 | 8,4 | TRGS900 | MAK | EU | 38490 | |
Nitrogen trifluoride | 1 | 7783-54-2 | 232-007-1 | 29 | 29 | 490979 | ||||
1-Nitroguanidine | 1 | 556-88-7 | 209-143-5 | 164,6 | 105189 | |||||
Nitromethane | 1 | 75-52-5 | 200-876-6 | 39 | 20 | 38500 | ||||
5-Nitro-2-(2-methyl-4-(diethylamino)phenylazo)thiazole | 1 | - | 435-600-5 | 13,3 | ||||||
2-Nitro-4-(methylsulfonyl)benzoic acid | 1 | 110964-79-9 | 601-017-1 | 1,78 | ||||||
4-(4-Nitrophenylazo)-2,6-di-sec-butyl-phenol | 1 | 111850-24-9 | 410-610-2 | 0,4 | 902616 | |||||
N-(2-Nitrophenyl)phosphoric triamide | 1 | - | 477-690-9 | 0,7 | ||||||
1-Nitropropane | 1 | 108-03-2 | 203-544-9 | 3,6 | 7,1 | TRGS900 | MAK | 38480 | ||
5-Nitrosalicylic acid | 1 | 96-97-9 | 202-548-8 | 2,657 | 492570 | |||||
N-Nitrosodiphenylamine | 1 | 86-30-6 | 201-663-0 | 0,82 | 16290 | |||||
Nitrous oxide | 1 | 10024-97-2 | 233-032-0 | 183 | TRGS900 | MAK | 4230 | |||
5-Nitrovanillin | 1 | 6635-20-7 | 229-633-2 | 146,93 | 120914 | |||||
1,1,2,2,3,3,4,4,4-Nonafluoro-N,N-bis(2-hydroxyethyl)butane-1-sulphonamide | 1 | 34455-00-0 | 252-044-7 | 2,35 | ||||||
1,1,2,2,3,3,4,4,4-Nonafluoro-N-(2-hydroxyethyl)-N-methylbutane-1-sulphonamide | 1 | 34454-97-2 | 252-043-1 | 0,6 | ||||||
1,1,1,2,2,4,5,5,5-Nonafluoro-4-(trifluoromethyl)-3-pentanone | 1 | 756-13-8 | 436-710-6 | 83,4 | 535172 | |||||
1,1,1,2,2,4,5,5,5-Nonafluoro-4-(trifluoromethyl)-3-pentanone | 2 | 756-13-8 | 436-710-6 | 780 | 535172 | |||||
Nonamethylenediamine | 1 | 646-24-2 | 211-470-3 | 0,35 | 493626 | |||||
Nonanal | 1 | 124-19-6 | 204-688-5 | 24,9 | 492875 | |||||
n-Nonane | 1 | 111-84-2 | 203-913-4 | 2035 | 29230 | |||||
Nonane-1,9-diol | 1 | 3937-56-2 | 223-517-5 | 18,81 | 4,7 | |||||
Nonan-1-ol | 1 | 143-08-8 | 205-583-7 | 118 | 176 | 490177 | ||||
Nonan-4-olide | 1 | 104-61-0 | 203-219-1 | 16,1 | 490135 | |||||
Nonene, branched | 1 | 97280-95-0 | 306-492-6 | 29 | ||||||
Non-graphitic carbon fibre | 1 | - | 701-026-1 | 14,1 | ||||||
Nonylbenzoate, branched and linear | 1 | 670241-72-2 | 447-010-5 | 14,9 | ||||||
4-Nonylphenol, branched | 1 | 84852-15-3 | 284-325-5 | 0,5 | 530292 | |||||
(4-Nonylphenoxy)acetic acid | 1 | 3115-49-9 | 221-486-2 | 1,76 | 114218 | |||||
6-Nonyl-1,3,5-triazine-2,4-diamine | 1 | 5921-65-3 | 227-645-2 | 2,63 | ||||||
2-Norbornene | 1 | 498-66-8 | 207-866-0 | 40,6 | 493129 | |||||
Norethisterone | 1 | 68-22-4 | 200-681-6 | 0,012 | ||||||
not applicable | 1 | - | 915-069-0 | 1,25 | 1,25 | |||||
not applicable, UVCB substance | 1 | 157707-87-4 | 500-394-9 | 70,5 | ||||||
Not assignable, UVCB | 1 | 1229648-98-9 | 641-088-6 | 0,352 | ||||||
Octabenzone | 1 | 1843-05-6 | 217-421-2 | 6,61 | 494099 | |||||
1,18-Octadecanedioic acid | 1 | - | 442-490-2 | 17,632 | ||||||
Octadecane-1,12-diol | 1 | 2726-73-0 | 220-342-6 | 97 | ||||||
Octadecane-1-thiol | 1 | 2885-00-9 | 220-744-1 | 2,47 | ||||||
Octadecanoic acid, reaction products with diethylenetriamine and urea, acetates | 1 | 84962-05-0 | 284-698-4 | 11,8 | ||||||
Octadecanoic acid, branched and linear | 1 | 68201-37-6 | 269-214-1 | 282,105 | ||||||
Octadecanoic acid, 12-hydroxy-, reaction products with ethylenediamine | 1 | 100545-48-0 | 309-629-8 | 0,308 | ||||||
Octadecanoic acid, reaction products with triethylenetetramine | 1 | 68412-15-7 | 270-171-6 | 16,4 | ||||||
Octadecanoic acid, reaction products with 2-amino-2-methyl-1-propanol | 1 | 68951-62-2 | 273-159-9 | 16,46 | ||||||
Octadecan-1-ol | 1 | 112-92-5 | 204-017-6 | 224 | 389 | 20650 | ||||
1-Octadecanol, phosphate, potassium salt | 1 | 68987-29-1 | 273-489-3 | 34,94 | ||||||
Octadec-1-ene | 1 | 112-88-9 | 204-012-9 | 29 | ||||||
9-Octadecenoic acid (Z)-, reaction products with diethylenetriamine, di-Me sulfate-quaternized | 1 | 97953-16-7 | 308-415-1 | 10,57 | ||||||
9-Octadecenoic acid (Z)-, isooctyl ester, reaction products with glycerol trioleate and sulfur | 1 | 96152-40-8 | 306-111-3 | 5,88 | ||||||
9-Octadecenoic acid (Z)-, monoester with 1,2,3-propanetriol ester with boric acid (H3BO3) | 1 | 63310-16-7 | 264-092-6 | 0,8 | ||||||
(Z)-9-Octadecenoic acid, sulfonated, potassium salts | 1 | 68609-93-8 | 271-843-1 | 0,99 | ||||||
9-Octadecenoic acid(Z), decyl ester | 1 | 3687-46-5 | 222-981-6 | 23,5 | TRGS900 | MAK | 492122 | |||
cis-9-Octadecen-1-ol | 1 | 143-28-2 | 205-597-3 | 219,5 | 389 | 33820 | ||||
(Z)-9-Octadecen-1-ol phosphate | 1 | 37310-83-1 | 253-455-4 | 19,6 | 140664 | |||||
(Z)-Octadec-9-enylamine, ethoxylated | 1 | 26635-93-8 | 500-048-7 | 2,112 | ||||||
(Z)-Octadec-9-enyl (Z)-docos-13-enoate | 1 | 17673-56-2 | 241-654-9 | 7,05 | 130676 | |||||
(Z)-N-Octadec-9-enylhexadecan-1-amide | 1 | 16260-09-6 | 240-367-6 | 70,52 | 129599 | |||||
2,2'-(Octadec-9-enylimino)bisethanol | 1 | 25307-17-9 | 246-807-3 | 2,112 | 135032 | |||||
(Z)-Octadec-9-enyl oleate | 1 | 3687-45-4 | 222-980-0 | 7,05 | 530547 | |||||
(Z)-N-9-Octadecenylpropane-1,3-diamine | 1 | 7173-62-8 | 230-528-9 | 0,0395 | 121670 | |||||
Octadecyl acrylate | 1 | 4813-57-4 | 225-383-3 | 97,9 | 117380 | |||||
Octadecylamine | 1 | 124-30-1 | 204-695-3 | 1 | 0,38 | 23100 | ||||
4-(Octadecylamino)-4-oxoisocrotonic acid | 1 | 3077-27-8 | 221-361-2 | 2,47 | ||||||
2-[(Octadecylcarbamoyl)oxy]ethyl acrylate | 1 | 78433-08-6 | 811-432-1 | 16,4 | ||||||
Octadecyl 3-(3,5-di-tert-butyl-4-hydroxyphenyl)propionate | 1 | 2082-79-3 | 218-216-0 | 3,6 | TRGS900 | MAK | 530535 | |||
(Z)-N-Octadecyldocos-13-enamide | 1 | 10094-45-8 | 233-226-5 | 70,52 | 123663 | |||||
2,2'-(Octadecylimino)bisethanol | 1 | 10213-78-2 | 233-520-3 | 2,11 | ||||||
Octadecyl 3-mercaptopropionate | 1 | 31778-15-1 | 250-801-6 | 0,49 | ||||||
2,6-Octadienal, 3,7-dimethyl-, acid-isomerized | 1 | 90480-35-6 | 291-768-8 | 2,6 | ||||||
1,7-Octadiene | 1 | 3710-30-3 | 223-054-9 | 8,5 | 40520 | |||||
1,6-Octadien-3-ol, 3,7-dimethyl-, acid-isomerized | 1 | 73018-51-6 | 277-225-8 | 17,63 | 7,05 | |||||
2,2,3,3,4,4,5,5-Octafluoropentyl methacrylate | 1 | 355-93-1 | 206-596-0 | 5,1 | ||||||
2,2,3,3,5,5,6,6-Octafluoro-4-(trifluoromethyl)morpholine | 1 | 382-28-5 | 206-841-1 | 12189 | 103571 | |||||
Octahydro-2H-1-benzopyran-2-one | 1 | 4430-31-3 | 224-623-4 | 6,3 | ||||||
[3R-(3α,3aβ,6α,7β,8aα)]-Octahydro-6-methoxy-3,6,8,8-tetramethyl-1H-3a,7-methanoazulene | 1 | 67874-81-1 | 267-510-5 | 16,1 | ||||||
[3R-(3α,3aβ,6α,7β,8aα)]-Octahydro-3,6,8,8-tetramethyl-1H-3a,7-methanoazulen-5-yl acetate | 1 | 77-54-3 | 201-036-1 | 0,639 | ||||||
1,2,3,4,4a,7,8,8a-Octahydro-2,4a,5,8a-tetramethyl-1-naphthyl formate | 1 | 65405-72-3 | 265-742-1 | 70,53 | 28,21 | |||||
Octahydro-1,3,5,7-tetranitro-1,3,5,7-tetrazocine | 1 | 2691-41-0 | 220-260-0 | 0,28 | 113259 | |||||
Octamethylcyclotetrasiloxane | 1 | 556-67-2 | 209-136-7 | 73 | 73 | 2750 | ||||
Octamethyltrisiloxane | 1 | 107-51-7 | 203-497-4 | 78 | 101675 | |||||
Octan-1-ol, reaction products with diphosphorus pentaoxide, potassium salts | 1 | 111062-42-1 | 807-789-8 | 11,6 | ||||||
Octanal | 1 | 124-13-0 | 204-683-8 | 1,3 | 40630 | |||||
n-Octane | 1 | 111-65-9 | 203-892-1 | 2035 | TRGS900 | MAK | 13810 | |||
Octane-1,2-diol | 1 | 1117-86-8 | 214-254-7 | 10,6 | 108667 | |||||
Octanoic acid, compound with dicyclohexylamine (1:1) | 1 | 15816-71-4 | 239-914-1 | 1,18 | ||||||
Octanoic acid, esters with anhydrosorbitol and dianhydrosorbitol | 1 | - | 939-179-3 | 88,2 | ||||||
Octanoic acid, compound with octylamine (1:1) | 1 | 17463-34-2 | 241-477-7 | 1 | ||||||
Octanoic acid, zinc salt, basic | 1 | 90480-58-3 | 291-793-4 | 22 | 174640 | |||||
Octan-2-ol | 1 | 123-96-6 | 204-667-0 | 14,8 | 22280 | |||||
Octan-1-ol | 1 | 111-87-5 | 203-917-6 | 106 | 176 | TRGS900 | MAK | 37840 | ||
1-Octanol reaction products with Epichlorhydrin and 2-Mercaptoethanol | 1 | 928768-73-4 | 473-730-4 | 3,35 | ||||||
Octan-4-olide | 1 | 104-50-7 | 203-208-1 | 8,22 | ||||||
Octan-4-olide | 2 | 104-50-7 | 203-208-1 | 8,82 | ||||||
2-Octanone | 1 | 111-13-7 | 203-837-1 | 1580 | 490146 | |||||
2-Octanone | 2 | 111-13-7 | 203-837-1 | 21100 | 490146 | |||||
Octasodium-2-(8-(4-chloro-6-(3-((4-chloro-6-(3,6-disulfonato-2-(1,5-disulfonatonaphthalene-2-ylazo)-1-hydroxynaphthalene-8-ylamino)-1,3,5-triazin-2-yl)-aminomethyl)phenylamino)-1,3,5-triazin-2-ylamino)-3,6-disulfonato-1-hydroxynaphthalene-2-ylazo)naphthalene-1,5-disulfonate | 1 | - | 413-550-5 | 8,75 | 900966 | |||||
Octasodium 2,2'-[1,4-phenylenebis[imino(6-chloro-1,3,5-triazine-4,2-diyl)imino(1-hydroxy-3,6-disulphonatonaphthalene-2,8-diyl)azo]]bisnaphthalene-1,5-disulphonate | 1 | 71002-20-5 | 275-108-6 | 1,6 | ||||||
Octene, hydroformylation products, low-boiling | 1 | 68938-03-4 | 273-110-1 | 9,87 | ||||||
2-[(E)-Oct-2-enyl] butanedioic acid | 1 | 62568-82-5 | 820-780-3 | 0,7 | ||||||
Octocrilene | 1 | 6197-30-4 | 228-250-8 | 5,4 | ||||||
Octylamine | 1 | 111-86-4 | 203-916-0 | 26,85 | 4,6 | 492770 | ||||
Octyl (R)-2-(4-chloro-2-methylphenoxy)propionate | 1 | 66423-13-0 | 266-358-7 | 3,2 | 152017 | |||||
2-Octyldodecyl isooctadecanoate | 1 | 93803-87-3 | 298-361-4 | 7,05 | ||||||
2,2'-(Octylimino)bisethanol | 1 | 15520-05-5 | 239-555-0 | 4,9 | ||||||
Octyl methacrylate | 1 | 2157-01-9 | 218-465-5 | 2,5 | ||||||
Octyloxirane | 1 | 2404-44-6 | 219-295-4 | 36,7 | 112523 | |||||
Octylphosphonic acid | 1 | 4724-48-5 | 225-218-5 | 0,14 | 117244 | |||||
N-(n-Octyl)-2-pyrrolidinone | 1 | 2687-94-7 | 403-700-8 | 17,45 | 530545 | |||||
N-(n-Octyl)-2-pyrrolidinone | 2 | 2687-94-7 | 403-700-8 | 18,52 | 530545 | |||||
Octyltrichlorosilane | 1 | 5283-66-9 | 226-112-1 | 18 | 510657 | |||||
n-Octyltrimethoxysilane | 1 | 3069-40-7 | 221-338-7 | 260 | 114101 | |||||
n-Octyltrimethoxysilane | 2 | 3069-40-7 | 221-338-7 | 10,56 | 114101 | |||||
Octyltris(2-ethylhexyloxycarbonylmethylthio)stannane | 1 | 26401-86-5 | 247-665-5 | 1,06 | TRGS900 | MAK | 490660 | |||
Oil shale, thermal processing waste | 1 | 93685-99-5 | 297-648-1 | 0,233 | ||||||
Oils, fish, sulfated, ammonium salt | 1 | 68187-91-7 | 269-134-7 | 11,7 | ||||||
Oils, lard, sulfated, ammonium salts | 1 | 91079-06-0 | 293-391-4 | 11,7 | ||||||
Oils, palm, propoxylated | 1 | 512802-65-2 | 610-641-3 | 3,52 | ||||||
Oils, vegetable, deodorizer distillates | 1 | 68476-80-2 | 270-700-0 | 912,8 | ||||||
Oils, vegetable, sulfated, ammonium salts | 1 | 91079-24-2 | 293-411-1 | 11,7 | ||||||
Oleic acid, compound with N-(2-Aminoethyl)ethane-1,2-diamine | 1 | 18016-43-8 | 241-924-6 | 8,3 | 8,3 | 130904 | ||||
Oleic acid, compound with (Z)-N-Octadec-9-enylpropane-1,3-diamine | 1 | 40027-38-1 | 254-754-2 | 0,074 | ||||||
Oleic acid, compound with (Z)-N-Octadec-9-enylpropane-1,3-diamine (2:1) | 1 | 34140-91-5 | 251-846-4 | 0,0984 | ||||||
Oligomeric reaction product of 1,1'-Methylenebis(4-isocyanatobenzene) and Oxybispropanol | 1 | - | 701-040-8 | 0,05 | ||||||
Oligomeric reaction product of 1,1'-Methylenebis(4-isocyanatobenzene), butane-1,3-diol, 2,2'-oxydiethanol and propane-1,2-diol | 1 | - | 701-173-1 | 0,05 | ||||||
Oligomerisation products of 2,2'- Oxydiethanol with Ethylene oxide and Propylene oxide | 1 | - | 701-310-5 | 98 | ||||||
Oligomerisation products of alpha-alkenes C16-18 (even numbered), hydrogenated, hydroisomerised | 1 | - | 832-827-5 | 9,87 | ||||||
Oligomerisation products of beta-pinene | 1 | - | 701-246-8 | 12,2 | ||||||
Oligomerisation products of 2,2'-[(1-Methylethylidene)bis(4,1-phenyleneoxymethylene)]bisoxirane with acrylic acid and fatty acids, C18-unsatd., dimers and nonanoic acid | 1 | - | 701-359-2 | 1,18 | ||||||
Oligomerisation products of sucrose with ethylene oxide and methyloxirane | 1 | - | 701-303-7 | 98 | ||||||
Oligomerisation reaction products of glyoxal and urea | 1 | 53037-34-6 | 610-945-6 | 35,26 | ||||||
Oligomers of rosin | 1 | 65997-05-9 | 500-163-2 | 10 | ||||||
222 OP | 1 | - | 700-733-2 | 44,1 | ||||||
ORANGE DER 8638 | 1 | - | 448-170-9 | 11,75 | ||||||
Orange II | 1 | 633-96-5 | 211-199-0 | 0,176 | 106453 | |||||
Orange sweet extract | 1 | 8028-48-6 | 232-433-8 | 31,1 | 123009 | |||||
Organosulphide | 1 | - | 482-120-7 | 1428 | ||||||
Orthoperiodic acid | 1 | 10450-60-9 | 233-937-0 | 0,1 | ||||||
Otto fuel II | 1 | 8006-61-9 | 232-349-1 | 837,5 | Carcinogenic | 531390 | ||||
Otto fuel II | 2 | 8006-61-9 | 232-349-1 | 837,5 | 1,9 | Carcinogenic | 531390 | |||
2-(1-Oxa-4-azaspiro[4.5]dec-4-yl)ethyl methacrylate | 1 | 4203-89-8 | 224-116-8 | 0,882 | ||||||
Oxacycloheptadec-10-en-2-one | 1 | 28645-51-4 | 249-120-7 | 16,4 | ||||||
Oxalic acid | 1 | 144-62-7 | 205-634-3 | 3,11 | TRGS900 | EU | 17910 | |||
Oxalonitrile | 1 | 460-19-5 | 207-306-5 | 18,84 | MAK | 38430 | ||||
2-(3-Oxazolidinyl)ethyl methacrylate | 1 | 46235-93-2 | 256-260-2 | 1,76 | ||||||
2-Oxepanone, polymer with 1,4-butanediol | 1 | 31831-53-5 | 608-670-1 | 18 | ||||||
2-Oxepanone, polymer with 2-Ethyl-2-(hydroxymethyl)-1,3-propanediol | 1 | 37625-56-2 | 500-099-5 | 3,5 | ||||||
2-Oxepanone, polymer with 1,6-hexanediol | 1 | 36609-29-7 | 609-271-5 | 3,5 | ||||||
Oxidised Crude Tall Oil | 1 | - | 938-639-0 | 70 | ||||||
[mu-[[3,3'-[(1-Oxido-1,2-diazenediyl)bis[[2-(hydroxy-kappa-O)- 4,1-phenylene]-2,1-diazenediyl-kappa-N1]]bis[4-(hydroxy-kappa-O)-2,7-naphthalenedisulfonato]](8-)]]dicopper, tetra sodium ammonium salt | 1 | 1713250-52-2 | 811-773-6 | 1,17 | ||||||
Oxirane, mono((C12-14-alkyloxy)methyl)derivs. | 1 | 68609-97-2 | 271-846-8 | 3,6 | 156848 | |||||
Oxirane, reaction products with Ammonia, distn. residues | 1 | 68953-70-8 | 273-224-1 | 5 | 5 | |||||
di-my-Oxo-bis-[(tetra-2-ethylhexanoate)molybdenum] | 1 | - | 700-831-5 | 3,53 | ||||||
N6-(1-Oxododecyl)-L-lysine | 1 | 52315-75-0 | 257-843-4 | 16,4 | ||||||
trans-1-(1-Oxohexadecyl)-4-[(1-oxohexadecyl)oxy]-L-proline | 1 | 41672-81-5 | 255-490-0 | 17,63 | 142453 | |||||
2-(2-Oxoimidazolidin-1-yl)ethyl methacrylate | 1 | 86261-90-7 | 289-214-5 | 9,8 | ||||||
N-(1-Oxooctyl)glycine | 1 | 14246-53-8 | 238-122-3 | 1,57 | 127708 | |||||
Oxo[(oxoalumanyl)oxy]alumane; silanedione | 1 | 142844-00-6 | 604-314-4 | 2,17 | ||||||
5-Oxo-DL-proline | 1 | 149-87-1 | 205-748-3 | 141 | ||||||
4-(1-Oxo-2-propenyl)-morpholine | 1 | 5117-12-4 | 418-140-1 | 132,24 | 901614 | |||||
N-(1-Oxotetradecyl)sarcosine | 1 | 52558-73-3 | 258-007-1 | 141,1 | ||||||
2-(2-Oxo-5-(1,1,3,3-tetramethylbutyl)-2,3-dihydro-1-benzofuran-3-yl)-4-(1,1,3,3-tetramethylbutyl)phenyl acetate | 1 | 216698-07-6 | 431-770-1 | 3 | 536086 | |||||
[(9-Oxo-9H-thioxanthen-2-yl)oxy]acetic acid | 1 | 84434-05-9 | 282-803-8 | 4,93 | ||||||
4-Oxo-4-(p-tolyl)butyric acid adduct with 4-Ethylmorpholine | 1 | 171054-89-0 | 419-240-6 | 4,42 | 536075 | |||||
Oxy alkylation products of glycerol and sucrose with propylenoxid (>1 - <6.5 mol PO) | 1 | - | 701-248-9 | 98 | ||||||
Oxybenzone | 1 | 131-57-7 | 205-031-5 | 27,7 | 492898 | |||||
2,2'-Oxybis[5,5-dimethyl-1,3,2-dioxaphosphorinane] 2,2'-disulphide | 1 | 4090-51-1 | 223-829-1 | 58,8 | ||||||
2,2'-Oxybis-ethanol diformate | 1 | 120570-77-6 | 601-722-4 | 4,3 | 8,7 | |||||
3,3`-Oxybis(ethylenoxy)bis(propylamine) | 1 | 4246-51-9 | 224-207-2 | 1 | 59 | 491415 | ||||
Oxybispropanediol | 1 | 59113-36-9 | 261-605-5 | 55 | 55 | 147816 | ||||
Oxybispropanol dibenzoate | 1 | 27138-31-4 | 248-258-5 | 8,8 | 495453 | |||||
4,4'-Oxydibenzenesulfonyl hydrazide | 1 | 80-51-3 | 201-286-1 | 0,1 | 0,7 | 15670 | ||||
2,2'-Oxydiethanol, propoxylated | 1 | 9051-51-8 | 500-031-4 | 98 | ||||||
2,2'-Oxydi(ethylamine) | 1 | 2752-17-2 | 220-395-5 | 0,08 | 0,16 | 113365 | ||||
Oxydiethylene dinitrate | 1 | 693-21-0 | 211-745-8 | 0,214 | 510791 | |||||
Ozone | 1 | 10028-15-6 | 233-069-2 | 0,024 | 4040 | |||||
P-1057 | 1 | - | 23,4 | |||||||
P-1401 | 1 | - | 0,53 | |||||||
Palladium(II) chloride | 1 | 7647-10-1 | 231-596-2 | 59,37 | 2570 | |||||
Palladium dihydroxide | 1 | 12135-22-7 | 235-219-2 | 47 | ||||||
Palladium (II) di(4-oxopent-2-en-2-oate) | 1 | 14024-61-4 | 237-859-8 | 25,5 | ||||||
Palmidrol | 1 | 544-31-0 | 208-867-9 | 49,3 | ||||||
Palmitic acid | 1 | 57-10-3 | 200-312-9 | 17,632 | 33990 | |||||
Palm oil, epoxidized | 1 | 1006899-79-1 | 805-711-7 | 5,87 | ||||||
Paraffin oils (petroleum), catalytic dewaxed heavy | 1 | 64742-70-7 | 265-174-4 | 5,58 | 2,73 | |||||
Paraffin oils (petroleum), catalytic dewaxed heavy | 2 | 64742-70-7 | 265-174-4 | 5,58 | ||||||
Paraffin oils (petroleum), catalytic dewaxed light | 1 | 64742-71-8 | 265-176-5 | 5,58 | 2,73 | |||||
Paraffin oils (petroleum), catalytic dewaxed light | 2 | 64742-71-8 | 265-176-5 | 5,58 | ||||||
Paraffin oils, sulfochlorinated, saponified | 1 | 68188-18-1 | 269-144-1 | 10 | 118 | |||||
Paraffin waxes and Hydrocarbon waxes, chloro, sulfochlorinated, saponified | 1 | - | 939-314-6 | 0,7 | ||||||
Paraffin waxes and Hydrocarbon waxes C14-17, chloro, sulfochlorinated, low sulphonated, saponified | 1 | - | 939-273-4 | 0,7 | ||||||
Paraffin waxes and Hydrocarbon waxes, chloro, sulphochlorinated, saponified, ammonium salt | 1 | - | 942-590-0 | 0,7 | ||||||
Paraffin waxes and Hydrocarbon waxes, oxidized, lithium salts | 1 | 68649-48-9 | 272-032-5 | 0,23 | ||||||
Paraffin oil | 1 | 8012-95-1 | 232-384-2 | 5 | 5 | 91110 | ||||
Paraffin waxes and Hydrocarbon waxes, oxidized | 1 | 68153-22-0 | 268-871-1 | 0,23 | ||||||
Paraquat dichloride | 1 | 1910-42-5 | 217-615-7 | 0,0864 | TRGS900 | MAK | 35430 | |||
(Pentabromophenyl)methyl acrylate | 1 | 59447-55-1 | 261-767-7 | 3,5 | 147959 | |||||
Pentaerythritol | 1 | 115-77-5 | 204-104-9 | 11,8 | 25930 | |||||
Pentaerythritol, ethoxylated, esters with acrylic acid | 1 | 51728-26-8 | 500-111-9 | 0,88 | ||||||
Pentaerythritol, propoxylated | 1 | 9051-49-4 | 500-030-9 | 98 | ||||||
Pentaerythritol, reaction product with fatty acids, C8 to 18 (even numbered) and/or branched and/or unsaturated | 1 | - | 484-420-3 | 9,8 | ||||||
Pentaerythritol tetraesters of n-C5, n-C7, n-C8, i-C9 and n-C10 fatty acids | 1 | 156558-98-4 | 451-190-0 | 4,93 | ||||||
Pentaerythritol tetra(2-ethylhexanoate) | 1 | 7299-99-2 | 230-743-8 | 70,52 | 121852 | |||||
Pentaerythritol tetrakis (3-(3,5-di-t-butyl-4-hydroxyphenyl)propionate) | 1 | 6683-19-8 | 229-722-6 | 10 | 494772 | |||||
Pentaerythritol tetrakis(3-mercaptopropionate) | 1 | 7575-23-7 | 231-472-8 | 40,13 | 1,74 | 122383 | ||||
Pentaerythritol tetranitrate | 1 | 78-11-5 | 201-084-3 | 220,4 | 490092 | |||||
Pentafluoroethane | 1 | 354-33-6 | 206-557-8 | 16444 | 103348 | |||||
N,N,N',N',N''-Pentamethyl-N-C16-18 (even numbered) C18 unsat.-alkyl-1,3-propanediammonium chloride | 1 | 1211950-04-7 | 629-716-7 | 1,76 | ||||||
2,4,6,8,10-Pentamethylcyclopentasiloxane | 1 | 6166-86-5 | 228-204-7 | 6,6 | 119715 | |||||
7,7,8,9,9-Pentamethyl-6,6a,7,8,9,9a-hexahydro-5H-cyclopenta[h]quinazoline | 1 | 1392325-86-8 | 801-694-5 | 6,94 | ||||||
1,2,2,6,6-Pentamethyl-4-piperidinol | 1 | 2403-89-6 | 219-292-8 | 11,2 | 112521 | |||||
3,3,5,7,7-Pentamethyl-1,2,4-trioxepane | 1 | - | 455-560-2 | 1,76 | ||||||
n-Pentane | 1 | 109-66-0 | 203-692-4 | 3000 | TRGS900 | MAK | EU | 10040 | ||
1,5-Pentanediamine, 2-methyl-, reaction products with 2-ethyl-1,4-butanediamine and glycidyl tolyl ether | 1 | 90480-76-5 | 291-813-1 | 1,64 | ||||||
1,5-Pentanediol | 1 | 111-29-5 | 203-854-4 | 35 | 37850 | |||||
1,2-Pentanediol | 1 | 5343-92-0 | 226-285-3 | 17,6 | 39730 | |||||
Pentane-2,4-dione | 1 | 123-54-6 | 204-634-0 | 84 | TRGS900 | MAK | 30800 | |||
1-Pentanol | 1 | 71-41-0 | 200-752-1 | 73,16 | TRGS900 | MAK | 13590 | |||
3-Pentanone | 1 | 96-22-0 | 202-490-3 | 705 | 708 | 13610 | ||||
2-Pentanone, O,O',O''-(ethenylsilylidyne)trioxime | 1 | 58190-62-8 | 700-810-0 | 0,229 | ||||||
2-Pentanone, 4-methyl-, reaction products with 2-(2-aminoethoxy)ethanol | 1 | 72480-17-2 | 615-768-8 | 3,5 | ||||||
2-Pentanone, O,O',O''-(phenylsilylidyne)trioxime | 1 | 1170315-90-8 | 700-833-6 | 0,176 | ||||||
2-Pentanone oxime | 1 | 623-40-5 | 484-470-6 | 25 | ||||||
2-Pentanone oxime | 2 | 623-40-5 | 484-470-6 | 8,3 | ||||||
N-Pentanoyl-N-{[2'-(1H-tetrazol-5-yl)biphenyl-4-yl]methyl}-L-valine | 1 | 137862-53-4 | 604-045-2 | 13,8 | ||||||
Pentapotassium 2-[2-[2-(bis(carboxylatomethyl)amino)ethyl-(carboxylatomethyl)amino]ethyl-(carboxylatomethyl)amino]acetate | 1 | 7216-95-7 | 404-290-3 | 1,5 | 900421 | |||||
Pentasodium 4-amino-6-[[5-[(4-amino-6-chloro-1,3,5-triazin-2-yl)amino]-2-sulphonatophenyl]azo]-3-[(2,5-disulphonatophenyl)azo]-5-hydroxynaphthalene-2,7-disulphonate | 1 | 68259-02-9 | 269-505-3 | 0,6 | ||||||
Pentasodium 7-(4-(4-(5-amino-4-sulfonato-2-(4-((2-(sulfonato-ethoxy)sulfonyl)phenylazo)phenylamino)-6-chloro-1,3,5-triazin-2-yl)amino-2-ureidophenylazo)naphtalene-1,3,6-trisulfonate | 1 | 171599-84-1 | 422-930-1 | 47 | 902414 | |||||
Pentasodium bis[5-[(4-amino-6-chloro-1,3,5-triazin-2-yl)amino]-4-hydroxy-3-[(2-hydroxy-5-nitrophenyl)azo]naphthalene-2,7-disufonato(4-)]chromate(5-) | 1 | 79828-43-6 | 279-317-3 | 29 | 163512 | |||||
Pentasodium triphosphate | 1 | 7758-29-4 | 231-838-7 | 0,661 | 5450 | |||||
Pentasodium 3,7,11-tris(carboxylatomethyl)-15-(C12-18)-alkyl-3,7,11,15-tetraazaheptadecane-1,17-dioate | 1 | 2060541-51-5 | 825-403-6 | 11,1 | ||||||
2-Pentene, 1,1,1,2,3,4,5,5,5-nonafluoro-4-(trifluoromethyl)-, (E)- | 1 | 3709-71-5 | 807-113-1 | 29 | ||||||
4-tert-Pentylcyclohexanone | 1 | 16587-71-6 | 240-642-0 | 20 | ||||||
tert-Pentyl hydroperoxide | 1 | 3425-61-4 | 222-321-7 | 3 | ||||||
tert-Pentyl peroxypivalate | 1 | 29240-17-3 | 249-530-6 | 2,64 | ||||||
Pentyl propionate | 1 | 624-54-4 | 210-852-7 | 20,2 | 510046 | |||||
4-trans-Pentyl-4'-trans-propyl-[1,1'-bicyclohexyl] | 1 | 92263-41-7 | 618-832-3 | 1,64 | ||||||
Pentyl salicylate | 1 | 2050-08-0 | 218-080-2 | 3,17 | ||||||
Peppermint extract | 1 | 84082-70-2 | 282-015-4 | 35,3 | 165892 | |||||
Peracetic acid solution | 1 | 79-21-0 | 201-186-8 | 0,56 | 0,56 | MAK | 39230 | |||
Perfluamine | 1 | 338-83-0 | 206-420-2 | 21338 | 103242 | |||||
Perfluorbutylethylene | 1 | 19430-93-4 | 243-053-7 | 67,4 | 131871 | |||||
Perfluorbutylethylene | 2 | 19430-93-4 | 243-053-7 | 1031,4 | 131871 | |||||
Perfluoro N-alkyl morpholines, C=1,3 | 1 | - | 473-390-7 | 16,341 | ||||||
Perfluoropropyl vinyl ether | 1 | 1623-05-8 | 216-600-2 | 294 | 110433 | |||||
Peroxyacetic acid, reaction products with N2,N2’-1,6-hexanediylbis[N4,N6-dibutyl-N2,N4,N6-tris(2,2,6,6-tetramethyl-4-piperidinyl)-1,3,5-triazine-2,4,6-triamine, hydrogenated | 1 | 1902936-62-2 | 812-927-5 | 10 | ||||||
PERYLEN SCHWARZ I | 1 | - | 479-300-2 | 1,25 | 1,25 | |||||
Perylene-3,4:9,10-tetracarboxydiimide | 1 | 81-33-4 | 201-344-6 | 1,25 | 1,25 | 491212 | ||||
Perylene-3,4:9,10-tetracarboxylic dianhydride | 1 | 128-69-8 | 204-905-3 | 1,25 | 1,25 | 492891 | ||||
Petrolatum | 1 | 8009-03-8 | 232-373-2 | 2,73 | ||||||
Petrolatum (petroleum), clay-treated | 2 | 100684-33-1 | 309-706-6 | 2,7 | ||||||
Petrolatum (petroleum), hydrotreated | 1 | 92045-77-7 | 295-459-9 | 2,73 | ||||||
Petrolatum (petroleum), oxidized | 2 | 64743-01-7 | 265-206-7 | 2,7 | ||||||
Petrolatum (petroleum), oxidized, Bu ester | 1 | 90669-48-0 | 292-642-5 | 0,24 | ||||||
Petroleum heavy cycle oil, co-processed (catalytic cracking) with renewable hydrocarbons of plant or animal origin | 1 | - | 701-293-4 | 0,18 | ||||||
Petroleum naphtha fraction, co-processed (catalytic cracking) with renewable hydrocarbons of plant and/or animal origin | 1 | - | 701-149-0 | 840 | ||||||
Petroleum naphtha fraction, co-processed (catalytic cracking) with renewable hydrocarbons of plant and/or animal origin | 2 | - | 701-149-0 | 840 | ||||||
Petroleum naphtha fraction, co-processed (hydrotreatment) with renewable hydrocarbons of plant or animal origin | 1 | - | 941-381-1 | 840 | ||||||
Petroleum products, hydrofiner-powerformer reformates | 1 | 68514-79-4 | 271-058-4 | 837,5 | ||||||
Phenethyl isobutyrate | 1 | 103-48-0 | 203-116-1 | 3,53 | ||||||
Phenethyl benzoate | 1 | 94-47-3 | 202-336-5 | 49,3 | ||||||
Phenethyl butyrate | 1 | 103-52-6 | 203-119-8 | 16,4 | ||||||
Phenethyl phenylacetate | 1 | 102-20-5 | 203-013-1 | 4,9 | 101469 | |||||
Phenethyl phenylacetate | 2 | 102-20-5 | 203-013-1 | 0,628 | 101469 | |||||
Phenol | 1 | 108-95-2 | 203-632-7 | 8 | TRGS900 | EU | 10430 | |||
Phenol, alkylation products with C10 - 15 branched olefins derived from propene oligomerization, reaction products with sulphur monochloride and decene, reaction products with polybutenyl benzenesulphonic acid, carbon dioxide and calcium hydroxide | 1 | - | 903-161-3 | 1,405 | ||||||
Phenol, 2,4-dinitro-, sulfurized, leuco derivatives | 1 | 66241-11-0 | 266-273-5 | 176 | ||||||
Phenol, dodecyl-, branched, sulfurized | 1 | 96152-43-1 | 306-115-5 | 3,526 | ||||||
Phenol, ethoxylated, esters with acrylic acid | 1 | 56641-05-5 | 500-133-9 | 97 | 12 | |||||
Phenol, heptyl derivs. | 1 | 72624-02-3 | 276-743-1 | 1,76 | ||||||
Phenol, isopropylated, phosphate (3:1) | 1 | 68937-41-7 | 273-066-3 | 0,145 | TRGS900 | MAK | 157929 | |||
Phenol, 4-methyl-, reaction products with Dicyclopentadiene and Isobutylene | 1 | 68610-51-5 | 271-867-2 | 0,29 | ||||||
Phenol, 4,4'-(1-methylethylidene)bis-, polymer with (chloromethyl)oxirane, dodecanoate 2-propenoate | 1 | 68071-07-8 | 614-255-6 | 10,58 | ||||||
Phenol, 4,4'-(1-methylethylidene)bis-, oligomeric reaction products with 2-(chloromethyl)oxirane, reaction products with 1,3-benzenedimethanamine | 1 | 113930-69-1 | 500-302-7 | 0,493 | ||||||
Phenol, methylstyrenated | 1 | - | 700-960-7 | 1,41 | ||||||
Phenol, nonyl-, phosphite (3:1) | 1 | - | 701-028-2 | 23,6 | ||||||
Phenol, paraalkylation products with C10-15 branched olefins (C12 rich) derived from propene oligomerization, carbonates, calcium salts, overbased, sulfurized, including distillates (petroleum), hydrotreated, solvent-refined, solvent-dewaxed, or catalytic dewaxed, light or heavy paraffinic C15-C50 | 1 | - | 701-251-5 | 3,5 | ||||||
Phenol, paraalkylation products with C10-15 branched olefins (C12 rich) derived from propene oligomerization, carbonates, calcium salts, overbased, sulfurized, including distillates (petroleum), hydrotreated, solvent-refined, solvent-dewaxed, or catalytic dewaxed, light or heavy paraffinic C15-C50 | 2 | - | 701-251-5 | 0,14 | ||||||
Phenol, paraalkylation products with C12-rich branched olefins derived from propene oligomerisation, reaction products with sulphur monochloride and decene, reaction products with Benzoic acid, 2-hydroxy-,C14-18 alkyl dervatives, polybutenyl benzenesulphonic acid, carbon dioxide and calcium hydroxide | 1 | - | 903-162-9 | 1,405 | ||||||
Phenol, paraalkylation products with C10-15 branched olefins (C12 rich) derived from propene oligomerization, carbonates, calcium salts, sulfurized, including distillates (petroleum), hydrotreated, solvent-refined, solvent-dewaxed, or catalytic dewaxed, l light or heavy paraffinic C15-C50 | 1 | - | 701-208-0 | 3,5 | ||||||
Phenol, paraalkylation products with C10-15 branched olefins (C12 rich) derived from propene oligomerization, reaction products with sulphur monochloride and dec-1-ene | 1 | - | 701-254-1 | 3,526 | ||||||
Phenol, paraalkylation products with C12-rich branched olefins derived from propene oligomerisation, sulfurized, calcium salts, overbased, reacted with alkylene carbonate, including distillates (petroleum), heavy paraffinic C10-C50 | 1 | - | 70,528 | |||||||
Phenol, paraalkylation products with C10-15 branched olefins (C12 rich) derived from propene oligomerization, calcium salts, sulfurized, including distillates (petroleum), hydrotreated, solvent-refined, solvent-dewaxed, or catalyc dewaxed, light or heavy | 1 | - | 701-249-4 | 3,5 | ||||||
Phenol, reaction products with 1-Halo-4-phenoxybenzene and 1,1’–Oxybis[4-halobenzene], halogenated | 1 | - | 11,7 | |||||||
Phenol, sulfonated | 1 | 74665-14-8 | 277-962-5 | 35 | ||||||
Phenol, 2,4-bis(1,1-dimethylethyl)-, phosphite (3:1) | 1 | 31570-04-4 | 250-709-6 | 4,1 | 495542 | |||||
Phenol-formaldehyde resin | 1 | 9003-35-4 | 500-005-2 | 98,7 | 531838 | |||||
Phenothiazine | 1 | 92-84-2 | 202-196-5 | 0,53 | 29550 | |||||
3-Phenoxybenzylic alcohol | 1 | 13826-35-2 | 237-525-1 | 2,888 | ||||||
2-Phenoxyethanol | 1 | 122-99-6 | 204-589-7 | 5,7 | 5,7 | TRGS900 | MAK | 20470 | ||
2-(2-Phenoxyethoxy)ethanol | 1 | 104-68-7 | 203-227-5 | 10,6 | 42,9 | 530426 | ||||
2-Phenoxyethyl methacrylate | 1 | 10595-06-9 | 234-201-1 | 84 | 12 | |||||
2-Phenoxyethyl acrylate | 1 | 48145-04-6 | 256-360-6 | 77 | 12 | 143216 | ||||
2-Phenoxyethyl isobutyrate | 1 | 103-60-6 | 203-127-1 | 0,34 | 491256 | |||||
4-Phenoxyphenol | 1 | 831-82-3 | 212-611-1 | 1,04 | ||||||
Phenylacetaldehyde | 1 | 122-78-1 | 204-574-5 | 4,94 | 491163 | |||||
Phenylacetic acid | 1 | 103-82-2 | 203-148-6 | 16,4 | 25530 | |||||
1-Phenylazo-2-naphthol | 1 | 842-07-9 | 212-668-2 | 11,2 | 107487 | |||||
α-Phenyl-1H-benzimidazole-2-methanol | 1 | 50-97-5 | 200-073-0 | 4,11 | ||||||
2-Phenyl-1H-benzimidazole-5-sufonic acid | 1 | 27503-81-7 | 248-502-0 | 7 | 136421 | |||||
4-Phenylbenzophenone | 1 | 2128-93-0 | 218-345-2 | 2,35 | ||||||
2-(4-Phenylbenzoyl)benzoic acid | 1 | 42797-18-2 | 700-862-4 | 1,64 | ||||||
Phenyl bis(2,4,6-trimethylbenzoyl)-phosphine oxide | 1 | 162881-26-7 | 423-340-5 | 21 | 902489 | |||||
Phenyl bis(2,4,6-trimethylbenzoyl)-phosphine oxide | 2 | 162881-26-7 | 423-340-5 | 14,8 | 902489 | |||||
Phenyl bis(2,4,6-trimethylbenzoyl)-phosphine oxide | 3 | 162881-26-7 | 423-340-5 | 7,84 | 902489 | |||||
Phenyl bis(2,4,6-trimethylbenzoyl)-phosphine oxide | 4 | 162881-26-7 | 423-340-5 | 11,75 | 902489 | |||||
Phenyl bis(2,4,6-trimethylbenzoyl)-phosphine oxide | 5 | 162881-26-7 | 423-340-5 | 16,46 | 902489 | |||||
4-Phenyl-3-buten-2-one | 1 | 122-57-6 | 204-555-1 | 7,16 | 492852 | |||||
1,4-Phenylene bis[(4-phenoxyphenyl)-methanone] | 1 | 54299-17-1 | 620-097-9 | 13,8 | ||||||
4,4'-[1,3-Phenylenebis(azo)]bisbenzene-1,3-diamine | 1 | 1052-38-6 | 213-888-1 | 1,4 | ||||||
2,2-(1,4-Phenylene)bis((4H-3,1-benzoxazine-4-one) | 1 | 18600-59-4 | 418-280-1 | 0,176 | 901915 | |||||
2,2-(1,4-Phenylene)bis((4H-3,1-benzoxazine-4-one) | 2 | 18600-59-4 | 418-280-1 | 0,15 | 901915 | |||||
N,N'-Phenylene-1,4-bis[4-[(2,5-dichlorophenyl)azo]-3-hydroxynaphthalene-2-carboxamide] | 1 | 3905-19-9 | 223-460-6 | 3 | 115815 | |||||
1,3-Phenylenebis((4-hydroxyphenyl)methanone) | 1 | 5436-05-5 | 816-325-3 | 4,93 | ||||||
m-Phenylenebis(methylamine) | 1 | 1477-55-0 | 216-032-5 | 0,2 | 1,2 | 491362 | ||||
4,4'-(1,3-Phenylene-bis(1-methylethylidene))bis-phenol | 1 | 13595-25-0 | 428-970-4 | 2,3 | 536046 | |||||
1,1'-(1,3-Phenylene)bis-1H-pyrrole-2,5-dione | 1 | 3006-93-7 | 221-112-8 | 0,176 | ||||||
m-Phenylene di(acetate) | 1 | 108-58-7 | 203-596-2 | 5,43 | ||||||
m-Phenylenediamine | 1 | 108-45-2 | 203-584-7 | 0,24 | 16690 | |||||
p-Phenylenediamine | 1 | 106-50-3 | 203-404-7 | 0,23 | TRGS900 | MAK | 16890 | |||
(Phenylenediisopropylidene)bis(tert-butylperoxide) | 1 | 25155-25-3 | 246-678-3 | 19,7 | 495392 | |||||
4,4'-(1-Phenylethane-1,1-diyl)bis(heptyloxybenzene) | 1 | 1799707-26-8 | 811-683-7 | 10,58 | ||||||
1-Phenylethanol | 1 | 98-85-1 | 202-707-1 | 4,66 | 22270 | |||||
2-Phenylethanol | 1 | 60-12-8 | 200-456-2 | 59,9 | 29280 | |||||
1-Phenylethyl acetate | 1 | 93-92-5 | 202-288-5 | 13,22 | 5,29 | 491241 | ||||
2-Phenylethyl acetate | 1 | 103-45-7 | 203-113-5 | 6,5 | 492648 | |||||
(R)-alpha-Phenylethylammonium-(-)-(1R, 2S)-(1,2-epoxypropyl)phosphonate monohydrate | 1 | 25383-07-7 | 418-570-8 | 5,3 | 533043 | |||||
(Phenylethyl)benzene | 1 | 38888-98-1 | 254-179-7 | 0,3 | 141299 | |||||
4-(1-Phenylethyl)-benzene-1,3-diol | 1 | 85-27-8 | 480-070-0 | 1,1 | ||||||
2-Phenylhexanenitrile | 1 | 3508-98-3 | 423-460-8 | 3,4 | 902487 | |||||
(2Z)-2-Phenylhex-2-enenitrile | 1 | 130786-09-3 | 482-160-5 | 2,351 | ||||||
2-Phenyl-2-imidazoline | 1 | 936-49-2 | 213-313-4 | 0,72 | 40980 | |||||
2-Phenyl-2-imidazoline pyromellitate | 1 | 54553-90-1 | 259-224-4 | 1,92 | 491643 | |||||
2-(Phenylmethoxy)naphthalene | 1 | 613-62-7 | 405-490-3 | 5,78 | 530684 | |||||
2-(Phenylmethoxy)naphthalene | 2 | 613-62-7 | 405-490-3 | 1,5 | 530684 | |||||
2-(Phenylmethoxy)naphthalene | 3 | 613-62-7 | 405-490-3 | 30 | 530684 | |||||
(2E)-2-(Phenylmethylidene)octanal | 1 | 165184-98-5 | 639-566-4 | 0,078 | ||||||
N-Phenyl-1-naphthylamine | 1 | 90-30-2 | 201-983-0 | 0,18 | MAK | 21470 | ||||
(2E)-3-Phenyl-2-pentyl-prop-2-enal | 1 | 78605-96-6 | 800-696-3 | 3,71 | ||||||
(2E)-3-Phenyl-2-pentyl-prop-2-enal | 2 | 78605-96-6 | 800-696-3 | 19,7 | ||||||
2-Phenylphenol, sodium salt | 1 | 132-27-4 | 205-055-6 | 19,25 | TRGS900 | MAK | 490162 | |||
3-Phenyl-1-propanol | 1 | 122-97-4 | 204-587-6 | 24,68 | 37920 | |||||
2-Phenylpropene | 1 | 98-83-9 | 202-705-0 | 246 | TRGS900 | MAK | EU | 11460 | ||
3-Phenylpropyl benzoate | 1 | 60045-26-3 | 611-930-7 | 2,94 | ||||||
1-Phenyl-3-pyrazolidone | 1 | 92-43-3 | 202-155-1 | 19,9 | 22910 | |||||
1-Phenyl-1H-pyrrole-2,5-dione | 1 | 941-69-5 | 213-382-0 | 0,009 | 493826 | |||||
3-Phenyl-5-(2-thienyl)-1,2,4-oxadiazole | 1 | 330459-31-9 | 810-533-8 | 1,13 | ||||||
6-Phenyl-1,3,5-triazine-2,4-diyldiamine | 1 | 91-76-9 | 202-095-6 | 3,3 | 570059 | |||||
1,1'-[(6-Phenyl-1,3,5-triazine-2,4-diyl)diimino]bisanthraquinone | 1 | 4118-16-5 | 223-912-2 | 1,25 | 1,25 | |||||
N-Phenyl-N-[(trichloromethyl)thio]benzenesulfonamide | 1 | 2280-49-1 | 218-915-0 | 6 | 491375 | |||||
Phloroglucinol | 1 | 108-73-6 | 203-611-2 | 18 | 101709 | |||||
Phosgene | 1 | 75-44-5 | 200-870-3 | 0,4 | TRGS900 | MAK | EU | 1340 | ||
Phosphinic acid, diethyl-, zinc salt | 1 | 284685-45-6 | 457-580-7 | 29,4 | ||||||
Phosphonic acid | 1 | 13598-36-2 | 237-066-7 | 2,94 | 3380 | |||||
Phosphonic acid, calcium salt (2:1) | 1 | 13780-04-6 | 813-845-2 | 34,6 | ||||||
Phosphonic acid, diammonium salt, monohydrate | 1 | 51503-61-8 | 610-672-2 | 41,2 | ||||||
Phosphonic acid, magnesium salt (2:1) | 1 | 13598-61-3 | 814-750-9 | 32 | ||||||
Phosphonic acid, potassium salt (1:1) | 1 | 13977-65-6 | 604-162-9 | 41,2 | ||||||
Phosphonium, tetrakis(hydroxymethyl)-, chloride (1:1), reaction products with 1-Tetradecanamine and Urea | 1 | 359406-89-6 | 436-230-7 | 0,44 | ||||||
Phosphonium, tetrakis(hydroxymethyl)-, chloride (1:1), polymer with urea | 1 | 27104-30-9 | 500-057-6 | 1,15 | ||||||
Phosphonium, tetrakis(hydroxymethyl)-, chloride (1:1), polymer with urea | 2 | 27104-30-9 | 500-057-6 | 1,4 | ||||||
1-Phosphonobutane-1,2,3,4-tetracarboxylate and 2-Phosphonosuccinate sodium salts | 1 | - | 10,6 | |||||||
2-Phosphonobutane-1,2,4-tricarboxylic acid | 1 | 37971-36-1 | 253-733-5 | 15 | 492194 | |||||
[[(Phosphonomethyl)imino]bis[ethane-2,1-diylnitrilobis(methylene)]]tetrakisphosphonic acid | 1 | 15827-60-8 | 239-931-4 | 10 | 7,27 | 30940 | ||||
[[(Phosphonomethyl)imino]bis[hexamethylenenitrilobis(methylene)]]tetrakisphosphonic acid | 1 | 34690-00-1 | 252-156-6 | 0,02 | 139542 | |||||
Phosphoric acid, linear and branched Octyl esters | 1 | - | 947-957-9 | 7,4 | ||||||
Phosphoric acid, mixed decyl and octyl esters, compds. with diethanolamine | 1 | 68425-57-0 | 619-536-7 | 1,4 | ||||||
Phosphoric acid | 1 | 7664-38-2 | 231-633-2 | 1 | 10,7 | TRGS900 | MAK | EU | 1800 | |
Phosphoric acid | 2 | 7664-38-2 | 231-633-2 | 1 | TRGS900 | MAK | EU | 1800 | ||
Phosphoric acid | 3 | 7664-38-2 | 231-633-2 | 2,92 | TRGS900 | MAK | EU | 1800 | ||
Phosphoric acid C12-alkyl and C18-alkyl esters, potassium salts | 1 | - | 947-924-9 | 24,68 | ||||||
Phosphoric acid, C8-12(even-numbered) linear Alkyl esters | 1 | - | 947-954-2 | 7,4 | ||||||
Phosphoric acid, C4 and C12-14(even-numbered) Alkyl Esters, Ammonium Salts | 1 | - | 947-971-5 | 7,4 | ||||||
Phosphoric acid, C16-18-alkyl esters, potassium salts | 1 | 90506-45-9 | 291-907-2 | 34,94 | ||||||
Phosphoric acid, C12-18-alkyl esters, potassium salts | 1 | 90506-43-7 | 291-905-1 | 16,4 | ||||||
Phosphoric acid, C14-15 branched and linear alkyl esters, potassium salts | 1 | 1893414-79-3 | 812-497-9 | 23,3 | ||||||
Phosphoric acid, Butyl ester | 1 | 12788-93-1 | 235-826-2 | 35,3 | 125838 | |||||
Phosphoric acid, Butyl ester | 2 | 12788-93-1 | 235-826-2 | 3,29 | 125838 | |||||
Phosphoric acid, chromium(3+) salt (1:2.5) | 1 | - | 946-354-8 | 6,25 | ||||||
Phosphoric acid, dodecyl ester, potassium salt | 1 | 39322-78-6 | 254-414-3 | 88,2 | 141504 | |||||
Phosphoric acid, Esters with Alcohols, C11-14 iso, C13-rich | 1 | - | 947-969-4 | 7,4 | ||||||
Phosphoric acid, 2-Ethylhexyl ester | 1 | 12645-31-7 | 235-741-0 | 36,73 | 125765 | |||||
Phosphoric acid, 2-ethylhexyl ester, ammonium salt | 1 | 86014-62-2 | 289-108-9 | 1,47 | ||||||
Phosphoric acid, hexadecyl esters, potassium salts with cetyl alcohol and isostearyl isostearate | 1 | - | 947-751-9 | 3,84 | ||||||
Phosphoric acid, C11-14 (C13-rich)-isoalkyl mono- and di-esters, partially salted with 1-Propanamine, 3-(tridecyloxy)-, branched | 1 | - | 947-480-6 | 3,29 | ||||||
Phosphoric acid, isononyl ester | 1 | 84988-61-4 | 284-851-5 | 2,94 | ||||||
Phosphoric acid, mixed esters with alcohols, C7-9-iso-, C8-rich and alcohols, C11-14-iso-, C13-rich, ethoxylated, potassium salt | 1 | - | 947-738-8 | 14,8 | ||||||
Phosphoric acid, mixed esters with Bu alc. and ethylene glycol | 1 | 84962-20-9 | 284-716-0 | 17,6 | 168318 | |||||
Phosphoric acid, mono and bis-linear butyl esters, potassium salts | 1 | - | 947-719-4 | 7,4 | ||||||
Phosphoric acid, mono- and di-C6-10-alkyl esters | 1 | 68307-94-8 | 269-616-7 | 5,87 | 154885 | |||||
Phosphoric acid, mono- and di-C11-14 (linear and branched) alkyl esters | 1 | 154518-38-4 | 800-484-0 | 34,94 | ||||||
Phosphoric acid, mono- and di-C16-20-(even numbered, branched and linear)-alkyl esters | 1 | - | 946-101-1 | 16,46 | ||||||
Phosphoric acid, mono- and di-C16-18 (even numbered) alkyl esters, salts with 2,2'-iminodiethanol | 1 | - | 950-746-4 | 1,4 | ||||||
Phosphoric acid, mono- and di-isotridecyl esters, compound with 2,2'-Iminobis[ethanol] | 1 | - | 947-589-9 | 1,65 | ||||||
Phosphoric acid, mono- and di-isotridecyl esters, potassium salts | 1 | - | 946-154-0 | 16,46 | ||||||
Phosphoric acid, mono- and di-C16-18 (even numbered) alkyl esters | 1 | - | 939-526-9 | 34,94 | ||||||
Phosphoric acid, mono- and di-C12-18-(even numbered)-alkyl esters, sodium salts | 1 | - | 947-360-3 | 16,46 | ||||||
Phosphoric acid, butyl ester, sodium salt | 1 | 53126-67-3 | 258-380-0 | 0,74 | ||||||
Phosphoric acid, decyl octyl ester | 1 | 68186-45-8 | 269-041-1 | 8,23 | ||||||
Phosphorodithioic acid, O,O-di-dodecyl-esters, zinc salts, neutral and basic | 1 | 4563-56-8 | 821-762-8 | 4,11 | ||||||
Phosphorodithioic acid, mixed O,O-Bis(sec-Butyl and 1,3-Dimethylbutyl) esters, zinc salts | 1 | 68784-31-6 | 272-238-5 | 2,93 | ||||||
Phosphorodithioic acid, mixed O,O-Bis(iso-Butyl and Pentyl) esters, zinc salts | 1 | 68457-79-4 | 270-608-0 | 8,13 | ||||||
Phosphorodithioic acid, mixed O,O-Bis(1,3-dimethylbutyl and iso-Propyl) esters, zinc salts | 1 | 84605-29-8 | 283-392-8 | 8,31 | ||||||
Phosphorodithioic acid, mixed O,O-Bis(2-ethylhexyl and iso-Butyl and iso-Propyl) esters, zinc salts | 1 | 85940-28-9 | 288-917-4 | 6,6 | ||||||
Phosphorodithioic acid, mixed O,O-bis(2-ethylhexyl and iso-Bu and pentyl) esters, zinc salts | 1 | 68988-45-4 | 273-527-9 | 6,8 | ||||||
Phosphorodithioic acid, mixed O,O-bis(2-ethylhexyl and iso-Bu) esters, zinc salts | 1 | 68442-22-8 | 270-478-5 | 8,05 | ||||||
Phosphorodithioic acid, mixed O,O-Bis(2-ethylhexyl and iso-Propyl) esters, zinc salts | 1 | 68909-93-3 | 272-723-1 | 8,03 | ||||||
Red phosphorus | 1 | 7723-14-0 | 231-768-7 | 97,95 | 3930 | |||||
Phosphorus pentoxide | 1 | 1314-56-3 | 215-236-1 | 1 | TRGS900 | MAK | EU | 1850 | ||
Phosphorus trichloride | 1 | 7719-12-2 | 231-749-3 | 1,1 | TRGS900 | MAK | 2530 | |||
Phthalaldehyde | 1 | 643-79-8 | 211-402-2 | 16,1 | ||||||
Phthalic acid | 1 | 88-99-3 | 201-873-2 | 10 | 175 | 10790 | ||||
Phthalic anhydride | 1 | 85-44-9 | 201-607-5 | 32,2 | 13390 | |||||
Phthalocyanine | 1 | 574-93-6 | 209-378-3 | 4 | 23920 | |||||
12H-Phthaloperin-12-one | 1 | 6925-69-5 | 230-049-5 | 12,3 | 121262 | |||||
Phthalylsulfathiazole | 1 | 85-73-4 | 201-627-4 | 1,423 | 100856 | |||||
4-Picoline | 1 | 108-89-4 | 203-626-4 | 2,5 | 12430 | |||||
2-Picoline | 1 | 109-06-8 | 203-643-7 | 2,5 | 18360 | |||||
Pigment Red 3092C | 1 | - | 419-370-3 | 3 | ||||||
Pigment Yellow FC 26290 | 1 | - | 411-080-5 | 98 | ||||||
alpha-Pinene | 1 | 80-56-8 | 201-291-9 | 3,8 | 491170 | |||||
(1S)-alpha-Pinene | 1 | 7785-26-4 | 232-077-3 | 3,8 | ||||||
(+)-Pin-2(3)-ene | 1 | 7785-70-8 | 232-087-8 | 0,933 | ||||||
(+)-Pin-2(3)-ene | 2 | 7785-70-8 | 232-087-8 | 5,69 | ||||||
(1S)-beta-Pinene | 1 | 18172-67-3 | 242-060-2 | 5,69 | ||||||
α-Pinene and β-Pinene oligomers | 1 | 31393-98-3 | 608-613-0 | 17,7 | ||||||
PINE OIL 50% | 1 | - | 7,05 | |||||||
Piperazine | 1 | 110-85-0 | 203-808-3 | 0,3 | 0,1 | TRGS900 | EU | 23850 | ||
Piperazine adipate | 1 | 142-88-1 | 205-569-0 | 2,043 | 102662 | |||||
Piperazine phosphate | 1 | 1951-97-9 | 217-775-8 | 1,029 | 111340 | |||||
N-[2-(Piperazin-1-yl)ethyl]C18-unsatured-alkylamide | 1 | 1228186-18-2 | 629-767-5 | 14,7 | ||||||
2-Piperazin-1-ylethylamine | 1 | 140-31-8 | 205-411-0 | 0,015 | 10,6 | 17780 | ||||
Piperidine | 1 | 110-89-4 | 203-813-0 | 7,05 | 15140 | |||||
2-Piperidinoethanol | 1 | 3040-44-6 | 221-244-6 | 1,85 | 28770 | |||||
Piperonal | 1 | 120-57-0 | 204-409-7 | 17,6 | 492835 | |||||
Piperonylbutoxide | 1 | 51-03-6 | 200-076-7 | 1,6 | 35450 | |||||
Piperonylbutoxide | 2 | 51-03-6 | 200-076-7 | 3,875 | 3,875 | 35450 | ||||
Pivalic acid | 1 | 75-98-9 | 200-922-5 | 2,94 | 37490 | |||||
Platinum(IV) aqua hydroxo nitrato complexes | 1 | - | 701-319-4 | 0,5 | ||||||
Poly (dipropyleneglycol) phenyl phosphite | 1 | 116265-68-0 | 601-420-2 | 0,53 | ||||||
Polyethylene, Polyamine, Pentaethylenehexamine fraction | 1 | - | 701-266-7 | 0,82 | ||||||
Polyethylene glycol, molecular weight 200 - 600 | 1 | 25322-68-3 | 500-038-2 | 40,2 | TRGS900 | MAK | 531416 | |||
Polyethylene glycol butyl ether | 1 | 9004-77-7 | 500-012-0 | 245 | ||||||
Polyethylene glycol butyl ether | 2 | 9004-77-7 | 500-012-0 | 195 | ||||||
Polyethylene glycol lauryl ether | 1 | 9002-92-0 | 500-002-6 | 4,93 | 531835 | |||||
Polyethylene glycol stearyl ether | 1 | 9005-00-9 | 500-017-8 | 294 | 531849 | |||||
Polyethylenepolyamines | 1 | 68131-73-7 | 268-626-9 | 0,82 | 496219 | |||||
Polymer with 2-Butyne-1,4-Diol and (Chloromethyl-)Oxirane, Brominated, Dehydrochlorinated, Methoxylated | 1 | 86675-46-9 | 617-903-6 | 6 | ||||||
Poly[oxy(methyl-1,2-ethanediyl)], a-hydro-¿-hydroxy-, ether with 2-ethyl-2-(hydroxymethyl)-1,3-propanediol (3:1), 2-propenoate | 1 | 68890-85-7 | 676-712-6 | 5,88 | ||||||
Poly[oxy(methyl-1,2-ethanediyl)], a-hydro-¿-hydroxy-, ether with 2-ethyl-2-(hydroxymethyl)-1,3-propanediol (3:1), 2-propenoate | 2 | 68890-85-7 | 676-712-6 | 16,46 | ||||||
Poly(oxy-1,2-ethanediyl), .alpha.-sulfo-.omega.-hydroxy-, C8-10 (even numbered)-alkyl ethers, ammonium salts (< 2.5EO) | 1 | 68891-29-2 | 500-233-2 | 175 | ||||||
Poly(oxy-1,2-ethanediyl), α-(carboxymethyl)-ω-hydroxy-, C16-18 (even numbered) and C18-unsatd. alkyl ethers | 1 | - | 946-061-5 | 1 | 294 | |||||
Poly[oxy(methyl-1,2-ethanediyl)], alpha,alpha'-(2,2-dimethyl-1,3-propanediyl)bis[omega-hydroxy-] | 1 | 52479-58-0 | 610-848-9 | 9,7 | ||||||
Poly[oxy(methyl-1,2-ethanediyl)], .alpha.,.alpha.',.alpha.''-1,2,3- propanetriyltris[.omega.-[(1-oxo-2-propenyl)oxy]]- | 1 | 52408-84-1 | 500-114-5 | 7,4 | ||||||
Polyphosphoric acids, esters with castor oil | 1 | 68308-61-2 | 614-406-6 | 11,76 | ||||||
Polyphosphoric acids, esters with triethanolamine, sodium salts | 1 | 68131-72-6 | 268-625-3 | 11,67 | ||||||
4-Poly(propyl), benzene sulfonic acid | 1 | - | 919-274-6 | 0,14 | ||||||
Polysodium 2-[(E)-{8-[(4-{[3-({[(2-alkenylsulfonyl) ethyl]amino}carbonyl)phenyl] amino}-6-fluoroheterocyclyl) amino]-1-hydroxy-polysulfonato-2-naphthalenyl}diazenyl]-1,5-naphthalene, polysulfonate | 1 | - | 403-880-8 | 0,588 | ||||||
Polysulfides, bis[3-(triethoxysilyl)propyl] | 1 | - | 915-673-4 | 4,7 | ||||||
Polysulfides, di-tert-Butyl | 1 | 68937-96-2 | 273-103-3 | 3,29 | ||||||
Polysulfides, di-tert-nonyl | 1 | 68425-16-1 | 270-336-2 | 23,5 | ||||||
Potassium; 2-[bis[2-[bis(carboxylatomethyl)amino]ethyl]amino]acetate; iron(3+) | 1 | 2055396-18-2 | 813-880-3 | 88,16 | ||||||
Potassium hydrogen sulphite | 1 | 7773-03-7 | 231-870-1 | 284 | ||||||
Potassium methylsilanetriolate | 1 | 31795-24-1 | 250-807-9 | 11,3 | 138387 | |||||
Potassium pentahydrogen bis(phosphate) | 1 | 14887-42-4 | 238-961-5 | 25,49 | 128407 | |||||
Potassium salts of [hexane-1,6-diylbis[nitrilobis(methylene)]]tetrakisphosphonic acid (4-7 K:1) | 1 | - | 701-184-1 | 0,02 | ||||||
Potassium titanium oxide | 1 | 690271-93-3 | 470-870-8 | 0,2 | ||||||
Potassium triphosphate | 1 | 13845-36-8 | 237-574-9 | 5,88 | 127270 | |||||
Potassium acetate | 1 | 127-08-2 | 204-822-2 | 1265,65 | 24010 | |||||
Potassium bifluoride | 1 | 7789-29-9 | 232-156-2 | 3,1 | TRGS900 | MAK | EU | 4760 | ||
Potassium 1,2-bis(2-ethylhexyloxycarbonyl)ethanesufonate | 1 | 7491-09-0 | 231-308-5 | 98,7 | 122243 | |||||
Potassium bromide | 1 | 7758-02-3 | 231-830-3 | 4,75 | 3660 | |||||
Potassium tert-butoxide | 1 | 865-47-4 | 212-740-3 | 1 | 1 | 30280 | ||||
Potassium carbamoylcarbamate | 1 | 26479-35-6 | 247-728-7 | 134 | 135786 | |||||
Potassium carbonate | 1 | 584-08-7 | 209-529-3 | 10 | 2070 | |||||
Potassium chlorate | 1 | 3811-04-9 | 223-289-7 | 5,76 | 2060 | |||||
Potassium chloride | 1 | 7447-40-7 | 231-211-8 | 1064 | 2200 | |||||
Potassium cyanate | 1 | 590-28-3 | 209-676-3 | 10 | 4060 | |||||
Potassium cyanide | 1 | 151-50-8 | 205-792-3 | 0,94 | TRGS900 | MAK | EU | 1970 | ||
Potassium dicyanoargentate(I) | 1 | 506-61-6 | 208-047-0 | 0,078 | TRGS900 | MAK | EU | 490214 | ||
Potassium dicyanoaurate(I) | 1 | 13967-50-5 | 237-748-4 | 0,071 | 570158 | |||||
Potassium difluorodihydroxyborate(1-) | 1 | 85392-66-1 | 286-925-2 | 18,4 | 10,95 | 170300 | ||||
Potassium dihydrogen phosphate | 1 | 7778-77-0 | 231-913-4 | 14,82 | 4860 | |||||
Potassium dimethyldithiocarbamate | 1 | 128-03-0 | 204-875-1 | 1,33 | 102244 | |||||
Potassium N,N-dimethylglycinate | 1 | 17647-86-8 | 241-629-2 | 18,04 | ||||||
Potassium disulfate | 1 | 7790-62-7 | 232-216-8 | 0,13 | 0,13 | 122844 | ||||
Potassium O-ethyl dithiocarbonate | 1 | 140-89-6 | 205-439-3 | 4,6 | 4,6 | 492925 | ||||
Potassium [[N,N'-ethylenebis[N-(carboxymethyl)glycinato]](4-)-N,N',O,O',ON,ON']ferrate(1-) | 1 | 54959-35-2 | 259-411-0 | 2 | ||||||
Potassium 2-ethylhexanoate | 1 | 3164-85-0 | 221-625-7 | 41,98 | 114329 | |||||
Potassium 2-ethylhexanoate | 2 | 3164-85-0 | 221-625-7 | 32 | 114329 | |||||
Potassium ferrite | 1 | 12160-44-0 | 430-010-4 | 2 | 535639 | |||||
Potassium fluoride | 1 | 7789-23-3 | 232-151-5 | 3 | 3 | TRGS900 | MAK | EU | 500035 | |
Potassium fluoroborates and potassium fluorohydroxyborates, exothermic reaction products of boron and potassium hydroxides and fluorohydroxides | 1 | - | 701-302-1 | 18,4 | 10,95 | |||||
Potassium formate | 1 | 590-29-4 | 209-677-9 | 43,55 | 491328 | |||||
Potassium hexadecyl hydrogen phosphate | 1 | 19035-79-1 | 242-768-1 | 10 | 131626 | |||||
Potassium hexafluorosilicate | 1 | 16871-90-2 | 240-896-2 | 2,5 | 2,5 | 4010 | ||||
Potassium hexahydroxoantimonate(V) | 1 | 12208-13-8 | 235-387-7 | 0,74 | 10 | 491131 | ||||
Potassium hydroxide | 1 | 1310-58-3 | 215-181-3 | 1 | 1420 | |||||
Potassium iodate | 1 | 7758-05-6 | 231-831-9 | 2,7 | 122620 | |||||
Potassium iodate | 2 | 7758-05-6 | 231-831-9 | 8,814 | 122620 | |||||
Potassium iodide | 1 | 7681-11-0 | 231-659-4 | 0,07 | 122515 | |||||
Potassium iodide | 2 | 7681-11-0 | 231-659-4 | 0,493 | 122515 | |||||
Potassium O-isobutyl dithiocarbonate | 1 | 13001-46-2 | 235-837-2 | 4,6 | 4,6 | |||||
Potassium isooctadecanoate | 1 | 66469-15-6 | 266-369-7 | 17,6 | ||||||
Potassium isopentyl dithiocarbonate | 1 | 928-70-1 | 213-180-2 | 15 | 107865 | |||||
Potassium 4-isopropylbenzenesulphonate | 1 | 164524-02-1 | 629-764-9 | 26,9 | ||||||
Potassium mercaptoacetate | 1 | 34452-51-2 | 252-038-4 | 1,41 | TRGS900 | MAK | 139441 | |||
Potassium (Z)-N-methyl-N-(1-oxo-9-octadecenyl)aminoacetate | 1 | 76622-74-7 | 278-503-1 | 141,1 | ||||||
Potassium naphthenate | 1 | 66072-08-0 | 266-120-2 | 3,67 | 151802 | |||||
Potassium neodecanoate | 1 | 26761-42-2 | 247-978-7 | 1,62 | ||||||
Potassium 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulphonate | 1 | 29420-49-3 | 249-616-3 | 7 | ||||||
Potassium oxide | 1 | 12136-45-7 | 235-227-6 | 15,83 | 15,83 | 1620 | ||||
Potassium pentaborate | 1 | 11128-29-3 | 234-371-7 | 10,3 | 5,9 | 124584 | ||||
Potassium O-pentyl dithiocarbonate | 1 | 2720-73-2 | 220-329-5 | 4,6 | 4,6 | 492118 | ||||
Potassium perchlorate | 1 | 7778-74-7 | 231-912-9 | 0,082 | 500037 | |||||
Potassium permanganate | 1 | 7722-64-7 | 231-760-3 | 0,2 | TRGS900 | MAK | EU | 4070 | ||
Potassium peroxymonosulfate sulfate | 1 | 70693-62-8 | 274-778-7 | 0,28 | 0,28 | 531291 | ||||
Potassium silicate | 1 | 1312-76-1 | 215-199-1 | 5,61 | 492102 | |||||
Potassium sodium amino-hydroxy-[(3-{[2-(substituted)ethyl]sulfonyl}phenyl)diazenyl]-[(2-sulfonato-4-{[2-(substituted)ethyl]sulfonyl}phenyl)diazenyl]naphthalene-disulfonate | 1 | - | 70,5 | |||||||
Potassium sodium 4,4'-bis[6-anilino-4-[bis(2-hydroxyethyl)amino]-1,3,5-triazin-2-yl]amino]stilbene-2,2'-disulphonate | 1 | 70942-01-7 | 275-031-8 | 59,42 | 491775 | |||||
Potassium, Sodium 2,4-diamino-3-(4-(2-sulfonatoethoxy-sulfonyl)phenylazo)-5-(4-(2-sulfonatoethoxysulfonyl)-2-sulfonatophenylazo)-benzenesulfonate | 1 | 187026-95-5 | 422-980-2 | 2,35 | 902427 | |||||
Potassium sodium tartrate | 1 | 304-59-6 | 206-156-8 | 1000 | 491070 | |||||
Potassium sorbate | 1 | 24634-61-5 | 246-376-1 | 17,63 | 35030 | |||||
Potassium sulfate | 1 | 7778-80-5 | 231-915-5 | 37,6 | 1580 | |||||
Potassium sulfite | 1 | 10117-38-1 | 233-321-1 | 374 | 3670 | |||||
Potassium 3-sulphopropyl methacrylate | 1 | 31098-21-2 | 250-466-6 | 32,9 | ||||||
Potassium tetrafluoroaluminate | 1 | 14484-69-6 | 238-485-8 | 0,12 | ||||||
Potassium tetrafluoroborate | 1 | 14075-53-7 | 237-928-2 | 4,54 | 5300 | |||||
Potassium thiocyanate | 1 | 333-20-0 | 206-370-1 | 3,6 | 103203 | |||||
Potassium thiosulfate | 1 | 10294-66-3 | 233-666-8 | 449 | 124008 | |||||
Potassium titanium oxide | 1 | 12056-51-8 | 432-240-0 | 10 | 535993 | |||||
Potassium titanium oxide | 2 | 12056-51-8 | 432-240-0 | 0,0462 | 535993 | |||||
Potassium triboron pentaoxide | 1 | - | 8,3 | |||||||
Potassium trifluorozincate | 1 | 13827-02-6 | 237-537-7 | 0,091 | 0,211 | 127239 | ||||
Potassium vanadium trioxide | 1 | 13769-43-2 | 237-388-8 | 0,22 | 0,76 | TRGS900 | 127118 | |||
Product of Semi-Dry Absorption method of Flue Gas Desulphurization (SDA Product) | 1 | - | 931-259-6 | 14,11 | ||||||
Product of Semi-Dry Absorption method of Flue Gas Desulphurization (SDA Product) | 2 | - | 931-259-6 | 28,21 | ||||||
Producto P0310 | 1 | - | 476-880-9 | 0,53 | ||||||
Profenofos | 1 | 41198-08-7 | 255-255-2 | 0,9 | 0,15 | 510335 | ||||
Proline | 1 | 147-85-3 | 205-702-2 | 488,9 | 492952 | |||||
Propanal | 1 | 123-38-6 | 204-623-0 | 12,1 | 6,1 | 13760 | ||||
Propanamide, 3-amino-2,2-dimethyl- | 1 | 324763-51-1 | 454-190-9 | 59 | ||||||
1-Propanaminium, 3-amino-N-(carboxymethyl)-N,N-dimethyl-, N-(C16-18(even numbered) and C18 unsaturated acyl) derivates, hydroxides, inner salts | 1 | - | 947-523-9 | 10,6 | ||||||
1-Propanaminium, 3-Amino-N-(carboxymethyl)-N,N-dimethyl-, N-C8-10 (even numbered) acyl derivs., hydroxides, inner salts | 1 | - | 944-170-2 | 10,46 | ||||||
1-Propanaminium, 3-amino-N-(carboxymethyl)-N,N-dimethyl-, N-C18(unsaturated) acyl derivates, hydroxides, inner salts | 1 | - | 947-349-3 | 1 | 21 | |||||
1-Propanaminium, 3-amino-N-(carboxymethyl)-N,N-dimethyl-, N-(C12-14(even numbered) acyl) derivs., hydroxides, inner salts | 1 | - | 946-191-2 | 44 | ||||||
1-Propanaminium, 3-amino-N-(carboxymethyl)-N,N-dimethyl-, N-coco acyl derivatives, hydroxides, inner salts | 1 | 61789-40-0 | 263-058-8 | 8,22 | ||||||
1-Propanaminium, 3-amino-N-(carboxymethyl)-N,N-dimethyl-, N-C8-18(even numbered) acyl derivs., hydroxides, inner salts | 1 | 97862-59-4 | 931-296-8 | 44 | ||||||
1-Propanaminium, 3-amino-N-(carboxymethyl)-N,N-dimethyl-, N-(C12-18(even numbered) acyl) derivs., hydroxides, inner salts | 1 | - | 931-513-6 | 44 | ||||||
1-Propanaminium, 3-amino-N-(carboxymethyl)-N,N-dimethyl-, N-(C8-18(even numbered) and C18 unsaturated acyl) derivs., hydroxides, inner salts | 1 | - | 931-333-8 | 44 | ||||||
1-Propanaminium, N-(3-aminopropyl)-2-hydroxy-N,N-dimethyl-3-sulfo-, N-(C8-18(even numbered) acyl) derivs., hydroxides, inner salts | 1 | - | 939-455-3 | 21,2 | ||||||
1-Propanaminium, N-(3-aminopropyl)-2-hydroxy-N,N-dimethyl-3-sulfo-, N-(C12-18(even numbered) acyl) derivs., hydroxides, inner salts | 1 | - | 939-457-4 | 21,2 | ||||||
1-Propanaminium, N-(3-aminopropyl)-2-hydroxy-N,N-dimethyl-3-sulfo-, N-C12-14 acyl derivatives, hydroxides, inner salts | 1 | 91648-19-0 | 293-878-1 | 1,2 | ||||||
1-Propanaminium, 2-hydroxy-N-(2-hydroxypropyl)-N,N-dimethyl-, esters with fatty acids, C18 unsatd., Me sulfates (salts) | 1 | - | 939-685-4 | 8,72 | ||||||
1,3-Propanediamine, N1-(3-aminopropyl)-N3-[3-(C18, C18 unsat) alkylamino]propyl]-, N-(carboxymethyl) derivates, sodium salts | 1 | - | 947-979-9 | 16,4 | ||||||
1,3-Propanediamine, N-[3-((C11-14, C13-rich)oxy)propyl]- branched acetate | 1 | - | 931-295-2 | 0,004 | ||||||
1,3-Propanediamine,N-N’’-1,2-ethanediylbis- reaction product with 1,3,5-triazine-2,4-diamine,N,N’-dibutyl-6-chloro-N,N’-bis(2,2,6,6-tetramethyl-4-piperidinyl), polymer with N-butyl-4,6-dichloro-N-(2,2,6,6-tetramethyl-4-piperidinyl)-1,3,5-triazin-2-amine_ | 1 | 120498-03-5 | 500-311-6 | 0,56 | ||||||
1,2-Propanediol | 1 | 57-55-6 | 200-338-0 | 10 | 168 | 13620 | ||||
1,3-Propanediol | 1 | 504-63-2 | 207-997-3 | 12 | 27410 | |||||
1,3-Propanediol, 2,2-bis(hydroxymethyl)-, allyl ether | 1 | 91648-24-7 | 293-883-9 | 8,8 | ||||||
Propane-1,2-diol, propoxylated | 1 | 25322-69-4 | 500-039-8 | 98 | ||||||
Propane-1,2-diol, propoxylated | 2 | 25322-69-4 | 500-039-8 | 10 | ||||||
Propane-1,2-diyl dibenzoate | 1 | 19224-26-1 | 242-894-7 | 88,16 | 35,26 | |||||
Propane-1,3-diyl dioctanoate | 1 | 56519-71-2 | 700-003-3 | 70,5 | ||||||
4,4'-Propane-2,2-diyldiphenol, polymer with 2-Methyloxirane | 1 | 37353-75-6 | 500-097-4 | 2,12 | ||||||
2-Propanethiol | 1 | 75-33-2 | 200-861-4 | 7,38 | 7,38 | 491067 | ||||
1-Propanethiol | 1 | 107-03-9 | 203-455-5 | 18,6 | 14,5 | 510684 | ||||
1,2,3-Propanetriol, homopolymer | 1 | 25618-55-7 | 607-759-2 | 55 | 55 | |||||
Propane-1,2,3-triyl 3,5,5-trimethylhexanoate | 1 | 56554-53-1 | 260-257-1 | 12,8 | ||||||
Propane-1,2,3-triyl trinonan-1-oate | 1 | 126-53-4 | 204-791-5 | 16,4 | ||||||
Propanoic acid, 2-hydroxy-, ammonium salt (1:1), (2S)- | 1 | 137296-15-2 | 604-012-2 | 41 | ||||||
Propanoic acid, 2-hydroxy-, C12-13-branched-alkyl esters | 1 | - | 939-514-3 | 17,6 | ||||||
Propanoic acid, 2-hydroxy-, 2-ethylhexyl ester, (2S)- | 1 | 186817-80-1 | 606-097-1 | 16,48 | ||||||
Propanoic acid, 2-hydroxy-, C12-15-alkyl esters | 1 | 93925-36-1 | 300-338-1 | 2,88 | ||||||
Propanoic acid, 2-hydroxy-, (1R,2S,5R)-5-methyl-2-(1-methylethyl)cyclohexyl ester, (2S)- | 1 | 61597-98-6 | 612-179-8 | 38,6 | ||||||
2-Propanol | 1 | 67-63-0 | 200-661-7 | 500 | TRGS900 | MAK | 11190 | |||
1-Propanol | 1 | 71-23-8 | 200-746-9 | 268 | 13580 | |||||
2-Propanol, 1,1'-[[3-[(3-aminopropyl)amino]propyl]imino]bis-, N-tallow alkyl derivs. | 1 | 97592-79-5 | 307-276-4 | 0,563 | ||||||
2-Propanol and 2-Butanol production, distn. residues | 1 | - | 228,1 | |||||||
1-Propanone, 2-hydroxy-2-methyl-, 1-(4-C10-13-alkylphenyl) derivs. | 1 | 1001416-18-7 | 600-033-6 | 1,76 | ||||||
2-Propanone, reaction products with diphenylamine | 1 | 68412-48-6 | 270-192-0 | 32,9 | ||||||
Propargite | 1 | 2312-35-8 | 219-006-1 | 0,3 | 0,3 | 510340 | ||||
2-Propen-1-aminium, N,N,N-tri-2-propen-1-yl-, chloride (1:1) | 1 | 13107-10-3 | 452-170-4 | 39,2 | ||||||
2-Propenenitrile, reaction products with 1,3-benzenedimethanamine | 1 | 90530-16-8 | 292-054-9 | 1,76 | ||||||
2-Propenenitrile, reaction products with 2,2,4(or 2,4,4)-Trimethyl-1,6-hexanediamine | 1 | 90530-20-4 | 292-059-6 | 0,5 | ||||||
2-Propenoic acid, ethyl ester, reaction products with mixed substituted alkyl esters of phosphorodithioic acid and propylene oxide | 1 | - | 11,76 | |||||||
2-Propenoic acid, heptadecyl ester, branched | 1 | 1473386-36-5 | 810-816-6 | 8,8 | ||||||
2-Propenoic acid, homopolymer | 1 | 9003-01-4 | 618-347-7 | 1,97 | ||||||
2-Propenoic acid, 2-methyl-, tetracosyl ester, branched | 1 | 90552-24-2 | 292-146-9 | 11,75 | ||||||
2-Propenoic acid, 2-methyl-, heptadecyl ester, branched | 1 | 1473386-29-6 | 810-817-1 | 31,25 | ||||||
2-Propenoic acid, 2-methyl-, 2-hydroxyethyl ester, phosphate | 1 | 52628-03-2 | 258-053-2 | 7,04 | ||||||
2-Propenoic acid, 2-methyl-, 2-hydroxyethyl ester, reaction products with phosphorus oxide | 1 | 1187441-10-6 | 810-703-1 | 7,05 | ||||||
2-Propenoic acid, 2-methyl-, C11-14-isoalkyl esters, C13-rich | 1 | 85736-97-6 | 288-509-6 | 10,58 | ||||||
2-Propenoic acid, methyl ester, reaction products with 2-ethyl-1-hexanamine and sodium hydroxide | 1 | 68610-44-6 | 271-865-1 | 8,22 | ||||||
2-Propenoic acid, methyl ester, reaction products with 2-ethyl-1-hexanamine and sodium hydroxide | 2 | 68610-44-6 | 271-865-1 | 260 | 260 | |||||
2-Propenoic acid, methyl ester, reaction products with mixed O,O-bis(branched and linear pentyl and iso-Bu) phosphorodithioates | 1 | 93925-38-3 | 300-340-2 | 8,82 | 8,82 | |||||
2-Propenoic acid, monoester with 1,2-propanediol, polymer with 2-(chloromethyl)oxirane, dihydro-2,5-furandione and 4,4'-(1-methylethylidene)bis[phenol] | 1 | 68958-77-0 | 500-240-0 | 1,64 | ||||||
2-Propenoic acid, reaction products with Dipentaerythritol | 1 | 1384855-91-7 | 800-838-4 | 1,76 | ||||||
2-Propen-1-ol | 1 | 107-18-6 | 203-470-7 | 4,63 | TRGS900 | EU | 24570 | |||
trans,trans-4-((E)-Propen-1-yl)-4'-propyl-bicyclohexane | 1 | 279246-65-0 | 608-148-3 | 4,93 | ||||||
4-trans-Propenylveratrole | 1 | 6379-72-2 | 228-958-7 | 3,1 | ||||||
Propionaldehyde, reaction products with Formaldehyde | 1 | - | 701-281-9 | 3,7 | ||||||
Propionic acid solution | 1 | 79-09-4 | 201-176-3 | 31 | 73 | TRGS900 | MAK | EU | 12590 | |
Propionic anhydride | 1 | 123-62-6 | 204-638-2 | 31 | 31 | 12600 | ||||
Propyl acetate anhydrous | 1 | 109-60-4 | 203-686-1 | 420 | MAK | 33670 | ||||
Propylamine | 1 | 107-10-8 | 203-462-3 | 4,91 | 38390 | |||||
Propyl (2S)-2-(1,1-dimethylpropoxy)-propanoate | 1 | 319002-92-1 | 437-530-0 | 8,8 | ||||||
Propylene carbonate | 1 | 108-32-7 | 203-572-1 | 20 | 70,53 | TRGS900 | MAK | 70730 | ||
Propylenediamine | 1 | 78-90-0 | 201-155-9 | 1 | 38380 | |||||
alpha,alpha'-Propylenedinitrilodi-o-cresol | 1 | 94-91-7 | 202-374-2 | 3,11 | 101232 | |||||
Propylene glycol-1-monopropyl ether | 1 | 1569-01-3 | 216-372-4 | 263 | 110254 | |||||
Propylene glycol 1-phenyl ether | 1 | 770-35-4 | 212-222-7 | 25,7 | 23780 | |||||
Propylene oxide | 1 | 75-56-9 | 200-879-2 | 2,4 | TRGS900 | MAK | EU | Carcinogenic | 12010 | |
2-Propylheptan-1-ol | 1 | 10042-59-8 | 233-126-1 | 7,41 | 123588 | |||||
2-Propylheptyl acrylate | 1 | 149021-58-9 | 604-669-5 | 44 | ||||||
2-Propylheptyl 2-methylprop-2-enoate | 1 | 149855-64-1 | 810-760-2 | 17,6 | ||||||
2-Propylheptyl octanoate | 1 | - | 485-390-4 | 293 | ||||||
Propyl 4-hydroxybenzoate | 1 | 94-13-3 | 202-307-7 | 88,2 | 25820 | |||||
Propyl (2S)-2-hydroxypropanoate | 1 | 53651-69-7 | 611-025-7 | 3,3 | 10 | |||||
Propylidynetrimethanol, ethoxylated | 1 | 50586-59-9 | 500-110-3 | 98 | ||||||
Propylidynetrimethanol, ethoxylated, esters with acrylic acid | 1 | 28961-43-5 | 500-066-5 | 16,2 | 531888 | |||||
Propylidynetrimethanol, propoxylated | 1 | 25723-16-4 | 500-041-9 | 98 | ||||||
Propylidynetrimethyl trimethacrylate | 1 | 3290-92-4 | 221-950-4 | 14,81 | 494390 | |||||
2-(Propyloxy)ethanol | 1 | 2807-30-9 | 220-548-6 | 36 | TRGS900 | MAK | 22310 | |||
N-Propylphosphorothioic triamide | 1 | 916809-14-8 | 618-780-1 | 0,99 | ||||||
Propyl propionate | 1 | 106-36-5 | 203-389-7 | 23,3 | 510344 | |||||
Propyltriacetoxysilane | 1 | 17865-07-5 | 241-816-9 | 85,39 | 130809 | |||||
Propyltrichlorosilane | 1 | 141-57-1 | 205-489-6 | 13 | 39620 | |||||
Propyl 3,4,5-trihydroxybenzoate | 1 | 121-79-9 | 204-498-2 | 6,66 | 492843 | |||||
Propyltrimethoxysilane | 1 | 1067-25-0 | 213-926-7 | 123,82 | 108427 | |||||
4-trans-Propyl-4-trans-vinyl-[1,1-bicylohexyl] | 1 | 116020-44-1 | 601-409-2 | 4,93 | ||||||
Prop-2-yn-1-ol | 1 | 107-19-7 | 203-471-2 | 9,4 | 4,7 | TRGS900 | MAK | 29350 | ||
2-Propyn-1-ol, compd. with methyloxirane | 1 | 38172-91-7 | 609-530-2 | 2,115 | ||||||
2-Propyn-1-ol, reaction product with 1-2.5 moles of Oxirane | 1 | - | 941-793-1 | 2,5 | ||||||
Proxan-sodium | 1 | 140-93-2 | 205-443-5 | 4,6 | 4,6 | 510346 | ||||
Proxan-sodium | 2 | 140-93-2 | 205-443-5 | 15 | 510346 | |||||
Pymetrozine (ISO); (E)-4,5-Dihydro-6-methyl-4-(3-pyridylmethyleneamino)-1,2,4-triazin-3(2H)-one | 1 | 123312-89-0 | 602-927-1 | 0,7376 | ||||||
Pyrazole | 1 | 288-13-1 | 206-017-1 | 0,024 | 492981 | |||||
1H-Pyrazole, 3,4-dimethyl-, phosphate (1:1) | 1 | - | 424-640-9 | 6,518 | ||||||
Pyridine | 1 | 110-86-1 | 203-809-9 | 2,5 | 13850 | |||||
Pyridine, alkyl derivatives; Crude Tar Bases | 1 | 68391-11-7 | 269-929-9 | 38 | ||||||
2,4-Pyridinedicarboxylic acid, diethyl ester | 1 | 41438-38-4 | 680-341-5 | 4,29 | ||||||
Pyridinium, 1,1'-[(6,13-Dichloro-4,11-disulfo-3,10-triphenodioxazinediyl)bis[imino-2,1-ethanediylimino[6-[(2,5-disulfophenyl)amino]-1,3,5-triazine-4,2-diyl]]]bis[3-carboxy-, dihydroxide, bis(inner salt), hexasodium salt | 1 | 79771-28-1 | 279-256-2 | 16,4 | ||||||
Pyridinium toluene-4-sulphonate | 1 | 24057-28-1 | 246-002-7 | 2,35 | ||||||
Pyridoxine hydrochloride | 1 | 58-56-0 | 200-386-2 | 1,9 | ||||||
Pyrocatechol | 1 | 120-80-9 | 204-427-5 | 0,9 | Carcinogenic | 10700 | ||||
Pyrolysis reaction product of Pinane | 1 | - | 947-964-7 | 19,75 | ||||||
Pyromellitic acid | 1 | 89-05-4 | 201-879-5 | 1,41 | 40970 | |||||
Pyrrolidine | 1 | 123-75-1 | 204-648-7 | 8,4 | 29400 | |||||
2-Pyrrolidone | 1 | 616-45-5 | 210-483-1 | 29,62 | 490258 | |||||
Quaternary ammonium compounds, C12-18-alkylbis(hydroxyethyl)methyl, chlorides | 1 | 71808-53-2 | 276-038-9 | 1,7 | ||||||
Quaternary Ammonium compounds, C12-14 (even-numbered)-alkylethyldimethyl, ethyl sulphates | 1 | - | 939-607-9 | 3,32 | ||||||
Quaternary Ammonium compounds, C18-22 (even numbered) alkyltrimethyl, chlorides | 1 | - | 947-874-8 | 0,132 | ||||||
Quaternary ammonium compounds, C12-14-alkyltrimethyl, methyl sulfates | 1 | 96690-44-7 | 306-238-4 | 1 | ||||||
Quaternary Ammonium compounds, Benzyl C12-C16 (even numbered)-alkyldimethyl chlorides | 1 | - | 939-253-5 | 3,96 | ||||||
Quaternary Ammonium compounds, C20-22-Alkyltrimethyl, chlorides | 1 | 68607-24-9 | 271-756-9 | 0,4 | 0,4 | |||||
Quaternary Ammonium compounds, Di-C12-18-alkyldimethyl, chlorides | 1 | 68391-05-9 | 269-924-1 | 27 | ||||||
Quaternary Ammonium compounds, Di-C16-18-alkyldimethyl, chlorides | 1 | 92129-33-4 | 295-835-2 | 9,7 | ||||||
Quaternary ammonium compounds, di-C14-18-alkyldimethyl, methyl sulfates | 1 | 68002-58-4 | 268-071-2 | 1 | 4,93 | |||||
Quaternary ammonium compounds, dicoco alkyldimethyl, nitrites | 1 | 71487-01-9 | 275-532-1 | 1,4 | ||||||
Quaternary ammonium compounds, C12-14-alkyl[(ethylphenyl)methyl]dimethyl, chlorides | 1 | 85409-23-0 | 287-090-7 | 1 | ||||||
Quaternary ammonium compounds, bis(hydrogenated tallow alkyl)dimethyl, acetates | 1 | 68334-33-8 | 269-824-8 | 9,7 | ||||||
Quaternary ammonium compounds, tri-C8-10-alkylmethyl, chlorides | 1 | 63393-96-4 | 264-120-7 | 0,42 | 150018 | |||||
Quaternary ammonium compounds, trimethylsoya alkyl, chlorides | 1 | 61790-41-8 | 263-134-0 | 1 | ||||||
Quaternary ammonium compounds, N,N,N'-Tris(hydroxyethyl)-N,N'-dimethyl-N'-C16-18 (even numbered) and C18 unsatd., alkyltrimethylenedi-, bis(Me sulfates) (salts) | 1 | - | 947-766-0 | 0,493 | ||||||
Quaternary ammonium compounds, coco alkyltrimethyl, chlorides | 1 | 61789-18-2 | 263-038-9 | 1 | ||||||
Quinacridone | 1 | 1047-16-1 | 213-879-2 | 3 | 147 | 491348 | ||||
Quinazolin-4(1H)-one | 1 | 491-36-1 | 207-735-8 | 1,64 | ||||||
Quinolin-8-ol | 1 | 148-24-3 | 205-711-1 | 3,29 | 492953 | |||||
Rabitle FP-100 | 1 | - | 482-200-1 | 16,4 | ||||||
Radia 7838 | 1 | - | 484-350-3 | 49 | ||||||
Raffinates (petroleum), catalytic reformer ethylene glycol-water countercurrent exts. | 1 | 68410-71-9 | 270-088-5 | 840 | ||||||
Raffinates (petroleum), catalytic reformer ethylene glycol-water countercurrent exts. | 2 | 68410-71-9 | 270-088-5 | 837,5 | ||||||
Rape oil, oxidized | 1 | 95193-59-2 | 305-871-3 | 49 | ||||||
Rape oil, reaction products with diethanolamine | 1 | 68187-80-4 | 269-125-8 | 73,44 | ||||||
Rape oil, sulfated, sodium salt | 1 | 84082-30-4 | 281-978-8 | 11,7 | ||||||
Rapicure DVE-3 | 1 | 765-12-8 | 402-600-1 | 44,1 | ||||||
RD 14153 | 1 | - | 943-665-0 | 17,62 | ||||||
RD 14156 | 1 | - | 17,62 | |||||||
Reaction mass of 1,3-Diisopropylbenzene and 1,4-Diisopropylbenzene | 1 | - | 905-459-9 | 7,4 | ||||||
Reaction mass of Bis(2-methylpropyl) pentanedioate and Bis(2-methylpropyl) butanedioate and Bis(2-methylpropyl) hexanedioate | 1 | - | 907-870-9 | 4,2 | ||||||
Reaction mass of butyl diphenyl phosphate and dibutyl phenyl phosphate and tributyl phosphate | 1 | - | 907-672-2 | 0,67 | 0,67 | |||||
Reaction mass of 3-[3-(2,3-dihydroxypropoxy)-2-hydroxypropoxy]propane-1,2-diol, 3-(2,3-dihydroxypropoxy)propane-1,2-diol,3-[3-[3-(2,3-dihydroxypropoxy)-2-hydroxypropoxy]-2-hydroxypropoxy]propane-1,2-diol, | 1 | - | 915-741-3 | 55 | 55 | |||||
Reaction mass of 4-isopropylidene-1-methylcyclohexene and 1-isopropyl-4-methyl-7-oxabicyclo[2.2.1]heptane and 1,3,3-trimethyl-2-oxabicyclo[2.2.2]octane | 1 | - | 938-945-4 | 5,12 | ||||||
Reaction mass of magnesium carbonate and magnesium hydroxide and magnesium oxide and magnesium peroxide | 1 | - | 908-749-3 | 6,2 | ||||||
Reaction mass of 2,2',2''-nitrilotriethanol and 2,2'-[[2-[(2-hydroxyethyl)amino]ethyl]imino]bisethanol and 2,2'-iminodiethanol | 1 | - | 905-898-6 | 2 | 3 | |||||
Reaction mass of 4-(2,6,6-trimethylcyclohex-2-ene-1-yl)-but-3-ene-2-one and 4-(2,6,6-trimethylcyclohex-1-ene-1-yl)-but-3-ene-2-one | 1 | - | 907-706-6 | 8,22 | ||||||
Reaction mass of 7539-04-0 and Pentaerythritol tetrakis(3-mercaptopropionate) and 2-{3-(3-Mercaptopropionyl)thiopropionyl}oxymethyl-2-(3-mercaptopropionyl)oxymethyl-1,3-propanediyl bis(3-mercaptopropionate) | 1 | - | 946-382-0 | 7,35 | ||||||
Reaction mass of Abieta-8,11,13-trien-18-yl [({[(abieta-8,11,13-trien-19-yloxy)carbonyl]amino}-polyalkylalicycleyl)methyl]carbamate, Abietan-19-yl [({[(abieta-8,11,13-trien-18-yloxy)carbonyl]amino}methyl)-polyalkylalicycleyl]carbamate | 1 | - | 9,8 | |||||||
Reaction mass of 3-O-Acetyl-1,5-anhydro-4-butyl-2,4-dideoxy-2-methyl-D-xylitol and (2R,3S)-2-Methyloctane-1,3-diyl diacetate | 1 | - | 945-946-3 | 5,4 | ||||||
Reaction mass of C12-14 tert-Alkylamines and Dimethyl hydrogen phosphate and Methyl dihydrogen phosphate | 1 | - | 948-071-5 | 1,23 | ||||||
Reaction mass of tert-Alkyl(C12-C14)ammonium bis[1-[(2-hydroxy-5-nitrophenyl)azo]-2-naphthalenolato(2-)]-chromate(1-) and tert-Alkyl(C12-C14)ammonium bis[1-[(2-hydroxy-4-nitrophenyl)azo]-2-naphthalenolato(2-)]-chromate(1-) and tert-Alkyl(C12-C14)ammonium bis[1-[[5-(1,1-dimethylpropyl)-2-hydroxy-3-nitrophenyl]azo]-2-naphthalenolato(2-)]-chromate(1-) and tert-Alkyl(C12-C14)ammonium [[1-[(2-hydroxy-4-nitrophenyl)azo]-2-naphthalenolato(2-)]-[1-[(2-hydroxy-5-nitrophenyl)azo]-2-naphthalenolato(2-)]]-chromate(1-) and tert-Alkyl(C12-C14)ammonium [[1-[[5-(1,1-dimethylpropyl)-2-hydroxy-3-nitrophenyl]azo]-2-naphthalenolato(2-)]-[1-[(2-hydroxy-5-nitrophenyl)azo]-2-naphthalenolato(2-)]]-chromate(1-) and tert-Alkyl(C12-C14)ammonium ((1-(4-nitro-2-oxidophenylazo)-2-naphtholato)(1-(3-nitro-2-oxido-5-(1,1-dimethylpropyl)phenylazo)-2-naphtholato))chromate(1-) | 1 | - | 938-781-3 | 0,94 | ||||||
Reaction mass of Allyl (2-methylbutoxy)acetate and Allyl (3-methylbutoxy)acetate | 1 | - | 916-328-0 | 0,493 | ||||||
Reaction mass of Aluminium and Aluminium oxide and Calcium oxide and Magnesium oxide | 1 | - | 909-586-0 | 15,63 | ||||||
Reaction mass of Aluminium fluoride and Chromium trifluoride and Nickel difluoride | 1 | - | 914-309-1 | 0,14 | ||||||
Reaction mass of Aluminium hydroxide and Aluminium nitrate and Aluminium sulphate | 1 | - | 914-920-3 | 28,658 | ||||||
Reaction mass of Amides, rape-oil, N-(hydroxyethyl), ethoxylated and Glycerol, ethoxylated | 1 | - | 932-164-2 | 7,05 | ||||||
Reaction mass of Amines, C10-14-branched and linear alkyl, [1-[(2-Hydroxy-4-nitrophenyl)azo]-2-naphthalenolato(2-)][1-[(2-hydroxy-5-nitrophenyl)azo]-2-naphthalenolato(2-)]chromate(1-) and Amines, C10-14-branched and linear alkyl, bis[1-[(2-hydroxy-5-nitrophenyl)azo]-2-naphthalenolato(2-)]chromate(1-) | 1 | - | 939-191-9 | 0,12 | ||||||
Reaction mass of Amines, coco alkyl and beta-Alanine, N-(2-carboxyethyl)-, N-coco alkyl derivs. and beta-Alanine, N-coco alkyl derivs. | 1 | - | 915-790-0 | 1,48 | ||||||
Reaction mass of Amines, N-tallow alkyltrimethylenedi-, mono(2-ethylhexanoates), Amines, N-tallow alkyltrimethylenedi-, acetates and n-tallow-1,3-diaminopropane ditallate | 1 | - | 947-476-4 | 0,038 | ||||||
Reaction mass of 1-[2-(2-Aminobutoxy)ethoxy]but-2-ylamine and 1-({[2-(2-Aminobutoxy)ethoxy]methyl}propoxy)but-2-ylamine | 1 | 897393-42-9 | 447-920-2 | 10,56 | 536382 | |||||
Reaction mass of 2-[[[2-[(2-Aminoethyl)amino]ethyl]amino]carbonyl]-benzoic acid and 2,2'-[Iminobis(2,1-ethanediyliminocarbonyl)]bis-benzoic acid and 7,8,9,10,11,12,20,21,22,23,24,25-Dodecahydrodibenzo[i,t][1,4,7,12,15,18] hexaazacyclodocosine-5,13,18,26(6H.19H)-tetrone | 1 | - | 942-764-6 | 11,7 | ||||||
Reaction mass of 6-Amino-5-(4-substituted-sulfophenylazo)-1-hydroxy-2-[2-alkoxy-5-alkyl- (substitutedsulfonyl)-phenylazo]-naphthalene-sulfonic acid, potassium/sodium salt and 6-Amino-1-hydroxy-2-[2-alkoxy-5-alkyl- (substitutedsulfonyl)-phenylazo]-5-[sulfo- (substitutedsulfonyl)-phenylazo]-naphthalene-sulfonic acid, potassium/sodium salt | 1 | - | 445-040-3 | 2,4 | ||||||
Reaction mass of Ammonium bisethanedioato bisaquo niobate(V) (anhydrous form) and Ammonium hydrogen ethanedioate ethanedioic acid (anhydrous form) | 1 | - | 939-559-9 | 5,085 | ||||||
Reaction mass of ammonium difluoro {[(4S,5R)-2,2,4,5-tetrafluoro-5-(trifluoromethoxy)-1,3-dioxolan-4-yl]oxy}acetate, ammonium difluoro {[(4R,5S)-2,2,4,5-tetrafluoro-5-(trifluoromethoxy)-1,3-dioxolan-4-yl]oxy}acetate, ammonium difluoro {[(4S,5S)-2,2,4,5-tetrafluoro-5-(trifluoromethoxy)-1,3-dioxolan-4-yl]oxy}acetate and ammonium difluoro {[(4R,5R)-2,2,4,5-tetrafluoro-5-(trifluoromethoxy)-1,3-dioxolan-4-yl]oxy}acetate | 1 | 1190931-27-1 | 682-238-0 | 0,035 | ||||||
Reaction mass of Ammonium dihydrogen citrate and water | 1 | - | 947-855-4 | 184,4 | ||||||
Reaction mass of Arylamino-(substituted-nitro-arylazo)-methyl-arylamino-heteroaryl-carbonitrile, Arylamino-(substituted-nitro-arylazo)-methyl-arylamino-heteroaryl-carbonitrile, [(Substituted-nitroaryl)diazenyl]-methyl-(arylamino)-[(2-arylmethyl)amino]heteroarylcarbonitrile, [(Substituted-nitroaryl)diazenyl]-methyl-(arylamino)-[(2-arylmethyl)amino]heteroarylcarbonitrile, Methyl-4(substituted-nitro-arylazo)-arylmethylamino-arylamino-heteroaryl-carbonitrile and Methyl-4(substituted-nitro-arylazo)-arylmethylamino-arylamino-heteroaryl-carbonitrile | 1 | - | 441-440-7 | 11,8 | ||||||
Reaction mass of (2-azaniumylethyl)[3-(trimethoxysilyl)propyl]amine chloride (2-azaniumylethyl)(benzyl)[3-(trimethoxysilyl)propyl]amine chloride 3,3-dimethoxy-11-phenyl-2-oxa-7,10-diaza-3-silaundecan-7-ium chloride 7-benzyl-3,3-dimethoxy-11-phenyl-2-ooxa-7,10-diaza-3-silaundecan-7-ium chloride 7-benzyl-3,3-dimethoxy-11-phenyl-2-oxa-7,10-diaza-3-silaundecan-10-ium chloride 10-benzyl-3,3-dimethoxy-11-phenyl-2-oxa-7,10-diaza-3-silaundecan-7-ium chloride 7,10-dibenzyl-3,3-dimethoxy-11-phenyl-2-oxa-7,10-diaza-3-silaundecan-7-ium chloride | 1 | - | 700-961-2 | 49,4 | ||||||
Reaction mass of (2-azaniumylethyl)[3-(trimethoxysilyl)propyl]amine chloride (2-azaniumylethyl)(benzyl)[3-(trimethoxysilyl)propyl]amine chloride 3,3-dimethoxy-11-phenyl-2-oxa-7,10-diaza-3-silaundecan-7-ium chloride 7-benzyl-3,3-dimethoxy-11-phenyl-2-ooxa-7,10-diaza-3-silaundecan-7-ium chloride 7-benzyl-3,3-dimethoxy-11-phenyl-2-oxa-7,10-diaza-3-silaundecan-10-ium chloride 10-benzyl-3,3-dimethoxy-11-phenyl-2-oxa-7,10-diaza-3-silaundecan-7-ium chloride 7,10-dibenzyl-3,3-dimethoxy-11-phenyl-2-oxa-7,10-diaza-3-silaundecan-7-ium chloride | 2 | - | 700-961-2 | 260 | 260 | |||||
Reaction mass of 7-azatridecane-1,13-diamine and hexamethylenediamine | 1 | 68815-47-4 | 907-605-7 | 0,42 | ||||||
Reaction mass of (2E)-2-Benylidene-5,6-dimethoxy-3,3-dimethylindan-1-one and (2Z)-2-Benylidene-5,6-dimethoxy-3,3-dimethylindan-1-one | 1 | - | 486-080-1 | 10 | ||||||
Reaction mass of Benzenamine, 2-ethyl-N-(2-ethyl-nonylphenyl) nonyl-, branched and Benzenamine, 2-ethyl-N-(2-ethyl-nonylphenyl)-, branched | 1 | - | 948-046-9 | 16,4 | ||||||
Reaction mass of 1,2-Benzenedicarboxylic acid, 3-sulfo-, ammonium salt (1:3) and 4-Sulphophthalic acid, ammonium salt and Ammonium sulphate | 1 | - | 939-221-0 | 172,85 | ||||||
Reaction mass of 1,2-Benzenedicarboxylic acid, 4-sulfo-, trisodium salt and 1,2-Benzenedicarboxylic acid, 3-sulfo-, sodium salt (1:3) and Sodium sulphate | 1 | - | 939-220-5 | 172,85 | ||||||
Reaction mass of Benzenepropanal, 4-ethyl-α,α-dimethyl- and 3-(2-Ethylphenyl)-2,2-dimethylpropanal | 1 | - | 916-329-6 | 14,7 | ||||||
Reaction mass of Benzene sulfonic acid, hexadecyl(sulfophenoxy)-,disodium salt and Benzene sulfonic acid, - oxibis[hexadecyl]-, disodium salt | 1 | 65143-89-7 | 405-430-6 | 8,8 | ||||||
Reaction mass of Benzenesulfonic acid, 2,2'-(1,2-ethenediyl)bis[5-[[4-[bis(2-hydroxyethyl)amino]-6-(phenylamino)-1,3,5-triazin-2-yl]amino]-, disodium salt and Benzenesulfonic acid, 5-[[4-[bis(2-hydroxyethyl)amino]-6-(phenylamino)-1,3,5-triazin-2-yl]amino | 1 | - | 942-661-6 | 9,9 | ||||||
Reaction mass of 2-[2-(Benzoyloxy)ethoxy]ethyl benzoate, 1-[2-(benzoyloxy)propoxy]propan-2-yl benzoate and 2-[2-[2-(Benzoyloxy)ethoxy]ethoxy]ethyl benzoate | 1 | - | 907-434-8 | 5,81 | ||||||
Reaction mass of 1-[2-(Benzoyloxy)propoxy]propan-2-yl benzoate and 2-[2-(Benzoyloxy)ethoxy]ethyl benzoate | 1 | - | 907-437-4 | 5,81 | ||||||
Reaction mass of benzyl 2-ethylhexyl adipate and bis(2-ethylhexyl) adipate and dibenzyl adipate | 1 | - | 905-983-8 | 97,9 | ||||||
Reaction mass of 5-[[4-[Benzylmethylamino]phenyl]azo]-1,4-dimethyl-1H-1,2,4-triazolium methyl sulphate and 3-[[4-[Benzylmethylamino]phenyl]azo]-1,4-dimethyl-1H-1,2,4-triazolium methyl sulphate | 1 | - | 915-761-2 | 2,88 | ||||||
Reaction mass of Bis[3-[[4-[benzylmethylamino]phenyl]azo]-1,4-dimethyl-1H-1,2,4-triazolium] tetrachlorozincate(2-) and Bis[5-[[4-[benzylmethylamino]phenyl]azo]-1,4-dimethyl-1H-1,2,4-triazolium] tetrachlorozincate(2-) | 1 | - | 916-918-8 | 5,76 | ||||||
Reaction mass of Bis[2,4-bis(2-methylbutan-2-yl)phenyl] 4-(2-methylbutan-2-yl)phenyl phosphite and 2,4-Bis(2-methylbutan-2-yl)phenyl bis[4-(2-methylbutan-2-yl)phenyl] phosphite and Tris[4-(2-methylbutan-2-yl)phenyl] phosphite | 1 | 939402-02-5 | 700-485-5 | 53,99 | ||||||
Reaction mass of Bis(2,3-epoxypropyl) terephthalate and Tris(oxiranylmethyl) benzene-1,2,4-tricarboxylate | 1 | - | 940-592-6 | 0,025 | ||||||
Reaction mass of 1,4-Bis[(2-ethylhexyl)amino]-9,10-dihydroanthracene-9,10-dione and 1-(Butylamino)-4-[(2-ethylhexyl)amino]-9,10-dihydroanthracene-9,10-dione and 1-[(2-Ethylhexyl)amino]-4-(methylamino)-9,10-dihydroanthracene-9,10-dione | 1 | 64553-79-3 | 915-600-6 | 1,1 | ||||||
Reaction mass of 2,2-Bis(hydroxymethyl)propane-1,3-diyl bis(2-ethylhexanoate) and 3-[(2-Ethylhexanoyl)oxy]-2-{[(2-ethylhexanoyl)oxy]methyl}-2-(hydroxymethyl)propyl 2-ethylhexanoate and 3-[(2-Ethylhexanoyl)oxy]-2,2-bis{[(2-ethylhexanoyl)oxy]methyl}propyl 2-ethylhexanoate | 1 | - | 939-690-1 | 35,263 | ||||||
Reaction mass of 1,4-Bis(methylamino)anthraquinone and 1,4-Bis[(2-ethylhexyl)amino]anthraquinone and 1-[(2-Ethylhexyl)amino]-4-(methylamino)anthraquinone and 9,10-Anthracenedione, 1,4-bis(pentylamino)-, branched and linear and 9,10-Anthracenedione, 1-(methylamino)-4-(pentylamino)-, branched and linear and 9,10-Anthracenedione, 1-[(2-ethylhexyl)amino]-4-(pentylamino)-, branched and linear | 1 | - | 911-360-1 | 2,25 | ||||||
Reaction mass of Bis(1,2,2,6,6-pentamethyl-4-piperidyl) sebacate and Methyl 1,2,2,6,6-pentamethyl-4-piperidyl sebacate | 1 | 1065336-91-5 | 915-687-0 | 0,68 | ||||||
Reaction mass of 2,6-bis(1-phenylethyl)phenol and 2,4,6-tris(1-phenylethyl)phenol | 1 | - | 701-171-0 | 3,5 | ||||||
Reaction mass of Bis[2-(2-{[(prop-2-en-1-yloxy)carbonyl]oxy}ethoxy)ethyl] carbonate and Diallyl 2,2'-oxydiethyl dicarbonate | 1 | - | 700-483-4 | 151,3 | ||||||
Reaction mass of Bis(2-propylheptyl) hexanedioate and O6-[2,2-Bis[[6-oxo-6-(2-propylheptoxy)hexanoyl]oxymethyl]butyl] O1-(2-propylheptyl) hexanedioate | 1 | - | 942-066-1 | 26,4 | ||||||
Reaction mass of DL-Borneol and exo-1,7,7-Trimethylbicyclo[2.2.1]heptan-2-ol | 1 | - | 907-653-9 | 17,632 | ||||||
Reaction mass of 2-(2-(2-Butoxyethoxy)ethoxy)ethanol and 3,6,9,12-Tetraoxahexadecan-1-ol | 1 | - | 907-996-4 | 195 | ||||||
Reaction mass of 3-[3-(9-Butyl-1,1,3,3,5,5,7,7,9,9-decamethylpentasiloxanyl)propoxy]-2-hydroxypropyl 2-methylprop-2-enoate and 1-[3-(9-Butyl-1,1,3,3,5,5,7,7,9,9-decamethylpentasiloxanyl)propoxy]-3-hydroxypropan-2-yl 2-methylprop-2-enoate | 1 | - | 700-043-1 | 11,75 | ||||||
Reaction mass of 2,6-di-tert-butylphenol and 2,4,6-tri-tert-butylphenol | 1 | - | 907-745-9 | 3,5 | ||||||
Reaction mass of p-t-Butylphenyldiphenyl phosphate and Bis(p-t-butylphenyl) phenyl phosphate | 1 | - | 939-505-4 | 0,2 | 2,03 | |||||
Reaction mass of p-t-Butylphenyldiphenyl phosphate and Bis(p-t-butylphenyl)phenyl phosphate and Triphenyl phosphate | 1 | - | 700-990-0 | 7,58 | ||||||
Reaction mass of N-butylphosphorothioic triamide and N-propylphosphorothioic triamide | 1 | - | 700-457-2 | 2,938 | ||||||
Reaction mass of Calcium chloride and Sodium chloride | 1 | - | 913-635-1 | 21,9 | ||||||
Reaction mass of Calcium 2,6-bis(3-carboxylatopropanamido)hexanoate and isomers of Calcium amino-(3-carboxylatopropanamido)hexanoate | 1 | - | 947-903-4 | 24,7 | ||||||
Reaction mass of calcium carbonate and calcium dihydroxide and calcium peroxide | 1 | - | 908-343-6 | 2 | ||||||
Reaction mass of Calcium carbonate and Calcium dihydroxide and Silicon dioxide | 1 | - | 932-084-8 | 5 | ||||||
Reaction mass of Calcium dihydroxide and Calcium peroxide | 1 | - | 930-930-0 | 1 | ||||||
Reaction mass of Calcium dihydroxide and Calcium peroxide | 2 | - | 930-930-0 | 1,4 | ||||||
Reaction mass of Calcium disilicide and Calcium silicide | 1 | - | 915-037-6 | 4 | ||||||
Reaction mass of calcium fluoride and calcium sulfate and calcium carbonate | 1 | - | 910-697-1 | 10 | ||||||
Reaction mass of Calcium sulfate and Potassium sulfate and Sodium sulphate | 1 | - | 914-100-5 | 9 | ||||||
Reaction mass of Carbon tetrachloride and Chloroform and 1,2-Dichloroethane | 1 | - | 900-600-0 | 1,29 | ||||||
Reaction mass of Carbon tetrachloride and Chloroform and 1,2-Dichloroethane | 2 | - | 900-600-0 | 2,5 | ||||||
Reaction mass of Cardanol diene and Cardanol monoene and Cardanol triene | 1 | - | 947-945-3 | 4,961 | ||||||
Reaction mass of 2-(Chloro-{ethyl-[3-substituted-phenyl]-amino}-heteromonocyclyl)-5-hydroxy-6-[(4- phenylazo)-phenylazo)]-naphthalene-polysulfonic acid as, sodium salt and 2-{Chloro-[(3-ethenesulfonyl-phenyl)-ethyl-amino]-heteromonocyclyl}-5-hydroxy-6-[(4- phenylazo)-phenylazo]-naphthalene-polysulfonic acid, as sodium salt | 1 | - | 459-580-2 | 2,94 | ||||||
Reaction mass of Chromate(1-), [N-[7-hydroxy-8-[(2-hydroxy-5-nitrophenyl)azo]-1-naphthalenyl]acetamidato(2-)][1-[(2-hydroxy-5-nitrophenyl)azo]-2-naphthalenolato(2-)]-, hydrogen, compd. with N-cyclohexylcyclohexanamine (1:1) and hydrogen bis[1-[(2-hydroxy-5-nitrophenyl)azo]-2-naphtholato(2-)]chromate(1-) , compound with dicyclohexylamine (1:1) and hydrogen bis[N-[7-hydroxy-8-[(2-hydroxy-5-nitrophenyl)azo]-1-naphthyl]acetamidato(2-)]chromate(1-) , compound with dicyclohexylamine (1:1) | 1 | - | 916-865-0 | 0,588 | ||||||
Reaction mass of Cobaltate(3-), bis[2-[[[3-[2-[1-[[(2-chlorophenyl)amino]carbonyl]-2-(oxo-κO)propyl]diazenyl-κN1]-4-(hydroxy-κO)phenyl]sulfonyl]amino]benzoato(3-)]-, sodium (1:3) and Tetrasodium bis[2-[[[3-[[1-[(2-chloroanilino)carbonyl]-2-oxopropyl]azo]-4-hydroxyphenyl]sulphonyl]amino]benzoato(3-)]cobaltate(4-) | 1 | - | 941-792-6 | 0,548 | ||||||
Reaction mass of Copper complex of [(2,6-Difluoroheterocycl-4-yl)amino]hydroxy{[2-hydroxy-3-sulfonato-5-(vinylsulfonyl)phenyl]diazenyl}naphthalene sulfonic acid, dialkali salt and Copper complex of [(2,6-difluoroheterocycl-4-yl)amino]-hydroxy{[2-hydroxy-3-sulfonato-5-{[2-(sulfonatooxy)ethyl]sulfonyl}phenyl]diazenyl}naphthalene sulfonic acid, trialkali salt | 1 | - | 479-550-2 | 2,35 | ||||||
Reaction mass of Copper oxide and Manganese dioxide | 1 | - | 910-356-7 | 0,16 | ||||||
Reaction mass of Copper digluconate, Sodium sulphate and Copper sulphate | 1 | - | 948-085-1 | 0,12 | ||||||
Reaction mass of Copper,di-µ-iodotris[triphenylphosphine]di- and Iodobis(triphenylphosphino)copper | 1 | - | 947-819-8 | 29,5 | ||||||
Reaction mass of m-cresol and 2-chloro-m-cresol and 6-chloro-m-cresol | 1 | - | 935-783-6 | 1 | 3,32 | |||||
Reaction mass of m-Cresol and p-Cresol | 1 | - | 906-151-7 | 0,9 | 3,5 | |||||
Reaction mass of trans-Cyclohexadecen-8-one, cis-Cyclohexadecen-8-one, trans-Cyclohexadecen-7-one, cis-Cyclohexadecen-7-one | 1 | - | 448-300-4 | 49,368 | ||||||
Reaction mass of cis-Cyclohexane, 1,4-bis(ethoxymethyl) and trans-Cyclohexane, 1,4-bis(ethoxymethyl) | 1 | 54889-63-3 | 700-868-7 | 0,73 | ||||||
Reaction mass of Decamethyltetrasiloxane; Dodecamethylpentasiloxane; Hexamethyldisiloxane; Octamethyltrisiloxane | 1 | - | 946-797-7 | 102 | ||||||
Reaction mass of Decamethyltetrasiloxane; Dodecamethylpentasiloxane; Hexamethyldisiloxane; Octamethyltrisiloxane | 2 | - | 946-797-7 | 53,4 | ||||||
Reaction mass of Decamethyltetrasiloxane; Dodecamethylpentasiloxane; Hexamethyldisiloxane; Octamethyltrisiloxane | 3 | - | 946-797-7 | 78 | ||||||
Reaction mass of Dibutyl adipate and Dibutyl glutarate | 1 | - | 936-196-8 | 2,1 | ||||||
Reaction mass of 6,13-Dichloro-3,10-bis{[2-({[(2-chloroethyl)sulfonyl]alkanoyl}amino)ethyl]-amino}-polycarboheterocyclo 4,11-disulfonic acid, mono and/or disodium salt and 6,13-Dichloro-3-{[2-({[(2-chloroethyl)sulfonyl]alkanoyl}amino) ethyl]amino}-10-[(2-{[4- (ethenylsulfonyl)alkanoyl]amino}ethyl)amino] polycarboheterocyclo -4,11-disulfonic acid, mono and/or di sodium salt | 1 | - | 700-149-8 | 11,57 | ||||||
Reaction mass of 1,3-Dichloropropene and 2-Chloropropane and 2-Chloropropene and 3-Chloropropene | 1 | - | 903-816-3 | 200 | ||||||
Reaction mass of Didodecyl nonylphenyl phosphite and Dodecyl bis(4-nonylphenyl) phosphite and 4-Nonylphenyl ditridecyl phosphite and Bis(4-nonylphenyl) tridecyl | 1 | - | 947-805-1 | 23,6 | ||||||
Reaction mass of Didodecyl 3,3'-thiodipropionate and Dioctadecyl 3,3'-thiodipropionate and Octadecyl 3-[[3-(dodecyloxy)-3-oxopropyl]thio]propionate | 1 | - | 907-498-7 | 0,49 | ||||||
Reaction mass of Dieuropium tricarbonate and Digadolinium tricarbonate and Disamarium tricarbonate | 1 | - | 945-733-5 | 11,75 | ||||||
Reaction mass of 5,12-Dihydro-2,9-dimethylquino[2,3-b]acridine-7,14-dione and 5,12-Dihydro-2-methylquino[2,3-b]acridine-7,14-dione and 5,12-Dihydroquino[2,3-b]acridine-7,14-dione | 1 | - | 909-082-0 | 3 | 147 | |||||
Reaction mass of 1,5-Dihydroxy-4-nitro-8-(phenylamino)anthraquinone and 1,8-Dihydroxy-4-nitro-5-(phenylamino)anthraquinone | 1 | - | 944-623-4 | 11,66 | ||||||
Reaction mass of 2,3-Dihydroxypropyl formate and 1,3-Dihydroxypropan-2-yl formate and 1-(Formyloxy)-3-hydroxypropyl formate and 3-(Formyloxy)-2-hydroxypropyl formate | 1 | 1410795-90-2 | 800-149-9 | 2 | 11,2 | |||||
Reaction mass of Diisopropyl hydrogen phosphate and {[Hydroxy(propan-2-yloxy)phosphoryl]oxy}(propan-2-yloxy)phosphinic acid and Isopropyl dihydrogen phosphate and Methyl dihydrogen phosphate and Phosphoric acid | 1 | - | 908-995-1 | 1 | 29,4 | |||||
Reaction mass of Dimethyl adipate and Dimethyl glutarate and Dimethyl succinate | 1 | - | 906-170-0 | 8,3 | TRGS900 | MAK | 540000 | |||
Reaction mass of N-[3-(Dimethylamino)propyl]docosanamide and N-[3-(Dimethylamino)propyl]stearamide | 1 | - | 913-660-8 | 14 | ||||||
Reaction mass of (1R,2R)-2,4-Dimethylcyclohex-3-enecarbaldehyde and (1R,2S)-2,4-Dimethylcyclohex-3-enecarbaldehyde | 1 | - | 943-728-2 | 1,837 | ||||||
Reaction mass of 1-(3,3-Dimethylcyclohex-1-en-1-yl)pent-4-en-1-one and 1-(5,5-Dimethylcyclohex-1-en-1-yl)pent-4-en-1-one | 1 | - | 944-482-9 | 6,2 | ||||||
Reaction mass of N,N-dimethyldecan-1-amide and N,N-dimethyloctanamide | 1 | - | 909-125-3 | 166,67 | ||||||
Reaction mass of N,N-Dimethyldodecanamide and N,N-Dimethyltetradecanamide | 1 | - | 944-968-0 | 40 | ||||||
Reaction mass of 2-(1,1-Dimethylethyl)-4-{[5-(1,1-dimethylethyl)-4-hydroxy-2-methylphenyl]thio}-5-methylphenyl 3-(dodecylthio)propionate and Thiobis[2-(1,1-dimethylethyl)-5-methyl-4,1-phenylene] bis[3-(dodecylthio)propionate] | 1 | - | 940-594-7 | 0,137 | ||||||
Reaction mass of 2,6-Dimethylheptan-4-ol and 4,6-Dimethylheptan-2-ol | 1 | - | 939-420-2 | 53 | ||||||
Reaction mass of 7,7-Dimethyl-2-methylidenebicyclo[2.2.1]heptane and (1R)-2,2-Dimethyl-3-methylenebicyclo[2.2.1]heptane and (1S)-2,2-Dimethyl-3-methylenebicyclo[2.2.1]heptane and (1S)-2,6,6-Trimethylbicyclo[3.1.1]hept-2-ene | 1 | - | 945-713-6 | 0,933 | ||||||
Reaction mass of 3,7-Dimethyl-1-octyl acetate and Citronellyl acetate | 1 | - | 908-114-0 | 14,7 | ||||||
Reaction mass of 2-[[4-[[3,5-Dimethyl-4-(oxiran-2-ylmethoxy)phenyl]methyl]-2,6-dimethyl-phenoxy]methyl]oxirane and 1,3-Bis[4-[[3,5-dimethyl-4-(oxiran-2-ylmethoxy)phenyl]methyl]-2,6-dimethyl-phenoxy]propan-2-ol and 1-[4-[[3,5-Dimethyl-4-(oxiran-2-ylmethoxy)phenyl]methyl]-2,6-dimethyl-phenoxy]-3-[4-[[4-[3-[4-[[3,5-dimethyl-4-(oxiran-2-ylmethoxy)phenyl]methyl]-2,6-dimethyl-phenoxy]-2-hydroxy-propoxy]-3,5-dimethyl-phenyl]methyl]-2,6-dimethyl-phenoxy]propan-2-ol | 1 | - | 941-357-0 | 14,8 | ||||||
Reaction Mass of 1,4-dimethyl-7-(prop-1-en-2-yl)-1,2,3,4,5,6,7,8-octahydroazulene and 3,8-dimethyl-5-(prop-1-en-2-yl)-1,2,3,3a,4,5,6,7-octahydroazulene and 4,8a,9,9-tetramethyldecahydro-1,6-methanonaphthalen-1-ol | 1 | - | 939-227-3 | 28,71 | 11,48 | |||||
Reaction mass of 3-({[2,2-dimethyl-3-({[2-(2-{[(prop-2-en-1-yloxy)carbonyl]oxy}ethoxy)ethoxy]carbonyl}oxy)propoxy]carbonyl}oxy)prop-1-ene and 3-{[(2,2-dimethyl-3-{[(prop-2-en-1-yloxy)carbonyl]oxy}propoxy)carbonyl]oxy}prop-1-ene and diallyl 2,2'-oxydiethyl dicarbonate | 1 | - | 700-742-1 | 151,3 | ||||||
Reaction mass of 2-(1,1-Dimethylpropyl)anthraquinone and 2-(1,2-Dimethylpropyl)anthraquinone | 1 | - | 915-623-1 | 0,88 | ||||||
Reaction mass of 2-(3,4-dimethyl-1H-pyrazol-1-yl)succinic acid and 2-(4,5-dimethyl-1H-pyrazol-1-yl)succinic acid | 1 | - | 940-877-5 | 11,75 | ||||||
Reaction mass of (2R*,4R*,4aR*,9bS*)-2,4-Dimethyl-4,4a,5,9b-tetrahydroindeno[1,2-d][1,3]dioxine and (2R*,4R*,4aS*,9bR*)-2,4-Dimethyl-4,4a,5,9b-tetrahydroindeno[1,2-d][1,3]dioxine | 1 | - | 944-528-8 | 0,94 | ||||||
Reaction mass of Dioctyl hydrogen phosphate and Octyl dihydrogen phosphate | 1 | - | 911-501-7 | 32,9 | ||||||
Reaction mass of 1,3-Dioxan-5-ol and 1,3-Dioxolan-4-ylmethanol | 1 | - | 911-694-8 | 1,322 | ||||||
Reaction mass of (1,3-Dioxo-1,3,4,5,6,7-hexahydro-2H-isoindol-2-yl)methyl (1R,3R)-2,2-dimethyl-3-(2-methylprop-1-en-1-yl)cyclopropanecarboxylate and (1,3-Dioxo-1,3,4,5,6,7-hexahydro-2H-isoindol-2-yl)methyl (1R,3S)-2,2-dimethyl-3-(2-methylprop-1-en-1-yl)cyclopropanecarboxylate (4:1) | 1 | - | 947-513-4 | 5,36 | ||||||
Reaction mass of Dipentarythritol and 3-Mercaptopropionic acid | 1 | - | 947-980-4 | 0,49 | ||||||
Reaction mass of 3-[(diphenoxyphosphoryl)oxy]phenyl triphenyl 1,3-phenylene bis(phosphate) and tetraphenyl 1,3-phenylene bis(phosphate) | 1 | - | 701-337-2 | 1,33 | ||||||
Reaction mass of Dipotassium 2-(3,4-dimethyl-1H-pyrazol-1-yl) succinate and Dipotassium 2-(4,5-dimethy-1H-pyrazol-1-yl) succinate | 1 | - | 950-225-1 | 16,5 | ||||||
Reaction mass of dipotassium phosphonate and Phosphonic acid, potassium salt (1:1) | 1 | - | 915-179-9 | 41,2 | ||||||
Reaction mass of Disodium metasilicate and Sodium hydroxide | 1 | - | 910-245-3 | 2 | ||||||
Reaction mass of disodium 2,2’-oxydiethanesulfonate and sodium ethenesulfonate | 1 | - | 700-978-5 | 46,66 | ||||||
Reaction mass of disodium 6-acetamido-4-hydroxy-3-[(4-{[2-(sulfonatooxy)ethyl]sulfonyl}phenyl)diazenyl]naphthalene-2-sulfonate and sodium 6-acetamido-4-hydroxy-3-{[4(vinylsulfonyl)phenyl]diazenyl}naphthalene-2-sulfonate | 1 | - | 701-348-2 | 3,5 | ||||||
Reaction mass of Disodium 4-amino-6-[[4-[(2,4-diaminophenyl)diazenyl]phenyl]]-3-((E)-[4-((E)-(2,4-diaminophenyl)diazenyl]phenyl)diazenyl)-5-hydroxynaphthalene-2,7-disulphonate and Disodium 4-amino-6-((E)-(4-aminophenyl)diazenyl)-3-((E)-(4-((E)-(2,4-diaminophenyl)diazenyl)phenyl)diazenyl)-5-hydroxynaphthalene-2,7-disulfonate | 1 | - | 951-695-0 | 1,88 | ||||||
Reaction mass of Disodium 1-amino-4-[[3-[(2,3-dibromo-1-oxopropyl)amino]-2,4,6-trimethyl-5-sulphonatophenyl]amino]-9,10-dihydro-9,10-dioxoanthracene-2-sulphonate and Disodium 1-amino-4-[[3-[(2-bromo-1-oxoallyl)amino]-2,4,6-trimethyl-5-sulphonatophenyl]amino]-9,10-dihydro-9,10-dioxoanthracene-2-sulphonate | 1 | - | 943-304-7 | 11,67 | ||||||
Reaction mass of Disodium 3-[2-(2-carboxylatoethylamino)-ethylamino]propanoate and Sodium 3-[(2-aminoethyl)amino]propanoate | 1 | - | 947-397-5 | 2,5 | ||||||
Reaction mass of Disodium decyl(sulphonatophenoxy)benzenesulphonate and Disodium oxybis[decylbenzenesulphonate] | 1 | - | 915-640-4 | 64 | ||||||
Reaction mass of Disodium 4-hydroxybenzene-1,3-disulphonate and Sodium sulphate and Sodium 4-hydroxybenzenesulphonate | 1 | - | 939-154-7 | 53,81 | ||||||
Reaction mass of Disodium 2,2'-{(2-hydroxy-5-nonyl-1,3-phenylene)bis[methylene(methylimino)]}diacetate and Sodium [(2-hydroxy-5-nonylbenzyl)(methyl)amino]acetate | 1 | - | 947-147-5 | 1,29 | ||||||
Reaction mass of Disodium [2,2'-(imino-κN)dibutanedioato-κ2O1,O4(4-)]calcium(2-), Sodium chloride and Aspartic acid disodium salt | 1 | - | 944-341-1 | 2,67 | ||||||
Reaction mass of Disodium [2,2'-(imino-κN)dibutanedioato-κ2O1,O4(4-)]cuprum(2-) and Sodium sulphate | 1 | - | 938-868-6 | 0,28 | ||||||
Reaction mass of Disodium [2,2'-(imino-κN)dibutanedioato-κ2O1,O4(4-)]magnesium(2-), Sodium chloride and Aspartic acid disodium salt | 1 | - | 946-985-9 | 0,89 | ||||||
Reaction mass of Disodium [2,2'-(imino-kappaN)dibutanedioato-kappa2O1,O4(4-)]manganese(2-) and Sodium sulphate | 1 | - | 939-867-3 | 5 | ||||||
Reaction mass of Disodium N-(1-oxooctadecyl)-L-glutamate and Disodium N-(1-oxohexadecyl)-L-glutamate | 1 | - | 936-611-2 | 3,8 | ||||||
Reaction mass of disodium sulphide and sodium carbonate and sodium hydrogensulphide | 1 | - | 908-552-2 | 2,84 | 22,6 | |||||
Reaction mass of Disodium (sulphonatothio)acetate and Sodium chloride | 1 | - | 947-115-0 | 1,5 | ||||||
Reaction mass of Ditungsten carbide and Tungsten carbide | 1 | - | 915-093-1 | 6 | ||||||
Reaction mass of Divinylbenzene and Ethylstyrene | 1 | - | 910-757-7 | 11 | ||||||
Reaction mass of Dodecane-1-thiol and Tridodecyl trithiophosphite | 1 | - | 947-268-3 | 13,1 | ||||||
Reaction mass of Dodecan-2-yl prop-2-enoate and Dodecan-3-yl prop-2-enoate and Dodecan-4-yl prop-2-enoate | 1 | - | 947-818-2 | 4 | ||||||
Reaction mass of Dodecyl methacrylate and Tridecyl methacrylate | 1 | - | 907-961-3 | 29,4 | ||||||
Reaction mass of 1-(2,3-epoxypropoxy)-2,2-bis ((2,3-epoxypropoxy)methyl) butane and 1-(2,3-epoxypropoxy)-2-((2,3-epoxypropoxy)methyl)-2-hydroxymethyl butane | 1 | - | 701-135-4 | 1,17 | ||||||
Reaction mass of Ethane-1,2-diol and 2-Hydroxyethyl formate and Ethylene diformate | 1 | - | 944-390-9 | 9 | 35,3 | |||||
Reaction mass of N,N-Ethanediylbis- Hexadecanamide, N-[2-[(1-oxohexadecyl)amino]ethyl]-Octadecanamide, Hexadecanoic acid, 12-hydroxystearic acid, reaction products with ethylenediamine, N,N-ethanediylbis-Octadecanamide and Octadecanoic acid, 12-hydroxystearic acid, reaction products with ethylenediamine | 1 | - | 906-763-4 | 88,2 | ||||||
Reaction mass of N,N’-Ethane-1,2-diylbis(12-hydroxyoctadecan-1-amide), Octadecanamide, 12-Hydroxy-N-[2-[(1-oxooctadecyl)amino]ethyl]- and Octadecanoic acid, 12-Hydroxy-, 1-Hexyl-12-[[2-[(12-hydroxy-1-oxooctadecyl)amino]ethyl]amino]-12-oxododecyl ester | 1 | - | 701-269-3 | 35,24 | ||||||
Reaction mass of Ethanol and Propan-2-ol | 1 | - | 902-053-3 | 500 | ||||||
Reaction mass of Ethanol and Sodium O-ethyl dithiocarbonate and Sodium hydroxide | 1 | - | 943-886-2 | 4,6 | 4,6 | |||||
Reaction mass of ethoxylated (= 3 moles) Bisphenol A dimethacrylate and (1-Methylethylidene)bis(4,1-phenyleneoxy-2,1-ethanediyl) bismethacrylate | 1 | - | 939-702-5 | 49,36 | ||||||
Reaction mass of Ethylbenzene and Xylene | 1 | - | 905-588-0 | 221 | 221 | |||||
Reaction mass of Ethylbenzene and m-Xylene and p-Xylene | 1 | - | 905-562-9 | 221 | 221 | |||||
Reaction mass of 2,2'-(Ethylenedioxy)diethanol and 3,6,9-Trioxaundecane-1,11-diol | 1 | - | 907-131-0 | 50 | ||||||
Reaction mass of 2-Ethylhexyl diphenyl phosphite and Bis(2-ethylhexyl) phenyl phosphite and Triphenyl phosphite | 1 | - | 905-728-0 | 1,06 | ||||||
Reaction mass of 2-Ethylhexyl (6-isocyanatohexyl)-carbamate and Bis(2-ethylhexyl) 1,6-hexan-1,6-diylbiscarbamate | 1 | - | 947-942-7 | 0,006 | ||||||
Reaction mass of 2-Ethylhexyl (3-isocyanato-4-methylphenyl)carbamate and 2-Ethylhexyl (5-isocyanato-2-methylphenyl)carbamate and 2-Ethylhexyl (3-isocyanato-2-methylphenyl)carbamate | 1 | - | 946-383-6 | 7,05 | ||||||
Reaction mass of 1-Ethyl-6-hydroxy-5-(4-alkoxy-2-nitro-phenylazo)-4-alkyl-2-substituted-1,2-dihydro-pyridine- 3-carbonitrile and 6-Hydroxy-1-(3-isoalkoxy-alkyl)-5-(4-alkoxy-2-nitro-phenylazo)-4-alkyl-2-substituted-1,2- dihydropyridine-3-carbonitrile | 1 | - | 419-330-5 | 23,5 | ||||||
Reaction mass of 2-Ethyl-2-[[3-(2-methylaziridin-1-yl)propionyl]methyl]propane-1,3-diyl bis(2-methylaziridine-1-propionate) and 2,2-Bis({[3-(2-methylaziridin-1-yl)propanoyl]oxy}methyl)butyl 3-[2,2-bis({[3-(2-methylaziridin-1-yl)propanoyl]oxy}methyl)butoxy]propanoate | 1 | - | 939-180-9 | 1,62 | ||||||
Reaction mass of 2-(3-Ethylphenyl)oxirane and 2,2’-(1,3-Phenylene)dioxirane and 2,2'-(1,4-Phenylene)dioxirane | 1 | - | 935-853-6 | 0,58 | ||||||
Reaction mass of 2-Ethylpropane-1,3-diol and 5-Ethyl-1,3-dioxane-5-methanol and Propylidynetrimethanol | 1 | - | 904-153-2 | 14,6 | ||||||
Reaction mass of Fatty acids, tallow, Guerbet reaction Products, Ca salts and Fatty acids, tallow, Guerbet reaction Products, Na salts and Fatty acids, tallow, Guerbet reaction Products | 1 | - | 947-684-5 | 8,8 | ||||||
Reaction mass of geranyl acetate and neryl acetate | 1 | - | 906-083-8 | 62,59 | ||||||
Reaction mass of 6-O-alfa-D-Glucopyranosyl-D-fructofuranose and 1-O-alfa-D-Glucopyranosyl-D-fructofuranose and D-Fructofuranose | 1 | 1236007-63-8 | 700-515-7 | 987 | ||||||
Reaction mass of L-Glutamic acid, N-Coco acyl derivatives, monosodium salts and Sodium hydrogen N-(1-oxooctadecyl)-L-glutamate | 1 | - | 915-656-1 | 0,29 | ||||||
Reaction mass of glycerol, glycerol 1-formate, glycerol 2-formate, glycerol 1,2-diformate, glycerol 1,3-diformate and glycerol triformate | 1 | - | 701-316-8 | 73,1 | ||||||
Reaction mass of heptachromium tricarbide and trichromium dicarbide | 1 | - | 915-035-5 | 0,5 | ||||||
Reaction mass of 2,2,5,8,12,15,15-heptamethyl-7,10-dioxa-4,13-diazahexadeca-3,13-diene-1,16-diyl didodecanoate and 2,2,5,8,12,15,18,18-octamethyl-7,10,13-trioxa-4,16-diazanonadeca-3,16-diene-1,19-diyl didodecanoate and 2,2,5,8,11,14,18,21,21-nonamethyl-7,10,13,16-tetraoxa-4,19-diazadocosa-3,19-diene-1,22-diyl didodecanoate | 1 | 613246-75-6 | 479-940-2 | 29,4 | ||||||
Reaction mass of 3-[3-(1,1,1,3,5,5,5-Heptamethyltrisiloxan-3-yl)propoxy]-2-hydroxypropyl methacrylate and 1-[3-(1,1,1,3,5,5,5-Heptamethyltrisiloxan-3-yl)propoxy]-3-hydroxypropan-2-yl methacrylate | 1 | - | 700-334-3 | 5,87 | ||||||
Reaction mass of Hexadecyl dihydrogen phosphate and Cetyl alcohol | 1 | - | 947-905-5 | 16,46 | ||||||
Reaction mass of Hexadecyl dihydrogen phosphate and Dihexadecyl hydrogen phosphate | 1 | - | 911-302-5 | 91,9 | ||||||
Reaction mass of 2,2,3,5,5,6-hexafluoro-3,6-bis(trifluoromethyl)-1,4-dioxane, 1,1,1,2,3,3-hexafluoro-2,3-bis(pentafluoroethoxy)propane, 1,1,1,2,3,3-hexafluoro-3-(pentafluoroethoxy)-2-(trifluoromethoxy)propane, 1,1,1,2,3,3-hexafluoro-2-(pentafluoroethoxy)-3-(trifluoromethoxy)propane, 2-(difluoromethoxy)-1,1,1,2,3,3-hexafluoro-3-(pentafluoroethoxy)propane, 1-(difluoromethoxy)-1,1,2,3,3,3-hexafluoro-2-(pentafluoroethoxy)propane, 1,1,1,2,3,3-hexafluoro-3-{[1,1,1,2,3,3-hexafluoro-3--(trifluoromethoxy)propan-2-yl]oxy}-2-(trifluoromethoxy)propane and 1,1,1,3,3,4,6,6,7,9,9,10,12,12,12-pentadecafluoro-4,7,10-tris(trifluoromethyl)-2,5,8,11-tetraoxadodecane | 1 | 161075-00-9 | 500-537-5 | 3088 | ||||||
Reaction mass of 1,1,2,3,3,3-Hexafluoro-1-methoxy-2-(trifluoromethyl)propane and 1,1,2,2,3,3,4,4,4-Nonafluoro-1-methoxybutane | 1 | - | 422-270-2 | 3107 | ||||||
Reaction mass of 3a,4,5,6,7,7a-Hexahydro-4,7-methanoinden-5-yl acetate and 3a,4,5,6,7,7a-Hexahydro-4,7-methanoinden-6-yl acetate | 1 | - | 911-369-0 | 4,93 | ||||||
Reaction mass of 2-[4-[(Hexahydro-2,4,6-trioxo-5-pyrimidyl)azo]phenyl]-6-methylbenzothiazole-7-sulphonic acid, compound with 2,2',2''-nitrilotris[ethanol] (1:1) and Lithium 2-[4-[(hexahydro-2,4,6-trioxopyrimidin-5-yl)azo]phenyl]-6-methylbenzothiazole-7-sulphonate | 1 | - | 938-398-1 | 16,5 | ||||||
Reaction mass of N, N'-Hexane-1,6-diylbis [12-hydroxyoctadecanamide] and 12-Hydroxy-N-[6-[1-oxoalkyl)amino] hexyl ] octadecanamide | 1 | - | 469-110-8 | 9,8 |